DE69736777T2 - Amidinohydrazone als protease-inhibitoren - Google Patents
Amidinohydrazone als protease-inhibitoren Download PDFInfo
- Publication number
- DE69736777T2 DE69736777T2 DE69736777T DE69736777T DE69736777T2 DE 69736777 T2 DE69736777 T2 DE 69736777T2 DE 69736777 T DE69736777 T DE 69736777T DE 69736777 T DE69736777 T DE 69736777T DE 69736777 T2 DE69736777 T2 DE 69736777T2
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- hydrogen
- amino
- aryl
- mmol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 229940042399 direct acting antivirals protease inhibitors Drugs 0.000 title description 4
- 239000000137 peptide hydrolase inhibitor Substances 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 274
- 238000000034 method Methods 0.000 claims abstract description 28
- 108090000190 Thrombin Proteins 0.000 claims abstract description 19
- 229960004072 thrombin Drugs 0.000 claims abstract description 17
- 150000003839 salts Chemical class 0.000 claims abstract description 16
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 claims abstract description 8
- 239000012453 solvate Substances 0.000 claims abstract description 7
- 150000004677 hydrates Chemical class 0.000 claims abstract description 4
- -1 N-piperazinylsulfonyl Chemical group 0.000 claims description 369
- 125000000217 alkyl group Chemical group 0.000 claims description 195
- 239000000203 mixture Substances 0.000 claims description 149
- 229910052739 hydrogen Inorganic materials 0.000 claims description 144
- 239000001257 hydrogen Substances 0.000 claims description 144
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 123
- 239000011541 reaction mixture Substances 0.000 claims description 119
- 125000003118 aryl group Chemical group 0.000 claims description 111
- PMGFHEJUUBDCLU-UHFFFAOYSA-N 2-aminoguanidine;nitric acid Chemical compound O[N+]([O-])=O.NN=C(N)N PMGFHEJUUBDCLU-UHFFFAOYSA-N 0.000 claims description 90
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 86
- 150000002431 hydrogen Chemical class 0.000 claims description 84
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 79
- 125000004181 carboxyalkyl group Chemical group 0.000 claims description 75
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 73
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 72
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 59
- 239000002904 solvent Substances 0.000 claims description 59
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 58
- 125000003545 alkoxy group Chemical group 0.000 claims description 45
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 42
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 41
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 40
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 40
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 31
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 29
- 125000004103 aminoalkyl group Chemical group 0.000 claims description 27
- 125000001424 substituent group Chemical group 0.000 claims description 27
- 125000004432 carbon atom Chemical group C* 0.000 claims description 25
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 25
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 24
- 125000001072 heteroaryl group Chemical group 0.000 claims description 24
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 24
- 238000006243 chemical reaction Methods 0.000 claims description 23
- CABZWVUOHXCMNP-UHFFFAOYSA-N acetic acid;2-aminoguanidine Chemical compound CC([O-])=O.N[NH+]=C(N)N CABZWVUOHXCMNP-UHFFFAOYSA-N 0.000 claims description 22
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 22
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 22
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 22
- 238000011282 treatment Methods 0.000 claims description 22
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 19
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 16
- 125000005422 alkyl sulfonamido group Chemical group 0.000 claims description 16
- 125000005111 carboxyalkoxy group Chemical group 0.000 claims description 16
- 125000001544 thienyl group Chemical group 0.000 claims description 16
- 229910052736 halogen Inorganic materials 0.000 claims description 15
- 150000002367 halogens Chemical class 0.000 claims description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 13
- 125000005087 alkynylcarbonyl group Chemical group 0.000 claims description 13
- 125000005421 aryl sulfonamido group Chemical group 0.000 claims description 13
- 230000002401 inhibitory effect Effects 0.000 claims description 13
- 239000000651 prodrug Substances 0.000 claims description 13
- 229940002612 prodrug Drugs 0.000 claims description 13
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 12
- 125000003342 alkenyl group Chemical group 0.000 claims description 12
- 125000005137 alkenylsulfonyl group Chemical group 0.000 claims description 12
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims description 12
- 125000000304 alkynyl group Chemical group 0.000 claims description 12
- 125000005139 alkynylsulfonyl group Chemical group 0.000 claims description 12
- 125000002431 aminoalkoxy group Chemical group 0.000 claims description 12
- HAMNKKUPIHEESI-UHFFFAOYSA-N aminoguanidine Chemical compound NNC(N)=N HAMNKKUPIHEESI-UHFFFAOYSA-N 0.000 claims description 12
- 125000005113 hydroxyalkoxy group Chemical group 0.000 claims description 12
- 125000004076 pyridyl group Chemical group 0.000 claims description 12
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 11
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 11
- 125000005843 halogen group Chemical group 0.000 claims description 11
- 241000124008 Mammalia Species 0.000 claims description 10
- 125000005090 alkenylcarbonyl group Chemical group 0.000 claims description 10
- 125000003282 alkyl amino group Chemical group 0.000 claims description 10
- 125000005129 aryl carbonyl group Chemical group 0.000 claims description 10
- 239000003814 drug Substances 0.000 claims description 10
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 claims description 9
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 9
- 125000004442 acylamino group Chemical group 0.000 claims description 9
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 9
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 claims description 9
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 claims description 9
- 238000004519 manufacturing process Methods 0.000 claims description 9
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 8
- 125000004104 aryloxy group Chemical group 0.000 claims description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 8
- 125000001624 naphthyl group Chemical group 0.000 claims description 8
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 8
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 claims description 8
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 8
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 claims description 8
- 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 claims description 7
- 229910052799 carbon Inorganic materials 0.000 claims description 7
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 claims description 7
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- 206010014561 Emphysema Diseases 0.000 claims description 6
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 claims description 6
- 239000008194 pharmaceutical composition Substances 0.000 claims description 6
- 230000017854 proteolysis Effects 0.000 claims description 6
- 125000006577 C1-C6 hydroxyalkyl group Chemical group 0.000 claims description 5
- 208000007536 Thrombosis Diseases 0.000 claims description 5
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 claims description 5
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 claims description 5
- 125000005518 carboxamido group Chemical group 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 125000004230 chromenyl group Chemical group O1C(C=CC2=CC=CC=C12)* 0.000 claims description 5
- 206010061218 Inflammation Diseases 0.000 claims description 4
- 206010033645 Pancreatitis Diseases 0.000 claims description 4
- 125000005140 aralkylsulfonyl group Chemical group 0.000 claims description 4
- 125000001246 bromo group Chemical group Br* 0.000 claims description 4
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 4
- 239000003937 drug carrier Substances 0.000 claims description 4
- 230000004054 inflammatory process Effects 0.000 claims description 4
- 150000002823 nitrates Chemical class 0.000 claims description 4
- 208000037803 restenosis Diseases 0.000 claims description 4
- 125000004738 (C1-C6) alkyl sulfinyl group Chemical group 0.000 claims description 3
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 3
- 108010049003 Fibrinogen Proteins 0.000 claims description 3
- 102000008946 Fibrinogen Human genes 0.000 claims description 3
- 102100027612 Kallikrein-11 Human genes 0.000 claims description 3
- 101710152431 Trypsin-like protease Proteins 0.000 claims description 3
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 3
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims description 3
- 239000003085 diluting agent Substances 0.000 claims description 3
- 229940012952 fibrinogen Drugs 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 125000001153 fluoro group Chemical group F* 0.000 claims description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 3
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 claims description 3
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims description 2
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 2
- 208000006011 Stroke Diseases 0.000 claims description 2
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 claims description 2
- 125000004849 alkoxymethyl group Chemical group 0.000 claims description 2
- 230000015271 coagulation Effects 0.000 claims description 2
- 238000005345 coagulation Methods 0.000 claims description 2
- 208000028867 ischemia Diseases 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 125000002853 C1-C4 hydroxyalkyl group Chemical group 0.000 claims 1
- IXLXPFVNCJZCOW-UHFFFAOYSA-N CC(O)=O.CC(O)=O.NNC(N)=N Chemical compound CC(O)=O.CC(O)=O.NNC(N)=N IXLXPFVNCJZCOW-UHFFFAOYSA-N 0.000 claims 1
- 125000005277 alkyl imino group Chemical group 0.000 claims 1
- 208000010110 spontaneous platelet aggregation Diseases 0.000 claims 1
- 108091005804 Peptidases Proteins 0.000 abstract description 15
- 102000035195 Peptidases Human genes 0.000 abstract description 15
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 abstract description 5
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 702
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 302
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 262
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 165
- 238000005160 1H NMR spectroscopy Methods 0.000 description 145
- 239000000243 solution Substances 0.000 description 133
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 131
- 239000011734 sodium Substances 0.000 description 110
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 108
- 238000003818 flash chromatography Methods 0.000 description 89
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 87
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 76
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 72
- 239000011159 matrix material Substances 0.000 description 69
- 238000001840 matrix-assisted laser desorption--ionisation time-of-flight mass spectrometry Methods 0.000 description 69
- 238000001819 mass spectrum Methods 0.000 description 67
- 239000007787 solid Substances 0.000 description 64
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 63
- AFVLVVWMAFSXCK-UHFFFAOYSA-N α-cyano-4-hydroxycinnamic acid Chemical compound OC(=O)C(C#N)=CC1=CC=C(O)C=C1 AFVLVVWMAFSXCK-UHFFFAOYSA-N 0.000 description 63
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 54
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 48
- 239000012267 brine Substances 0.000 description 46
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 46
- 239000003921 oil Substances 0.000 description 41
- 235000019198 oils Nutrition 0.000 description 41
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 40
- 239000012230 colorless oil Substances 0.000 description 40
- 239000000706 filtrate Substances 0.000 description 38
- 239000002244 precipitate Substances 0.000 description 37
- UDYFLDICVHJSOY-UHFFFAOYSA-N sulfur trioxide-pyridine complex Substances O=S(=O)=O.C1=CC=NC=C1 UDYFLDICVHJSOY-UHFFFAOYSA-N 0.000 description 36
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 35
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 35
- BAKYASSDAXQKKY-UHFFFAOYSA-N 4-Hydroxy-3-methylbenzaldehyde Chemical compound CC1=CC(C=O)=CC=C1O BAKYASSDAXQKKY-UHFFFAOYSA-N 0.000 description 33
- 229920006395 saturated elastomer Polymers 0.000 description 33
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 32
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 30
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 30
- NBKPNAMTHBIMLA-UHFFFAOYSA-N 5-methylbenzene-1,3-diol;hydrate Chemical compound O.CC1=CC(O)=CC(O)=C1 NBKPNAMTHBIMLA-UHFFFAOYSA-N 0.000 description 29
- 239000010410 layer Substances 0.000 description 29
- OQJBFFCUFALWQL-UHFFFAOYSA-N n-(piperidine-1-carbonylimino)piperidine-1-carboxamide Chemical compound C1CCCCN1C(=O)N=NC(=O)N1CCCCC1 OQJBFFCUFALWQL-UHFFFAOYSA-N 0.000 description 29
- 239000000741 silica gel Substances 0.000 description 28
- 229910002027 silica gel Inorganic materials 0.000 description 28
- 238000001914 filtration Methods 0.000 description 27
- 239000012074 organic phase Substances 0.000 description 23
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 22
- 229940035437 1,3-propanediol Drugs 0.000 description 22
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 22
- 239000012455 biphasic mixture Substances 0.000 description 22
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 22
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 22
- 239000012044 organic layer Substances 0.000 description 20
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 19
- 239000000284 extract Substances 0.000 description 17
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 16
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 16
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 16
- 229960000583 acetic acid Drugs 0.000 description 15
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 14
- 229910052757 nitrogen Inorganic materials 0.000 description 14
- 201000010099 disease Diseases 0.000 description 12
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 12
- 239000006260 foam Substances 0.000 description 12
- 239000012458 free base Substances 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N butyric aldehyde Natural products CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 11
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 11
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- WXTMDXOMEHJXQO-UHFFFAOYSA-N 2,5-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC(O)=CC=C1O WXTMDXOMEHJXQO-UHFFFAOYSA-N 0.000 description 10
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 10
- 239000012362 glacial acetic acid Substances 0.000 description 10
- 238000002360 preparation method Methods 0.000 description 10
- 108090000790 Enzymes Proteins 0.000 description 9
- 102000004190 Enzymes Human genes 0.000 description 9
- 239000004365 Protease Substances 0.000 description 9
- 239000012043 crude product Substances 0.000 description 9
- WBKFWQBXFREOFH-UHFFFAOYSA-N dichloromethane;ethyl acetate Chemical compound ClCCl.CCOC(C)=O WBKFWQBXFREOFH-UHFFFAOYSA-N 0.000 description 9
- 229940088598 enzyme Drugs 0.000 description 9
- 239000003112 inhibitor Substances 0.000 description 9
- 125000006239 protecting group Chemical group 0.000 description 9
- 239000006188 syrup Substances 0.000 description 9
- 235000020357 syrup Nutrition 0.000 description 9
- LKDMKWNDBAVNQZ-UHFFFAOYSA-N 4-[[1-[[1-[2-[[1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)NC(C)C(=O)NC(C)C(=O)N1CCCC1C(=O)NC(C(=O)NC=1C=CC(=CC=1)[N+]([O-])=O)CC1=CC=CC=C1 LKDMKWNDBAVNQZ-UHFFFAOYSA-N 0.000 description 8
- 108090000617 Cathepsin G Proteins 0.000 description 8
- 102100025975 Cathepsin G Human genes 0.000 description 8
- 108090000317 Chymotrypsin Proteins 0.000 description 8
- 108010074860 Factor Xa Proteins 0.000 description 8
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 8
- 229960002376 chymotrypsin Drugs 0.000 description 8
- 210000000265 leukocyte Anatomy 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- 238000000746 purification Methods 0.000 description 8
- 229910000104 sodium hydride Inorganic materials 0.000 description 8
- 238000003786 synthesis reaction Methods 0.000 description 8
- UBDZFAGVPPMTIT-UHFFFAOYSA-N 2-aminoguanidine;hydron;chloride Chemical compound [Cl-].NC(N)=N[NH3+] UBDZFAGVPPMTIT-UHFFFAOYSA-N 0.000 description 7
- 239000000460 chlorine Substances 0.000 description 7
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- 102000016387 Pancreatic elastase Human genes 0.000 description 6
- 108010067372 Pancreatic elastase Proteins 0.000 description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 108090000631 Trypsin Proteins 0.000 description 6
- 102000004142 Trypsin Human genes 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 239000000872 buffer Substances 0.000 description 6
- 229940079593 drug Drugs 0.000 description 6
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 6
- 239000003208 petroleum Substances 0.000 description 6
- 230000003389 potentiating effect Effects 0.000 description 6
- 239000012312 sodium hydride Substances 0.000 description 6
- 230000001225 therapeutic effect Effects 0.000 description 6
- 239000012588 trypsin Substances 0.000 description 6
- 229960001322 trypsin Drugs 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 5
- 238000005481 NMR spectroscopy Methods 0.000 description 5
- 229910002651 NO3 Inorganic materials 0.000 description 5
- 102100033174 Neutrophil elastase Human genes 0.000 description 5
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 5
- 108010022999 Serine Proteases Proteins 0.000 description 5
- 102000012479 Serine Proteases Human genes 0.000 description 5
- 108090000435 Urokinase-type plasminogen activator Proteins 0.000 description 5
- 102000003990 Urokinase-type plasminogen activator Human genes 0.000 description 5
- 235000011054 acetic acid Nutrition 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 230000023555 blood coagulation Effects 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 238000003776 cleavage reaction Methods 0.000 description 5
- 238000010828 elution Methods 0.000 description 5
- 239000000945 filler Substances 0.000 description 5
- 229960005219 gentisic acid Drugs 0.000 description 5
- 239000008187 granular material Substances 0.000 description 5
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 5
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 108090000623 proteins and genes Proteins 0.000 description 5
- 102000004169 proteins and genes Human genes 0.000 description 5
- 230000007017 scission Effects 0.000 description 5
- 229960005356 urokinase Drugs 0.000 description 5
- PVEFUDIXDYZOOF-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 2-methoxybenzenesulfonate Chemical compound COC1=CC=CC=C1S(=O)(=O)OC1=CC(C)=CC(O)=C1 PVEFUDIXDYZOOF-UHFFFAOYSA-N 0.000 description 4
- FGQOOHJZONJGDT-UHFFFAOYSA-N 3-hydroxy-5-methoxybenzaldehyde Chemical compound COC1=CC(O)=CC(C=O)=C1 FGQOOHJZONJGDT-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- 108010028275 Leukocyte Elastase Proteins 0.000 description 4
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 4
- 102000001938 Plasminogen Activators Human genes 0.000 description 4
- 108010001014 Plasminogen Activators Proteins 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 229920002472 Starch Polymers 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- JTDCEPSVZBADBW-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] 5-chloro-2-methoxybenzenesulfonate Chemical compound COC1=CC=C(Cl)C=C1S(=O)(=O)OC1=CC(C)=CC(OCCC=O)=C1 JTDCEPSVZBADBW-UHFFFAOYSA-N 0.000 description 4
- 239000003146 anticoagulant agent Substances 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 238000010168 coupling process Methods 0.000 description 4
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical class C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 4
- 239000008298 dragée Substances 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- 239000000825 pharmaceutical preparation Substances 0.000 description 4
- 150000002989 phenols Chemical class 0.000 description 4
- 229940127126 plasminogen activator Drugs 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 206010039073 rheumatoid arthritis Diseases 0.000 description 4
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical class ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- WORJRXHJTUTINR-UHFFFAOYSA-N 1,4-dioxane;hydron;chloride Chemical compound Cl.C1COCCO1 WORJRXHJTUTINR-UHFFFAOYSA-N 0.000 description 3
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 3
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 3
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- ROZYHGLKHNBLOT-UHFFFAOYSA-N CC(O)=O.CCC(Oc1cc(C)cc(OS(=O)(=O)c2cc(Cl)ccc2OC)c1)=NN(N=C(CC)Oc1cc(C)cc(OS(=O)(=O)c2cc(Cl)ccc2OC)c1)C(N)=N Chemical compound CC(O)=O.CCC(Oc1cc(C)cc(OS(=O)(=O)c2cc(Cl)ccc2OC)c1)=NN(N=C(CC)Oc1cc(C)cc(OS(=O)(=O)c2cc(Cl)ccc2OC)c1)C(N)=N ROZYHGLKHNBLOT-UHFFFAOYSA-N 0.000 description 3
- 229920000858 Cyclodextrin Polymers 0.000 description 3
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 3
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 229940123583 Factor Xa inhibitor Drugs 0.000 description 3
- 108010088842 Fibrinolysin Proteins 0.000 description 3
- 108010010803 Gelatin Proteins 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 201000005569 Gout Diseases 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 108010006035 Metalloproteases Proteins 0.000 description 3
- 206010027476 Metastases Diseases 0.000 description 3
- 206010028980 Neoplasm Diseases 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- 206010047249 Venous thrombosis Diseases 0.000 description 3
- RIKQTZJVTANQSB-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] 3-cyanobenzenesulfonate Chemical compound CC1=CC(OCCC=O)=CC(OS(=O)(=O)C=2C=C(C=CC=2)C#N)=C1 RIKQTZJVTANQSB-UHFFFAOYSA-N 0.000 description 3
- UDKYKXQKXHLFFA-UHFFFAOYSA-N acetic acid [3-(5-chloro-2-methoxyphenyl)sulfonyloxy-5-methylphenyl] N-[N'-[1-[3-(5-chloro-2-methoxyphenyl)sulfonyloxy-5-methylphenoxy]propylideneamino]carbamimidoyl]propanehydrazonate Chemical compound CC(O)=O.CCC(Oc1cc(C)cc(OS(=O)(=O)c2cc(Cl)ccc2OC)c1)=NNC(=N)NN=C(CC)Oc1cc(C)cc(OS(=O)(=O)c2cc(Cl)ccc2OC)c1 UDKYKXQKXHLFFA-UHFFFAOYSA-N 0.000 description 3
- 230000004913 activation Effects 0.000 description 3
- 239000002671 adjuvant Substances 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 238000002306 biochemical method Methods 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 3
- 210000004027 cell Anatomy 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 125000004122 cyclic group Chemical group 0.000 description 3
- 230000006378 damage Effects 0.000 description 3
- 238000013461 design Methods 0.000 description 3
- 230000020764 fibrinolysis Effects 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 229940014259 gelatin Drugs 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 235000011852 gelatine desserts Nutrition 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 208000027866 inflammatory disease Diseases 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 230000009401 metastasis Effects 0.000 description 3
- 125000002950 monocyclic group Chemical group 0.000 description 3
- YCUGJRRXYZIUSO-UHFFFAOYSA-N n-(3-methyl-5-phenylmethoxyphenyl)-2-(trifluoromethyl)benzenesulfonamide Chemical compound C=1C(OCC=2C=CC=CC=2)=CC(C)=CC=1NS(=O)(=O)C1=CC=CC=C1C(F)(F)F YCUGJRRXYZIUSO-UHFFFAOYSA-N 0.000 description 3
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 210000000440 neutrophil Anatomy 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 125000004430 oxygen atom Chemical group O* 0.000 description 3
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 3
- 229940012957 plasmin Drugs 0.000 description 3
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 3
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 3
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 239000000600 sorbitol Substances 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- 235000012222 talc Nutrition 0.000 description 3
- 239000003643 water by type Substances 0.000 description 3
- XGEAUXVPBXUBKN-WUFINQPMSA-N (+)-Obamegine Natural products C([C@H]1N(C)CCC=2C=C(C(=C(OC3=C(OC)C=C4CCN(C)[C@H](C4=C3)CC3=CC=C(C=C3)O3)C=21)O)OC)C1=CC=C(O)C3=C1 XGEAUXVPBXUBKN-WUFINQPMSA-N 0.000 description 2
- WQFSBYHHEJFDOX-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 2,1,3-benzothiadiazole-4-sulfonate Chemical compound CC1=CC(O)=CC(OS(=O)(=O)C=2C3=NSN=C3C=CC=2)=C1 WQFSBYHHEJFDOX-UHFFFAOYSA-N 0.000 description 2
- HUWPRETWTLFOTQ-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 2,3-dichlorobenzenesulfonate Chemical compound CC1=CC(O)=CC(OS(=O)(=O)C=2C(=C(Cl)C=CC=2)Cl)=C1 HUWPRETWTLFOTQ-UHFFFAOYSA-N 0.000 description 2
- GLEZGPZCRDCAPE-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 2,5-dichlorobenzenesulfonate Chemical compound CC1=CC(O)=CC(OS(=O)(=O)C=2C(=CC=C(Cl)C=2)Cl)=C1 GLEZGPZCRDCAPE-UHFFFAOYSA-N 0.000 description 2
- GPSMQNXBCUBDBJ-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 2,5-dimethoxybenzenesulfonate Chemical compound COC1=CC=C(OC)C(S(=O)(=O)OC=2C=C(O)C=C(C)C=2)=C1 GPSMQNXBCUBDBJ-UHFFFAOYSA-N 0.000 description 2
- GGOKDFMKFQSLLX-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 2,5-dimethylbenzenesulfonate Chemical compound CC1=CC=C(C)C(S(=O)(=O)OC=2C=C(O)C=C(C)C=2)=C1 GGOKDFMKFQSLLX-UHFFFAOYSA-N 0.000 description 2
- BFLHWTOBLOBWEF-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 2-(trifluoromethoxy)benzenesulfonate Chemical compound CC1=CC(O)=CC(OS(=O)(=O)C=2C(=CC=CC=2)OC(F)(F)F)=C1 BFLHWTOBLOBWEF-UHFFFAOYSA-N 0.000 description 2
- OUBXDNQOOPCHBR-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 2-chloro-5-(trifluoromethyl)benzenesulfonate Chemical compound CC1=CC(O)=CC(OS(=O)(=O)C=2C(=CC=C(C=2)C(F)(F)F)Cl)=C1 OUBXDNQOOPCHBR-UHFFFAOYSA-N 0.000 description 2
- NLNQGGXKFYQXCA-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 2-cyano-5-methylbenzenesulfonate Chemical compound CC1=CC=C(C#N)C(S(=O)(=O)OC=2C=C(O)C=C(C)C=2)=C1 NLNQGGXKFYQXCA-UHFFFAOYSA-N 0.000 description 2
- XQXSSRWVLRSYFE-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 2-cyanobenzenesulfonate Chemical compound CC1=CC(O)=CC(OS(=O)(=O)C=2C(=CC=CC=2)C#N)=C1 XQXSSRWVLRSYFE-UHFFFAOYSA-N 0.000 description 2
- VSXWPYLGEPRRHZ-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 2-methoxy-5-methylbenzenesulfonate Chemical compound COC1=CC=C(C)C=C1S(=O)(=O)OC1=CC(C)=CC(O)=C1 VSXWPYLGEPRRHZ-UHFFFAOYSA-N 0.000 description 2
- VXLZQTCAPJBFKW-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 2-methyl-5-nitrobenzenesulfonate Chemical compound CC1=CC(O)=CC(OS(=O)(=O)C=2C(=CC=C(C=2)[N+]([O-])=O)C)=C1 VXLZQTCAPJBFKW-UHFFFAOYSA-N 0.000 description 2
- ZPPRAAPQYTZFPL-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 3-bromobenzenesulfonate Chemical compound CC1=CC(O)=CC(OS(=O)(=O)C=2C=C(Br)C=CC=2)=C1 ZPPRAAPQYTZFPL-UHFFFAOYSA-N 0.000 description 2
- KWSLSKJGPZXCFW-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 3-chlorobenzenesulfonate Chemical compound CC1=CC(O)=CC(OS(=O)(=O)C=2C=C(Cl)C=CC=2)=C1 KWSLSKJGPZXCFW-UHFFFAOYSA-N 0.000 description 2
- PWWDQMRQMFRQAC-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 3-cyanobenzenesulfonate Chemical compound CC1=CC(O)=CC(OS(=O)(=O)C=2C=C(C=CC=2)C#N)=C1 PWWDQMRQMFRQAC-UHFFFAOYSA-N 0.000 description 2
- VTMVTBFPXOIFLJ-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 3-fluorobenzenesulfonate Chemical compound CC1=CC(O)=CC(OS(=O)(=O)C=2C=C(F)C=CC=2)=C1 VTMVTBFPXOIFLJ-UHFFFAOYSA-N 0.000 description 2
- WTPJGJKJSWHHPW-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 3-methylbenzenesulfonate Chemical compound CC1=CC=CC(S(=O)(=O)OC=2C=C(O)C=C(C)C=2)=C1 WTPJGJKJSWHHPW-UHFFFAOYSA-N 0.000 description 2
- PSJAPNBKCZGPSB-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 5-bromo-2-methoxybenzenesulfonate Chemical compound COC1=CC=C(Br)C=C1S(=O)(=O)OC1=CC(C)=CC(O)=C1 PSJAPNBKCZGPSB-UHFFFAOYSA-N 0.000 description 2
- YTDLYWJSYDUHKB-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 5-chloro-1,3-dimethylpyrazole-4-sulfonate Chemical compound CC1=NN(C)C(Cl)=C1S(=O)(=O)OC1=CC(C)=CC(O)=C1 YTDLYWJSYDUHKB-UHFFFAOYSA-N 0.000 description 2
- ABURZMNVRVIFEQ-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 5-chloro-2-methoxybenzenesulfonate Chemical compound COC1=CC=C(Cl)C=C1S(=O)(=O)OC1=CC(C)=CC(O)=C1 ABURZMNVRVIFEQ-UHFFFAOYSA-N 0.000 description 2
- WSLHTEGLEKDYOO-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 5-fluoro-2-methylbenzenesulfonate Chemical compound CC1=CC(O)=CC(OS(=O)(=O)C=2C(=CC=C(F)C=2)C)=C1 WSLHTEGLEKDYOO-UHFFFAOYSA-N 0.000 description 2
- IGDXKZWSEUZIJJ-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) isoquinoline-5-sulfonate Chemical compound CC1=CC(O)=CC(OS(=O)(=O)C=2C3=CC=NC=C3C=CC=2)=C1 IGDXKZWSEUZIJJ-UHFFFAOYSA-N 0.000 description 2
- JWCSWGHMLKMQLY-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) naphthalene-1-sulfonate Chemical compound CC1=CC(O)=CC(OS(=O)(=O)C=2C3=CC=CC=C3C=CC=2)=C1 JWCSWGHMLKMQLY-UHFFFAOYSA-N 0.000 description 2
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 description 2
- ZIZGWNOAHUCACM-UHFFFAOYSA-N 2-(trifluoromethyl)benzenesulfonyl chloride Chemical compound FC(F)(F)C1=CC=CC=C1S(Cl)(=O)=O ZIZGWNOAHUCACM-UHFFFAOYSA-N 0.000 description 2
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 2
- LGNVAEIITHYWCG-UHFFFAOYSA-N 2-amino-4-methylbenzonitrile Chemical compound CC1=CC=C(C#N)C(N)=C1 LGNVAEIITHYWCG-UHFFFAOYSA-N 0.000 description 2
- WTRIMJTZOOLIFZ-UHFFFAOYSA-N 2-bromo-2-methylpropanamide Chemical compound CC(C)(Br)C(N)=O WTRIMJTZOOLIFZ-UHFFFAOYSA-N 0.000 description 2
- KMVZDSQHLDGKGV-UHFFFAOYSA-N 2-chlorobenzenesulfonyl chloride Chemical compound ClC1=CC=CC=C1S(Cl)(=O)=O KMVZDSQHLDGKGV-UHFFFAOYSA-N 0.000 description 2
- ZFQDREVAYVNITB-UHFFFAOYSA-N 2-cyano-5-methylbenzenesulfonyl chloride Chemical compound CC1=CC=C(C#N)C(S(Cl)(=O)=O)=C1 ZFQDREVAYVNITB-UHFFFAOYSA-N 0.000 description 2
- ILJKKAIQFPEIBL-UHFFFAOYSA-N 2-cyclopropyl-2-hydroxyacetonitrile Chemical compound N#CC(O)C1CC1 ILJKKAIQFPEIBL-UHFFFAOYSA-N 0.000 description 2
- VWWHIWMMYHYYQW-UHFFFAOYSA-N 2-hydroxy-2-methyl-n-(3-methyl-5-phenylmethoxyphenyl)propanamide Chemical compound CC1=CC(NC(=O)C(C)(C)O)=CC(OCC=2C=CC=CC=2)=C1 VWWHIWMMYHYYQW-UHFFFAOYSA-N 0.000 description 2
- JKUNYOVTULTVIA-UHFFFAOYSA-N 2-methyl-2-phenoxypropanamide Chemical compound NC(=O)C(C)(C)OC1=CC=CC=C1 JKUNYOVTULTVIA-UHFFFAOYSA-N 0.000 description 2
- ULTNGASOSWGCIC-UHFFFAOYSA-N 3-[3-(1,3-dioxan-2-yl)propyl]-5-methoxyphenol Chemical compound COC1=CC(O)=CC(CCCC2OCCCO2)=C1 ULTNGASOSWGCIC-UHFFFAOYSA-N 0.000 description 2
- NWDXLNRBMHDGPL-UHFFFAOYSA-N 3-[3-methyl-5-[[2-(trifluoromethyl)phenyl]methoxy]phenoxy]propan-1-ol Chemical compound CC1=CC(OCCCO)=CC(OCC=2C(=CC=CC=2)C(F)(F)F)=C1 NWDXLNRBMHDGPL-UHFFFAOYSA-N 0.000 description 2
- OGQIMPOJYMHLBE-UHFFFAOYSA-N 3-[3-methyl-5-[[2-(trifluoromethyl)phenyl]methoxy]phenoxy]propanal Chemical compound CC1=CC(OCCC=O)=CC(OCC=2C(=CC=CC=2)C(F)(F)F)=C1 OGQIMPOJYMHLBE-UHFFFAOYSA-N 0.000 description 2
- ATGPJLSWPLCROE-UHFFFAOYSA-N 3-methyl-5-[[2-(trifluoromethyl)phenyl]methoxy]phenol Chemical compound CC1=CC(O)=CC(OCC=2C(=CC=CC=2)C(F)(F)F)=C1 ATGPJLSWPLCROE-UHFFFAOYSA-N 0.000 description 2
- HQOPQGDDTOUNDP-UHFFFAOYSA-N 3-methyl-5-phenylmethoxyphenol Chemical compound CC1=CC(O)=CC(OCC=2C=CC=CC=2)=C1 HQOPQGDDTOUNDP-UHFFFAOYSA-N 0.000 description 2
- WIPKZLIKOXLWCF-UHFFFAOYSA-N 4,5-dihydro-1h-imidazol-2-ylhydrazine Chemical compound NNC1=NCCN1 WIPKZLIKOXLWCF-UHFFFAOYSA-N 0.000 description 2
- LKDMKWNDBAVNQZ-WJNSRDFLSA-N 4-[[(2s)-1-[[(2s)-1-[(2s)-2-[[(2s)-1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)NC=1C=CC(=CC=1)[N+]([O-])=O)CC1=CC=CC=C1 LKDMKWNDBAVNQZ-WJNSRDFLSA-N 0.000 description 2
- FCJGLIMDVOTBLO-UHFFFAOYSA-N 5-chloro-2-methoxybenzenesulfonyl chloride Chemical compound COC1=CC=C(Cl)C=C1S(Cl)(=O)=O FCJGLIMDVOTBLO-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- 108091005508 Acid proteases Proteins 0.000 description 2
- 208000024827 Alzheimer disease Diseases 0.000 description 2
- 206010004446 Benign prostatic hyperplasia Diseases 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 206010053567 Coagulopathies Diseases 0.000 description 2
- 102000016917 Complement C1 Human genes 0.000 description 2
- 108010028774 Complement C1 Proteins 0.000 description 2
- 102000016574 Complement C3-C5 Convertases Human genes 0.000 description 2
- 108010067641 Complement C3-C5 Convertases Proteins 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 206010018364 Glomerulonephritis Diseases 0.000 description 2
- 108060005987 Kallikrein Proteins 0.000 description 2
- 102000001399 Kallikrein Human genes 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 102000005741 Metalloproteases Human genes 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 229920002565 Polyethylene Glycol 400 Polymers 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N Propene Chemical group CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 2
- 206010060862 Prostate cancer Diseases 0.000 description 2
- 208000004403 Prostatic Hyperplasia Diseases 0.000 description 2
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 2
- 201000004681 Psoriasis Diseases 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 206010040070 Septic Shock Diseases 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 229940122388 Thrombin inhibitor Drugs 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- OCVZQUSECMRGCM-UHFFFAOYSA-N [3-(2-hydroxyethoxy)-5-methylphenyl] 2-methoxybenzenesulfonate Chemical compound COC1=CC=CC=C1S(=O)(=O)OC1=CC(C)=CC(OCCO)=C1 OCVZQUSECMRGCM-UHFFFAOYSA-N 0.000 description 2
- WWHCDVIOJMOBJJ-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 2,1,3-benzothiadiazole-4-sulfonate Chemical compound CC1=CC(OCCCO)=CC(OS(=O)(=O)C=2C3=NSN=C3C=CC=2)=C1 WWHCDVIOJMOBJJ-UHFFFAOYSA-N 0.000 description 2
- BYBOGKGBJVBZAS-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 2,3-dichlorobenzenesulfonate Chemical compound CC1=CC(OCCCO)=CC(OS(=O)(=O)C=2C(=C(Cl)C=CC=2)Cl)=C1 BYBOGKGBJVBZAS-UHFFFAOYSA-N 0.000 description 2
- KFKPUSRIRABHEI-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 2,5-dichlorobenzenesulfonate Chemical compound CC1=CC(OCCCO)=CC(OS(=O)(=O)C=2C(=CC=C(Cl)C=2)Cl)=C1 KFKPUSRIRABHEI-UHFFFAOYSA-N 0.000 description 2
- VPOLUXVBGZHSJQ-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 2,5-dimethoxybenzenesulfonate Chemical compound COC1=CC=C(OC)C(S(=O)(=O)OC=2C=C(OCCCO)C=C(C)C=2)=C1 VPOLUXVBGZHSJQ-UHFFFAOYSA-N 0.000 description 2
- KKGGRUWJHSXXQK-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 2,5-dimethylbenzenesulfonate Chemical compound CC1=CC=C(C)C(S(=O)(=O)OC=2C=C(OCCCO)C=C(C)C=2)=C1 KKGGRUWJHSXXQK-UHFFFAOYSA-N 0.000 description 2
- ALSHWOFEFNHMDE-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 2-(trifluoromethoxy)benzenesulfonate Chemical compound CC1=CC(OCCCO)=CC(OS(=O)(=O)C=2C(=CC=CC=2)OC(F)(F)F)=C1 ALSHWOFEFNHMDE-UHFFFAOYSA-N 0.000 description 2
- FOGYRAWAYWSDNE-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 2-chloro-5-(trifluoromethyl)benzenesulfonate Chemical compound CC1=CC(OCCCO)=CC(OS(=O)(=O)C=2C(=CC=C(C=2)C(F)(F)F)Cl)=C1 FOGYRAWAYWSDNE-UHFFFAOYSA-N 0.000 description 2
- OUELYMDOEHMNLB-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 2-chlorobenzenesulfonate Chemical compound CC1=CC(OCCCO)=CC(OS(=O)(=O)C=2C(=CC=CC=2)Cl)=C1 OUELYMDOEHMNLB-UHFFFAOYSA-N 0.000 description 2
- FUXXPRJXHYLUCL-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 2-cyano-5-methylbenzenesulfonate Chemical compound CC1=CC=C(C#N)C(S(=O)(=O)OC=2C=C(OCCCO)C=C(C)C=2)=C1 FUXXPRJXHYLUCL-UHFFFAOYSA-N 0.000 description 2
- CCLFENFVBPPMFR-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 2-cyanobenzenesulfonate Chemical compound CC1=CC(OCCCO)=CC(OS(=O)(=O)C=2C(=CC=CC=2)C#N)=C1 CCLFENFVBPPMFR-UHFFFAOYSA-N 0.000 description 2
- MJLVLFIINGQDOU-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 2-methoxy-5-methylbenzenesulfonate Chemical compound COC1=CC=C(C)C=C1S(=O)(=O)OC1=CC(C)=CC(OCCCO)=C1 MJLVLFIINGQDOU-UHFFFAOYSA-N 0.000 description 2
- QAWYVGJELIINGP-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 2-methoxybenzenesulfonate Chemical compound COC1=CC=CC=C1S(=O)(=O)OC1=CC(C)=CC(OCCCO)=C1 QAWYVGJELIINGP-UHFFFAOYSA-N 0.000 description 2
- FBHYPOWRJILULB-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 2-methyl-5-nitrobenzenesulfonate Chemical compound CC1=CC(OCCCO)=CC(OS(=O)(=O)C=2C(=CC=C(C=2)[N+]([O-])=O)C)=C1 FBHYPOWRJILULB-UHFFFAOYSA-N 0.000 description 2
- KNWHHJFNJFNZMO-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 3-bromobenzenesulfonate Chemical compound CC1=CC(OCCCO)=CC(OS(=O)(=O)C=2C=C(Br)C=CC=2)=C1 KNWHHJFNJFNZMO-UHFFFAOYSA-N 0.000 description 2
- DPZWKBZUSRYMDS-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 3-chlorobenzenesulfonate Chemical compound CC1=CC(OCCCO)=CC(OS(=O)(=O)C=2C=C(Cl)C=CC=2)=C1 DPZWKBZUSRYMDS-UHFFFAOYSA-N 0.000 description 2
- KYNMSUOBZLIHGN-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 3-cyanobenzenesulfonate Chemical compound CC1=CC(OCCCO)=CC(OS(=O)(=O)C=2C=C(C=CC=2)C#N)=C1 KYNMSUOBZLIHGN-UHFFFAOYSA-N 0.000 description 2
- GRKOGNDVQLUBCC-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 3-fluorobenzenesulfonate Chemical compound CC1=CC(OCCCO)=CC(OS(=O)(=O)C=2C=C(F)C=CC=2)=C1 GRKOGNDVQLUBCC-UHFFFAOYSA-N 0.000 description 2
- IMKQHKPFUPQZGB-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 3-methylbenzenesulfonate Chemical compound CC1=CC=CC(S(=O)(=O)OC=2C=C(OCCCO)C=C(C)C=2)=C1 IMKQHKPFUPQZGB-UHFFFAOYSA-N 0.000 description 2
- IYSMHMBMXOAFKG-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 5-bromo-2-methoxybenzenesulfonate Chemical compound COC1=CC=C(Br)C=C1S(=O)(=O)OC1=CC(C)=CC(OCCCO)=C1 IYSMHMBMXOAFKG-UHFFFAOYSA-N 0.000 description 2
- LRHSEAUHORGBSA-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 5-chloro-1,3-dimethylpyrazole-4-sulfonate Chemical compound CC1=NN(C)C(Cl)=C1S(=O)(=O)OC1=CC(C)=CC(OCCCO)=C1 LRHSEAUHORGBSA-UHFFFAOYSA-N 0.000 description 2
- OGSFTVYKYGBKOM-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 5-chloro-2-methoxybenzenesulfonate Chemical compound COC1=CC=C(Cl)C=C1S(=O)(=O)OC1=CC(C)=CC(OCCCO)=C1 OGSFTVYKYGBKOM-UHFFFAOYSA-N 0.000 description 2
- FPJSSFXXXIBDJA-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 5-fluoro-2-methylbenzenesulfonate Chemical compound CC1=CC(OCCCO)=CC(OS(=O)(=O)C=2C(=CC=C(F)C=2)C)=C1 FPJSSFXXXIBDJA-UHFFFAOYSA-N 0.000 description 2
- IYNMAFYZYHQRJJ-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] isoquinoline-5-sulfonate Chemical compound CC1=CC(OCCCO)=CC(OS(=O)(=O)C=2C3=CC=NC=C3C=CC=2)=C1 IYNMAFYZYHQRJJ-UHFFFAOYSA-N 0.000 description 2
- RQMQHNNPGOKINL-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] naphthalene-1-sulfonate Chemical compound CC1=CC(OCCCO)=CC(OS(=O)(=O)C=2C3=CC=CC=C3C=CC=2)=C1 RQMQHNNPGOKINL-UHFFFAOYSA-N 0.000 description 2
- OMCNKBUIDYPOSU-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] pyridine-3-sulfonate Chemical compound CC1=CC(OCCCO)=CC(OS(=O)(=O)C=2C=NC=CC=2)=C1 OMCNKBUIDYPOSU-UHFFFAOYSA-N 0.000 description 2
- TZLGEIGWYSFXFN-UHFFFAOYSA-N [3-(4-hydroxybutoxy)-5-methylphenyl] 2-methoxybenzenesulfonate Chemical compound COC1=CC=CC=C1S(=O)(=O)OC1=CC(C)=CC(OCCCCO)=C1 TZLGEIGWYSFXFN-UHFFFAOYSA-N 0.000 description 2
- LATXAIGZLOCYQO-UHFFFAOYSA-N [3-[3-(1,3-dioxan-2-yl)propyl]-5-methoxyphenyl] 2-chlorobenzenesulfonate Chemical compound C=1C(OS(=O)(=O)C=2C(=CC=CC=2)Cl)=CC(OC)=CC=1CCCC1OCCCO1 LATXAIGZLOCYQO-UHFFFAOYSA-N 0.000 description 2
- GZDDUBINVITATB-UHFFFAOYSA-N [3-methoxy-5-(4-oxobutyl)phenyl] 2-chlorobenzenesulfonate Chemical compound COC1=CC(CCCC=O)=CC(OS(=O)(=O)C=2C(=CC=CC=2)Cl)=C1 GZDDUBINVITATB-UHFFFAOYSA-N 0.000 description 2
- JCLNPKOSYFQDEK-UHFFFAOYSA-N [3-methyl-5-(2-oxoethoxy)phenyl] 2-methoxybenzenesulfonate Chemical compound COC1=CC=CC=C1S(=O)(=O)OC1=CC(C)=CC(OCC=O)=C1 JCLNPKOSYFQDEK-UHFFFAOYSA-N 0.000 description 2
- NYIJOFBMJBHUAB-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] 2,1,3-benzothiadiazole-4-sulfonate Chemical compound CC1=CC(OCCC=O)=CC(OS(=O)(=O)C=2C3=NSN=C3C=CC=2)=C1 NYIJOFBMJBHUAB-UHFFFAOYSA-N 0.000 description 2
- NFGBMJWYMCZVBU-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] 2,3-dichlorobenzenesulfonate Chemical compound CC1=CC(OCCC=O)=CC(OS(=O)(=O)C=2C(=C(Cl)C=CC=2)Cl)=C1 NFGBMJWYMCZVBU-UHFFFAOYSA-N 0.000 description 2
- KIFBBBUYPTWDEG-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] 2,5-dichlorobenzenesulfonate Chemical compound CC1=CC(OCCC=O)=CC(OS(=O)(=O)C=2C(=CC=C(Cl)C=2)Cl)=C1 KIFBBBUYPTWDEG-UHFFFAOYSA-N 0.000 description 2
- QFPSJWQETMZXMI-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] 2,5-dimethoxybenzenesulfonate Chemical compound COC1=CC=C(OC)C(S(=O)(=O)OC=2C=C(OCCC=O)C=C(C)C=2)=C1 QFPSJWQETMZXMI-UHFFFAOYSA-N 0.000 description 2
- RRIGMHPBBUMFCE-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] 2,5-dimethylbenzenesulfonate Chemical compound CC1=CC=C(C)C(S(=O)(=O)OC=2C=C(OCCC=O)C=C(C)C=2)=C1 RRIGMHPBBUMFCE-UHFFFAOYSA-N 0.000 description 2
- XJBFFCHXLDLWBZ-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] 2-(trifluoromethoxy)benzenesulfonate Chemical compound CC1=CC(OCCC=O)=CC(OS(=O)(=O)C=2C(=CC=CC=2)OC(F)(F)F)=C1 XJBFFCHXLDLWBZ-UHFFFAOYSA-N 0.000 description 2
- ACLFBRPPRFUPIK-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] 2-chloro-5-(trifluoromethyl)benzenesulfonate Chemical compound CC1=CC(OCCC=O)=CC(OS(=O)(=O)C=2C(=CC=C(C=2)C(F)(F)F)Cl)=C1 ACLFBRPPRFUPIK-UHFFFAOYSA-N 0.000 description 2
- INMBOTWFMSFEQY-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] 2-chlorobenzenesulfonate Chemical compound CC1=CC(OCCC=O)=CC(OS(=O)(=O)C=2C(=CC=CC=2)Cl)=C1 INMBOTWFMSFEQY-UHFFFAOYSA-N 0.000 description 2
- FBHQQGNMHVHZLC-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] 2-cyano-5-methylbenzenesulfonate Chemical compound CC1=CC=C(C#N)C(S(=O)(=O)OC=2C=C(OCCC=O)C=C(C)C=2)=C1 FBHQQGNMHVHZLC-UHFFFAOYSA-N 0.000 description 2
- VGGOTNXSGXTEGB-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] 2-methoxy-5-methylbenzenesulfonate Chemical compound COC1=CC=C(C)C=C1S(=O)(=O)OC1=CC(C)=CC(OCCC=O)=C1 VGGOTNXSGXTEGB-UHFFFAOYSA-N 0.000 description 2
- WQVFIHUXTQQWEE-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] 2-methoxybenzenesulfonate Chemical compound COC1=CC=CC=C1S(=O)(=O)OC1=CC(C)=CC(OCCC=O)=C1 WQVFIHUXTQQWEE-UHFFFAOYSA-N 0.000 description 2
- VKJFWADUDFARGG-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] 2-methyl-5-nitrobenzenesulfonate Chemical compound CC1=CC(OCCC=O)=CC(OS(=O)(=O)C=2C(=CC=C(C=2)[N+]([O-])=O)C)=C1 VKJFWADUDFARGG-UHFFFAOYSA-N 0.000 description 2
- IWCZZQOBQSVJJP-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] 3-bromobenzenesulfonate Chemical compound CC1=CC(OCCC=O)=CC(OS(=O)(=O)C=2C=C(Br)C=CC=2)=C1 IWCZZQOBQSVJJP-UHFFFAOYSA-N 0.000 description 2
- CNDSETYJTWWQEU-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] 3-chlorobenzenesulfonate Chemical compound CC1=CC(OCCC=O)=CC(OS(=O)(=O)C=2C=C(Cl)C=CC=2)=C1 CNDSETYJTWWQEU-UHFFFAOYSA-N 0.000 description 2
- HXRFAMHYDRPYAJ-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] 3-fluorobenzenesulfonate Chemical compound CC1=CC(OCCC=O)=CC(OS(=O)(=O)C=2C=C(F)C=CC=2)=C1 HXRFAMHYDRPYAJ-UHFFFAOYSA-N 0.000 description 2
- AITZFBNDLHXXAA-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] 5-bromo-2-methoxybenzenesulfonate Chemical compound COC1=CC=C(Br)C=C1S(=O)(=O)OC1=CC(C)=CC(OCCC=O)=C1 AITZFBNDLHXXAA-UHFFFAOYSA-N 0.000 description 2
- RANYILICLAWGBU-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] 5-fluoro-2-methylbenzenesulfonate Chemical compound CC1=CC(OCCC=O)=CC(OS(=O)(=O)C=2C(=CC=C(F)C=2)C)=C1 RANYILICLAWGBU-UHFFFAOYSA-N 0.000 description 2
- IKGIMIJMZDYXKB-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] isoquinoline-5-sulfonate Chemical compound CC1=CC(OCCC=O)=CC(OS(=O)(=O)C=2C3=CC=NC=C3C=CC=2)=C1 IKGIMIJMZDYXKB-UHFFFAOYSA-N 0.000 description 2
- VBTFSXUSIGSGSQ-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] naphthalene-1-sulfonate Chemical compound CC1=CC(OCCC=O)=CC(OS(=O)(=O)C=2C3=CC=CC=C3C=CC=2)=C1 VBTFSXUSIGSGSQ-UHFFFAOYSA-N 0.000 description 2
- ZNPZKTYCAQXRCM-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] pyridine-3-sulfonate Chemical compound CC1=CC(OCCC=O)=CC(OS(=O)(=O)C=2C=NC=CC=2)=C1 ZNPZKTYCAQXRCM-UHFFFAOYSA-N 0.000 description 2
- SISFCZIMMRRGRS-UHFFFAOYSA-N [3-methyl-5-(4-oxobutoxy)phenyl] 2-methoxybenzenesulfonate Chemical compound COC1=CC=CC=C1S(=O)(=O)OC1=CC(C)=CC(OCCCC=O)=C1 SISFCZIMMRRGRS-UHFFFAOYSA-N 0.000 description 2
- 230000001594 aberrant effect Effects 0.000 description 2
- 159000000021 acetate salts Chemical class 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 102000015395 alpha 1-Antitrypsin Human genes 0.000 description 2
- 108010050122 alpha 1-Antitrypsin Proteins 0.000 description 2
- 229940024142 alpha 1-antitrypsin Drugs 0.000 description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 230000003110 anti-inflammatory effect Effects 0.000 description 2
- 230000002785 anti-thrombosis Effects 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000002051 biphasic effect Effects 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 150000001720 carbohydrates Chemical class 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 230000010261 cell growth Effects 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000013375 chromatographic separation Methods 0.000 description 2
- 230000037012 chymotrypsin-like activity Effects 0.000 description 2
- 230000035602 clotting Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 229940097362 cyclodextrins Drugs 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- GUDMZGLFZNLYEY-UHFFFAOYSA-N cyclopropylmethanol Chemical compound OCC1CC1 GUDMZGLFZNLYEY-UHFFFAOYSA-N 0.000 description 2
- SPWVRYZQLGQKGK-UHFFFAOYSA-N dichloromethane;hexane Chemical compound ClCCl.CCCCCC SPWVRYZQLGQKGK-UHFFFAOYSA-N 0.000 description 2
- FDSGHYHRLSWSLQ-UHFFFAOYSA-N dichloromethane;propan-2-one Chemical compound ClCCl.CC(C)=O FDSGHYHRLSWSLQ-UHFFFAOYSA-N 0.000 description 2
- 108091007734 digestive enzymes Proteins 0.000 description 2
- 102000038379 digestive enzymes Human genes 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- GUVUOGQBMYCBQP-UHFFFAOYSA-N dmpu Chemical compound CN1CCCN(C)C1=O GUVUOGQBMYCBQP-UHFFFAOYSA-N 0.000 description 2
- 210000002889 endothelial cell Anatomy 0.000 description 2
- 239000002532 enzyme inhibitor Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- YYMBZPIXOUABES-UHFFFAOYSA-N ethyl 6-(3-methyl-5-phenylmethoxy-n-[2-(trifluoromethyl)phenyl]sulfonylanilino)hexanoate Chemical compound C=1C=CC=C(C(F)(F)F)C=1S(=O)(=O)N(CCCCCC(=O)OCC)C(C=1)=CC(C)=CC=1OCC1=CC=CC=C1 YYMBZPIXOUABES-UHFFFAOYSA-N 0.000 description 2
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 2
- 239000010685 fatty oil Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 230000006870 function Effects 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 210000000224 granular leucocyte Anatomy 0.000 description 2
- 230000036571 hydration Effects 0.000 description 2
- 238000006703 hydration reaction Methods 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical compound C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 208000014674 injury Diseases 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- WHIDHHUCCTYJKA-UHFFFAOYSA-N isoquinoline-5-sulfonyl chloride Chemical compound N1=CC=C2C(S(=O)(=O)Cl)=CC=CC2=C1 WHIDHHUCCTYJKA-UHFFFAOYSA-N 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 208000010125 myocardial infarction Diseases 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 230000037361 pathway Effects 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- 238000011321 prophylaxis Methods 0.000 description 2
- 108010014806 prothrombinase complex Proteins 0.000 description 2
- LEHBURLTIWGHEM-UHFFFAOYSA-N pyridinium chlorochromate Chemical compound [O-][Cr](Cl)(=O)=O.C1=CC=[NH+]C=C1 LEHBURLTIWGHEM-UHFFFAOYSA-N 0.000 description 2
- 125000000168 pyrrolyl group Chemical group 0.000 description 2
- 239000002464 receptor antagonist Substances 0.000 description 2
- 229940044551 receptor antagonist Drugs 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 210000000329 smooth muscle myocyte Anatomy 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 2
- 125000003396 thiol group Chemical class [H]S* 0.000 description 2
- 239000003868 thrombin inhibitor Substances 0.000 description 2
- 239000003768 thromboxane synthase inhibitor Substances 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical class [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- FIQMHBFVRAXMOP-UHFFFAOYSA-N triphenylphosphane oxide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)C1=CC=CC=C1 FIQMHBFVRAXMOP-UHFFFAOYSA-N 0.000 description 2
- XGEAUXVPBXUBKN-UHFFFAOYSA-N (+)-Atherospermoline Natural products O1C(C=C2)=CC=C2CC(C2=C3)N(C)CCC2=CC(OC)=C3OC(C=23)=C(O)C(OC)=CC=2CCN(C)C3CC2=CC=C(O)C1=C2 XGEAUXVPBXUBKN-UHFFFAOYSA-N 0.000 description 1
- MTCFGRXMJLQNBG-REOHCLBHSA-N (2S)-2-Amino-3-hydroxypropansäure Chemical compound OC[C@H](N)C(O)=O MTCFGRXMJLQNBG-REOHCLBHSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- YDSGILDPWJLZSG-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 2-(trifluoromethyl)benzenesulfonate Chemical compound CC1=CC(O)=CC(OS(=O)(=O)C=2C(=CC=CC=2)C(F)(F)F)=C1 YDSGILDPWJLZSG-UHFFFAOYSA-N 0.000 description 1
- IYGMCDMURWZLNR-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 2-chlorobenzenesulfonate Chemical compound CC1=CC(O)=CC(OS(=O)(=O)C=2C(=CC=CC=2)Cl)=C1 IYGMCDMURWZLNR-UHFFFAOYSA-N 0.000 description 1
- MGXZSAIYEGFAGF-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 3-(trifluoromethyl)benzenesulfonate Chemical compound CC1=CC(O)=CC(OS(=O)(=O)C=2C=C(C=CC=2)C(F)(F)F)=C1 MGXZSAIYEGFAGF-UHFFFAOYSA-N 0.000 description 1
- XLKNHHCGRNHGNQ-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) pyridine-3-sulfonate Chemical compound CC1=CC(O)=CC(OS(=O)(=O)C=2C=NC=CC=2)=C1 XLKNHHCGRNHGNQ-UHFFFAOYSA-N 0.000 description 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- OQJBFFCUFALWQL-BUHFOSPRSA-N (ne)-n-(piperidine-1-carbonylimino)piperidine-1-carboxamide Chemical compound C1CCCCN1C(=O)\N=N\C(=O)N1CCCCC1 OQJBFFCUFALWQL-BUHFOSPRSA-N 0.000 description 1
- HAZRIBSLCUYMQP-UHFFFAOYSA-N 1,2-diaminoguanidine;hydron;chloride Chemical compound Cl.NN\C(N)=N/N HAZRIBSLCUYMQP-UHFFFAOYSA-N 0.000 description 1
- VDFVNEFVBPFDSB-UHFFFAOYSA-N 1,3-dioxane Chemical compound C1COCOC1 VDFVNEFVBPFDSB-UHFFFAOYSA-N 0.000 description 1
- GCYHIJSKROXMKP-CMXBXVFLSA-N 1,3-dioxane;(2r,3s)-3-heptyl-2-octyloxane Chemical compound C1COCOC1.CCCCCCCC[C@H]1OCCC[C@@H]1CCCCCCC GCYHIJSKROXMKP-CMXBXVFLSA-N 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- BBXDMCQDLOCXRA-UHFFFAOYSA-N 1-(chloromethyl)-2-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC=C1CCl BBXDMCQDLOCXRA-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- JWDWROXBPTWEJO-UHFFFAOYSA-N 1-phenylmethoxypropan-1-ol Chemical compound CCC(O)OCC1=CC=CC=C1 JWDWROXBPTWEJO-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- SVUOLADPCWQTTE-UHFFFAOYSA-N 1h-1,2-benzodiazepine Chemical compound N1N=CC=CC2=CC=CC=C12 SVUOLADPCWQTTE-UHFFFAOYSA-N 0.000 description 1
- CXAICGCTHOWKPP-UHFFFAOYSA-N 2,1,3-benzothiadiazole-4-sulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC2=NSN=C12 CXAICGCTHOWKPP-UHFFFAOYSA-N 0.000 description 1
- PQODWTNHDKDHIW-UHFFFAOYSA-N 2,3-dichlorobenzenesulfonyl chloride Chemical compound ClC1=CC=CC(S(Cl)(=O)=O)=C1Cl PQODWTNHDKDHIW-UHFFFAOYSA-N 0.000 description 1
- HMBHAQMOBKLWRX-UHFFFAOYSA-N 2,3-dihydro-1,4-benzodioxine-3-carboxylic acid Chemical compound C1=CC=C2OC(C(=O)O)COC2=C1 HMBHAQMOBKLWRX-UHFFFAOYSA-N 0.000 description 1
- BXCOSWRSIISQSL-UHFFFAOYSA-N 2,5-dichlorobenzenesulfonyl chloride Chemical compound ClC1=CC=C(Cl)C(S(Cl)(=O)=O)=C1 BXCOSWRSIISQSL-UHFFFAOYSA-N 0.000 description 1
- SHELADVIRCCTFN-UHFFFAOYSA-N 2,5-dimethoxybenzenesulfonyl chloride Chemical compound COC1=CC=C(OC)C(S(Cl)(=O)=O)=C1 SHELADVIRCCTFN-UHFFFAOYSA-N 0.000 description 1
- FZVZUIBYLZZOEW-UHFFFAOYSA-N 2,5-dimethylbenzenesulfonyl chloride Chemical compound CC1=CC=C(C)C(S(Cl)(=O)=O)=C1 FZVZUIBYLZZOEW-UHFFFAOYSA-N 0.000 description 1
- WMDHQEHPOVOEOG-UHFFFAOYSA-N 2-(2-bromoethyl)-1,3-dioxane Chemical compound BrCCC1OCCCO1 WMDHQEHPOVOEOG-UHFFFAOYSA-N 0.000 description 1
- JLTBWYIUMFEOTN-UHFFFAOYSA-N 2-(trifluoromethoxy)benzenesulfonyl chloride Chemical compound FC(F)(F)OC1=CC=CC=C1S(Cl)(=O)=O JLTBWYIUMFEOTN-UHFFFAOYSA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- YOCIJWAHRAJQFT-UHFFFAOYSA-N 2-bromo-2-methylpropanoyl bromide Chemical compound CC(C)(Br)C(Br)=O YOCIJWAHRAJQFT-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- ZEYKLMDPUOVUCR-UHFFFAOYSA-N 2-chloro-5-(trifluoromethyl)benzenesulfonyl chloride Chemical compound FC(F)(F)C1=CC=C(Cl)C(S(Cl)(=O)=O)=C1 ZEYKLMDPUOVUCR-UHFFFAOYSA-N 0.000 description 1
- NQAYCMBZPAARNO-UHFFFAOYSA-N 2-cyanobenzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1C#N NQAYCMBZPAARNO-UHFFFAOYSA-N 0.000 description 1
- ODZTXUXIYGJLMC-UHFFFAOYSA-N 2-hydroxycyclohexan-1-one Chemical compound OC1CCCCC1=O ODZTXUXIYGJLMC-UHFFFAOYSA-N 0.000 description 1
- LUTDLYPHDVQSHT-UHFFFAOYSA-N 2-hydroxycyclopentan-1-one Chemical compound OC1CCCC1=O LUTDLYPHDVQSHT-UHFFFAOYSA-N 0.000 description 1
- HZLCGUXUOFWCCN-UHFFFAOYSA-N 2-hydroxynonadecane-1,2,3-tricarboxylic acid Chemical compound CCCCCCCCCCCCCCCCC(C(O)=O)C(O)(C(O)=O)CC(O)=O HZLCGUXUOFWCCN-UHFFFAOYSA-N 0.000 description 1
- PBOWEPIARFALSS-UHFFFAOYSA-N 2-methoxy-3-methylbenzenesulfonyl chloride Chemical compound COC1=C(C)C=CC=C1S(Cl)(=O)=O PBOWEPIARFALSS-UHFFFAOYSA-N 0.000 description 1
- 125000006020 2-methyl-1-propenyl group Chemical group 0.000 description 1
- WPGVQDHXOUAJBW-UHFFFAOYSA-N 2-methyl-5-nitrobenzenesulfonyl chloride Chemical compound CC1=CC=C([N+]([O-])=O)C=C1S(Cl)(=O)=O WPGVQDHXOUAJBW-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- HAQLHRYUDBKTJG-UHFFFAOYSA-N 3,5-dihydroxybenzaldehyde Chemical compound OC1=CC(O)=CC(C=O)=C1 HAQLHRYUDBKTJG-UHFFFAOYSA-N 0.000 description 1
- DBHRDAVPINPZSE-UHFFFAOYSA-N 3,6-dichloro-3-methylcyclohexa-1,5-dien-1-ol Chemical compound ClC1(CC=C(C(=C1)O)Cl)C DBHRDAVPINPZSE-UHFFFAOYSA-N 0.000 description 1
- PJGOLCXVWIYXRQ-UHFFFAOYSA-N 3-bromobenzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC(Br)=C1 PJGOLCXVWIYXRQ-UHFFFAOYSA-N 0.000 description 1
- OINWZUJVEXUHCC-UHFFFAOYSA-N 3-chlorobenzenesulfonyl chloride Chemical compound ClC1=CC=CC(S(Cl)(=O)=O)=C1 OINWZUJVEXUHCC-UHFFFAOYSA-N 0.000 description 1
- BHNRGBRMCNHNQD-UHFFFAOYSA-N 3-cyanobenzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC(C#N)=C1 BHNRGBRMCNHNQD-UHFFFAOYSA-N 0.000 description 1
- OKYSUJVCDXZGKE-UHFFFAOYSA-N 3-fluorobenzenesulfonyl chloride Chemical compound FC1=CC=CC(S(Cl)(=O)=O)=C1 OKYSUJVCDXZGKE-UHFFFAOYSA-N 0.000 description 1
- TWEVQGUWCLBRMJ-UHFFFAOYSA-N 3-hydroxycyclohexanone Chemical compound OC1CCCC(=O)C1 TWEVQGUWCLBRMJ-UHFFFAOYSA-N 0.000 description 1
- AGUBQTXICDWDOC-UHFFFAOYSA-N 3-methyl-5-phenylmethoxyaniline Chemical compound CC1=CC(N)=CC(OCC=2C=CC=CC=2)=C1 AGUBQTXICDWDOC-UHFFFAOYSA-N 0.000 description 1
- KFPMLWUKHQMEBU-UHFFFAOYSA-N 3-methylbenzenesulfonyl chloride Chemical compound CC1=CC=CC(S(Cl)(=O)=O)=C1 KFPMLWUKHQMEBU-UHFFFAOYSA-N 0.000 description 1
- SQGBBDFDRHDJCJ-UHFFFAOYSA-N 3-phenylbutan-1-ol Chemical compound OCCC(C)C1=CC=CC=C1 SQGBBDFDRHDJCJ-UHFFFAOYSA-N 0.000 description 1
- UVKUOMXDACMPJR-UHFFFAOYSA-N 4-(3-ethoxy-4-pentoxyphenyl)-1,3-thiazolidin-5-one Chemical class C1=C(OCC)C(OCCCCC)=CC=C1C1C(=O)SCN1 UVKUOMXDACMPJR-UHFFFAOYSA-N 0.000 description 1
- LACFLXDRFOQEFZ-UHFFFAOYSA-N 4-ethylbenzenesulfonyl chloride Chemical compound CCC1=CC=C(S(Cl)(=O)=O)C=C1 LACFLXDRFOQEFZ-UHFFFAOYSA-N 0.000 description 1
- QGBSLPHQCUIZKK-UHFFFAOYSA-N 4-methyl-2-nitrobenzonitrile Chemical compound CC1=CC=C(C#N)C([N+]([O-])=O)=C1 QGBSLPHQCUIZKK-UHFFFAOYSA-N 0.000 description 1
- LDZLXQFDGRCELX-UHFFFAOYSA-N 4-phenylbutan-1-ol Chemical compound OCCCCC1=CC=CC=C1 LDZLXQFDGRCELX-UHFFFAOYSA-N 0.000 description 1
- 125000002471 4H-quinolizinyl group Chemical group C=1(C=CCN2C=CC=CC12)* 0.000 description 1
- IXSBNNRUQYYMRM-UHFFFAOYSA-N 5-bromo-2-methoxybenzenesulfonyl chloride Chemical compound COC1=CC=C(Br)C=C1S(Cl)(=O)=O IXSBNNRUQYYMRM-UHFFFAOYSA-N 0.000 description 1
- HWGVUNSKAPCFNF-UHFFFAOYSA-N 5-chloro-1,3-dimethylpyrazole-4-sulfonyl chloride Chemical compound CC1=NN(C)C(Cl)=C1S(Cl)(=O)=O HWGVUNSKAPCFNF-UHFFFAOYSA-N 0.000 description 1
- SORSTNOXGOXWAO-UHFFFAOYSA-N 5-chlorothiophene-2-sulfonyl chloride Chemical compound ClC1=CC=C(S(Cl)(=O)=O)S1 SORSTNOXGOXWAO-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 108090000107 Acrosin Proteins 0.000 description 1
- 102100026041 Acrosin Human genes 0.000 description 1
- 206010001052 Acute respiratory distress syndrome Diseases 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 206010002388 Angina unstable Diseases 0.000 description 1
- 102000001381 Arachidonate 5-Lipoxygenase Human genes 0.000 description 1
- 108010093579 Arachidonate 5-lipoxygenase Proteins 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 206010003178 Arterial thrombosis Diseases 0.000 description 1
- 102000004580 Aspartic Acid Proteases Human genes 0.000 description 1
- 108010017640 Aspartic Acid Proteases Proteins 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 201000001320 Atherosclerosis Diseases 0.000 description 1
- 239000007989 BIS-Tris Propane buffer Substances 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- FGUUSXIOTUKUDN-IBGZPJMESA-N C1(=CC=CC=C1)N1C2=C(NC([C@H](C1)NC=1OC(=NN=1)C1=CC=CC=C1)=O)C=CC=C2 Chemical compound C1(=CC=CC=C1)N1C2=C(NC([C@H](C1)NC=1OC(=NN=1)C1=CC=CC=C1)=O)C=CC=C2 FGUUSXIOTUKUDN-IBGZPJMESA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 208000024172 Cardiovascular disease Diseases 0.000 description 1
- 108090000227 Chymases Proteins 0.000 description 1
- 102000003858 Chymases Human genes 0.000 description 1
- 229910020366 ClO 4 Inorganic materials 0.000 description 1
- 206010009900 Colitis ulcerative Diseases 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- 206010051055 Deep vein thrombosis Diseases 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 229940123900 Direct thrombin inhibitor Drugs 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 201000010374 Down Syndrome Diseases 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- 206010014824 Endotoxic shock Diseases 0.000 description 1
- 108010074105 Factor Va Proteins 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 208000018522 Gastrointestinal disease Diseases 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101000933179 Homo sapiens Cathepsin G Proteins 0.000 description 1
- 101000851058 Homo sapiens Neutrophil elastase Proteins 0.000 description 1
- WRYCSMQKUKOKBP-UHFFFAOYSA-N Imidazolidine Chemical compound C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- 208000019693 Lung disease Diseases 0.000 description 1
- 208000032376 Lung infection Diseases 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- OCGNXVJEQPQYHS-UHFFFAOYSA-N N-cyano-1-nitroformamide Chemical compound [O-][N+](=O)C(=O)NC#N OCGNXVJEQPQYHS-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 208000016222 Pancreatic disease Diseases 0.000 description 1
- 208000018737 Parkinson disease Diseases 0.000 description 1
- 102000057297 Pepsin A Human genes 0.000 description 1
- 108090000284 Pepsin A Proteins 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 102100027378 Prothrombin Human genes 0.000 description 1
- 108010094028 Prothrombin Proteins 0.000 description 1
- 206010063837 Reperfusion injury Diseases 0.000 description 1
- 208000013616 Respiratory Distress Syndrome Diseases 0.000 description 1
- 108010000303 Secretory Proteinase Inhibitory Proteins Proteins 0.000 description 1
- 102000002255 Secretory Proteinase Inhibitory Proteins Human genes 0.000 description 1
- 206010040047 Sepsis Diseases 0.000 description 1
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 108010023197 Streptokinase Proteins 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- 238000006859 Swern oxidation reaction Methods 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 108090001109 Thermolysin Proteins 0.000 description 1
- 101710097834 Thiol protease Proteins 0.000 description 1
- 102000003790 Thrombin receptors Human genes 0.000 description 1
- 108090000166 Thrombin receptors Proteins 0.000 description 1
- 108010000499 Thromboplastin Proteins 0.000 description 1
- 102000002262 Thromboplastin Human genes 0.000 description 1
- 102000003938 Thromboxane Receptors Human genes 0.000 description 1
- 108090000300 Thromboxane Receptors Proteins 0.000 description 1
- 229940122202 Thromboxane receptor antagonist Drugs 0.000 description 1
- 108090000373 Tissue Plasminogen Activator Proteins 0.000 description 1
- 102000003978 Tissue Plasminogen Activator Human genes 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 201000006704 Ulcerative Colitis Diseases 0.000 description 1
- 208000007814 Unstable Angina Diseases 0.000 description 1
- 208000036142 Viral infection Diseases 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 description 1
- YAINYZJQSQEGND-UHFFFAOYSA-N [1-(hydroxymethyl)cyclopropyl]methanol Chemical compound OCC1(CO)CC1 YAINYZJQSQEGND-UHFFFAOYSA-N 0.000 description 1
- WSQIBSBRDFKBGR-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 2-(trifluoromethyl)benzenesulfonate Chemical compound CC1=CC(OCCCO)=CC(OS(=O)(=O)C=2C(=CC=CC=2)C(F)(F)F)=C1 WSQIBSBRDFKBGR-UHFFFAOYSA-N 0.000 description 1
- QOIOPIWRNHFHQP-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] 2-(trifluoromethyl)benzenesulfonate Chemical compound CC1=CC(OCCC=O)=CC(OS(=O)(=O)C=2C(=CC=CC=2)C(F)(F)F)=C1 QOIOPIWRNHFHQP-UHFFFAOYSA-N 0.000 description 1
- WWFGGFXCJFQYGY-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] 2-cyanobenzenesulfonate Chemical compound CC1=CC(OCCC=O)=CC(OS(=O)(=O)C=2C(=CC=CC=2)C#N)=C1 WWFGGFXCJFQYGY-UHFFFAOYSA-N 0.000 description 1
- RUYYTRQIMXAORP-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] 3-methylbenzenesulfonate Chemical compound CC1=CC=CC(S(=O)(=O)OC=2C=C(OCCC=O)C=C(C)C=2)=C1 RUYYTRQIMXAORP-UHFFFAOYSA-N 0.000 description 1
- AWONEOLKDMODCK-UHFFFAOYSA-N [3-methyl-5-(3-oxopropoxy)phenyl] 5-chloro-1,3-dimethylpyrazole-4-sulfonate Chemical compound CC1=NN(C)C(Cl)=C1S(=O)(=O)OC1=CC(C)=CC(OCCC=O)=C1 AWONEOLKDMODCK-UHFFFAOYSA-N 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 239000004015 abortifacient agent Substances 0.000 description 1
- 231100000641 abortifacient agent Toxicity 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- RRUDCFGSUDOHDG-UHFFFAOYSA-N acetohydroxamic acid Chemical class CC(O)=NO RRUDCFGSUDOHDG-UHFFFAOYSA-N 0.000 description 1
- 229940081735 acetylcellulose Drugs 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 229940040563 agaric acid Drugs 0.000 description 1
- 125000006241 alcohol protecting group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000003172 aldehyde group Chemical group 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000005079 alkoxycarbonylmethyl group Chemical group 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 208000006682 alpha 1-Antitrypsin Deficiency Diseases 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 238000002399 angioplasty Methods 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 230000002744 anti-aggregatory effect Effects 0.000 description 1
- 230000002927 anti-mitotic effect Effects 0.000 description 1
- 229940127219 anticoagulant drug Drugs 0.000 description 1
- 239000003472 antidiabetic agent Substances 0.000 description 1
- 229940125708 antidiabetic agent Drugs 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000005604 azodicarboxylate group Chemical group 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 229940049706 benzodiazepine Drugs 0.000 description 1
- 125000005874 benzothiadiazolyl group Chemical group 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000008827 biological function Effects 0.000 description 1
- HHKZCCWKTZRCCL-UHFFFAOYSA-N bis-tris propane Chemical compound OCC(CO)(CO)NCCCNC(CO)(CO)CO HHKZCCWKTZRCCL-UHFFFAOYSA-N 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 208000015294 blood coagulation disease Diseases 0.000 description 1
- 210000001772 blood platelet Anatomy 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000004799 bromophenyl group Chemical group 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- DLIJPAHLBJIQHE-UHFFFAOYSA-N butylphosphane Chemical compound CCCCP DLIJPAHLBJIQHE-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- FUFJGUQYACFECW-UHFFFAOYSA-L calcium hydrogenphosphate Chemical compound [Ca+2].OP([O-])([O-])=O FUFJGUQYACFECW-UHFFFAOYSA-L 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000002612 cardiopulmonary effect Effects 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 150000005829 chemical entities Chemical class 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 229940075419 choline hydroxide Drugs 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 201000007717 corneal ulcer Diseases 0.000 description 1
- 229940099112 cornstarch Drugs 0.000 description 1
- 238000007887 coronary angioplasty Methods 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 150000003997 cyclic ketones Chemical class 0.000 description 1
- 125000005170 cycloalkyloxycarbonyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000006547 cyclononyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000000151 cysteine group Chemical group N[C@@H](CS)C(=O)* 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 238000000502 dialysis Methods 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 235000019700 dicalcium phosphate Nutrition 0.000 description 1
- 239000002027 dichloromethane extract Substances 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- 229940079919 digestives enzyme preparation Drugs 0.000 description 1
- 125000005805 dimethoxy phenyl group Chemical group 0.000 description 1
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 1
- 208000009190 disseminated intravascular coagulation Diseases 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- DXBULVYHTICWKT-UHFFFAOYSA-N ethyl 6-bromohexanoate Chemical compound CCOC(=O)CCCCCBr DXBULVYHTICWKT-UHFFFAOYSA-N 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- YBURKGRQNJPCSW-UHFFFAOYSA-N ethyl n-methoxycarbamate Chemical compound CCOC(=O)NOC YBURKGRQNJPCSW-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000006624 extrinsic pathway Effects 0.000 description 1
- 150000002194 fatty esters Chemical class 0.000 description 1
- 230000008713 feedback mechanism Effects 0.000 description 1
- 239000003527 fibrinolytic agent Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 239000008202 granule composition Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 159000000011 group IA salts Chemical class 0.000 description 1
- 208000037824 growth disorder Diseases 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 238000001631 haemodialysis Methods 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 230000000322 hemodialysis Effects 0.000 description 1
- 230000023597 hemostasis Effects 0.000 description 1
- 230000002439 hemostatic effect Effects 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000011540 hip replacement Methods 0.000 description 1
- 102000052896 human CTSG Human genes 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- RCBVKBFIWMOMHF-UHFFFAOYSA-L hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine Chemical compound C1=CC=NC=C1.C1=CC=NC=C1.O[Cr](=O)(=O)O[Cr](O)(=O)=O RCBVKBFIWMOMHF-UHFFFAOYSA-L 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 1
- 229940031704 hydroxypropyl methylcellulose phthalate Drugs 0.000 description 1
- 229920003132 hydroxypropyl methylcellulose phthalate Polymers 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 230000008105 immune reaction Effects 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- 201000004332 intermediate coronary syndrome Diseases 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 230000006623 intrinsic pathway Effects 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000006303 iodophenyl group Chemical group 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- YFMJTLUPSMCTOQ-UHFFFAOYSA-N isoquinoline-5-sulfonic acid Chemical compound N1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 YFMJTLUPSMCTOQ-UHFFFAOYSA-N 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 239000003591 leukocyte elastase inhibitor Substances 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 238000012792 lyophilization process Methods 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 231100001225 mammalian toxicity Toxicity 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 229960002900 methylcellulose Drugs 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- WOBWKHAXTMPONZ-UHFFFAOYSA-N n-(3-methyl-5-phenylmethoxyphenyl)-n-(4-phenylbutyl)-2-(trifluoromethyl)benzenesulfonamide Chemical compound C=1C(N(CCCCC=2C=CC=CC=2)S(=O)(=O)C=2C(=CC=CC=2)C(F)(F)F)=CC(C)=CC=1OCC1=CC=CC=C1 WOBWKHAXTMPONZ-UHFFFAOYSA-N 0.000 description 1
- DASJFYAPNPUBGG-UHFFFAOYSA-N naphthalene-1-sulfonyl chloride Chemical compound C1=CC=C2C(S(=O)(=O)Cl)=CC=CC2=C1 DASJFYAPNPUBGG-UHFFFAOYSA-N 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 230000009826 neoplastic cell growth Effects 0.000 description 1
- 230000004770 neurodegeneration Effects 0.000 description 1
- 208000015122 neurodegenerative disease Diseases 0.000 description 1
- 210000002569 neuron Anatomy 0.000 description 1
- 210000004493 neutrocyte Anatomy 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000002892 organic cations Chemical class 0.000 description 1
- 239000003791 organic solvent mixture Substances 0.000 description 1
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 210000001819 pancreatic juice Anatomy 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000008506 pathogenesis Effects 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 229940111202 pepsin Drugs 0.000 description 1
- 125000005327 perimidinyl group Chemical group N1C(=NC2=CC=CC3=CC=CC1=C23)* 0.000 description 1
- 125000004934 phenanthridinyl group Chemical group C1(=CC=CC2=NC=C3C=CC=CC3=C12)* 0.000 description 1
- 125000004625 phenanthrolinyl group Chemical group N1=C(C=CC2=CC=C3C=CC=NC3=C12)* 0.000 description 1
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000005954 phenoxathiinyl group Chemical group 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- 150000003904 phospholipids Chemical class 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 229940068918 polyethylene glycol 400 Drugs 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 229940116317 potato starch Drugs 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 238000000164 protein isolation Methods 0.000 description 1
- 230000002797 proteolythic effect Effects 0.000 description 1
- 230000006337 proteolytic cleavage Effects 0.000 description 1
- 229940039716 prothrombin Drugs 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 230000002685 pulmonary effect Effects 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- USPWKWBDZOARPV-UHFFFAOYSA-N pyrazolidine Chemical compound C1CNNC1 USPWKWBDZOARPV-UHFFFAOYSA-N 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- VIVPWOMJFLICOZ-UHFFFAOYSA-N pyridine-3-sulfonyl chloride;hydrochloride Chemical compound Cl.ClS(=O)(=O)C1=CC=CN=C1 VIVPWOMJFLICOZ-UHFFFAOYSA-N 0.000 description 1
- DUPBILVWMPJNKH-UHFFFAOYSA-N pyridine;sulfur dioxide Chemical compound O=S=O.C1=CC=NC=C1 DUPBILVWMPJNKH-UHFFFAOYSA-N 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- JUYUYCIJACTHMK-UHFFFAOYSA-N quinoline-8-sulfonyl chloride Chemical compound C1=CN=C2C(S(=O)(=O)Cl)=CC=CC2=C1 JUYUYCIJACTHMK-UHFFFAOYSA-N 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000000306 recurrent effect Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 229940100486 rice starch Drugs 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- HFHDHCJBZVLPGP-UHFFFAOYSA-N schardinger α-dextrin Chemical compound O1C(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(O)C2O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC2C(O)C(O)C1OC2CO HFHDHCJBZVLPGP-UHFFFAOYSA-N 0.000 description 1
- 230000036303 septic shock Effects 0.000 description 1
- 239000003001 serine protease inhibitor Substances 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 229960005202 streptokinase Drugs 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 125000006296 sulfonyl amino group Chemical group [H]N(*)S(*)(=O)=O 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000004627 thianthrenyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3SC12)* 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 229960000103 thrombolytic agent Drugs 0.000 description 1
- 230000002537 thrombolytic effect Effects 0.000 description 1
- 201000005665 thrombophilia Diseases 0.000 description 1
- 239000002396 thromboxane receptor blocking agent Substances 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 229960000187 tissue plasminogen activator Drugs 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 230000008733 trauma Effects 0.000 description 1
- 150000003626 triacylglycerols Chemical class 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 108010036927 trypsin-like serine protease Proteins 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 230000009385 viral infection Effects 0.000 description 1
- 229940100445 wheat starch Drugs 0.000 description 1
- 125000001834 xanthenyl group Chemical group C1=CC=CC=2OC3=CC=CC=C3C(C12)* 0.000 description 1
- 125000004933 β-carbolinyl group Chemical group C1(=NC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/14—Thiadiazoles; Hydrogenated thiadiazoles condensed with carbocyclic rings or ring systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/18—Drugs for disorders of the alimentary tract or the digestive system for pancreatic disorders, e.g. pancreatic enzymes
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C281/00—Derivatives of carbonic acid containing functional groups covered by groups C07C269/00 - C07C279/00 in which at least one nitrogen atom of these functional groups is further bound to another nitrogen atom not being part of a nitro or nitroso group
- C07C281/16—Compounds containing any of the groups, e.g. aminoguanidine
- C07C281/18—Compounds containing any of the groups, e.g. aminoguanidine the other nitrogen atom being further doubly-bound to a carbon atom, e.g. guanylhydrazones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/63—Esters of sulfonic acids
- C07C309/72—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C309/73—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton to carbon atoms of non-condensed six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/63—Esters of sulfonic acids
- C07C309/72—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C309/74—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton to carbon atoms of six-membered aromatic rings being part of condensed ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/63—Esters of sulfonic acids
- C07C309/72—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C309/75—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing singly-bound oxygen atoms bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/63—Esters of sulfonic acids
- C07C309/72—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C309/77—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing carboxyl groups bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
- C07C311/21—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/64—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and sulfur atoms, not being part of thio groups, bound to the same carbon skeleton
- C07C323/66—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and sulfur atoms, not being part of thio groups, bound to the same carbon skeleton containing sulfur atoms of sulfo, esterified sulfo or halosulfonyl groups, bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/27—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation
- C07C45/29—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation of hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/20—Unsaturated compounds having —CHO groups bound to acyclic carbon atoms
- C07C47/277—Unsaturated compounds having —CHO groups bound to acyclic carbon atoms containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/70—Sulfur atoms
- C07D213/71—Sulfur atoms to which a second hetero atom is attached
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/36—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/18—One oxygen or sulfur atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/28—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/44—Nitrogen atoms not forming part of a nitro radical
- C07D233/52—Nitrogen atoms not forming part of a nitro radical with hetero atoms directly attached to said nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/32—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D317/34—Oxygen atoms
- C07D317/40—Vinylene carbonate; Substituted vinylene carbonates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/30—Hetero atoms other than halogen
- C07D333/34—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/02—Systems containing only non-condensed rings with a three-membered ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Hematology (AREA)
- Diabetes (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Detergent Compositions (AREA)
- Plural Heterocyclic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Quinoline Compounds (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US1431796P | 1996-03-29 | 1996-03-29 | |
| US14317P | 1996-03-29 | ||
| PCT/US1997/005274 WO1997036580A1 (en) | 1996-03-29 | 1997-03-27 | Amidinohydrazones as protease inhibitors |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69736777D1 DE69736777D1 (de) | 2006-11-16 |
| DE69736777T2 true DE69736777T2 (de) | 2007-08-23 |
Family
ID=21764747
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69736777T Expired - Fee Related DE69736777T2 (de) | 1996-03-29 | 1997-03-27 | Amidinohydrazone als protease-inhibitoren |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US5891909A (enExample) |
| EP (1) | EP0906091B1 (enExample) |
| JP (1) | JP2000507588A (enExample) |
| AT (1) | ATE341317T1 (enExample) |
| AU (1) | AU722161B2 (enExample) |
| CA (1) | CA2250426C (enExample) |
| DE (1) | DE69736777T2 (enExample) |
| ES (1) | ES2273365T3 (enExample) |
| NZ (1) | NZ332073A (enExample) |
| WO (1) | WO1997036580A1 (enExample) |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TW499412B (en) | 1996-11-26 | 2002-08-21 | Dimensional Pharm Inc | Aminoguanidines and alkoxyguanidines as protease inhibitors |
| CA2311969A1 (en) | 1997-11-26 | 1999-06-03 | 3-Dimensional Pharmaceuticals, Inc. | Heteroaryl aminoguanidines and alkoxyguanidines and their use as protease inhibitors |
| US6344486B1 (en) | 1998-04-03 | 2002-02-05 | 3-Dimensional Pharmaceuticals, Inc. | Benzamide and sulfonamide substituted aminoguanidines and alkoxyguanidines as protease inhibitors |
| CA2329929A1 (en) | 1998-04-24 | 1999-11-04 | 3-Dimensional Pharmaceuticals, Inc. | Amino acid amidinohydrazones, alkoxyguanidines and aminoguanidines as protease inhibitors |
| EP1086122B1 (en) | 1998-06-11 | 2005-08-24 | Johnson & Johnson Pharmaceutical Research & Development, L.L.C. | Pyrazinone protease inhibitors |
| FR2786181B1 (fr) * | 1998-11-24 | 2001-10-26 | Hoechst Marion Roussel Inc | Nouveaux derives d'iminoguanidines, leur procede de preparation, leur application comme medicaments et les compositions pharmaceutiques les renfermant |
| AU3127900A (en) | 1998-12-23 | 2000-07-31 | Du Pont Pharmaceuticals Company | Thrombin or factor xa inhibitors |
| CA2379416A1 (en) | 1999-07-09 | 2001-01-18 | 3-Dimensional Pharmaceuticals, Inc. | Heteroaryl protease inhibitors and diagnostic imaging agents |
| CA2384247A1 (en) | 1999-09-13 | 2001-03-22 | 3-Dimensional Pharmaceuticals, Inc. | Azacycloalkanone serine protease inhibitors |
| EP1303510A2 (en) | 2000-07-17 | 2003-04-23 | 3-Dimensional Pharmaceuticals, Inc. | Cyclic oxyguanidine pyrazinones as protease inhibitors |
| WO2002012207A1 (en) | 2000-08-04 | 2002-02-14 | 3-Dimensional Pharmaceuticals, Inc. | Cyclic oxyguanidine protease inhibitors |
| US6486174B2 (en) | 2000-08-07 | 2002-11-26 | 3-Dimensional Pharmaceuticals, Inc. | Tetrahydroisoquinoline-3-carboxylic acid alkoxyguanidines as integrin antagonists |
| US6589504B1 (en) * | 2000-09-22 | 2003-07-08 | Pharmacia & Upjohn Company | Compounds and methods for diagnosing and treating amyloid-related conditions |
| CA2445160A1 (en) * | 2001-04-24 | 2002-10-31 | Aryx Therapeutics | Coumarin derivatives to be used as anticoagulants |
| CN1578764A (zh) | 2001-11-06 | 2005-02-09 | 惠氏公司 | 2-[烷基(芳基)]磺酰基苯磺酰氯及其中间体的制备方法 |
| EP1569912B1 (en) | 2002-12-03 | 2015-04-29 | Pharmacyclics, Inc. | 2-(2-hydroxybiphenyl-3-yl)-1h-benzoimidazole-5-carboxamidine derivatives as factor viia inhibitors |
| EP1644335A4 (en) * | 2003-07-11 | 2008-06-04 | Bristol Myers Squibb Co | TETRAHYDROQUINOLINE DERIVATIVES COMPRISING MODULATORS OF CANNABINOID RECEPTORS |
| GB0507577D0 (en) * | 2005-04-14 | 2005-05-18 | Novartis Ag | Organic compounds |
| US20070087061A1 (en) * | 2005-10-14 | 2007-04-19 | Medafor, Incorporated | Method and composition for creating and/or activating a platelet-rich gel by contact with a porous particulate material, for use in wound care, tissue adhesion, or as a matrix for delivery of therapeutic components |
| US20070086958A1 (en) * | 2005-10-14 | 2007-04-19 | Medafor, Incorporated | Formation of medically useful gels comprising microporous particles and methods of use |
| US7893080B2 (en) * | 2006-10-20 | 2011-02-22 | Neurendo Pharma, Llc | Method of restoring the incretin effect |
| RU2353619C2 (ru) * | 2007-06-28 | 2009-04-27 | Общество С Ограниченной Ответственностью "Бионика" | Новые соединения, обладающие функцией антикоагулянтов, фармацевтические композиции на их основе для лечения тромботических состояний и плазмозамещающий раствор для коррекции гиперкоагуляционных нарушений при гемодилюции |
| RU2354647C2 (ru) * | 2007-06-28 | 2009-05-10 | Общество С Ограниченной Ответственностью "Бионика" | Новые соединения, обладающие функцией ингибиторов тромбина, и фармацевтические композиции на их основе |
| GB0815784D0 (en) * | 2008-08-29 | 2008-10-08 | Xention Ltd | Novel potassium channel blockers |
| EP2658580A4 (en) * | 2010-12-31 | 2014-07-23 | Corridor Pharmaceuticals Inc | ARGINE STARTER AND USE METHOD |
| JP6523337B2 (ja) * | 2014-05-05 | 2019-05-29 | リセラ・コーポレイションLycera Corporation | RORγのアゴニストとしての使用及び疾患治療のためのベンゼンスルホンアミド及び関連化合物 |
| EP3215154B1 (en) | 2014-11-07 | 2020-01-29 | Regents of the University of Minnesota | Salts and compositions useful for treating disease |
| CN110407721A (zh) * | 2019-08-13 | 2019-11-05 | 上海毕得医药科技有限公司 | 一种4-氰基-3-(三氟甲基)苯-1-磺酰氯的合成方法 |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3131218A (en) * | 1961-02-15 | 1964-04-28 | Smith Kline French Lab | N-amino guanidine derivatives |
| US3271448A (en) * | 1961-11-21 | 1966-09-06 | Pfizer & Co C | Phenoxyalkyl aminoguanidines |
| DE1263762B (de) * | 1964-04-20 | 1968-03-21 | Bayer Ag | Verfahren zur Herstellung von Steroidguanylhydrazonen |
| BE663481A (enExample) * | 1964-05-05 | |||
| US3413303A (en) * | 1965-09-27 | 1968-11-26 | Ciba Geigy Corp | Aralkenyloxyguanidines |
| FR2390954A1 (fr) * | 1976-10-13 | 1978-12-15 | Choay Sa | Nouvelles guanylhydrazones, leurs procedes de preparation et medicaments les contenant |
| FR2549049B1 (fr) * | 1983-07-13 | 1986-06-20 | Chauvin Blache Lab | Nouvelles amidines, leur procede de preparation et leur application therapeutique |
| US4499082A (en) * | 1983-12-05 | 1985-02-12 | E. I. Du Pont De Nemours And Company | α-Aminoboronic acid peptides |
| US4727064A (en) * | 1984-04-25 | 1988-02-23 | The United States Of America As Represented By The Department Of Health And Human Services | Pharmaceutical preparations containing cyclodextrin derivatives |
| GB8506792D0 (en) * | 1985-03-15 | 1985-04-17 | Janssen Pharmaceutica Nv | Derivatives of y-cyclodextrin |
| US4824849A (en) * | 1985-06-03 | 1989-04-25 | Merck & Co., Inc. | α2 -adrenoceptor antagonistic arylquinolizines |
| US5002935A (en) * | 1987-12-30 | 1991-03-26 | University Of Florida | Improvements in redox systems for brain-targeted drug delivery |
| FR2669927B1 (fr) * | 1990-11-29 | 1994-04-08 | Adir Cie | Nouveaux derives de guanidine, leur procede de preparation et les compositions pharmaceutiques qui les contiennent. |
| US5466811A (en) * | 1994-07-18 | 1995-11-14 | Merck & Co., Inc. | Dioxolenylmethyl carbamates pro moieties for amine drugs |
-
1997
- 1997-03-27 NZ NZ332073A patent/NZ332073A/xx unknown
- 1997-03-27 JP JP9535525A patent/JP2000507588A/ja not_active Ceased
- 1997-03-27 AU AU24292/97A patent/AU722161B2/en not_active Ceased
- 1997-03-27 AT AT97919990T patent/ATE341317T1/de not_active IP Right Cessation
- 1997-03-27 WO PCT/US1997/005274 patent/WO1997036580A1/en not_active Ceased
- 1997-03-27 DE DE69736777T patent/DE69736777T2/de not_active Expired - Fee Related
- 1997-03-27 ES ES97919990T patent/ES2273365T3/es not_active Expired - Lifetime
- 1997-03-27 US US08/828,160 patent/US5891909A/en not_active Expired - Lifetime
- 1997-03-27 CA CA002250426A patent/CA2250426C/en not_active Expired - Fee Related
- 1997-03-27 EP EP97919990A patent/EP0906091B1/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| EP0906091B1 (en) | 2006-10-04 |
| EP0906091A4 (en) | 2004-07-21 |
| ATE341317T1 (de) | 2006-10-15 |
| AU2429297A (en) | 1997-10-22 |
| NZ332073A (en) | 2000-05-26 |
| WO1997036580A1 (en) | 1997-10-09 |
| AU722161B2 (en) | 2000-07-20 |
| JP2000507588A (ja) | 2000-06-20 |
| EP0906091A1 (en) | 1999-04-07 |
| CA2250426C (en) | 2006-05-02 |
| DE69736777D1 (de) | 2006-11-16 |
| ES2273365T3 (es) | 2007-05-01 |
| US5891909A (en) | 1999-04-06 |
| CA2250426A1 (en) | 1997-10-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69736777T2 (de) | Amidinohydrazone als protease-inhibitoren | |
| DE69711222T2 (de) | Aminoguanidine und alkoxyguanidine als protease-hemmer | |
| DE69631692T2 (de) | Amidino proteaseinhibitoren | |
| DE69637307T2 (de) | Aus d-aminosäuren abgeleitete cystein-und serinproteasehemmer | |
| DE60012883T2 (de) | 2,3,4,5-tetrahydro-1h-[1,4]benzodiazepin-3-hydroxamsäure als matrix metalloproteinaseinhibitoren | |
| EP0194548A2 (de) | Neue Sulfonylaminoäthylverbindungen, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung | |
| WO1997047299A1 (en) | Amidino and guanidino heterocyclic protease inhibitors | |
| US5792769A (en) | Guanidino protease inhibitors | |
| DE69625505T2 (de) | Guanidino proteiase inhibitoren | |
| DE3715779A1 (de) | Flavon-3-carbonsaeure-verbindungen sowie verfahren, zwischenprodukte zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE4430757A1 (de) | Neue 4-Aminopyridazine, Verfahren zu ihrer Herstellung sowie diese Verbindungen enthaltende Arzneimittel | |
| DE102005015040A1 (de) | Substituierte Tetrahydroisochinoline als MMP-Inhibitoren, Verfahren zu ihrer Herstellung und ihre Verwendung als Medikament | |
| CH625210A5 (enExample) | ||
| EP1763515B1 (de) | 4-trifluormethoxyphenoxybenzol-4'-sulfonsäuren, verfahren zu ihrer herstellung und verwendung in arzneimitteln | |
| AU706145C (en) | Amidino protease inhibitors | |
| JPS63227573A (ja) | ピリミジニルプロピオン酸誘導体 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |