DE3686193T2 - Natriumhochdruckentladungslampe mit getter. - Google Patents
Natriumhochdruckentladungslampe mit getter.Info
- Publication number
- DE3686193T2 DE3686193T2 DE8686105336T DE3686193T DE3686193T2 DE 3686193 T2 DE3686193 T2 DE 3686193T2 DE 8686105336 T DE8686105336 T DE 8686105336T DE 3686193 T DE3686193 T DE 3686193T DE 3686193 T2 DE3686193 T2 DE 3686193T2
- Authority
- DE
- Germany
- Prior art keywords
- lamp
- sodium
- mixture
- hps
- lamps
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 56
- 239000011734 sodium Substances 0.000 claims description 56
- 229910052708 sodium Inorganic materials 0.000 claims description 56
- 239000000203 mixture Substances 0.000 claims description 49
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 19
- 239000001301 oxygen Substances 0.000 claims description 19
- 229910052760 oxygen Inorganic materials 0.000 claims description 19
- 239000000463 material Substances 0.000 claims description 17
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 9
- 229910052751 metal Inorganic materials 0.000 claims description 8
- 239000002184 metal Substances 0.000 claims description 8
- 238000000354 decomposition reaction Methods 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 239000007787 solid Substances 0.000 claims description 4
- 102100031242 Deoxyhypusine synthase Human genes 0.000 claims 3
- 101000844963 Homo sapiens Deoxyhypusine synthase Proteins 0.000 claims 3
- 239000003870 refractory metal Substances 0.000 claims 2
- 238000000151 deposition Methods 0.000 claims 1
- 238000002844 melting Methods 0.000 claims 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- 239000012071 phase Substances 0.000 description 7
- 238000000034 method Methods 0.000 description 6
- 229910052721 tungsten Inorganic materials 0.000 description 6
- 239000010937 tungsten Substances 0.000 description 6
- 230000000694 effects Effects 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 230000007246 mechanism Effects 0.000 description 5
- 229910052758 niobium Inorganic materials 0.000 description 5
- 239000010955 niobium Substances 0.000 description 5
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 230000009467 reduction Effects 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 230000008901 benefit Effects 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 238000007789 sealing Methods 0.000 description 3
- 229910001388 sodium aluminate Inorganic materials 0.000 description 3
- 229910001023 sodium amalgam Inorganic materials 0.000 description 3
- 229910052727 yttrium Inorganic materials 0.000 description 3
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 description 3
- MWZMHLBLVDPOJE-UHFFFAOYSA-N 1-[4-[[n'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]amino]phenyl]sulfonyl-3-phenylurea Chemical compound CC1=CC(C)=NC(N=C(N)NC=2C=CC(=CC=2)S(=O)(=O)NC(=O)NC=2C=CC=CC=2)=N1 MWZMHLBLVDPOJE-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 2
- KKCBUQHMOMHUOY-UHFFFAOYSA-N Na2O Inorganic materials [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 2
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 2
- 238000000137 annealing Methods 0.000 description 2
- 238000000498 ball milling Methods 0.000 description 2
- AYJRCSIUFZENHW-UHFFFAOYSA-L barium carbonate Chemical compound [Ba+2].[O-]C([O-])=O AYJRCSIUFZENHW-UHFFFAOYSA-L 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 239000000919 ceramic Substances 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 229910052593 corundum Inorganic materials 0.000 description 2
- 229910001882 dioxygen Inorganic materials 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 229910052735 hafnium Inorganic materials 0.000 description 2
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 description 2
- 238000010849 ion bombardment Methods 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- 239000005394 sealing glass Substances 0.000 description 2
- 239000006104 solid solution Substances 0.000 description 2
- 229910052715 tantalum Inorganic materials 0.000 description 2
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- PBYZMCDFOULPGH-UHFFFAOYSA-N tungstate Chemical compound [O-][W]([O-])(=O)=O PBYZMCDFOULPGH-UHFFFAOYSA-N 0.000 description 2
- 229910001845 yogo sapphire Inorganic materials 0.000 description 2
- 229910052726 zirconium Inorganic materials 0.000 description 2
- 229910000838 Al alloy Inorganic materials 0.000 description 1
- 229910000497 Amalgam Inorganic materials 0.000 description 1
- 229910015805 BaWO4 Inorganic materials 0.000 description 1
- 229910000873 Beta-alumina solid electrolyte Inorganic materials 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- COHCXWLRUISKOO-UHFFFAOYSA-N [AlH3].[Ba] Chemical compound [AlH3].[Ba] COHCXWLRUISKOO-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 238000005868 electrolysis reaction Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000005247 gettering Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 238000010422 painting Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000006069 physical mixture Substances 0.000 description 1
- XMVONEAAOPAGAO-UHFFFAOYSA-N sodium tungstate Chemical compound [Na+].[Na+].[O-][W]([O-])(=O)=O XMVONEAAOPAGAO-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/24—Means for obtaining or maintaining the desired pressure within the vessel
- H01J61/26—Means for absorbing or adsorbing gas, e.g. by gettering; Means for preventing blackening of the envelope
Landscapes
- Discharge Lamp (AREA)
- Vessels And Coating Films For Discharge Lamps (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/728,556 US4620129A (en) | 1985-04-29 | 1985-04-29 | Gettered high pressure sodium lamp |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3686193D1 DE3686193D1 (de) | 1992-09-03 |
| DE3686193T2 true DE3686193T2 (de) | 1993-03-11 |
Family
ID=24927326
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8686105336T Expired - Fee Related DE3686193T2 (de) | 1985-04-29 | 1986-04-17 | Natriumhochdruckentladungslampe mit getter. |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4620129A (cg-RX-API-DMAC10.html) |
| EP (1) | EP0200109B1 (cg-RX-API-DMAC10.html) |
| JP (1) | JPS61281450A (cg-RX-API-DMAC10.html) |
| BR (1) | BR8601990A (cg-RX-API-DMAC10.html) |
| DE (1) | DE3686193T2 (cg-RX-API-DMAC10.html) |
| MX (1) | MX164682B (cg-RX-API-DMAC10.html) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4686421A (en) * | 1985-05-30 | 1987-08-11 | Gte Products Corporation | Glow discharge starter and arc discharge lamp containing same |
| US4806826A (en) * | 1986-12-16 | 1989-02-21 | Gte Products Corporation | High pressure sodium vapor discharge device |
| TW385479B (en) * | 1998-04-08 | 2000-03-21 | Koninkl Philips Electronics Nv | Metal-halide lamp |
| TW403819B (en) * | 1998-04-08 | 2000-09-01 | Koninkl Philips Electronics Nv | High-pressure metal-halide lamp |
| ITMI20012273A1 (it) * | 2001-10-29 | 2003-04-29 | Getters Spa | Leghe e dispositivi getter per l'evaporazione del calcio |
| RU169961U1 (ru) * | 2016-06-20 | 2017-04-11 | Евгений Михайлович Силкин | Натриевая лампа |
| RU169962U1 (ru) * | 2016-06-20 | 2017-04-11 | Евгений Михайлович Силкин | Натриевая лампа низкого давления |
| RU169967U1 (ru) * | 2016-07-19 | 2017-04-11 | Евгений Михайлович Силкин | Натриевая лампа высокого давления |
| RU169964U1 (ru) * | 2016-09-12 | 2017-04-11 | Евгений Михайлович Силкин | Натриевая лампа высокого давления |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3708710A (en) * | 1970-12-14 | 1973-01-02 | Gen Electric | Discharge lamp thermoionic cathode containing emission material |
| JPS5528180A (en) * | 1978-08-19 | 1980-02-28 | Sankyo Co | Medal for medal player |
| JPS5717554A (en) * | 1980-07-07 | 1982-01-29 | Matsushita Electronics Corp | High pressure sodium lamp |
| CA1214196A (en) * | 1983-02-14 | 1986-11-18 | Jack M. Strok | Color rendition high pressure sodium arc tubes having an oxygen getter |
| US4617492A (en) * | 1985-02-04 | 1986-10-14 | General Electric Company | High pressure sodium lamp having improved pressure stability |
-
1985
- 1985-04-29 US US06/728,556 patent/US4620129A/en not_active Expired - Lifetime
-
1986
- 1986-04-17 DE DE8686105336T patent/DE3686193T2/de not_active Expired - Fee Related
- 1986-04-17 EP EP86105336A patent/EP0200109B1/en not_active Expired
- 1986-04-18 BR BR8601990A patent/BR8601990A/pt not_active Application Discontinuation
- 1986-04-28 JP JP61097042A patent/JPS61281450A/ja active Granted
- 1986-04-29 MX MX2337A patent/MX164682B/es unknown
Also Published As
| Publication number | Publication date |
|---|---|
| EP0200109B1 (en) | 1992-07-29 |
| US4620129A (en) | 1986-10-28 |
| DE3686193D1 (de) | 1992-09-03 |
| MX164682B (es) | 1992-09-17 |
| JPH0561747B2 (cg-RX-API-DMAC10.html) | 1993-09-07 |
| JPS61281450A (ja) | 1986-12-11 |
| EP0200109A3 (en) | 1989-03-08 |
| BR8601990A (pt) | 1987-01-06 |
| EP0200109A2 (en) | 1986-11-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2161173C3 (de) | Oxydelektrode für elektrische Hochleistungs-Gasentladungslampen | |
| DE2626700C2 (de) | Hochdruckgasentladungslampe und Verfahren zu ihrer Herstellung | |
| DE69318638T2 (de) | Universelle Metallhalogenidlampe | |
| DE3042291C2 (de) | Hochdruck-Metallhalogenid-Entladungslampe | |
| DE3686193T2 (de) | Natriumhochdruckentladungslampe mit getter. | |
| DE2647396A1 (de) | Gasentladungspaneel | |
| DE1911985C3 (de) | Hochdruck-Bogenentladungslampe | |
| DE2951741A1 (de) | Elektrode fuer eine entladungslampe | |
| DE19957420A1 (de) | Gasentladungslampe mit Oxidemitter-Elektrode | |
| EP1032022B1 (de) | Metallhalogenidlampe mit keramischem Entladungsgefäss | |
| DE2530076C3 (de) | Elektrode für Hochdruck-Entladungslampen | |
| DE69915966T2 (de) | Niederdruck-Quecksilberdampfentladungslampe | |
| DE19616408A1 (de) | Elektrode für Entladungslampen | |
| EP1104005B1 (de) | Gasentladungslampe mit Oxidemitter-Elektrode | |
| US4617492A (en) | High pressure sodium lamp having improved pressure stability | |
| US4620128A (en) | Tungsten laden emission mix of improved stability | |
| DE3733217C2 (cg-RX-API-DMAC10.html) | ||
| DE68906174T2 (de) | Ungesättigte Hochdrucknatriumdampfentladungslampe. | |
| DE69911538T2 (de) | Niederdruckquecksilberdampfentladungslampe | |
| US3188236A (en) | Cathodes and method of manufacture | |
| US6157132A (en) | Discharge lamp emission material | |
| DE3123605A1 (de) | Metalldampf-hochdruckentladungslampe | |
| DE3780246T3 (de) | Drahtförmige Glühkathode. | |
| DE60027262T2 (de) | Niederdruck-quecksilberdampfentladungslampe | |
| DE2845333A1 (de) | Hochintensive entladungslampen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |