DE69828935T2 - Verfahren zur vernetzung thermoplastischer polymere und dabei benutztes vernetzungssystem - Google Patents
Verfahren zur vernetzung thermoplastischer polymere und dabei benutztes vernetzungssystem Download PDFInfo
- Publication number
- DE69828935T2 DE69828935T2 DE69828935T DE69828935T DE69828935T2 DE 69828935 T2 DE69828935 T2 DE 69828935T2 DE 69828935 T DE69828935 T DE 69828935T DE 69828935 T DE69828935 T DE 69828935T DE 69828935 T2 DE69828935 T2 DE 69828935T2
- Authority
- DE
- Germany
- Prior art keywords
- dimethacrylate
- diacrylate
- crosslinking
- component
- polymer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000000034 method Methods 0.000 title claims description 34
- 229920001169 thermoplastic Polymers 0.000 title claims description 23
- 230000006855 networking Effects 0.000 title description 9
- 238000004132 cross linking Methods 0.000 claims description 45
- -1 methyl-substituted phenyl Chemical group 0.000 claims description 37
- 150000001875 compounds Chemical class 0.000 claims description 28
- 229920000642 polymer Polymers 0.000 claims description 18
- 229920001903 high density polyethylene Polymers 0.000 claims description 15
- 239000004700 high-density polyethylene Substances 0.000 claims description 15
- BJELTSYBAHKXRW-UHFFFAOYSA-N 2,4,6-triallyloxy-1,3,5-triazine Chemical compound C=CCOC1=NC(OCC=C)=NC(OCC=C)=N1 BJELTSYBAHKXRW-UHFFFAOYSA-N 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 13
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 13
- BCGQKAZEVCTGCE-UHFFFAOYSA-N 1,2,4-trioxepane Chemical compound C1COCOOC1 BCGQKAZEVCTGCE-UHFFFAOYSA-N 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 9
- 239000000178 monomer Substances 0.000 claims description 9
- 229910052760 oxygen Inorganic materials 0.000 claims description 8
- 239000001301 oxygen Substances 0.000 claims description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 7
- 125000000623 heterocyclic group Chemical group 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 7
- LEJBBGNFPAFPKQ-UHFFFAOYSA-N 2-(2-prop-2-enoyloxyethoxy)ethyl prop-2-enoate Chemical compound C=CC(=O)OCCOCCOC(=O)C=C LEJBBGNFPAFPKQ-UHFFFAOYSA-N 0.000 claims description 6
- XFCMNSHQOZQILR-UHFFFAOYSA-N 2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCOC(=O)C(C)=C XFCMNSHQOZQILR-UHFFFAOYSA-N 0.000 claims description 6
- HCLJOFJIQIJXHS-UHFFFAOYSA-N 2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethyl prop-2-enoate Chemical compound C=CC(=O)OCCOCCOCCOCCOC(=O)C=C HCLJOFJIQIJXHS-UHFFFAOYSA-N 0.000 claims description 6
- 239000002202 Polyethylene glycol Substances 0.000 claims description 6
- 229920006037 cross link polymer Polymers 0.000 claims description 6
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Substances CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 claims description 6
- 229920001223 polyethylene glycol Polymers 0.000 claims description 6
- 125000003710 aryl alkyl group Chemical class 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 125000004386 diacrylate group Chemical group 0.000 claims description 5
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 4
- 239000005977 Ethylene Substances 0.000 claims description 4
- 229920000181 Ethylene propylene rubber Polymers 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 229920001684 low density polyethylene Polymers 0.000 claims description 4
- 239000004702 low-density polyethylene Substances 0.000 claims description 4
- MYWOJODOMFBVCB-UHFFFAOYSA-N 1,2,6-trimethylphenanthrene Chemical compound CC1=CC=C2C3=CC(C)=CC=C3C=CC2=C1C MYWOJODOMFBVCB-UHFFFAOYSA-N 0.000 claims description 3
- VDYWHVQKENANGY-UHFFFAOYSA-N 1,3-Butyleneglycol dimethacrylate Chemical compound CC(=C)C(=O)OC(C)CCOC(=O)C(C)=C VDYWHVQKENANGY-UHFFFAOYSA-N 0.000 claims description 3
- HWSSEYVMGDIFMH-UHFFFAOYSA-N 2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCOCCOC(=O)C(C)=C HWSSEYVMGDIFMH-UHFFFAOYSA-N 0.000 claims description 3
- LTHJXDSHSVNJKG-UHFFFAOYSA-N 2-[2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCOCCOCCOC(=O)C(C)=C LTHJXDSHSVNJKG-UHFFFAOYSA-N 0.000 claims description 3
- AGEXUCKZTAUZJM-UHFFFAOYSA-N 2-[4,6-bis[2-(2-methylprop-2-enoyloxy)ethyl]-1,3,5-triazin-2-yl]ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCC1=NC(CCOC(=O)C(C)=C)=NC(CCOC(=O)C(C)=C)=N1 AGEXUCKZTAUZJM-UHFFFAOYSA-N 0.000 claims description 3
- FDSUVTROAWLVJA-UHFFFAOYSA-N 2-[[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]methyl]-2-(hydroxymethyl)propane-1,3-diol;prop-2-enoic acid Chemical compound OC(=O)C=C.OC(=O)C=C.OC(=O)C=C.OC(=O)C=C.OC(=O)C=C.OCC(CO)(CO)COCC(CO)(CO)CO FDSUVTROAWLVJA-UHFFFAOYSA-N 0.000 claims description 3
- FQMIAEWUVYWVNB-UHFFFAOYSA-N 3-prop-2-enoyloxybutyl prop-2-enoate Chemical compound C=CC(=O)OC(C)CCOC(=O)C=C FQMIAEWUVYWVNB-UHFFFAOYSA-N 0.000 claims description 3
- XOJWAAUYNWGQAU-UHFFFAOYSA-N 4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCCOC(=O)C(C)=C XOJWAAUYNWGQAU-UHFFFAOYSA-N 0.000 claims description 3
- DBCAQXHNJOFNGC-UHFFFAOYSA-N 4-bromo-1,1,1-trifluorobutane Chemical compound FC(F)(F)CCCBr DBCAQXHNJOFNGC-UHFFFAOYSA-N 0.000 claims description 3
- JHWGFJBTMHEZME-UHFFFAOYSA-N 4-prop-2-enoyloxybutyl prop-2-enoate Chemical compound C=CC(=O)OCCCCOC(=O)C=C JHWGFJBTMHEZME-UHFFFAOYSA-N 0.000 claims description 3
- SAPGBCWOQLHKKZ-UHFFFAOYSA-N 6-(2-methylprop-2-enoyloxy)hexyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCCCCOC(=O)C(C)=C SAPGBCWOQLHKKZ-UHFFFAOYSA-N 0.000 claims description 3
- FIHBHSQYSYVZQE-UHFFFAOYSA-N 6-prop-2-enoyloxyhexyl prop-2-enoate Chemical compound C=CC(=O)OCCCCCCOC(=O)C=C FIHBHSQYSYVZQE-UHFFFAOYSA-N 0.000 claims description 3
- DAKWPKUUDNSNPN-UHFFFAOYSA-N Trimethylolpropane triacrylate Chemical compound C=CC(=O)OCC(CC)(COC(=O)C=C)COC(=O)C=C DAKWPKUUDNSNPN-UHFFFAOYSA-N 0.000 claims description 3
- OKKRPWIIYQTPQF-UHFFFAOYSA-N Trimethylolpropane trimethacrylate Chemical compound CC(=C)C(=O)OCC(CC)(COC(=O)C(C)=C)COC(=O)C(C)=C OKKRPWIIYQTPQF-UHFFFAOYSA-N 0.000 claims description 3
- ULQMPOIOSDXIGC-UHFFFAOYSA-N [2,2-dimethyl-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC(C)(C)COC(=O)C(C)=C ULQMPOIOSDXIGC-UHFFFAOYSA-N 0.000 claims description 3
- HVVWZTWDBSEWIH-UHFFFAOYSA-N [2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate Chemical compound C=CC(=O)OCC(CO)(COC(=O)C=C)COC(=O)C=C HVVWZTWDBSEWIH-UHFFFAOYSA-N 0.000 claims description 3
- FHLPGTXWCFQMIU-UHFFFAOYSA-N [4-[2-(4-prop-2-enoyloxyphenyl)propan-2-yl]phenyl] prop-2-enoate Chemical class C=1C=C(OC(=O)C=C)C=CC=1C(C)(C)C1=CC=C(OC(=O)C=C)C=C1 FHLPGTXWCFQMIU-UHFFFAOYSA-N 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- QUZSUMLPWDHKCJ-UHFFFAOYSA-N bisphenol A dimethacrylate Chemical class C1=CC(OC(=O)C(=C)C)=CC=C1C(C)(C)C1=CC=C(OC(=O)C(C)=C)C=C1 QUZSUMLPWDHKCJ-UHFFFAOYSA-N 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- 229920001519 homopolymer Polymers 0.000 claims description 3
- YDKNBNOOCSNPNS-UHFFFAOYSA-N methyl 1,3-benzoxazole-2-carboxylate Chemical compound C1=CC=C2OC(C(=O)OC)=NC2=C1 YDKNBNOOCSNPNS-UHFFFAOYSA-N 0.000 claims description 3
- YIJYFLXQHDOQGW-UHFFFAOYSA-N 2-[2,4,6-trioxo-3,5-bis(2-prop-2-enoyloxyethyl)-1,3,5-triazinan-1-yl]ethyl prop-2-enoate Chemical compound C=CC(=O)OCCN1C(=O)N(CCOC(=O)C=C)C(=O)N(CCOC(=O)C=C)C1=O YIJYFLXQHDOQGW-UHFFFAOYSA-N 0.000 claims description 2
- DHMANIAEDBFOCS-UHFFFAOYSA-N C(C(=C)C)(=O)O.C(C(=C)C)(=O)O.C(C=C)(=O)O.C(C=C)(=O)O.C(COCCOCCO)O Chemical compound C(C(=C)C)(=O)O.C(C(=C)C)(=O)O.C(C=C)(=O)O.C(C=C)(=O)O.C(COCCOCCO)O DHMANIAEDBFOCS-UHFFFAOYSA-N 0.000 claims description 2
- 229920001577 copolymer Polymers 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical class OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 claims description 2
- 239000004416 thermosoftening plastic Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 7
- BPXVHIRIPLPOPT-UHFFFAOYSA-N 1,3,5-tris(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione Chemical compound OCCN1C(=O)N(CCO)C(=O)N(CCO)C1=O BPXVHIRIPLPOPT-UHFFFAOYSA-N 0.000 claims 1
- KNSXNCFKSZZHEA-UHFFFAOYSA-N [3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] prop-2-enoate Chemical class C=CC(=O)OCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C KNSXNCFKSZZHEA-UHFFFAOYSA-N 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 150000002978 peroxides Chemical class 0.000 description 9
- 150000002431 hydrogen Chemical class 0.000 description 6
- 239000003208 petroleum Substances 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 125000004122 cyclic group Chemical group 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 229920001155 polypropylene Polymers 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 229920006337 unsaturated polyester resin Polymers 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- SVTBMSDMJJWYQN-UHFFFAOYSA-N 2-methylpentane-2,4-diol Chemical compound CC(O)CC(C)(C)O SVTBMSDMJJWYQN-UHFFFAOYSA-N 0.000 description 2
- UWSCTMIMCGDSMG-UHFFFAOYSA-N 9,9,11-trimethyl-7,8,12-trioxaspiro[5.6]dodecane Chemical compound O1C(C)CC(C)(C)OOC11CCCCC1 UWSCTMIMCGDSMG-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- 239000003431 cross linking reagent Substances 0.000 description 2
- 229920003020 cross-linked polyethylene Polymers 0.000 description 2
- 239000004703 cross-linked polyethylene Substances 0.000 description 2
- 125000002243 cyclohexanonyl group Chemical class *C1(*)C(=O)C(*)(*)C(*)(*)C(*)(*)C1(*)* 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- 239000000806 elastomer Substances 0.000 description 2
- 238000007654 immersion Methods 0.000 description 2
- 239000003999 initiator Substances 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 2
- 239000003505 polymerization initiator Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 description 1
- 150000007579 7-membered cyclic compounds Chemical class 0.000 description 1
- 0 CCC1(C)OOC(C)(*)CC(C)N1 Chemical compound CCC1(C)OOC(C)(*)CC(C)N1 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 229920000339 Marlex Polymers 0.000 description 1
- RSPISYXLHRIGJD-UHFFFAOYSA-N OOOO Chemical class OOOO RSPISYXLHRIGJD-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 150000001260 acyclic compounds Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N butyric aldehyde Natural products CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000009838 combustion analysis Methods 0.000 description 1
- 239000002837 defoliant Substances 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- HQQADJVZYDDRJT-UHFFFAOYSA-N ethene;prop-1-ene Chemical group C=C.CC=C HQQADJVZYDDRJT-UHFFFAOYSA-N 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- 229920001038 ethylene copolymer Polymers 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- UYMQGIDIEUCSBT-UHFFFAOYSA-N hexane-1,6-diol hydrogen peroxide Chemical compound OO.OCCCCCCO UYMQGIDIEUCSBT-UHFFFAOYSA-N 0.000 description 1
- 229940051250 hexylene glycol Drugs 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000002685 polymerization catalyst Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 238000010526 radical polymerization reaction Methods 0.000 description 1
- QEVHRUUCFGRFIF-MDEJGZGSSA-N reserpine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C(C5=CC=C(OC)C=C5N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 QEVHRUUCFGRFIF-MDEJGZGSSA-N 0.000 description 1
- 238000005070 sampling Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 239000012815 thermoplastic material Substances 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F8/00—Chemical modification by after-treatment
Landscapes
- Chemical & Material Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
- Processes Of Treating Macromolecular Substances (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US850334 | 1997-05-02 | ||
| US08/850,334 US5856412A (en) | 1997-05-02 | 1997-05-02 | Process for crosslinking thermoplastic polymers and crosslinking system used therein |
| PCT/US1998/008907 WO1998050354A1 (en) | 1997-05-02 | 1998-05-01 | Process for cross-linking thermoplastic polymers and cross-linking system used therein |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69828935D1 DE69828935D1 (de) | 2005-03-17 |
| DE69828935T2 true DE69828935T2 (de) | 2005-07-07 |
Family
ID=25307851
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69828935T Expired - Lifetime DE69828935T2 (de) | 1997-05-02 | 1998-05-01 | Verfahren zur vernetzung thermoplastischer polymere und dabei benutztes vernetzungssystem |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US5856412A (enExample) |
| EP (1) | EP0909269B1 (enExample) |
| JP (1) | JP4098879B2 (enExample) |
| DE (1) | DE69828935T2 (enExample) |
| WO (1) | WO1998050354A1 (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ATE280785T1 (de) * | 2000-08-15 | 2004-11-15 | Akzo Nobel Nv | Verwendung von trioxepanen zur herstellung von acrylharzen mit hohem feststoffgehalt, styrolharzen und polyethylenharzen mit niedriger dichte |
| KR100833763B1 (ko) | 2000-08-15 | 2008-05-29 | 아크조 노벨 엔.브이. | 하이솔리드 아크릴, 스티렌 및 ｌｄｐｅ-형 수지를 제조하는데 사용되는 트리옥세판의 용도 |
| AU2002212134A1 (en) * | 2000-08-15 | 2002-02-25 | Akzo Nobel N.V. | Use of trixepans in the process to modify (co) polymers |
| DE60106630T2 (de) | 2000-08-15 | 2005-10-27 | Akzo Nobel N.V. | Verwendung von trioxepanen in brennstoffen mit verbesserter entzündung |
| KR100819680B1 (ko) * | 2000-08-15 | 2008-04-04 | 아크조 노벨 엔.브이. | 트리옥세판 화합물 |
| AU2004263256A1 (en) * | 2003-07-17 | 2005-02-17 | Akzo Nobel N.V. | 1,2,4,-trioxepanes as precursors for lactones |
| KR101189558B1 (ko) * | 2004-12-23 | 2012-10-11 | 아크조 노벨 엔.브이. | 트리옥세판 조성물의 제조 방법 및 폴리머의 가교 결합에사용하는 이의 용도 |
| US8235992B2 (en) * | 2007-09-28 | 2012-08-07 | Tyco Healthcare Group Lp | Insulating boot with mechanical reinforcement for electrosurgical forceps |
| US20100087602A1 (en) * | 2008-10-08 | 2010-04-08 | Fina Technology, Inc. | Long chain branched polypropylene for cast film applications |
| WO2013181784A1 (zh) | 2012-06-04 | 2013-12-12 | 北京低碳清洁能源研究所 | 一种加工性能改善的交联聚乙烯组合物 |
| US9617356B2 (en) * | 2012-06-13 | 2017-04-11 | National Institute Of Clean-And-Low-Carbon Energy | Crosslinked polyethylene composition |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2776319A (en) * | 1954-05-26 | 1957-01-01 | Hercules Powder Co Ltd | Monoperoxyacetals |
| US3576826A (en) * | 1966-10-10 | 1971-04-27 | Pennwalt Corp | Process for preparing ether peroxy compounds from alpha-substituted vinyl ether |
| US3822317A (en) * | 1966-10-10 | 1974-07-02 | Pennwalt Corp | Certain ether peroxides derivable from alpha-substituted vinyl ethers |
| US3956398A (en) * | 1975-05-16 | 1976-05-11 | Hercules Incorporated | Bis-monoperoxyacetals and -ketals |
| CA1190692A (en) * | 1982-02-09 | 1985-07-16 | Du Pont Canada Inc. | Polyethylene compositions for rotational moulding processes |
| DE3307408A1 (de) * | 1983-03-02 | 1984-09-06 | Siemens AG, 1000 Berlin und 8000 München | Verfahren zur radikalischen vernetzung organischer polymerer |
| US4900792A (en) * | 1983-06-13 | 1990-02-13 | Allied-Signal Inc. | Crosslinkable polyethylene composition |
| US4857257A (en) * | 1983-06-13 | 1989-08-15 | Allied-Signal Inc. | Rotationally molding crosslinkable polyethylene composition |
| DE68915824T2 (de) * | 1988-03-10 | 1994-09-15 | Nippon Oils & Fats Co Ltd | Cyclische Monoperoxyketale. |
| JPH03112960A (ja) * | 1988-08-18 | 1991-05-14 | Pennwalt Corp | アミノ又はヒドラジノペルオキシド、それらの誘導体及びそれらの使用 |
| US5272219A (en) * | 1988-08-18 | 1993-12-21 | Elf Atochem North America, Inc. | Process for preparing amino or hydrazino peroxides, derivatives and their uses |
| US4956416A (en) * | 1988-08-18 | 1990-09-11 | Atochem North America, Inc. | Amino or hydrazino peroxides, derivatives and their uses |
| CA2005835A1 (en) * | 1989-01-30 | 1990-07-30 | Jose Sanchez | Hydroxy-peroxides and their uses |
| US5387654A (en) * | 1993-01-08 | 1995-02-07 | Elf Atochem North America, Inc. | Hydroxy-peroxides and their uses |
| US5260381A (en) * | 1991-10-08 | 1993-11-09 | Neeco, Inc. | Crosslinkable polyethylene-based composition for rotational molding |
| US5539061A (en) * | 1992-08-31 | 1996-07-23 | Elf Atochem North America, Inc. | Liquid peroxide compositions |
| BR9204279A (pt) * | 1992-08-31 | 1994-03-01 | Atochem North America Elf | Composicao ou mistura liquida de peroxido,processo para preparar uma composicao ou mistura de peroxido,processo para preparar um peroxido liquido,polimeros e copolimeros,processo para reticular polimeros e copolimeros de peroxido reticulaveis termoplasticos e/ou elastomericos,e,composicao util na producao de polietileno reticulado |
-
1997
- 1997-05-02 US US08/850,334 patent/US5856412A/en not_active Expired - Fee Related
-
1998
- 1998-05-01 EP EP98920129A patent/EP0909269B1/en not_active Expired - Lifetime
- 1998-05-01 WO PCT/US1998/008907 patent/WO1998050354A1/en not_active Ceased
- 1998-05-01 DE DE69828935T patent/DE69828935T2/de not_active Expired - Lifetime
- 1998-05-06 JP JP12326898A patent/JP4098879B2/ja not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| EP0909269B1 (en) | 2005-02-09 |
| JPH11106521A (ja) | 1999-04-20 |
| EP0909269A4 (en) | 2002-08-14 |
| US5856412A (en) | 1999-01-05 |
| WO1998050354A1 (en) | 1998-11-12 |
| EP0909269A1 (en) | 1999-04-21 |
| DE69828935D1 (de) | 2005-03-17 |
| JP4098879B2 (ja) | 2008-06-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0386630B1 (de) | Thermoplastisch verarbeitbare lösungsmittelbeständige Kunststoffmischungen | |
| DE69828935T2 (de) | Verfahren zur vernetzung thermoplastischer polymere und dabei benutztes vernetzungssystem | |
| DE3300526A1 (de) | Schlagzaehmodifizierungsmittel | |
| DE2037419A1 (de) | Acrylharzmasse | |
| EP0501917A2 (de) | Kontaktlinsen aus thermoformbarem Material | |
| EP0093910A1 (de) | Verfahren zur Behandlung von (Co)Polymerisaten zur Entfernung von Restmonomeren | |
| DE1228418B (de) | Verfahren zur Herstellung von modifiziertem Polypropylen | |
| DE2225772A1 (de) | Synergetische Mischungen aus modifizierten Polyolefinen und unmodifizierten Polyolefinen | |
| EP0623641B1 (de) | Verfahren zur Oxidation von Thioethergruppen enthaltenden Polyarylenverbindungen | |
| DE3887551T2 (de) | Gebundene Antioxydationsvormischung. | |
| EP0492405B1 (de) | Acrylat-Methacrylat-Propfpolymerisate | |
| DE2942362A1 (de) | Peroxidgemische und ihre verwendung | |
| EP0001625A1 (de) | Thermoplastische Formmassen | |
| DE1940473A1 (de) | Azoverbindungen und Verfahren zur Erzeugung freier Radikale aus solchen Verbindungen fuer Zwecke der Polymerisation | |
| DE3018203A1 (de) | Verfahren zur herstellung von polymerisaten | |
| EP0792298B1 (de) | Verfahren zur herstellung von kautschukmodifizierten formmassen mittels in den kautschuk eingebauten, bei thermischer zersetzung radikale bildenden gruppen | |
| DE1770664C3 (de) | Verfahren zum kontinuierlichen Polymerisieren in Masse von monomeren Vinylverbindungen | |
| EP0503361A1 (de) | Teilvernetzte Kunststoffmasse | |
| DE4207313A1 (de) | Teilvernetzte kunststoffmassen aus propylencopolymerisaten | |
| DE2903853A1 (de) | Stabile, extrudierbare masse auf der grundlage von heterocyclischen polymeren | |
| EP0093854B1 (de) | Hochtransparente schlagzähe Formmassen auf der Basis von Polyvinylchlorid | |
| DE2718089A1 (de) | Extraktionsbestaendige polyolefinstabilisatoren | |
| DE2905430A1 (de) | Schmelzklebstoff und klebverfahren | |
| DE4022570A1 (de) | Gepfropfte, vernetzte und vernetzbare propylencopolymerisate | |
| EP0792301B1 (de) | Verfahren zur herstellung von kautschukmodifizierten formmassen aus derivate von acrylamiden oder -methacrylamiden enthaltenden reaktionsgemischen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8328 | Change in the person/name/address of the agent |
Representative=s name: SPOTT, WEINMILLER & BOEHM, 80336 MUENCHEN |