DE3429481A1 - Flammwidrige polycarbonatformmassen - Google Patents
Flammwidrige polycarbonatformmassenInfo
- Publication number
- DE3429481A1 DE3429481A1 DE19843429481 DE3429481A DE3429481A1 DE 3429481 A1 DE3429481 A1 DE 3429481A1 DE 19843429481 DE19843429481 DE 19843429481 DE 3429481 A DE3429481 A DE 3429481A DE 3429481 A1 DE3429481 A1 DE 3429481A1
- Authority
- DE
- Germany
- Prior art keywords
- free
- phosphate
- molding compositions
- polycarbonate
- bis
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 229920000515 polycarbonate Polymers 0.000 title claims description 78
- 239000004417 polycarbonate Substances 0.000 title claims description 78
- -1 hydrocarbon radicals Chemical class 0.000 claims description 45
- 239000000203 mixture Substances 0.000 claims description 42
- 238000000465 moulding Methods 0.000 claims description 27
- 229910019142 PO4 Inorganic materials 0.000 claims description 25
- 239000003063 flame retardant Substances 0.000 claims description 23
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 claims description 16
- 150000003014 phosphoric acid esters Chemical class 0.000 claims description 15
- 229920000642 polymer Polymers 0.000 claims description 15
- 239000010452 phosphate Substances 0.000 claims description 14
- 229920001169 thermoplastic Polymers 0.000 claims description 14
- 239000004416 thermosoftening plastic Substances 0.000 claims description 14
- 150000003254 radicals Chemical class 0.000 claims description 10
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 claims description 10
- 125000003118 aryl group Chemical group 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 8
- 238000004519 manufacturing process Methods 0.000 claims description 7
- 150000005840 aryl radicals Chemical class 0.000 claims description 6
- 239000004215 Carbon black (E152) Substances 0.000 claims description 4
- 230000001588 bifunctional effect Effects 0.000 claims description 4
- 229930195733 hydrocarbon Natural products 0.000 claims description 4
- 239000004033 plastic Substances 0.000 claims description 3
- 229920003023 plastic Polymers 0.000 claims description 3
- 125000004956 cyclohexylene group Chemical group 0.000 claims description 2
- FNIATMYXUPOJRW-UHFFFAOYSA-N cyclohexylidene Chemical group [C]1CCCCC1 FNIATMYXUPOJRW-UHFFFAOYSA-N 0.000 claims description 2
- 239000000975 dye Substances 0.000 claims description 2
- 239000000945 filler Substances 0.000 claims description 2
- 239000006082 mold release agent Substances 0.000 claims description 2
- 239000000049 pigment Substances 0.000 claims description 2
- 239000012779 reinforcing material Substances 0.000 claims description 2
- 239000003381 stabilizer Substances 0.000 claims description 2
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 25
- 235000021317 phosphate Nutrition 0.000 description 24
- 239000004810 polytetrafluoroethylene Substances 0.000 description 24
- 238000012360 testing method Methods 0.000 description 21
- XZZNDPSIHUTMOC-UHFFFAOYSA-N triphenyl phosphate Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=O)OC1=CC=CC=C1 XZZNDPSIHUTMOC-UHFFFAOYSA-N 0.000 description 20
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 9
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 9
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 9
- 150000002366 halogen compounds Chemical class 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- AZZWZMUXHALBCQ-UHFFFAOYSA-N 4-[(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(CC=2C=C(C)C(O)=C(C)C=2)=C1 AZZWZMUXHALBCQ-UHFFFAOYSA-N 0.000 description 5
- ODJUOZPKKHIEOZ-UHFFFAOYSA-N 4-[2-(4-hydroxy-3,5-dimethylphenyl)propan-2-yl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1 ODJUOZPKKHIEOZ-UHFFFAOYSA-N 0.000 description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 5
- 238000002425 crystallisation Methods 0.000 description 5
- 230000008025 crystallization Effects 0.000 description 5
- 239000011888 foil Substances 0.000 description 5
- 229910052736 halogen Inorganic materials 0.000 description 5
- 150000002367 halogens Chemical class 0.000 description 5
- 239000000155 melt Substances 0.000 description 5
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 description 4
- XKZQKPRCPNGNFR-UHFFFAOYSA-N 2-(3-hydroxyphenyl)phenol Chemical compound OC1=CC=CC(C=2C(=CC=CC=2)O)=C1 XKZQKPRCPNGNFR-UHFFFAOYSA-N 0.000 description 4
- 229930185605 Bisphenol Natural products 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 238000012545 processing Methods 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- XMNDMAQKWSQVOV-UHFFFAOYSA-N (2-methylphenyl) diphenyl phosphate Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C=CC=CC=1)OC1=CC=CC=C1 XMNDMAQKWSQVOV-UHFFFAOYSA-N 0.000 description 3
- YSMRWXYRXBRSND-UHFFFAOYSA-N TOTP Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C YSMRWXYRXBRSND-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 229920000728 polyester Polymers 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 229920000388 Polyphosphate Polymers 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- VYGRRCKMMADGBB-UHFFFAOYSA-N [3-hydroxy-2,2-bis(hydroxymethyl)propyl] phosphono hydrogen phosphate Chemical class OCC(CO)(CO)COP(O)(=O)OP(O)(O)=O VYGRRCKMMADGBB-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 2
- NRHMSJGIJYQISI-UHFFFAOYSA-N bis(2,6-dimethylphenyl) phenyl phosphate Chemical compound CC1=CC=CC(C)=C1OP(=O)(OC=1C(=CC=CC=1C)C)OC1=CC=CC=C1 NRHMSJGIJYQISI-UHFFFAOYSA-N 0.000 description 2
- XSRQYQRFQNGZKR-UHFFFAOYSA-N bis(2-methylphenyl) phenyl phosphate Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1 XSRQYQRFQNGZKR-UHFFFAOYSA-N 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003518 caustics Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 238000001746 injection moulding Methods 0.000 description 2
- 229910001389 inorganic alkali salt Inorganic materials 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- YAFOVCNAQTZDQB-UHFFFAOYSA-N octyl diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(OCCCCCCCC)OC1=CC=CC=C1 YAFOVCNAQTZDQB-UHFFFAOYSA-N 0.000 description 2
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 2
- 239000001205 polyphosphate Substances 0.000 description 2
- 235000011176 polyphosphates Nutrition 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000005204 segregation Methods 0.000 description 2
- 230000002195 synergetic effect Effects 0.000 description 2
- QLORRTLBSJTMSN-UHFFFAOYSA-N tris(2,6-dimethylphenyl) phosphate Chemical compound CC1=CC=CC(C)=C1OP(=O)(OC=1C(=CC=CC=1C)C)OC1=C(C)C=CC=C1C QLORRTLBSJTMSN-UHFFFAOYSA-N 0.000 description 2
- LPFAQQYUKORPFJ-UHFFFAOYSA-N (2-ethyl-1,1-diphenylhexyl) dihydrogen phosphate Chemical compound C=1C=CC=CC=1C(OP(O)(O)=O)(C(CC)CCCC)C1=CC=CC=C1 LPFAQQYUKORPFJ-UHFFFAOYSA-N 0.000 description 1
- MQCPOLNSJCWPGT-UHFFFAOYSA-N 2,2'-Bisphenol F Chemical compound OC1=CC=CC=C1CC1=CC=CC=C1O MQCPOLNSJCWPGT-UHFFFAOYSA-N 0.000 description 1
- YIYBRXKMQFDHSM-UHFFFAOYSA-N 2,2'-Dihydroxybenzophenone Chemical class OC1=CC=CC=C1C(=O)C1=CC=CC=C1O YIYBRXKMQFDHSM-UHFFFAOYSA-N 0.000 description 1
- VXHYVVAUHMGCEX-UHFFFAOYSA-N 2-(2-hydroxyphenoxy)phenol Chemical class OC1=CC=CC=C1OC1=CC=CC=C1O VXHYVVAUHMGCEX-UHFFFAOYSA-N 0.000 description 1
- KYGLCUAXJICESS-UHFFFAOYSA-N 2-[2,3-di(propan-2-yl)phenyl]phenol Chemical class CC(C)C1=CC=CC(C=2C(=CC=CC=2)O)=C1C(C)C KYGLCUAXJICESS-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- YMTYZTXUZLQUSF-UHFFFAOYSA-N 3,3'-Dimethylbisphenol A Chemical compound C1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=CC=2)=C1 YMTYZTXUZLQUSF-UHFFFAOYSA-N 0.000 description 1
- 125000003469 3-methylhexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- ODVXUYPWFWVHGW-UHFFFAOYSA-N 4-[1-(4-hydroxy-3,5-dimethylphenyl)-2-methylpropyl]-2,6-dimethylphenol Chemical compound C=1C(C)=C(O)C(C)=CC=1C(C(C)C)C1=CC(C)=C(O)C(C)=C1 ODVXUYPWFWVHGW-UHFFFAOYSA-N 0.000 description 1
- BWCAVNWKMVHLFW-UHFFFAOYSA-N 4-[1-(4-hydroxy-3,5-dimethylphenyl)cyclohexyl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(C2(CCCCC2)C=2C=C(C)C(O)=C(C)C=2)=C1 BWCAVNWKMVHLFW-UHFFFAOYSA-N 0.000 description 1
- WZDLEYNMGWZAEJ-UHFFFAOYSA-N 4-[1-(4-hydroxy-3,5-dimethylphenyl)ethyl]-2,6-dimethylphenol Chemical compound C=1C(C)=C(O)C(C)=CC=1C(C)C1=CC(C)=C(O)C(C)=C1 WZDLEYNMGWZAEJ-UHFFFAOYSA-N 0.000 description 1
- OBZFGWBLZXIBII-UHFFFAOYSA-N 4-[3-(4-hydroxy-3,5-dimethylphenyl)-3-methylbutyl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(CCC(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1 OBZFGWBLZXIBII-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- OZFLRNPZLCUVFP-UHFFFAOYSA-N 8-methylnonyl dihydrogen phosphate Chemical compound CC(C)CCCCCCCOP(O)(O)=O OZFLRNPZLCUVFP-UHFFFAOYSA-N 0.000 description 1
- SDDLEVPIDBLVHC-UHFFFAOYSA-N Bisphenol Z Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)CCCCC1 SDDLEVPIDBLVHC-UHFFFAOYSA-N 0.000 description 1
- PQUFWJJROQTZSX-UHFFFAOYSA-N CC1=C(C(=C(C=C1C2=CC=CC=C2)C3=CC=CC=C3)C)OP(=O)(O)O Chemical compound CC1=C(C(=C(C=C1C2=CC=CC=C2)C3=CC=CC=C3)C)OP(=O)(O)O PQUFWJJROQTZSX-UHFFFAOYSA-N 0.000 description 1
- WISGDVJLNKTUTC-UHFFFAOYSA-N CCCCC(CC)C(C1=CC=C(C=C1)C)(C2=CC=C(C=C2)C)OP(=O)(O)O Chemical compound CCCCC(CC)C(C1=CC=C(C=C1)C)(C2=CC=C(C=C2)C)OP(=O)(O)O WISGDVJLNKTUTC-UHFFFAOYSA-N 0.000 description 1
- 229920000049 Carbon (fiber) Polymers 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- 229920006360 Hostaflon Polymers 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- NICFFUUHSILOBQ-UHFFFAOYSA-N P(=O)(O)(O)OC1=CC=C(C(=C1C)C1=CC=CC=C1)C1=CC=CC=C1 Chemical compound P(=O)(O)(O)OC1=CC=C(C(=C1C)C1=CC=CC=C1)C1=CC=CC=C1 NICFFUUHSILOBQ-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- SBENAKPBEVNCRU-UHFFFAOYSA-N [2,3-bis(2,6-dimethylphenyl)-4-propan-2-ylphenyl] dihydrogen phosphate Chemical compound CC=1C=CC=C(C)C=1C=1C(C(C)C)=CC=C(OP(O)(O)=O)C=1C1=C(C)C=CC=C1C SBENAKPBEVNCRU-UHFFFAOYSA-N 0.000 description 1
- UTWXEYMRVCKEJW-UHFFFAOYSA-N [2,4-bis(2,6-dimethylphenyl)-3-methylphenyl] dihydrogen phosphate Chemical compound CC1=CC=CC(C)=C1C1=CC=C(OP(O)(O)=O)C(C=2C(=CC=CC=2C)C)=C1C UTWXEYMRVCKEJW-UHFFFAOYSA-N 0.000 description 1
- DZEPMIPVDHPIOI-UHFFFAOYSA-N [3,4-bis(2,6-dimethylphenyl)-2-propan-2-ylphenyl] dihydrogen phosphate Chemical compound CC=1C=CC=C(C)C=1C=1C(C(C)C)=C(OP(O)(O)=O)C=CC=1C1=C(C)C=CC=C1C DZEPMIPVDHPIOI-UHFFFAOYSA-N 0.000 description 1
- RGMIJYNHIFBBPY-UHFFFAOYSA-N [4-tert-butyl-2,3-bis(2,6-dimethylphenyl)phenyl] dihydrogen phosphate Chemical compound CC1=CC=CC(C)=C1C1=C(OP(O)(O)=O)C=CC(C(C)(C)C)=C1C1=C(C)C=CC=C1C RGMIJYNHIFBBPY-UHFFFAOYSA-N 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 238000004378 air conditioning Methods 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000001118 alkylidene group Chemical group 0.000 description 1
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 1
- 235000019395 ammonium persulphate Nutrition 0.000 description 1
- 150000001463 antimony compounds Chemical class 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 238000000149 argon plasma sintering Methods 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- VOFXXWRGTVLEOU-UHFFFAOYSA-N bis(2,6-dimethylphenyl) (2-methylphenyl) phosphate Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1C)C)OC1=C(C)C=CC=C1C VOFXXWRGTVLEOU-UHFFFAOYSA-N 0.000 description 1
- OYNXIRVCWGNZCE-UHFFFAOYSA-N bis(2,6-dimethylphenyl) (4-methylphenyl) phosphate Chemical compound C1=CC(C)=CC=C1OP(=O)(OC=1C(=CC=CC=1C)C)OC1=C(C)C=CC=C1C OYNXIRVCWGNZCE-UHFFFAOYSA-N 0.000 description 1
- NVMHZSCMWYZDCC-UHFFFAOYSA-N bis(4-methylphenyl) phenyl phosphate Chemical compound C1=CC(C)=CC=C1OP(=O)(OC=1C=CC(C)=CC=1)OC1=CC=CC=C1 NVMHZSCMWYZDCC-UHFFFAOYSA-N 0.000 description 1
- 229920000402 bisphenol A polycarbonate polymer Polymers 0.000 description 1
- 239000006085 branching agent Substances 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- DIBUFQMCUZYQKN-UHFFFAOYSA-N butyl diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(OCCCC)OC1=CC=CC=C1 DIBUFQMCUZYQKN-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 239000004917 carbon fiber Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 150000001896 cresols Chemical class 0.000 description 1
- 150000001924 cycloalkanes Chemical class 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- JJXNVYMIYBNZQX-UHFFFAOYSA-N diphenyl (2-propan-2-ylphenyl) phosphate Chemical compound CC(C)C1=CC=CC=C1OP(=O)(OC=1C=CC=CC=1)OC1=CC=CC=C1 JJXNVYMIYBNZQX-UHFFFAOYSA-N 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010616 electrical installation Methods 0.000 description 1
- JSPBAVGTJNAVBJ-UHFFFAOYSA-N ethyl diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(OCC)OC1=CC=CC=C1 JSPBAVGTJNAVBJ-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 238000010304 firing Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 229920000578 graft copolymer Polymers 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- CAYGQBVSOZLICD-UHFFFAOYSA-N hexabromobenzene Chemical compound BrC1=C(Br)C(Br)=C(Br)C(Br)=C1Br CAYGQBVSOZLICD-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 235000000396 iron Nutrition 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- VOWPVJACXJNHBC-UHFFFAOYSA-N methyl diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(OC)OC1=CC=CC=C1 VOWPVJACXJNHBC-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000012768 molten material Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- RMNODSGCFHVNDC-UHFFFAOYSA-N phenyl bis(2-propan-2-ylphenyl) phosphate Chemical compound CC(C)C1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C(C)C)OC1=CC=CC=C1 RMNODSGCFHVNDC-UHFFFAOYSA-N 0.000 description 1
- CMPQUABWPXYYSH-UHFFFAOYSA-N phenyl phosphate Chemical compound OP(O)(=O)OC1=CC=CC=C1 CMPQUABWPXYYSH-UHFFFAOYSA-N 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229920002981 polyvinylidene fluoride Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000019394 potassium persulphate Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003017 thermal stabilizer Substances 0.000 description 1
- 229920005992 thermoplastic resin Polymers 0.000 description 1
- OOZBTDPWFHJVEK-UHFFFAOYSA-N tris(2-nonylphenyl) phosphate Chemical compound CCCCCCCCCC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)CCCCCCCCC)OC1=CC=CC=C1CCCCCCCCC OOZBTDPWFHJVEK-UHFFFAOYSA-N 0.000 description 1
- LIPMRGQQBZJCTM-UHFFFAOYSA-N tris(2-propan-2-ylphenyl) phosphate Chemical compound CC(C)C1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C(C)C)OC1=CC=CC=C1C(C)C LIPMRGQQBZJCTM-UHFFFAOYSA-N 0.000 description 1
- BOSMZFBHAYFUBJ-UHFFFAOYSA-N tris(4-methylphenyl) phosphate Chemical compound C1=CC(C)=CC=C1OP(=O)(OC=1C=CC(C)=CC=1)OC1=CC=C(C)C=C1 BOSMZFBHAYFUBJ-UHFFFAOYSA-N 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/49—Phosphorus-containing compounds
- C08K5/51—Phosphorus bound to oxygen
- C08K5/52—Phosphorus bound to oxygen only
- C08K5/521—Esters of phosphoric acids, e.g. of H3PO4
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L69/00—Compositions of polycarbonates; Compositions of derivatives of polycarbonates
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Priority Applications (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843429481 DE3429481A1 (de) | 1984-08-10 | 1984-08-10 | Flammwidrige polycarbonatformmassen |
| DE8585109533T DE3566268D1 (en) | 1984-08-10 | 1985-07-29 | Flame resistant polycarbonate moulding compositions |
| EP85109533A EP0173856B1 (de) | 1984-08-10 | 1985-07-29 | Flammwidrige Polycarbonatformmassen |
| JP60172531A JPS6147747A (ja) | 1984-08-10 | 1985-08-07 | 防炎性ポリカーボナート成型用組成物 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843429481 DE3429481A1 (de) | 1984-08-10 | 1984-08-10 | Flammwidrige polycarbonatformmassen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3429481A1 true DE3429481A1 (de) | 1986-02-20 |
Family
ID=6242779
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19843429481 Withdrawn DE3429481A1 (de) | 1984-08-10 | 1984-08-10 | Flammwidrige polycarbonatformmassen |
| DE8585109533T Expired DE3566268D1 (en) | 1984-08-10 | 1985-07-29 | Flame resistant polycarbonate moulding compositions |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8585109533T Expired DE3566268D1 (en) | 1984-08-10 | 1985-07-29 | Flame resistant polycarbonate moulding compositions |
Country Status (3)
| Country | Link |
|---|---|
| EP (1) | EP0173856B1 (enExample) |
| JP (1) | JPS6147747A (enExample) |
| DE (2) | DE3429481A1 (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5137953A (en) * | 1989-12-12 | 1992-08-11 | Bayer Aktiengesellschaft | Flame-resistant thermoplastic polycarbonate molding compounds |
| US5240978A (en) * | 1990-06-26 | 1993-08-31 | Bayer Aktiengesellschaft | Thermoplastic polycarbonate moulding compositions with flame-resistant properties |
| US5272193A (en) * | 1991-07-12 | 1993-12-21 | Bayer Aktiengesellschaft | Thermoplastic polycarbonate moulding compounds with flame-resistant properties |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4826900A (en) * | 1988-03-31 | 1989-05-02 | The Dow Chemical Company | Ignition resistant modified carbonate polymer composition |
| US5276077A (en) * | 1992-06-03 | 1994-01-04 | The Dow Chemical Company | Ignition resistant carbonate polymer blends |
| JP6002490B2 (ja) * | 2011-09-27 | 2016-10-05 | 三菱化学株式会社 | ポリカーボネート樹脂組成物 |
| BE1020466A3 (nl) * | 2012-02-10 | 2013-11-05 | Bonar Technical Fabrics | Vlamvertragend doek. |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3703495A (en) * | 1971-04-19 | 1972-11-21 | Eastman Kodak Co | Processable polyester compositions |
| US3809729A (en) * | 1971-06-10 | 1974-05-07 | Gen Electric | Flame retardant thermoplastic compositions |
| US4222910A (en) * | 1977-11-10 | 1980-09-16 | Teijin Chemicals, Ltd. | Fire-retardant polycarbonate composition |
| GB2019422B (en) * | 1978-04-20 | 1982-07-14 | Gen Electric | Flame retardant crystalline polycarbonate compositions |
| DE2918882A1 (de) * | 1979-05-10 | 1980-11-13 | Bayer Ag | Flammwidrige polycarbonat-legierungen mit erhoehter waermeformbestaendigkeit |
| DE3378125D1 (en) * | 1982-09-10 | 1988-11-03 | Bayer Ag | Flame-retardant polymer mixtures |
-
1984
- 1984-08-10 DE DE19843429481 patent/DE3429481A1/de not_active Withdrawn
-
1985
- 1985-07-29 DE DE8585109533T patent/DE3566268D1/de not_active Expired
- 1985-07-29 EP EP85109533A patent/EP0173856B1/de not_active Expired
- 1985-08-07 JP JP60172531A patent/JPS6147747A/ja active Granted
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5137953A (en) * | 1989-12-12 | 1992-08-11 | Bayer Aktiengesellschaft | Flame-resistant thermoplastic polycarbonate molding compounds |
| US5240978A (en) * | 1990-06-26 | 1993-08-31 | Bayer Aktiengesellschaft | Thermoplastic polycarbonate moulding compositions with flame-resistant properties |
| US5272193A (en) * | 1991-07-12 | 1993-12-21 | Bayer Aktiengesellschaft | Thermoplastic polycarbonate moulding compounds with flame-resistant properties |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6147747A (ja) | 1986-03-08 |
| JPH0434572B2 (enExample) | 1992-06-08 |
| EP0173856B1 (de) | 1988-11-17 |
| DE3566268D1 (en) | 1988-12-22 |
| EP0173856A1 (de) | 1986-03-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0103230B1 (de) | Flammwidrige Polymermischungen | |
| DE2331826A1 (de) | Thermoplastische massen | |
| EP0034697B2 (de) | Mischungen aus Polycarbonaten und Polyphosphonaten und deren Verwendung zur Herstellung von Folien | |
| DE2757323A1 (de) | Thermoplastische copolyester | |
| JP4046371B2 (ja) | 難燃性成形用熱可塑性樹脂組成物 | |
| EP0103231B1 (de) | Flammwidrige Polymermischungen | |
| DE2242509C2 (de) | Nicht-tropfende, flammhemmende, mit Glas verstärkte Polyesterharze und Verfahren zu ihrer Herstellung | |
| DE2921325A1 (de) | Flammabweisende aromatische polycarbonatmassen | |
| DE2310742A1 (de) | Entflammungshemmende thermoplastische zusammensetzungen | |
| DE69123262T2 (de) | Flammgeschützte polymermischung aus polybutylenterephthalat und einem aromatischen polycarbonat oder einem polyetherimid | |
| EP0030618A1 (de) | Flammwidrige Formmassen auf Basis von Polyethylenterephthalat, Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von Formkörpern | |
| EP0033077B1 (de) | Flammhemmende Zusammensetzung aus Polyphenylenether, Polystyrolharz und Polyphosphonat | |
| EP0173856B1 (de) | Flammwidrige Polycarbonatformmassen | |
| EP0173869A1 (de) | Flammwidrige, thermoplastische Polymermischungen | |
| EP0188683B1 (de) | Thermoplastische Formmassen mit flammwidrigen Eigenschaften | |
| DE3444867A1 (de) | Thermoplastische formmassen mit flammwidrigen eigenschaften | |
| EP0310979A2 (de) | Glasfaserverstärkte flammgeschützte thermoplastische Formmassen auf der Basis von Polyestern und Pfropfpolymerisaten | |
| DE3786567T2 (de) | Stabilisierte aromatische polyesterzusammensetzungen. | |
| WO2023180228A1 (de) | Polycarbonat-zusammensetzungen mit hohem cti | |
| EP0103227B1 (de) | Verfahren zur Herstellung von Polyphosphaten, nach diesem Verfahren hergestellte Polyphosphate und ihre Verwendung | |
| DE2606279C2 (de) | Flammwidrige aromatische Copolyestermasse und deren Verwendung zur Herstellung von Formkörpern | |
| EP0287953A2 (de) | Flammgeschützte thermoplastische Polyesterformmassen | |
| DE10050121A1 (de) | Polycarbonatharzzusammensetzung | |
| DE3332396A1 (de) | Mischungen aus voll-aromatischen polyestern und/oder polycarbonaten und/oder polyestercarbonaten, aromatischen polyphosphonaten und polyepoxiden, verfahren zu ihrer herstellung und ihre verwendung zur herstellung von formkoerpern, folien und fasern | |
| DE2749261A1 (de) | Harzzusammensetzung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |