DE69621498T2 - Zusammensetzung mit positivem Temperaturkoeffizienten - Google Patents
Zusammensetzung mit positivem TemperaturkoeffizientenInfo
- Publication number
- DE69621498T2 DE69621498T2 DE69621498T DE69621498T DE69621498T2 DE 69621498 T2 DE69621498 T2 DE 69621498T2 DE 69621498 T DE69621498 T DE 69621498T DE 69621498 T DE69621498 T DE 69621498T DE 69621498 T2 DE69621498 T2 DE 69621498T2
- Authority
- DE
- Germany
- Prior art keywords
- composition
- temperature
- ptc
- polymer
- resistivity
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000203 mixture Substances 0.000 title claims description 39
- 239000006229 carbon black Substances 0.000 claims description 16
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 claims description 10
- 229920005989 resin Polymers 0.000 claims description 9
- 239000011347 resin Substances 0.000 claims description 9
- 238000010438 heat treatment Methods 0.000 claims description 6
- 239000004743 Polypropylene Substances 0.000 claims description 4
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 claims description 4
- -1 polypropylene Polymers 0.000 claims description 4
- 229920001155 polypropylene Polymers 0.000 claims description 4
- 238000010521 absorption reaction Methods 0.000 claims description 3
- 229920001911 maleic anhydride grafted polypropylene Polymers 0.000 claims description 2
- 239000002245 particle Substances 0.000 claims description 2
- 229920000642 polymer Polymers 0.000 description 19
- 235000019241 carbon black Nutrition 0.000 description 14
- 229920002681 hypalon Polymers 0.000 description 14
- 239000000463 material Substances 0.000 description 10
- 239000002904 solvent Substances 0.000 description 7
- 230000000694 effects Effects 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- 229920001940 conductive polymer Polymers 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000011231 conductive filler Substances 0.000 description 4
- 239000000945 filler Substances 0.000 description 4
- 239000000976 ink Substances 0.000 description 4
- 239000004020 conductor Substances 0.000 description 3
- 229920000728 polyester Polymers 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- RUJPNZNXGCHGID-UHFFFAOYSA-N (Z)-beta-Terpineol Natural products CC(=C)C1CCC(C)(O)CC1 RUJPNZNXGCHGID-UHFFFAOYSA-N 0.000 description 2
- KZVBBTZJMSWGTK-UHFFFAOYSA-N 1-[2-(2-butoxyethoxy)ethoxy]butane Chemical compound CCCCOCCOCCOCCCC KZVBBTZJMSWGTK-UHFFFAOYSA-N 0.000 description 2
- 241000721047 Danaus plexippus Species 0.000 description 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 239000012456 homogeneous solution Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 238000007650 screen-printing Methods 0.000 description 2
- 229910052709 silver Inorganic materials 0.000 description 2
- 239000004332 silver Substances 0.000 description 2
- QJVXKWHHAMZTBY-GCPOEHJPSA-N syringin Chemical compound COC1=CC(\C=C\CO)=CC(OC)=C1O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 QJVXKWHHAMZTBY-GCPOEHJPSA-N 0.000 description 2
- 229920002799 BoPET Polymers 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229920006125 amorphous polymer Polymers 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 239000007822 coupling agent Substances 0.000 description 1
- 229920006037 cross link polymer Polymers 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- BNMYXGKEMMVHOX-UHFFFAOYSA-N dimethyl butanedioate;dimethyl pentanedioate Chemical compound COC(=O)CCC(=O)OC.COC(=O)CCCC(=O)OC BNMYXGKEMMVHOX-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 239000010954 inorganic particle Substances 0.000 description 1
- 239000012212 insulator Substances 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000615 nonconductor Substances 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000001282 organosilanes Chemical class 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 238000007639 printing Methods 0.000 description 1
- 238000000518 rheometry Methods 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 229920006126 semicrystalline polymer Polymers 0.000 description 1
- 230000007928 solubilization Effects 0.000 description 1
- 238000005063 solubilization Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01C—RESISTORS
- H01C7/00—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material
- H01C7/02—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material having positive temperature coefficient
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01C—RESISTORS
- H01C7/00—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material
- H01C7/02—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material having positive temperature coefficient
- H01C7/027—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material having positive temperature coefficient consisting of conducting or semi-conducting material dispersed in a non-conductive organic material
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10T—TECHNICAL SUBJECTS COVERED BY FORMER US CLASSIFICATION
- Y10T428/00—Stock material or miscellaneous articles
- Y10T428/249921—Web or sheet containing structurally defined element or component
Landscapes
- Engineering & Computer Science (AREA)
- Microelectronics & Electronic Packaging (AREA)
- Ceramic Engineering (AREA)
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Chemical & Material Sciences (AREA)
- Dispersion Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Thermistors And Varistors (AREA)
- Conductive Materials (AREA)
- Paints Or Removers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US40153695A | 1995-03-10 | 1995-03-10 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69621498D1 DE69621498D1 (de) | 2002-07-11 |
| DE69621498T2 true DE69621498T2 (de) | 2003-02-13 |
Family
ID=23588167
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69621498T Expired - Lifetime DE69621498T2 (de) | 1995-03-10 | 1996-02-22 | Zusammensetzung mit positivem Temperaturkoeffizienten |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US5714096A (enExample) |
| EP (1) | EP0731475B1 (enExample) |
| JP (1) | JP3558771B2 (enExample) |
| KR (1) | KR960035671A (enExample) |
| CN (1) | CN1068693C (enExample) |
| DE (1) | DE69621498T2 (enExample) |
| TW (1) | TW317689B (enExample) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5985182A (en) * | 1996-10-08 | 1999-11-16 | Therm-O-Disc, Incorporated | High temperature PTC device and conductive polymer composition |
| US6074576A (en) * | 1998-03-24 | 2000-06-13 | Therm-O-Disc, Incorporated | Conductive polymer materials for high voltage PTC devices |
| US6582647B1 (en) | 1998-10-01 | 2003-06-24 | Littelfuse, Inc. | Method for heat treating PTC devices |
| US5963121A (en) * | 1998-11-11 | 1999-10-05 | Ferro Corporation | Resettable fuse |
| US6628498B2 (en) | 2000-08-28 | 2003-09-30 | Steven J. Whitney | Integrated electrostatic discharge and overcurrent device |
| US7049558B2 (en) * | 2003-01-27 | 2006-05-23 | Arcturas Bioscience, Inc. | Apparatus and method for heating microfluidic volumes and moving fluids |
| US7000457B2 (en) * | 2003-04-01 | 2006-02-21 | Cabot Corporation | Methods to control and/or predict rheological properties |
| US7776604B2 (en) * | 2003-04-01 | 2010-08-17 | Cabot Corporation | Methods of selecting and developing a particulate material |
| US20040197924A1 (en) * | 2003-04-01 | 2004-10-07 | Murphy Lawrence J. | Liquid absorptometry method of providing product consistency |
| US7776602B2 (en) * | 2003-04-01 | 2010-08-17 | Cabot Corporation | Methods of providing product consistency |
| US7776603B2 (en) * | 2003-04-01 | 2010-08-17 | Cabot Corporation | Methods of specifying or identifying particulate material |
| US20060043343A1 (en) * | 2004-08-24 | 2006-03-02 | Chacko Antony P | Polymer composition and film having positive temperature coefficient |
| US7722713B2 (en) * | 2005-05-17 | 2010-05-25 | Cabot Corporation | Carbon blacks and polymers containing the same |
| TWI407458B (zh) * | 2009-02-10 | 2013-09-01 | Fuzetec Technology Co Ltd | Positive temperature coefficient Conductive polymer composition and its material |
| US8093328B2 (en) | 2010-04-21 | 2012-01-10 | E.I. Du Pont De Nemours And Company | Polymer thick film encapsulant and enhanced stability PTC carbon system |
| EP2578624A1 (en) | 2011-10-06 | 2013-04-10 | Henkel Italia S.p.A. | Polymeric PTC thermistors |
| US9573438B2 (en) | 2013-04-10 | 2017-02-21 | E I Du Pont De Nemours And Company | Polymer thick film positive temperature coefficient carbon composition |
| US10373745B2 (en) | 2014-06-12 | 2019-08-06 | LMS Consulting Group | Electrically conductive PTC ink with double switching temperatures and applications thereof in flexible double-switching heaters |
| US11332632B2 (en) | 2016-02-24 | 2022-05-17 | Lms Consulting Group, Llc | Thermal substrate with high-resistance magnification and positive temperature coefficient ink |
| US10822512B2 (en) | 2016-02-24 | 2020-11-03 | LMS Consulting Group | Thermal substrate with high-resistance magnification and positive temperature coefficient |
| WO2020016853A1 (en) | 2018-07-20 | 2020-01-23 | LMS Consulting Group | Thermal substrate with high-resistance magnification and positive temperature coefficient |
| US10822513B1 (en) | 2019-04-26 | 2020-11-03 | 1-Material Inc | Electrically conductive PTC screen printable ink composition with low inrush current and high NTC onset temperature |
| US10839992B1 (en) * | 2019-05-17 | 2020-11-17 | Raytheon Company | Thick film resistors having customizable resistances and methods of manufacture |
Family Cites Families (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2715668A (en) * | 1952-10-23 | 1955-08-16 | Electrofilm Inc | Electrically conductive film panel heaters |
| US3287684A (en) * | 1964-02-27 | 1966-11-22 | Motson Services Inc | Electrical heating device |
| US3457537A (en) * | 1966-11-23 | 1969-07-22 | Paul J Hines | Flexible resistance element film |
| US3793716A (en) * | 1972-09-08 | 1974-02-26 | Raychem Corp | Method of making self limiting heat elements |
| US3878362A (en) * | 1974-02-15 | 1975-04-15 | Du Pont | Electric heater having laminated structure |
| US4124747A (en) * | 1974-06-04 | 1978-11-07 | Exxon Research & Engineering Co. | Conductive polyolefin sheet element |
| US4560498A (en) * | 1975-08-04 | 1985-12-24 | Raychem Corporation | Positive temperature coefficient of resistance compositions |
| US4658121A (en) * | 1975-08-04 | 1987-04-14 | Raychem Corporation | Self regulating heating device employing positive temperature coefficient of resistance compositions |
| US4071736A (en) * | 1976-02-12 | 1978-01-31 | Donnelly Mirrors, Inc. | Defrosting mirror |
| US4775778A (en) * | 1976-10-15 | 1988-10-04 | Raychem Corporation | PTC compositions and devices comprising them |
| US4534889A (en) * | 1976-10-15 | 1985-08-13 | Raychem Corporation | PTC Compositions and devices comprising them |
| GB1604735A (en) * | 1978-04-14 | 1981-12-16 | Raychem Corp | Ptc compositions and devices comprising them |
| US4388607A (en) * | 1976-12-16 | 1983-06-14 | Raychem Corporation | Conductive polymer compositions, and to devices comprising such compositions |
| US4237441A (en) * | 1978-12-01 | 1980-12-02 | Raychem Corporation | Low resistivity PTC compositions |
| EP0038718B1 (en) * | 1980-04-21 | 1986-08-27 | RAYCHEM CORPORATION (a California corporation) | Conductive polymer compositions containing fillers |
| US4591700A (en) * | 1980-05-19 | 1986-05-27 | Raychem Corporation | PTC compositions |
| US4400614A (en) * | 1980-05-19 | 1983-08-23 | Raychem Corporation | PTC Devices and their preparation |
| US4426633A (en) * | 1981-04-15 | 1984-01-17 | Raychem Corporation | Devices containing PTC conductive polymer compositions |
| JPS57205462A (en) * | 1981-06-12 | 1982-12-16 | Sumitomo Metal Mining Co Ltd | Resistance paint |
| US4935156A (en) * | 1981-09-09 | 1990-06-19 | Raychem Corporation | Conductive polymer compositions |
| US4560524A (en) * | 1983-04-15 | 1985-12-24 | Smuckler Jack H | Method of manufacturing a positive temperature coefficient resistive heating element |
| JPS6099138A (ja) * | 1983-11-02 | 1985-06-03 | Mitsui Petrochem Ind Ltd | ポリオレフイン成形品の塗装用下塗剤 |
| US4761541A (en) * | 1984-01-23 | 1988-08-02 | Raychem Corporation | Devices comprising conductive polymer compositions |
| US4777351A (en) * | 1984-09-14 | 1988-10-11 | Raychem Corporation | Devices comprising conductive polymer compositions |
| US4857880A (en) * | 1985-03-14 | 1989-08-15 | Raychem Corporation | Electrical devices comprising cross-linked conductive polymers |
| US4774024A (en) * | 1985-03-14 | 1988-09-27 | Raychem Corporation | Conductive polymer compositions |
| US4818439A (en) * | 1986-01-30 | 1989-04-04 | Sunbeam Corporation | PTC compositions containing low molecular weight polymer molecules for reduced annealing |
| US4727417A (en) * | 1986-05-14 | 1988-02-23 | Olympus Optical Co., Ltd. | Endoscope video apparatus |
| JPH0799721B2 (ja) * | 1986-09-13 | 1995-10-25 | 日本メクトロン株式会社 | Ptc組成物の製造法 |
| JPH01112686A (ja) * | 1987-10-27 | 1989-05-01 | Matsushita Electric Ind Co Ltd | 正抵抗温度係数発熱体 |
| US5093036A (en) * | 1988-09-20 | 1992-03-03 | Raychem Corporation | Conductive polymer composition |
| US5181006A (en) * | 1988-09-20 | 1993-01-19 | Raychem Corporation | Method of making an electrical device comprising a conductive polymer composition |
| JPH03176980A (ja) * | 1989-12-04 | 1991-07-31 | Matsushita Electric Ind Co Ltd | 正抵抗温度係数をもつ発熱体 |
| US5174924A (en) * | 1990-06-04 | 1992-12-29 | Fujikura Ltd. | Ptc conductive polymer composition containing carbon black having large particle size and high dbp absorption |
| US5198639A (en) * | 1990-11-08 | 1993-03-30 | Smuckler Jack H | Self-regulating heated mirror and method of forming same |
| US5206482A (en) * | 1990-11-08 | 1993-04-27 | Smuckler Jack H | Self regulating laminar heating device and method of forming same |
| US5378407A (en) * | 1992-06-05 | 1995-01-03 | Raychem Corporation | Conductive polymer composition |
-
1996
- 1996-02-14 TW TW85101841A patent/TW317689B/zh not_active IP Right Cessation
- 1996-02-22 EP EP96102647A patent/EP0731475B1/en not_active Expired - Lifetime
- 1996-02-22 DE DE69621498T patent/DE69621498T2/de not_active Expired - Lifetime
- 1996-03-08 CN CN96103068A patent/CN1068693C/zh not_active Expired - Lifetime
- 1996-03-09 KR KR1019960006235A patent/KR960035671A/ko not_active Ceased
- 1996-03-11 JP JP5334696A patent/JP3558771B2/ja not_active Expired - Fee Related
- 1996-09-03 US US08/707,034 patent/US5714096A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| EP0731475A2 (en) | 1996-09-11 |
| EP0731475B1 (en) | 2002-06-05 |
| US5714096A (en) | 1998-02-03 |
| CN1068693C (zh) | 2001-07-18 |
| EP0731475A3 (en) | 1997-07-16 |
| KR960035671A (ko) | 1996-10-24 |
| DE69621498D1 (de) | 2002-07-11 |
| CN1138063A (zh) | 1996-12-18 |
| JP3558771B2 (ja) | 2004-08-25 |
| JPH08339904A (ja) | 1996-12-24 |
| TW317689B (enExample) | 1997-10-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69621498T2 (de) | Zusammensetzung mit positivem Temperaturkoeffizienten | |
| DE3854498T2 (de) | Elektrische Einrichtung mit einem Widerstandselement aus PTC-Polymer. | |
| EP1274102B1 (de) | Polymercompound mit nichtlinearer Strom-Spannungs-Kennlinie und Verfahren zur Herstellung eines Polymercompounds | |
| DE69416128T2 (de) | Vorrichtung zum schutz elektrischer leiter | |
| DE69233426T2 (de) | Verfahren zur Herstellung leitfähiger Polymerzusammensetzungen | |
| US4980541A (en) | Conductive polymer composition | |
| DE68923455T2 (de) | Leitende polymerzusammensetzung. | |
| DE3707503C2 (de) | PTC-Zusammensetzung | |
| DE3050761C2 (de) | Elektrisch leitfähiger, selbstregelnder Gegenstand mit positiven Temperaturkoeffizienten des elektrischen Widerstandes, sowie Verfahren zu seiner Herstellung | |
| DE2425141C3 (de) | Flexibles Überzugsmaterial für Zündkabel u.dgl. Substrate | |
| DE3789325T2 (de) | Leitfähige Polymerzusammensetzung. | |
| US4722853A (en) | Method of printing a polymer thick film ink | |
| DE3687062T2 (de) | Polymerzusammensetzung mit positiven temperaturkoeffizienten-charakteristiken. | |
| DE69606316T2 (de) | Verbesserte polymer ptc-zusammensetzungen | |
| DE69522688T2 (de) | Leitfähige polymerzusammensetzung | |
| DE69633718T2 (de) | Leitfähige polymerzusammensetzung und vorrichtung | |
| DE68919359T2 (de) | Polymer-ptc-zusammenstellung und elektrische vorrichtung daraus. | |
| DE69625864T2 (de) | Elektrische Schutzschaltungskreisvorrichtung, die leitende PTC Flüssigkristallpolymerverbindungen enthält | |
| DE2543346C2 (de) | Elektrische Vorrichtung auf Basis einer Polymermasse mit positivem Temperaturkoeffizienten des Widerstands | |
| US20150361287A1 (en) | Electrically conductive PTC screen printable ink with double switching temperatures and method of making the same | |
| DE3889177T2 (de) | Leitfähige Kunststoffzusammensetzung. | |
| DE7737676U1 (de) | Selbstregulierende elektrische Heizvorrichtung | |
| DE68929517T2 (de) | Leitfähige Polymerzusammensetzung | |
| DE69132877T2 (de) | Flammhemmende leitfähige polymerzusammensetzungvorrichtung | |
| DE69033364T2 (de) | Bauelement aus leitendem polymer |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition |