DE961897C - Mehrstufiger Verstaerker mit Transistoren - Google Patents
Mehrstufiger Verstaerker mit TransistorenInfo
- Publication number
- DE961897C DE961897C DEG11676A DEG0011676A DE961897C DE 961897 C DE961897 C DE 961897C DE G11676 A DEG11676 A DE G11676A DE G0011676 A DEG0011676 A DE G0011676A DE 961897 C DE961897 C DE 961897C
- Authority
- DE
- Germany
- Prior art keywords
- transistor
- collector
- current
- stage
- amplifier
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000006641 stabilisation Effects 0.000 claims description 12
- 238000011105 stabilization Methods 0.000 claims description 12
- 238000004804 winding Methods 0.000 claims description 7
- 230000008054 signal transmission Effects 0.000 claims 1
- 239000003990 capacitor Substances 0.000 description 20
- 230000008878 coupling Effects 0.000 description 13
- 238000010168 coupling process Methods 0.000 description 13
- 238000005859 coupling reaction Methods 0.000 description 13
- 230000014509 gene expression Effects 0.000 description 8
- YBJHBAHKTGYVGT-ZKWXMUAHSA-N (+)-Biotin Chemical compound N1C(=O)N[C@@H]2[C@H](CCCCC(=O)O)SC[C@@H]21 YBJHBAHKTGYVGT-ZKWXMUAHSA-N 0.000 description 6
- FEPMHVLSLDOMQC-UHFFFAOYSA-N virginiamycin-S1 Natural products CC1OC(=O)C(C=2C=CC=CC=2)NC(=O)C2CC(=O)CCN2C(=O)C(CC=2C=CC=CC=2)N(C)C(=O)C2CCCN2C(=O)C(CC)NC(=O)C1NC(=O)C1=NC=CC=C1O FEPMHVLSLDOMQC-UHFFFAOYSA-N 0.000 description 6
- 238000010586 diagram Methods 0.000 description 5
- 230000000087 stabilizing effect Effects 0.000 description 5
- 230000003321 amplification Effects 0.000 description 4
- 208000037516 chromosome inversion disease Diseases 0.000 description 4
- 238000003199 nucleic acid amplification method Methods 0.000 description 4
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 229910052732 germanium Inorganic materials 0.000 description 1
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03F—AMPLIFIERS
- H03F1/00—Details of amplifiers with only discharge tubes, only semiconductor devices or only unspecified devices as amplifying elements
- H03F1/30—Modifications of amplifiers to reduce influence of variations of temperature or supply voltage or other physical parameters
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03F—AMPLIFIERS
- H03F1/00—Details of amplifiers with only discharge tubes, only semiconductor devices or only unspecified devices as amplifying elements
- H03F1/30—Modifications of amplifiers to reduce influence of variations of temperature or supply voltage or other physical parameters
- H03F1/302—Modifications of amplifiers to reduce influence of variations of temperature or supply voltage or other physical parameters in bipolar transistor amplifiers
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03F—AMPLIFIERS
- H03F3/00—Amplifiers with only discharge tubes or only semiconductor devices as amplifying elements
- H03F3/26—Push-pull amplifiers; Phase-splitters therefor
Landscapes
- Engineering & Computer Science (AREA)
- Power Engineering (AREA)
- Amplifiers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US286103A US2794076A (en) | 1952-05-05 | 1952-05-05 | Transistor amplifiers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE961897C true DE961897C (de) | 1957-04-11 |
Family
ID=23097085
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEG11676A Expired DE961897C (de) | 1952-05-05 | 1953-05-06 | Mehrstufiger Verstaerker mit Transistoren |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2794076A (enExample) |
| BE (1) | BE519695A (enExample) |
| DE (1) | DE961897C (enExample) |
| FR (1) | FR1087808A (enExample) |
| GB (1) | GB781570A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1131275B (de) * | 1958-07-26 | 1962-06-14 | Philips Nv | Zweistufiger Breitband-Gegentaktverstaerker mit Transistoren |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3123778A (en) * | 1964-03-03 | Wolters | ||
| NL89157C (enExample) * | 1952-11-05 | |||
| DE1014168B (de) * | 1953-03-14 | 1957-08-22 | Philips Nv | Transistor-Kaskadenverstaerker in Emitterschaltung |
| NL191906A (enExample) * | 1953-10-29 | |||
| BE536128A (enExample) * | 1954-03-01 | |||
| US2883479A (en) * | 1955-07-28 | 1959-04-21 | Rca Corp | Class b amplifier biasing circuit |
| DE1061375B (de) * | 1955-08-16 | 1959-07-16 | Telefunken Gmbh | NF-Gegentaktverstaerker mit Transistoren |
| US2940051A (en) * | 1955-08-17 | 1960-06-07 | Motorola Inc | Neutralized transistor amplifier |
| US2924744A (en) * | 1955-09-08 | 1960-02-09 | Gen Electric | Deflection circuit |
| US2999984A (en) * | 1956-02-13 | 1961-09-12 | Honeywell Regulator Co | Series-energized cascaded transistor amplifier |
| US2942200A (en) * | 1956-05-07 | 1960-06-21 | Rudolf A Hanel | High impedance transistor circuits |
| US2881269A (en) * | 1956-05-07 | 1959-04-07 | Hanel Rudolf Albert | High impedance transistor circuits |
| US3101453A (en) * | 1957-01-21 | 1963-08-20 | Modern Telephones Great Britai | Transistor amplifiers with protective circuit means |
| US2990452A (en) * | 1957-02-08 | 1961-06-27 | Avco Mfg Corp | Component-connected temperature-stabilized transistor amplifier circuit |
| US2935606A (en) * | 1957-02-08 | 1960-05-03 | Avco Mfg Corp | Transistorized portable communication set |
| US2896114A (en) * | 1957-04-18 | 1959-07-21 | Rca Corp | Television deflection and power supply circuits |
| NL112693C (enExample) * | 1957-08-02 | |||
| US3108263A (en) * | 1957-09-10 | 1963-10-22 | Bendix Corp | Error detecting and indicating system |
| US3026380A (en) * | 1958-04-01 | 1962-03-20 | Telefunken Gmbh | Transistorized reproducing amplifier circuitry having feedback |
| US3121832A (en) * | 1959-07-30 | 1964-02-18 | Gen Motors Corp | Push-pull control for constant speed motor |
| CH374391A (de) * | 1959-10-02 | 1964-01-15 | Hasler Ag | Mehrstufiger Transistorverstärker |
| US3257615A (en) * | 1961-12-12 | 1966-06-21 | Stephen A Slenker | High impedance semiconductor amplifier and measuring instrument |
| US3267387A (en) * | 1964-02-06 | 1966-08-16 | Ampex | Temperature and frequency stable amplifier |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2579336A (en) * | 1950-09-15 | 1951-12-18 | Bell Telephone Labor Inc | Stabilized transistor trigger circuit |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL145843B (nl) * | 1948-04-23 | Merck & Co Inc | Werkwijze voor het bereiden van derivaten van 3-hydroxy alfa-(1-aminoethyl)benzylalcohol; werkwijze ter bereiding van farmaceutische preparaten, alsmede de door toepassing van die werkwijze verkregen voorwerpen. | |
| US2585078A (en) * | 1948-11-06 | 1952-02-12 | Bell Telephone Labor Inc | Negative resistance device utilizing semiconductor amplifier |
| US2647957A (en) * | 1949-06-01 | 1953-08-04 | Bell Telephone Labor Inc | Transistor circuit |
| US2531076A (en) * | 1949-10-22 | 1950-11-21 | Rca Corp | Bistable semiconductor multivibrator circuit |
| US2647958A (en) * | 1949-10-25 | 1953-08-04 | Bell Telephone Labor Inc | Voltage and current bias of transistors |
| US2666817A (en) * | 1950-11-09 | 1954-01-19 | Bell Telephone Labor Inc | Transistor amplifier and power supply therefor |
| US2680160A (en) * | 1951-09-15 | 1954-06-01 | Bell Telephone Labor Inc | Bias circuit for transistor amplifiers |
| US2730576A (en) * | 1951-09-17 | 1956-01-10 | Bell Telephone Labor Inc | Miniaturized transistor amplifier circuit |
| US2693568A (en) * | 1952-03-05 | 1954-11-02 | Bell Telephone Labor Inc | Current and voltage regulation |
-
0
- BE BE519695D patent/BE519695A/xx unknown
-
1952
- 1952-05-05 US US286103A patent/US2794076A/en not_active Expired - Lifetime
-
1953
- 1953-05-05 FR FR1087808D patent/FR1087808A/fr not_active Expired
- 1953-05-05 GB GB12463/53A patent/GB781570A/en not_active Expired
- 1953-05-06 DE DEG11676A patent/DE961897C/de not_active Expired
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2579336A (en) * | 1950-09-15 | 1951-12-18 | Bell Telephone Labor Inc | Stabilized transistor trigger circuit |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1131275B (de) * | 1958-07-26 | 1962-06-14 | Philips Nv | Zweistufiger Breitband-Gegentaktverstaerker mit Transistoren |
Also Published As
| Publication number | Publication date |
|---|---|
| GB781570A (en) | 1957-08-21 |
| US2794076A (en) | 1957-05-28 |
| FR1087808A (fr) | 1955-03-01 |
| BE519695A (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE961897C (de) | Mehrstufiger Verstaerker mit Transistoren | |
| DE927932C (de) | Schaltung fuer einen sehr kleinen Transistor-Verstaerker | |
| DE2549575C2 (de) | Transistorschaltung | |
| DE2603164B2 (de) | Differentialverstärker | |
| DE2718491C2 (de) | Schaltungsanordnung zur Verstärkung der Signale eines elektromagnetischen Wandlers und zur Vorspannungserzeugung für den Wandler | |
| DE2513906B2 (de) | Stromspiegelverstaerker | |
| DE2936286C3 (de) | Breitbandverstärker | |
| DE2223244B2 (de) | Verstärkerschaltung mit Stromverteilungssteuerung | |
| DE2639790A1 (de) | Schaltungsanordnung zur lieferung konstanten stroms | |
| DE2024806B2 (de) | Lineare verstaerkerschaltung | |
| DE2849216B2 (de) | Schaltungsanordnung zum Regeln der Drehzahl eines Gleichstrommotors | |
| DE1909721C3 (de) | Schaltungsanordnung zur Gleichspannungsteilung | |
| DE3853425T2 (de) | Spannungsregelvorrichtung. | |
| DE2850487A1 (de) | Transistor-verstaerkerkreis | |
| DE2328402A1 (de) | Konstantstromkreis | |
| DE951216C (de) | Kaskadenverstaerker mit wenigstens zwei Transistorstufen | |
| DE2810167C2 (de) | Transistorverstärker | |
| DE2516319A1 (de) | Stromverstaerker | |
| DE2729722C2 (enExample) | ||
| DE2361809C3 (de) | Verstärkungsreglerschaltung | |
| DE3118617A1 (de) | Stromspiegelschaltung mit hoher ausgangsimpedanz und niedrigem spannungsverlust | |
| EP0676099B1 (de) | Schaltungsanordnung für einen integrierten ausgangsverstärker | |
| DE2635574A1 (de) | Stromspiegelverstaerker | |
| DE3120689A1 (de) | "gegentaktendstufe" | |
| DE3811949C2 (enExample) |