DE8805183U1 - Hochdruckentladungslampe - Google Patents
HochdruckentladungslampeInfo
- Publication number
- DE8805183U1 DE8805183U1 DE8805183U DE8805183U DE8805183U1 DE 8805183 U1 DE8805183 U1 DE 8805183U1 DE 8805183 U DE8805183 U DE 8805183U DE 8805183 U DE8805183 U DE 8805183U DE 8805183 U1 DE8805183 U1 DE 8805183U1
- Authority
- DE
- Germany
- Prior art keywords
- tube
- discharge lamp
- pressure discharge
- igr
- quartz glass
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000011888 foil Substances 0.000 claims description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 11
- 239000000463 material Substances 0.000 claims description 11
- 238000007789 sealing Methods 0.000 claims description 11
- 229910001507 metal halide Inorganic materials 0.000 claims description 6
- 150000005309 metal halides Chemical class 0.000 claims description 6
- 238000002844 melting Methods 0.000 claims description 4
- 230000008018 melting Effects 0.000 claims description 3
- 239000012777 electrically insulating material Substances 0.000 claims description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 2
- 229910052753 mercury Inorganic materials 0.000 claims description 2
- 229910052756 noble gas Inorganic materials 0.000 claims description 2
- 239000000654 additive Substances 0.000 claims 1
- 244000309464 bull Species 0.000 description 9
- 238000005260 corrosion Methods 0.000 description 5
- 230000007797 corrosion Effects 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 239000010453 quartz Substances 0.000 description 5
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 4
- 229910052721 tungsten Inorganic materials 0.000 description 4
- 239000010937 tungsten Substances 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 230000007704 transition Effects 0.000 description 3
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 229910052750 molybdenum Inorganic materials 0.000 description 2
- 239000011733 molybdenum Substances 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N Alumina Chemical compound [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- -1 Vycof®) Chemical compound 0.000 description 1
- 150000003842 bromide salts Chemical class 0.000 description 1
- 230000009172 bursting Effects 0.000 description 1
- 230000003628 erosive effect Effects 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910001509 metal bromide Inorganic materials 0.000 description 1
- 229910001511 metal iodide Inorganic materials 0.000 description 1
- 238000009877 rendering Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052716 thallium Inorganic materials 0.000 description 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/36—Seals between parts of vessels; Seals for leading-in conductors; Leading-in conductors
- H01J61/366—Seals for leading-in conductors
- H01J61/368—Pinched seals or analogous seals
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
Priority Applications (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE8805183U DE8805183U1 (de) | 1988-04-19 | 1988-04-19 | Hochdruckentladungslampe |
| US07/338,307 US5001395A (en) | 1988-04-19 | 1989-04-14 | High-pressure discharge lamp with corrosion protected electrode leads |
| JP1989044569U JPH01155652U (enExample) | 1988-04-19 | 1989-04-18 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE8805183U DE8805183U1 (de) | 1988-04-19 | 1988-04-19 | Hochdruckentladungslampe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE8805183U1 true DE8805183U1 (de) | 1988-07-14 |
Family
ID=6823125
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8805183U Expired DE8805183U1 (de) | 1988-04-19 | 1988-04-19 | Hochdruckentladungslampe |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US5001395A (enExample) |
| JP (1) | JPH01155652U (enExample) |
| DE (1) | DE8805183U1 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0391283A3 (de) * | 1989-04-04 | 1991-05-02 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH | Zweiseitig gesockelte Hochdruckentladungslampe |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4024603A1 (de) * | 1990-08-02 | 1992-02-06 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Hochdruckentladungslampe |
| US5598063A (en) * | 1992-12-16 | 1997-01-28 | General Electric Company | Means for supporting and sealing the lead structure of a lamp |
| JP3665510B2 (ja) * | 1999-06-28 | 2005-06-29 | 株式会社小糸製作所 | 放電ランプ装置用アークチューブ |
| US6759806B2 (en) * | 2000-03-13 | 2004-07-06 | Nec Microwave Tube, Ltd. | High pressure discharge lamp and method for sealing a bulb thereof |
| US20030111958A1 (en) * | 2001-12-13 | 2003-06-19 | Holger Claus | Single ended discharge light source |
| DE102008049476A1 (de) * | 2008-09-29 | 2010-04-01 | Osram Gesellschaft mit beschränkter Haftung | Hochdruckentladungslampe |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4633136A (en) * | 1982-04-20 | 1986-12-30 | Patent-Treuhand-Gesellschaft Fur Elektrische Gluhlampen Mbh | High-pressure discharge lamp with low power input |
| DE3232207A1 (de) * | 1982-08-30 | 1984-03-08 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Hochdruckentladungslampe kleiner leistung |
| NL8302128A (nl) * | 1983-06-15 | 1985-01-02 | Philips Nv | Lagedruknatriumdampontladingslamp. |
| DE3427280C2 (de) * | 1984-07-24 | 1986-06-12 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Metallhalogenid-Hochdruckentladungslampe |
| NL8402866A (nl) * | 1984-09-19 | 1986-04-16 | Philips Nv | Elektrische lamp en glassamenstelling. |
-
1988
- 1988-04-19 DE DE8805183U patent/DE8805183U1/de not_active Expired
-
1989
- 1989-04-14 US US07/338,307 patent/US5001395A/en not_active Expired - Lifetime
- 1989-04-18 JP JP1989044569U patent/JPH01155652U/ja active Pending
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0391283A3 (de) * | 1989-04-04 | 1991-05-02 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH | Zweiseitig gesockelte Hochdruckentladungslampe |
Also Published As
| Publication number | Publication date |
|---|---|
| US5001395A (en) | 1991-03-19 |
| JPH01155652U (enExample) | 1989-10-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69804192T2 (de) | Hochdruckentladungslampe mit uv-verstärker | |
| DE69805390T2 (de) | Metalldampfentladungslampe | |
| DE69318638T2 (de) | Universelle Metallhalogenidlampe | |
| DE3504058C2 (de) | Elektrodenfreie Niederdruckgasentladungslampe | |
| EP0335202B1 (de) | Hochdruck-Entladungslampe, insbesondere Hochdrucknatriumdampflampe | |
| DE69502581T2 (de) | Entladungslampe | |
| EP0602529A2 (de) | Hochdruckentladungslampe mit einem keramischen Entladungsgefäss | |
| DE1571502A1 (de) | Verfahren zum Verschliessen einer Roehre aus feuerfestem Oxid-Material | |
| EP0092221B1 (de) | Hochdruckentladungslampe mit kleiner Leistung | |
| DE8805183U1 (de) | Hochdruckentladungslampe | |
| DE3429105C2 (enExample) | ||
| DE2422576C3 (de) | Quecksilberdampflampe | |
| EP0456907B1 (de) | Hochdruckentladungslampe | |
| DE69824824T2 (de) | Dichtung eines lampenkolben | |
| DE20106002U1 (de) | Metallhalogenidlampe mit keramischem Entladungsgefäß | |
| DE3750865T2 (de) | Entladungsröhrenaufbau für Hochdruckentladungslampe. | |
| EP1351278B1 (de) | Metallhalogenidlampe mit keramischem Entladungsgefäss | |
| DE69020465T3 (de) | Einseitig gequetschte elektrische Metalldampfentladungslampe. | |
| EP0722616A1 (de) | Metallhalogenidentladungslampe | |
| DE10312748A1 (de) | Entladungslampe | |
| DE4203976A1 (de) | Hochdruckentladungslampe | |
| DE2729043A1 (de) | Lichtbogenroehre einer lichtbogenlampe | |
| DE2342568C3 (de) | Elektrischer Durchführungsleiter aus Kupfermanteldraht für eine Entladungslampe mit Quecksilberfüllung | |
| DE2535031C3 (de) | Zündelektrode für Hochdruck-Entladungslampen | |
| EP0250920A2 (de) | Metallhalogenidhochdruckentladungslampe |