DE955704C - Schalter mit magnetischer Blasung - Google Patents
Schalter mit magnetischer BlasungInfo
- Publication number
- DE955704C DE955704C DEF17790A DEF0017790A DE955704C DE 955704 C DE955704 C DE 955704C DE F17790 A DEF17790 A DE F17790A DE F0017790 A DEF0017790 A DE F0017790A DE 955704 C DE955704 C DE 955704C
- Authority
- DE
- Germany
- Prior art keywords
- switch according
- electrodes
- switch
- magnetic
- arc
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000007664 blowing Methods 0.000 claims description 9
- 239000007789 gas Substances 0.000 claims description 6
- 230000009471 action Effects 0.000 claims description 3
- 238000009423 ventilation Methods 0.000 claims description 3
- 238000013461 design Methods 0.000 claims description 2
- DOSMHBDKKKMIEF-UHFFFAOYSA-N 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-[3-[3-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]propylsulfamoyl]benzenesulfonate Chemical compound C1=CC(=[N+](CC)CC)C=C2OC3=CC(N(CC)CC)=CC=C3C(C=3C(=CC(=CC=3)S(=O)(=O)NCCCN3C4=CC=CC=C4C(C=4C(NC(=O)C=4C=4C5=CC=CC=C5N(C)C=4)=O)=C3)S([O-])(=O)=O)=C21 DOSMHBDKKKMIEF-UHFFFAOYSA-N 0.000 description 3
- 230000002349 favourable effect Effects 0.000 description 3
- 230000008033 biological extinction Effects 0.000 description 2
- 239000004020 conductor Substances 0.000 description 2
- 238000002242 deionisation method Methods 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 238000012549 training Methods 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000012217 deletion Methods 0.000 description 1
- 230000037430 deletion Effects 0.000 description 1
- 230000005520 electrodynamics Effects 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H33/00—High-tension or heavy-current switches with arc-extinguishing or arc-preventing means
- H01H33/02—Details
- H01H33/04—Means for extinguishing or preventing arc between current-carrying parts
- H01H33/18—Means for extinguishing or preventing arc between current-carrying parts using blow-out magnet
- H01H33/187—Means for extinguishing or preventing arc between current-carrying parts using blow-out magnet comprising a hollow annular arc runner and a central contact between which a radially drawn arc rotates
Landscapes
- Arc-Extinguishing Devices That Are Switches (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR955704X | 1954-07-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE955704C true DE955704C (de) | 1957-01-10 |
Family
ID=9487702
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF17790A Expired DE955704C (de) | 1954-07-16 | 1955-06-25 | Schalter mit magnetischer Blasung |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US2820122A (enExample) |
| BE (1) | BE539076A (enExample) |
| DE (1) | DE955704C (enExample) |
| FR (1) | FR1109180A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1261579B (de) * | 1959-12-03 | 1968-02-22 | Weber A G | Niederspannungsschaltgeraet fuer Wechselstrom |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3128359A (en) * | 1960-01-06 | 1964-04-07 | Westinghouse Electric Corp | Circuit interrupters having arc extinguishing means |
| US3234345A (en) * | 1960-04-11 | 1966-02-08 | Rupert Evan Howard Carpenter | Electromagnetic relay having novel field pieces and a novel coil bobbin |
| US3542985A (en) * | 1967-01-27 | 1970-11-24 | Asea Ab | Circuit breaker for high voltage direct current |
| NL159524B (nl) * | 1975-04-02 | 1979-02-15 | Hazemeijer Bv | Elektrische schakelaar, vonkbrug of dergelijke voorzien van een boogblusinrichting met spiraal- of schroefgewijs gekromde boogvoetgeleiders. |
| NL101699C (enExample) * | 1976-03-03 | |||
| US4393289A (en) * | 1976-12-30 | 1983-07-12 | Texas Instruments Incorporated | Circuit breaker |
| US4401870A (en) * | 1981-11-10 | 1983-08-30 | Hydro-Quebec | Modular suction-gas-cooled magnetic blast circuit breaker |
| GB8725582D0 (en) * | 1987-10-31 | 1987-12-02 | Northern Eng Ind | Arc interruptor |
| FR2834121B1 (fr) * | 2001-12-21 | 2004-01-30 | Alstom | Disjoncteur limiteur de courant |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1015442A (en) * | 1907-02-23 | 1912-01-23 | Clinton J Hixson | Circuit-interrupter. |
| US967280A (en) * | 1910-02-04 | 1910-08-16 | Gen Electric | Magnetic blow-out. |
| FR693293A (fr) * | 1928-12-29 | 1930-11-18 | Merlin Gerin | Perfectionnements aux interrupteurs électriques |
| US2051478A (en) * | 1933-04-25 | 1936-08-18 | Weldon O Hampton | Arc extinguishing apparatus |
| US2150564A (en) * | 1935-09-28 | 1939-03-14 | Trumbull Electric Mfg Co | Circuit breaker |
| US2109226A (en) * | 1936-01-30 | 1938-02-22 | Westinghouse Electric & Mfg Co | Circuit breaker |
-
0
- BE BE539076D patent/BE539076A/xx unknown
-
1954
- 1954-07-16 FR FR1109180D patent/FR1109180A/fr not_active Expired
-
1955
- 1955-06-25 DE DEF17790A patent/DE955704C/de not_active Expired
- 1955-07-01 US US519580A patent/US2820122A/en not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1261579B (de) * | 1959-12-03 | 1968-02-22 | Weber A G | Niederspannungsschaltgeraet fuer Wechselstrom |
Also Published As
| Publication number | Publication date |
|---|---|
| BE539076A (enExample) | |
| FR1109180A (fr) | 1956-01-23 |
| US2820122A (en) | 1958-01-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2209287C3 (de) | Elektrischer Druckgasschalter | |
| DE955704C (de) | Schalter mit magnetischer Blasung | |
| DE69920796T2 (de) | Schutzschalter mit mehreren parallelgeschalteten Schaltkammern pro Phase | |
| DE3311022A1 (de) | Trennschalter | |
| DE2946800C2 (de) | Vakuumschalter | |
| DE1298598C2 (de) | Vakuumschalter | |
| DE69223292T2 (de) | Mittel- oder Hochspannungslastschalter mit aufeinanderstossenden Lichtbogenkontakten | |
| DE3319010A1 (de) | Gasisolierter schalter | |
| DE3038312A1 (de) | Druckgasschalter | |
| DE1959385A1 (de) | Vakuumlastschalter | |
| DE3705719C2 (enExample) | ||
| WO2011035781A1 (de) | Abbrandelement zur anordnung an einem schaltkontakt eines leistungsschalters | |
| DE2618087C2 (de) | Schalter mit einem äußeren und einem zusätzlichen inneren elektrodynamischen Antrieb | |
| DEF0017790MA (enExample) | ||
| DE969871C (de) | Leistungsschalter mit zentripetaler Beblasung des Lichtbogens und zylindrische Form aufweisenden Kontakten | |
| DE2349187C3 (de) | Vorrichtung zur Unterbrechung von Stromkreisen | |
| DE2118166B2 (de) | Unterbrecherkammer für einen. elektrischen Druckgasschalter mit einer Blasdüse | |
| DE1088580B (de) | Leistungsschalter | |
| DE1515692A1 (de) | Kontaktsystem fuer automatische Leistungsschalter,insbesondere Niederspannungsschutzschalter | |
| DE638423C (de) | Vorrichtung zum Loeschen des Lichtbogens in Stromunterbrechungsvorrichtungen | |
| DE1239386B (de) | Schalter, insbesondere fuer grosse Stromstaerken | |
| DE2549860C3 (de) | Elektrische Funkenstrecke für den Überspannungsschutz | |
| DE2910495C2 (de) | Elektrischer Leistungsschalter | |
| DE355876C (de) | Blasmagnet fuer elektrische Schalter | |
| DE911986C (de) | Schaltkontaktanordnung |