DE3742991C2 - - Google Patents
Info
- Publication number
- DE3742991C2 DE3742991C2 DE3742991A DE3742991A DE3742991C2 DE 3742991 C2 DE3742991 C2 DE 3742991C2 DE 3742991 A DE3742991 A DE 3742991A DE 3742991 A DE3742991 A DE 3742991A DE 3742991 C2 DE3742991 C2 DE 3742991C2
- Authority
- DE
- Germany
- Prior art keywords
- radiation source
- radioactive
- lamp
- metal vapor
- voltage
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 230000005855 radiation Effects 0.000 claims description 34
- 239000012857 radioactive material Substances 0.000 claims description 25
- 229910052751 metal Inorganic materials 0.000 claims description 23
- 239000002184 metal Substances 0.000 claims description 23
- 230000002285 radioactive effect Effects 0.000 claims description 11
- VQMWBBYLQSCNPO-NJFSPNSNSA-N promethium-147 Chemical compound [147Pm] VQMWBBYLQSCNPO-NJFSPNSNSA-N 0.000 claims description 7
- 229910010293 ceramic material Inorganic materials 0.000 claims description 5
- 239000011241 protective layer Substances 0.000 claims description 4
- OYPRJOBELJOOCE-BKFZFHPZSA-N Calcium-45 Chemical compound [45Ca] OYPRJOBELJOOCE-BKFZFHPZSA-N 0.000 claims description 3
- GUTLYIVDDKVIGB-OUBTZVSYSA-N Cobalt-60 Chemical compound [60Co] GUTLYIVDDKVIGB-OUBTZVSYSA-N 0.000 claims description 3
- XEEYBQQBJWHFJM-BJUDXGSMSA-N Iron-55 Chemical compound [55Fe] XEEYBQQBJWHFJM-BJUDXGSMSA-N 0.000 claims description 3
- HCWPIIXVSYCSAN-IGMARMGPSA-N Radium-226 Chemical compound [226Ra] HCWPIIXVSYCSAN-IGMARMGPSA-N 0.000 claims description 3
- CIOAGBVUUVVLOB-NJFSPNSNSA-N Strontium-90 Chemical compound [90Sr] CIOAGBVUUVVLOB-NJFSPNSNSA-N 0.000 claims description 3
- QQINRWTZWGJFDB-IGMARMGPSA-N actinium-227 Chemical compound [227Ac] QQINRWTZWGJFDB-IGMARMGPSA-N 0.000 claims description 3
- GWXLDORMOJMVQZ-RNFDNDRNSA-N cerium-144 Chemical compound [144Ce] GWXLDORMOJMVQZ-RNFDNDRNSA-N 0.000 claims description 3
- NIWWFAAXEMMFMS-OIOBTWANSA-N curium-244 Chemical compound [244Cm] NIWWFAAXEMMFMS-OIOBTWANSA-N 0.000 claims description 3
- OGPBJKLSAFTDLK-NJFSPNSNSA-N europium-154 Chemical compound [154Eu] OGPBJKLSAFTDLK-NJFSPNSNSA-N 0.000 claims description 3
- PCHJSUWPFVWCPO-YPZZEJLDSA-N gold-195 Chemical compound [195Au] PCHJSUWPFVWCPO-YPZZEJLDSA-N 0.000 claims description 3
- PXHVJJICTQNCMI-RNFDNDRNSA-N nickel-63 Chemical compound [63Ni] PXHVJJICTQNCMI-RNFDNDRNSA-N 0.000 claims description 3
- HCWPIIXVSYCSAN-NJFSPNSNSA-N radium-228 Chemical compound [228Ra] HCWPIIXVSYCSAN-NJFSPNSNSA-N 0.000 claims description 3
- BQCADISMDOOEFD-NJFSPNSNSA-N silver-110 Chemical compound [110Ag] BQCADISMDOOEFD-NJFSPNSNSA-N 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- ZSLUVFAKFWKJRC-AHCXROLUSA-N thorium-228 Chemical compound [228Th] ZSLUVFAKFWKJRC-AHCXROLUSA-N 0.000 claims description 3
- OKTJSMMVPCPJKN-NJFSPNSNSA-N Carbon-14 Chemical compound [14C] OKTJSMMVPCPJKN-NJFSPNSNSA-N 0.000 claims description 2
- HCHKCACWOHOZIP-IGMARMGPSA-N Zinc-65 Chemical compound [65Zn] HCHKCACWOHOZIP-IGMARMGPSA-N 0.000 claims description 2
- LXQXZNRPTYVCNG-YPZZEJLDSA-N americium-241 Chemical compound [241Am] LXQXZNRPTYVCNG-YPZZEJLDSA-N 0.000 claims description 2
- WATWJIUSRGPENY-AKLPVKDBSA-N antimony-125 Chemical compound [125Sb] WATWJIUSRGPENY-AKLPVKDBSA-N 0.000 claims description 2
- DSAJWYNOEDNPEQ-AHCXROLUSA-N barium-133 Chemical compound [133Ba] DSAJWYNOEDNPEQ-AHCXROLUSA-N 0.000 claims description 2
- TVFDJXOCXUVLDH-OUBTZVSYSA-N cesium-134 Chemical compound [134Cs] TVFDJXOCXUVLDH-OUBTZVSYSA-N 0.000 claims description 2
- TVFDJXOCXUVLDH-RNFDNDRNSA-N cesium-137 Chemical compound [137Cs] TVFDJXOCXUVLDH-RNFDNDRNSA-N 0.000 claims description 2
- NIWWFAAXEMMFMS-FTXFMUIASA-N curium-242 Chemical compound [242Cm] NIWWFAAXEMMFMS-FTXFMUIASA-N 0.000 claims description 2
- OGPBJKLSAFTDLK-AKLPVKDBSA-N europium-155 Chemical compound [155Eu] OGPBJKLSAFTDLK-AKLPVKDBSA-N 0.000 claims description 2
- PWHULOQIROXLJO-BJUDXGSMSA-N manganese-54 Chemical compound [54Mn] PWHULOQIROXLJO-BJUDXGSMSA-N 0.000 claims description 2
- KJTLSVCANCCWHF-BKFZFHPZSA-N ruthenium-106 Chemical compound [106Ru] KJTLSVCANCCWHF-BKFZFHPZSA-N 0.000 claims description 2
- KEAYESYHFKHZAL-BJUDXGSMSA-N sodium-22 Chemical compound [22Na] KEAYESYHFKHZAL-BJUDXGSMSA-N 0.000 claims description 2
- BKVIYDNLLOSFOA-IGMARMGPSA-N thallium-204 Chemical compound [204Tl] BKVIYDNLLOSFOA-IGMARMGPSA-N 0.000 claims description 2
- 238000005299 abrasion Methods 0.000 claims 1
- 239000000919 ceramic Substances 0.000 description 15
- 239000007858 starting material Substances 0.000 description 12
- 239000010410 layer Substances 0.000 description 11
- 239000011734 sodium Substances 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- 238000010438 heat treatment Methods 0.000 description 7
- 239000011261 inert gas Substances 0.000 description 7
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 6
- 229910052814 silicon oxide Inorganic materials 0.000 description 6
- 238000010891 electric arc Methods 0.000 description 5
- 239000011521 glass Substances 0.000 description 5
- 229910052753 mercury Inorganic materials 0.000 description 5
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 4
- 229910004298 SiO 2 Inorganic materials 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 230000001681 protective effect Effects 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- WABPQHHGFIMREM-UHFFFAOYSA-N lead(0) Chemical compound [Pb] WABPQHHGFIMREM-UHFFFAOYSA-N 0.000 description 3
- 229910001507 metal halide Inorganic materials 0.000 description 3
- 150000005309 metal halides Chemical class 0.000 description 3
- 238000005245 sintering Methods 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 239000000395 magnesium oxide Substances 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 2
- 150000004706 metal oxides Chemical class 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- -1 sodium nitride Chemical class 0.000 description 2
- 229910001948 sodium oxide Inorganic materials 0.000 description 2
- PIGFYZPCRLYGLF-UHFFFAOYSA-N Aluminum nitride Chemical compound [Al]#N PIGFYZPCRLYGLF-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- LTPBRCUWZOMYOC-UHFFFAOYSA-N Beryllium oxide Chemical compound O=[Be] LTPBRCUWZOMYOC-UHFFFAOYSA-N 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- 239000005997 Calcium carbide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N Calcium oxide Chemical compound [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- WBUHVURCBUYCHD-UHFFFAOYSA-K Cl.[Cl-].[Pm+3].[Cl-].[Cl-] Chemical compound Cl.[Cl-].[Pm+3].[Cl-].[Cl-] WBUHVURCBUYCHD-UHFFFAOYSA-K 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- CAVCGVPGBKGDTG-UHFFFAOYSA-N alumanylidynemethyl(alumanylidynemethylalumanylidenemethylidene)alumane Chemical compound [Al]#C[Al]=C=[Al]C#[Al] CAVCGVPGBKGDTG-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- JJWKPURADFRFRB-UHFFFAOYSA-N carbonyl sulfide Chemical compound O=C=S JJWKPURADFRFRB-UHFFFAOYSA-N 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- 229910052743 krypton Inorganic materials 0.000 description 1
- DNNSSWSSYDEUBZ-UHFFFAOYSA-N krypton atom Chemical compound [Kr] DNNSSWSSYDEUBZ-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000005461 lubrication Methods 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000001247 metal acetylides Chemical class 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 239000011812 mixed powder Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- 150000004767 nitrides Chemical class 0.000 description 1
- 229910052755 nonmetal Inorganic materials 0.000 description 1
- HUIHCQPFSRNMNM-UHFFFAOYSA-K scandium(3+);triiodide Chemical compound [Sc+3].[I-].[I-].[I-] HUIHCQPFSRNMNM-UHFFFAOYSA-K 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- CLZWAWBPWVRRGI-UHFFFAOYSA-N tert-butyl 2-[2-[2-[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-5-bromophenoxy]ethoxy]-4-methyl-n-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]anilino]acetate Chemical compound CC1=CC=C(N(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C)C(OCCOC=2C(=CC=C(Br)C=2)N(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C)=C1 CLZWAWBPWVRRGI-UHFFFAOYSA-N 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium(II) oxide Chemical compound [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/54—Igniting arrangements, e.g. promoting ionisation for starting
- H01J61/548—Igniting arrangements, e.g. promoting ionisation for starting using radioactive means to promote ionisation
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
- Discharge Lamps And Accessories Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP61303978A JPS63158737A (ja) | 1986-12-22 | 1986-12-22 | 金属蒸気放電灯 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3742991A1 DE3742991A1 (de) | 1988-06-30 |
| DE3742991C2 true DE3742991C2 (member.php) | 1992-07-09 |
Family
ID=17927568
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19873742991 Granted DE3742991A1 (de) | 1986-12-22 | 1987-12-18 | Metalldampf-entladungslampe |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4827176A (member.php) |
| JP (1) | JPS63158737A (member.php) |
| DE (1) | DE3742991A1 (member.php) |
| GB (1) | GB2202081B (member.php) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3840577A1 (de) * | 1988-12-01 | 1990-06-07 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Entladungsgefaess fuer eine hochdruckentladungslampe und verfahren zu dessen herstellung |
| JP3993692B2 (ja) * | 1997-11-28 | 2007-10-17 | 関西ペイント株式会社 | レジストパターン形成方法 |
| RU2158983C1 (ru) * | 1999-11-02 | 2000-11-10 | Агеенко Вячеслав Анатольевич | Биодетектор |
| EP1229567A1 (fr) * | 2001-02-05 | 2002-08-07 | Koninklijke Philips Electronics N.V. | Lampe à décharge avec gaz d'amorçage |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3093593A (en) * | 1958-07-14 | 1963-06-11 | Coors Porcelain Co | Method for disposing of radioactive waste and resultant product |
| US4445067A (en) * | 1980-06-18 | 1984-04-24 | Tokyo Shibaura Denki Kabushiki Kaisha | High pressure metal vapor discharge lamp with radioactive material impregnated in ceramic |
| JPS6034223B2 (ja) * | 1980-06-18 | 1985-08-07 | 株式会社東芝 | 金属蒸気放電灯 |
| JPS6034224B2 (ja) * | 1981-02-13 | 1985-08-07 | 株式会社東芝 | 金属蒸気放電灯 |
| JPH0634220A (ja) * | 1992-07-21 | 1994-02-08 | Daikin Ind Ltd | 空気調和装置 |
-
1986
- 1986-12-22 JP JP61303978A patent/JPS63158737A/ja active Pending
-
1987
- 1987-12-16 GB GB8729312A patent/GB2202081B/en not_active Expired - Lifetime
- 1987-12-18 DE DE19873742991 patent/DE3742991A1/de active Granted
- 1987-12-18 US US07/135,077 patent/US4827176A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| US4827176A (en) | 1989-05-02 |
| JPS63158737A (ja) | 1988-07-01 |
| GB2202081A (en) | 1988-09-14 |
| DE3742991A1 (de) | 1988-06-30 |
| GB8729312D0 (en) | 1988-01-27 |
| GB2202081B (en) | 1990-12-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE819430C (de) | Glueh-Elektrode | |
| DE1911985C3 (de) | Hochdruck-Bogenentladungslampe | |
| DE2346132A1 (de) | Keramik-entladungslampe | |
| DE69502581T2 (de) | Entladungslampe | |
| DE3123604C2 (de) | Metalldampf-Hochdruckentladungslampe | |
| DE3742991C2 (member.php) | ||
| DE2735865C3 (de) | Gasentladungs-Überspannungsableiter | |
| WO1994028607A1 (de) | Gasgefüllter überspannungsableiter | |
| DE2743082A1 (de) | Hochdruckentladungslampe | |
| EP0062782A1 (de) | Gasentladungs-Überspannungsableiter | |
| DE69915966T2 (de) | Niederdruck-Quecksilberdampfentladungslampe | |
| DE2550661C3 (de) | Quecksilberdampf - Hochdrucklampe | |
| DE2625554C2 (de) | Wandstabilisierte Blitzröhre | |
| DE2639478A1 (de) | Hochdruckgasentladungslampe | |
| DE2519014C3 (de) | Verfahren zur Herstellung von Elektroden für Hochdruckentladungslampen | |
| US4777399A (en) | High pressure metal vapor discharge lamp | |
| DE4008375A1 (de) | Hochdruckentladungslampe | |
| DE3123605A1 (de) | Metalldampf-hochdruckentladungslampe | |
| DE2301465A1 (de) | Elektrische entladungslampe | |
| DE2416397A1 (de) | Ueberspannungsableiter | |
| DE3618573C2 (member.php) | ||
| DE2202827C3 (de) | Gitterelektrode für elektrische Entladungsgefäße und Verfahren zu ihrer Herstellung | |
| DE68906174T2 (de) | Ungesättigte Hochdrucknatriumdampfentladungslampe. | |
| DE69205228T2 (de) | Hochdrucknatriumlampe. | |
| DE2903963A1 (de) | Entladungslampe und ihre verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| 8128 | New person/name/address of the agent |
Representative=s name: STOLBERG-WERNIGERODE, GRAF ZU, U., DIPL.-CHEM. DR. |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |