DE4440247A1 - Flüssiggasgenerator - Google Patents
FlüssiggasgeneratorInfo
- Publication number
- DE4440247A1 DE4440247A1 DE4440247A DE4440247A DE4440247A1 DE 4440247 A1 DE4440247 A1 DE 4440247A1 DE 4440247 A DE4440247 A DE 4440247A DE 4440247 A DE4440247 A DE 4440247A DE 4440247 A1 DE4440247 A1 DE 4440247A1
- Authority
- DE
- Germany
- Prior art keywords
- reaction container
- generator according
- cavity
- lpg
- housing
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000007789 gas Substances 0.000 claims abstract description 44
- 238000006243 chemical reaction Methods 0.000 claims abstract description 42
- 239000007788 liquid Substances 0.000 claims abstract description 23
- 239000000567 combustion gas Substances 0.000 claims abstract description 11
- 230000015556 catabolic process Effects 0.000 claims description 20
- 230000035515 penetration Effects 0.000 claims description 16
- 230000006378 damage Effects 0.000 claims description 3
- 230000000977 initiatory effect Effects 0.000 claims description 2
- 239000007787 solid Substances 0.000 claims description 2
- 208000027418 Wounds and injury Diseases 0.000 claims 1
- 208000014674 injury Diseases 0.000 claims 1
- 238000000465 moulding Methods 0.000 claims 1
- 238000010304 firing Methods 0.000 abstract 2
- 239000000203 mixture Substances 0.000 description 12
- 238000002485 combustion reaction Methods 0.000 description 7
- 230000009172 bursting Effects 0.000 description 5
- 239000012528 membrane Substances 0.000 description 5
- 230000000149 penetrating effect Effects 0.000 description 3
- 239000003380 propellant Substances 0.000 description 3
- 229910000831 Steel Inorganic materials 0.000 description 2
- 230000001133 acceleration Effects 0.000 description 2
- POIUWJQBRNEFGX-XAMSXPGMSA-N cathelicidin Chemical compound C([C@@H](C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CO)C(O)=O)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CC(C)C)C1=CC=CC=C1 POIUWJQBRNEFGX-XAMSXPGMSA-N 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 238000005192 partition Methods 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000004080 punching Methods 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- 239000000020 Nitrocellulose Substances 0.000 description 1
- OLRXHZHVFRYMHO-UHFFFAOYSA-N [N+](=O)([O-])[O-].[K+].[B+3].[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[N+](=O)([O-])[O-] Chemical compound [N+](=O)([O-])[O-].[K+].[B+3].[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[N+](=O)([O-])[O-] OLRXHZHVFRYMHO-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 239000003517 fume Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B60—VEHICLES IN GENERAL
- B60R—VEHICLES, VEHICLE FITTINGS, OR VEHICLE PARTS, NOT OTHERWISE PROVIDED FOR
- B60R21/00—Arrangements or fittings on vehicles for protecting or preventing injuries to occupants or pedestrians in case of accidents or other traffic risks
- B60R21/02—Occupant safety arrangements or fittings, e.g. crash pads
- B60R21/16—Inflatable occupant restraints or confinements designed to inflate upon impact or impending impact, e.g. air bags
- B60R21/26—Inflatable occupant restraints or confinements designed to inflate upon impact or impending impact, e.g. air bags characterised by the inflation fluid source or means to control inflation fluid flow
- B60R21/264—Inflatable occupant restraints or confinements designed to inflate upon impact or impending impact, e.g. air bags characterised by the inflation fluid source or means to control inflation fluid flow using instantaneous generation of gas, e.g. pyrotechnic
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B60—VEHICLES IN GENERAL
- B60R—VEHICLES, VEHICLE FITTINGS, OR VEHICLE PARTS, NOT OTHERWISE PROVIDED FOR
- B60R21/00—Arrangements or fittings on vehicles for protecting or preventing injuries to occupants or pedestrians in case of accidents or other traffic risks
- B60R21/02—Occupant safety arrangements or fittings, e.g. crash pads
- B60R21/16—Inflatable occupant restraints or confinements designed to inflate upon impact or impending impact, e.g. air bags
- B60R21/20—Arrangements for storing inflatable members in their non-use or deflated condition; Arrangement or mounting of air bag modules or components
- B60R21/217—Inflation fluid source retainers, e.g. reaction canisters; Connection of bags, covers, diffusers or inflation fluid sources therewith or together
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B60—VEHICLES IN GENERAL
- B60R—VEHICLES, VEHICLE FITTINGS, OR VEHICLE PARTS, NOT OTHERWISE PROVIDED FOR
- B60R21/00—Arrangements or fittings on vehicles for protecting or preventing injuries to occupants or pedestrians in case of accidents or other traffic risks
- B60R21/02—Occupant safety arrangements or fittings, e.g. crash pads
- B60R21/16—Inflatable occupant restraints or confinements designed to inflate upon impact or impending impact, e.g. air bags
- B60R21/26—Inflatable occupant restraints or confinements designed to inflate upon impact or impending impact, e.g. air bags characterised by the inflation fluid source or means to control inflation fluid flow
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Physics & Mathematics (AREA)
- Fluid Mechanics (AREA)
- Air Bags (AREA)
- Feeding, Discharge, Calcimining, Fusing, And Gas-Generation Devices (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4440247A DE4440247A1 (de) | 1994-11-11 | 1994-11-11 | Flüssiggasgenerator |
| TR95/01388A TR199501388A2 (tr) | 1994-11-11 | 1995-11-08 | Sivi gaz jeneratörü. |
| CZ971430A CZ143097A3 (en) | 1994-11-11 | 1995-11-09 | Generator employing liquefied gas |
| KR1019970703104A KR970706991A (ko) | 1994-11-11 | 1995-11-09 | 액체-가스 발생기 (liquid gas generator) |
| CN95197227A CN1171759A (zh) | 1994-11-11 | 1995-11-09 | 液化气体发生器 |
| EP95940169A EP0790906A1 (de) | 1994-11-11 | 1995-11-09 | Flüssiggasgenerator |
| PCT/EP1995/004404 WO1996015012A1 (de) | 1994-11-11 | 1995-11-09 | Flüssiggasgenerator |
| CA002204787A CA2204787A1 (en) | 1994-11-11 | 1995-11-09 | Liquid-gas generator |
| BR9509643A BR9509643A (pt) | 1994-11-11 | 1995-11-09 | Gerador de gás líquido |
| PL95320136A PL320136A1 (en) | 1994-11-11 | 1995-11-09 | Liquefied gas generator |
| TW084112426A TW286302B (enExample) | 1994-11-11 | 1995-11-22 | |
| MXPA/A/1997/003452A MXPA97003452A (en) | 1994-11-11 | 1997-05-09 | Liquid gas generator |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4440247A DE4440247A1 (de) | 1994-11-11 | 1994-11-11 | Flüssiggasgenerator |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE4440247A1 true DE4440247A1 (de) | 1996-05-15 |
Family
ID=6533021
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE4440247A Withdrawn DE4440247A1 (de) | 1994-11-11 | 1994-11-11 | Flüssiggasgenerator |
Country Status (11)
| Country | Link |
|---|---|
| EP (1) | EP0790906A1 (enExample) |
| KR (1) | KR970706991A (enExample) |
| CN (1) | CN1171759A (enExample) |
| BR (1) | BR9509643A (enExample) |
| CA (1) | CA2204787A1 (enExample) |
| CZ (1) | CZ143097A3 (enExample) |
| DE (1) | DE4440247A1 (enExample) |
| PL (1) | PL320136A1 (enExample) |
| TR (1) | TR199501388A2 (enExample) |
| TW (1) | TW286302B (enExample) |
| WO (1) | WO1996015012A1 (enExample) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19631315A1 (de) * | 1996-08-02 | 1998-02-05 | Dynamit Nobel Ag | Hybrid-Gasgenerator |
| WO2000071390A1 (de) | 1999-05-21 | 2000-11-30 | Volkswagen Aktiengesellschaft | Airbag für ein kraftfahrzeug |
| WO2000071389A1 (de) | 1999-05-21 | 2000-11-30 | Volkswagen Aktiengesellschaft | Airbageinrichtung für ein kraftfahrzeug |
| DE10028169A1 (de) * | 2000-06-09 | 2001-12-20 | Peter Lell | Hybrid-Gasgenerator, insbesondere zum Befüllen eines Gassacks |
| DE19631316B4 (de) * | 1996-08-02 | 2006-06-14 | Dynamit Nobel Gmbh Explosivstoff- Und Systemtechnik | Hybrid-Gasgenerator |
| DE102008056948A1 (de) * | 2008-08-06 | 2010-02-18 | Takata-Petri Ag | Airbagmodul für ein Kraftfahrzeug |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20040232679A1 (en) * | 2001-08-09 | 2004-11-25 | Dairi Kubo | Gas generator |
| CN101462530B (zh) * | 2007-12-21 | 2011-05-25 | 比亚迪股份有限公司 | 一种用于产气组合物的容器及其密封方法 |
| CN108284932B (zh) * | 2018-01-05 | 2019-11-22 | 东阳市善水环境工程有限公司 | 一种新型水下防碰撞拍摄用无人机 |
Citations (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3027903A (en) * | 1958-10-31 | 1962-04-03 | Universal Match Corp | Explosively actuated valves |
| EP0512747A1 (en) * | 1991-05-09 | 1992-11-11 | Oea, Inc. | A method and apparatus for supplying gas |
| DE4231556A1 (de) * | 1991-09-20 | 1993-04-01 | Trw Vehicle Safety Systems | Aufblasvorrichtungsanordnung |
| DE4135547A1 (de) * | 1991-10-28 | 1993-04-29 | Dynamit Nobel Ag | Gasgenerator, insbesondere fuer ein aufblasbares aufprallkissen zum schutz eines kraftfahrzeug-insassen vor verletzungen |
| DE4241221A1 (de) * | 1992-12-08 | 1994-06-09 | Dynamit Nobel Ag | Flüssiggasgenerator für ein aufblasbares Aufprallschutzkissen zum Schutz eines Kraftfahrzeug-Insassen vor Verletzungen |
| EP0604001A1 (en) * | 1992-12-24 | 1994-06-29 | Trw Vehicle Safety Systems Inc. | Inflator assembly |
| US5350192A (en) * | 1993-08-11 | 1994-09-27 | Trw Vehicle Safety Systems Inc. | Inflator assembly |
| US5356176A (en) * | 1993-05-25 | 1994-10-18 | Trw Technar Inc. | Vehicle occupant restraint apparatus |
| DE4420606A1 (de) * | 1993-06-11 | 1994-12-15 | Trw Inc | Aufblasanordnung |
-
1994
- 1994-11-11 DE DE4440247A patent/DE4440247A1/de not_active Withdrawn
-
1995
- 1995-11-08 TR TR95/01388A patent/TR199501388A2/xx unknown
- 1995-11-09 CZ CZ971430A patent/CZ143097A3/cs unknown
- 1995-11-09 BR BR9509643A patent/BR9509643A/pt not_active Application Discontinuation
- 1995-11-09 WO PCT/EP1995/004404 patent/WO1996015012A1/de not_active Ceased
- 1995-11-09 CA CA002204787A patent/CA2204787A1/en not_active Abandoned
- 1995-11-09 CN CN95197227A patent/CN1171759A/zh active Pending
- 1995-11-09 KR KR1019970703104A patent/KR970706991A/ko not_active Withdrawn
- 1995-11-09 PL PL95320136A patent/PL320136A1/xx unknown
- 1995-11-09 EP EP95940169A patent/EP0790906A1/de not_active Withdrawn
- 1995-11-22 TW TW084112426A patent/TW286302B/zh active
Patent Citations (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3027903A (en) * | 1958-10-31 | 1962-04-03 | Universal Match Corp | Explosively actuated valves |
| EP0512747A1 (en) * | 1991-05-09 | 1992-11-11 | Oea, Inc. | A method and apparatus for supplying gas |
| DE4231556A1 (de) * | 1991-09-20 | 1993-04-01 | Trw Vehicle Safety Systems | Aufblasvorrichtungsanordnung |
| DE4135547A1 (de) * | 1991-10-28 | 1993-04-29 | Dynamit Nobel Ag | Gasgenerator, insbesondere fuer ein aufblasbares aufprallkissen zum schutz eines kraftfahrzeug-insassen vor verletzungen |
| DE4241221A1 (de) * | 1992-12-08 | 1994-06-09 | Dynamit Nobel Ag | Flüssiggasgenerator für ein aufblasbares Aufprallschutzkissen zum Schutz eines Kraftfahrzeug-Insassen vor Verletzungen |
| EP0604001A1 (en) * | 1992-12-24 | 1994-06-29 | Trw Vehicle Safety Systems Inc. | Inflator assembly |
| US5356176A (en) * | 1993-05-25 | 1994-10-18 | Trw Technar Inc. | Vehicle occupant restraint apparatus |
| DE4420606A1 (de) * | 1993-06-11 | 1994-12-15 | Trw Inc | Aufblasanordnung |
| US5350192A (en) * | 1993-08-11 | 1994-09-27 | Trw Vehicle Safety Systems Inc. | Inflator assembly |
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19631315A1 (de) * | 1996-08-02 | 1998-02-05 | Dynamit Nobel Ag | Hybrid-Gasgenerator |
| DE19631315B4 (de) * | 1996-08-02 | 2006-03-09 | Dynamit Nobel Gmbh Explosivstoff- Und Systemtechnik | Hybrid-Gasgenerator |
| DE19631316B4 (de) * | 1996-08-02 | 2006-06-14 | Dynamit Nobel Gmbh Explosivstoff- Und Systemtechnik | Hybrid-Gasgenerator |
| WO2000071390A1 (de) | 1999-05-21 | 2000-11-30 | Volkswagen Aktiengesellschaft | Airbag für ein kraftfahrzeug |
| WO2000071389A1 (de) | 1999-05-21 | 2000-11-30 | Volkswagen Aktiengesellschaft | Airbageinrichtung für ein kraftfahrzeug |
| DE10028169A1 (de) * | 2000-06-09 | 2001-12-20 | Peter Lell | Hybrid-Gasgenerator, insbesondere zum Befüllen eines Gassacks |
| DE102008056948A1 (de) * | 2008-08-06 | 2010-02-18 | Takata-Petri Ag | Airbagmodul für ein Kraftfahrzeug |
| US8136836B2 (en) | 2008-08-06 | 2012-03-20 | Takata-Petri Ag | Airbag module for a motor vehicle |
Also Published As
| Publication number | Publication date |
|---|---|
| WO1996015012A1 (de) | 1996-05-23 |
| BR9509643A (pt) | 1997-09-16 |
| KR970706991A (ko) | 1997-12-01 |
| TR199501388A2 (tr) | 1996-06-21 |
| PL320136A1 (en) | 1997-09-15 |
| CZ143097A3 (en) | 1997-10-15 |
| TW286302B (enExample) | 1996-09-21 |
| MX9703452A (es) | 1998-07-31 |
| EP0790906A1 (de) | 1997-08-27 |
| CN1171759A (zh) | 1998-01-28 |
| CA2204787A1 (en) | 1996-05-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69107093T2 (de) | Hybride aufblasvorrichtung. | |
| EP0601489B1 (de) | Flüssiggasgenerator für Airbag | |
| EP0554919B1 (de) | Verfahren zum Aufblasen eines Gaskissens und Sicherheitssystem vom Airbag-Typ | |
| DE69102504T2 (de) | Flüssiger Brennstoff-Gas-Generator für eine Vorrichtung zum Schützen eines Insassen eines Fahrzeuges. | |
| DE69515161T2 (de) | Rückhaltevorrichtung | |
| DE4231356B4 (de) | Vorrichtung zum Aufblasen einer aufblasbaren Einrichtung | |
| US5345876A (en) | Hybrid inflator | |
| DE69213311T2 (de) | Verfahren und Vorrichtung zur Versorgung mit Gas | |
| US6106008A (en) | Hybrid airbag inflator | |
| DE69312923T2 (de) | Hybrider gasgenerator zum stufenweisen aufblasen eines airbags | |
| DE4242793A1 (enExample) | ||
| DE2431686A1 (de) | Verbesserte aufblasvorrichtung fuer kraftfahrzeugsicherheitseinrichtung | |
| DE60102414T2 (de) | Hybridgasgenerator mit einem Bohrpfosten | |
| DE2259798A1 (de) | Vorrichtung zur verwendung in einer sicherheitseinrichtung, insbesondere fuer fahrzeuge | |
| DE3742278A1 (de) | Gasgenerator-system fuer einen gassack in einem fahrzeug | |
| DE2120277A1 (de) | Vorrichtung zum Aufblasen von Sicherheitskissen in Fahrzeugen | |
| DE2352358A1 (de) | Auslassventil bei einer fahrzeugsicherheitsvorrichtung | |
| DE19802548A1 (de) | Hybrid-Aufblasvorrichtung für Airbags | |
| DE2046265A1 (de) | Aufblasbare Sicherheitsvorrichtung und Verfahren zum Aufblasen derselben | |
| DE19726275A1 (de) | Initiator für eine Airbagaufblasvorrichtung | |
| DE2443267A1 (de) | Sicherheitseinrichtung fuer kraftfahrzeuginsassen | |
| DE69208370T2 (de) | Hybride aufblasvorrichtung | |
| DE19954875A1 (de) | Initiator für Airbagaufblasvorrichtung | |
| DE4440247A1 (de) | Flüssiggasgenerator | |
| DE19703945A1 (de) | Airbagvorrichtung in einem Kraftfahrzeug |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OM8 | Search report available as to paragraph 43 lit. 1 sentence 1 patent law | ||
| 8139 | Disposal/non-payment of the annual fee |