DE3425151A1 - Haarfaerbemittel - Google Patents
HaarfaerbemittelInfo
- Publication number
- DE3425151A1 DE3425151A1 DE19843425151 DE3425151A DE3425151A1 DE 3425151 A1 DE3425151 A1 DE 3425151A1 DE 19843425151 DE19843425151 DE 19843425151 DE 3425151 A DE3425151 A DE 3425151A DE 3425151 A1 DE3425151 A1 DE 3425151A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- hair
- acid
- dyes
- nitrobenzoic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000118 hair dye Substances 0.000 claims abstract description 41
- 230000003647 oxidation Effects 0.000 claims abstract description 16
- 238000007254 oxidation reaction Methods 0.000 claims abstract description 16
- 239000002243 precursor Substances 0.000 claims abstract description 10
- 239000001257 hydrogen Substances 0.000 claims abstract description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 5
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims abstract description 3
- 239000000975 dye Substances 0.000 claims description 18
- -1 β-hydroxyethyl Chemical group 0.000 claims description 14
- 150000001875 compounds Chemical class 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 239000003086 colorant Substances 0.000 claims description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- KSMLIIWEQBYUKA-UHFFFAOYSA-N 4-(methylamino)-3-nitrobenzoic acid Chemical compound CNC1=CC=C(C(O)=O)C=C1[N+]([O-])=O KSMLIIWEQBYUKA-UHFFFAOYSA-N 0.000 claims description 2
- QQANOUXMWFQYFE-UHFFFAOYSA-N 5-nitro-2-piperidin-1-ylbenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC([N+]([O-])=O)=CC=C1N1CCCCC1 QQANOUXMWFQYFE-UHFFFAOYSA-N 0.000 claims description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 2
- 125000004103 aminoalkyl group Chemical group 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims 1
- 229910052757 nitrogen Inorganic materials 0.000 claims 1
- 239000001047 purple dye Substances 0.000 claims 1
- 238000002360 preparation method Methods 0.000 abstract description 9
- 230000037308 hair color Effects 0.000 abstract description 4
- 230000002110 toxicologic effect Effects 0.000 abstract description 3
- 125000001424 substituent group Chemical group 0.000 abstract description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- 229910006069 SO3H Inorganic materials 0.000 abstract 1
- 230000002349 favourable effect Effects 0.000 abstract 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 abstract 1
- 231100000723 toxicological property Toxicity 0.000 abstract 1
- 240000007817 Olea europaea Species 0.000 description 15
- 239000000982 direct dye Substances 0.000 description 11
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 239000007800 oxidant agent Substances 0.000 description 6
- 239000002453 shampoo Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000006071 cream Substances 0.000 description 5
- 235000014113 dietary fatty acids Nutrition 0.000 description 5
- 239000000194 fatty acid Substances 0.000 description 5
- 229930195729 fatty acid Natural products 0.000 description 5
- 150000002191 fatty alcohols Chemical class 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- 239000003581 cosmetic carrier Substances 0.000 description 4
- 150000004665 fatty acids Chemical class 0.000 description 4
- BJFMTEPHRNENIO-UHFFFAOYSA-N 5-nitro-2-piperidin-1-ylbenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1N1CCCCC1 BJFMTEPHRNENIO-UHFFFAOYSA-N 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 239000000499 gel Substances 0.000 description 3
- 150000005181 nitrobenzenes Chemical class 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- GHOKWGTUZJEAQD-ZETCQYMHSA-N (D)-(+)-Pantothenic acid Chemical compound OCC(C)(C)[C@@H](O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-ZETCQYMHSA-N 0.000 description 2
- HDYDAVTYZWGYTF-UHFFFAOYSA-N 2-(ethylamino)-5-nitrobenzenesulfonic acid Chemical compound CCNC1=CC=C([N+]([O-])=O)C=C1S(O)(=O)=O HDYDAVTYZWGYTF-UHFFFAOYSA-N 0.000 description 2
- JUNACKVGXUTVCN-UHFFFAOYSA-N 2-amino-4-[2-(dimethylamino)ethyl]-3-nitrobenzoic acid Chemical compound CN(C)CCC1=CC=C(C(O)=O)C(N)=C1[N+]([O-])=O JUNACKVGXUTVCN-UHFFFAOYSA-N 0.000 description 2
- MRCONLVSTRNJQT-UHFFFAOYSA-N 2-morpholino-5-nitrobenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1N1CCOCC1 MRCONLVSTRNJQT-UHFFFAOYSA-N 0.000 description 2
- YVODCTHEVCBRCV-UHFFFAOYSA-N 3-nitro-4-piperidin-1-ylbenzoic acid Chemical compound [O-][N+](=O)C1=CC(C(=O)O)=CC=C1N1CCCCC1 YVODCTHEVCBRCV-UHFFFAOYSA-N 0.000 description 2
- MKTQASLRSMDHRE-UHFFFAOYSA-N 3-nitro-4-pyrrolidin-1-ylbenzoic acid Chemical compound [O-][N+](=O)C1=CC(C(=O)O)=CC=C1N1CCCC1 MKTQASLRSMDHRE-UHFFFAOYSA-N 0.000 description 2
- XPLTXYDVYDWSSO-UHFFFAOYSA-N 4-(ethylamino)-3-nitrobenzoic acid Chemical compound CCNC1=CC=C(C(O)=O)C=C1[N+]([O-])=O XPLTXYDVYDWSSO-UHFFFAOYSA-N 0.000 description 2
- SREBONXEMNOUKV-UHFFFAOYSA-N 4-morpholino-3-nitrobenzoic acid Chemical compound [O-][N+](=O)C1=CC(C(=O)O)=CC=C1N1CCOCC1 SREBONXEMNOUKV-UHFFFAOYSA-N 0.000 description 2
- UEALKTCRMBVTFN-UHFFFAOYSA-N 4-nitroanthranilic acid Chemical compound NC1=CC([N+]([O-])=O)=CC=C1C(O)=O UEALKTCRMBVTFN-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- XUMBMVFBXHLACL-UHFFFAOYSA-N Melanin Chemical compound O=C1C(=O)C(C2=CNC3=C(C(C(=O)C4=C32)=O)C)=C2C4=CNC2=C1C XUMBMVFBXHLACL-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 239000001000 anthraquinone dye Substances 0.000 description 2
- 230000000740 bleeding effect Effects 0.000 description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 238000004040 coloring Methods 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 239000002537 cosmetic Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000004043 dyeing Methods 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 235000012907 honey Nutrition 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- VBEGHXKAFSLLGE-UHFFFAOYSA-N n-phenylnitramide Chemical compound [O-][N+](=O)NC1=CC=CC=C1 VBEGHXKAFSLLGE-UHFFFAOYSA-N 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 238000005691 oxidative coupling reaction Methods 0.000 description 2
- XXQBEVHPUKOQEO-UHFFFAOYSA-N potassium superoxide Chemical compound [K+].[K+].[O-][O-] XXQBEVHPUKOQEO-UHFFFAOYSA-N 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- 231100000027 toxicology Toxicity 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 150000005207 1,3-dihydroxybenzenes Chemical class 0.000 description 1
- RQSZZLSHECUEDX-UHFFFAOYSA-N 19555-48-7 Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1N1CCCC1 RQSZZLSHECUEDX-UHFFFAOYSA-N 0.000 description 1
- ZHLLWDOGYSLSPA-UHFFFAOYSA-N 2-(2-hydroxyethylamino)-5-nitrobenzenesulfonic acid Chemical compound OCCNC1=CC=C([N+]([O-])=O)C=C1S(O)(=O)=O ZHLLWDOGYSLSPA-UHFFFAOYSA-N 0.000 description 1
- ZCXBRELULXFLOW-UHFFFAOYSA-N 2-(2-hydroxyethylamino)-5-nitrobenzoic acid Chemical compound OCCNC1=CC=C([N+]([O-])=O)C=C1C(O)=O ZCXBRELULXFLOW-UHFFFAOYSA-N 0.000 description 1
- FAVDVRYGVZMEFI-UHFFFAOYSA-N 2-(methylamino)-5-nitrobenzoic acid Chemical compound CNC1=CC=C([N+]([O-])=O)C=C1C(O)=O FAVDVRYGVZMEFI-UHFFFAOYSA-N 0.000 description 1
- LTASFWDWBYFZQQ-UHFFFAOYSA-N 2-amino-5-nitrobenzenesulfonic acid Chemical compound NC1=CC=C([N+]([O-])=O)C=C1S(O)(=O)=O LTASFWDWBYFZQQ-UHFFFAOYSA-N 0.000 description 1
- GNTARUIZNIWBCN-UHFFFAOYSA-N 2-chloro-5-nitrobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC([N+]([O-])=O)=CC=C1Cl GNTARUIZNIWBCN-UHFFFAOYSA-N 0.000 description 1
- CCDVXIZHZZZDSV-UHFFFAOYSA-N 2-morpholin-4-yl-5-nitrobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC([N+]([O-])=O)=CC=C1N1CCOCC1 CCDVXIZHZZZDSV-UHFFFAOYSA-N 0.000 description 1
- FGMRHNYMZYMARX-UHFFFAOYSA-N 3-amino-2-nitrobenzoic acid Chemical compound NC1=CC=CC(C(O)=O)=C1[N+]([O-])=O FGMRHNYMZYMARX-UHFFFAOYSA-N 0.000 description 1
- CWLKGDAVCFYWJK-UHFFFAOYSA-N 3-aminophenol Chemical class NC1=CC=CC(O)=C1 CWLKGDAVCFYWJK-UHFFFAOYSA-N 0.000 description 1
- QWIWYBUPJLCBSE-UHFFFAOYSA-N 3-chloro-2-nitrobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC(Cl)=C1[N+]([O-])=O QWIWYBUPJLCBSE-UHFFFAOYSA-N 0.000 description 1
- CLQHQKVADUXBRZ-UHFFFAOYSA-N 3-nitro-4-piperidin-1-ylbenzenesulfonic acid Chemical compound [O-][N+](=O)C1=CC(S(=O)(=O)O)=CC=C1N1CCCCC1 CLQHQKVADUXBRZ-UHFFFAOYSA-N 0.000 description 1
- ZNMGCJDUZADKPW-UHFFFAOYSA-N 3-nitroaniline-4-sulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C([N+]([O-])=O)=C1 ZNMGCJDUZADKPW-UHFFFAOYSA-N 0.000 description 1
- AFPHTEQTJZKQAQ-UHFFFAOYSA-N 3-nitrobenzoic acid Chemical compound OC(=O)C1=CC=CC([N+]([O-])=O)=C1 AFPHTEQTJZKQAQ-UHFFFAOYSA-N 0.000 description 1
- WTZIRHQYKCHHNN-UHFFFAOYSA-N 4-(dimethylamino)-3-nitrobenzenesulfonic acid Chemical compound CN(C)C1=CC=C(S(O)(=O)=O)C=C1[N+]([O-])=O WTZIRHQYKCHHNN-UHFFFAOYSA-N 0.000 description 1
- ZXBMWJZLUDXEPS-UHFFFAOYSA-N 4-(dimethylamino)-3-nitrobenzoic acid Chemical compound CN(C)C1=CC=C(C(O)=O)C=C1[N+]([O-])=O ZXBMWJZLUDXEPS-UHFFFAOYSA-N 0.000 description 1
- ZZNAYFWAXZJITH-UHFFFAOYSA-N 4-amino-3-nitrobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1[N+]([O-])=O ZZNAYFWAXZJITH-UHFFFAOYSA-N 0.000 description 1
- XSFKCGABINPZRK-UHFFFAOYSA-N 4-aminopyrazol-3-one Chemical class NC1=CN=NC1=O XSFKCGABINPZRK-UHFFFAOYSA-N 0.000 description 1
- RPKWNMFDAOACCX-UHFFFAOYSA-N 4-chloro-3-nitrobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 RPKWNMFDAOACCX-UHFFFAOYSA-N 0.000 description 1
- VCHSXYHBMFKRBK-UHFFFAOYSA-N 4771-47-5 Chemical compound OC(=O)C1=CC=CC(Cl)=C1[N+]([O-])=O VCHSXYHBMFKRBK-UHFFFAOYSA-N 0.000 description 1
- QHMVCKFDGPANNT-UHFFFAOYSA-N 5-nitro-2-pyrrolidin-1-ylbenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC([N+]([O-])=O)=CC=C1N1CCCC1 QHMVCKFDGPANNT-UHFFFAOYSA-N 0.000 description 1
- DFXQXFGFOLXAPO-UHFFFAOYSA-N 96-99-1 Chemical compound OC(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 DFXQXFGFOLXAPO-UHFFFAOYSA-N 0.000 description 1
- GHOKWGTUZJEAQD-UHFFFAOYSA-N Chick antidermatitis factor Natural products OCC(C)(C)C(O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 229940051880 analgesics and antipyretics pyrazolones Drugs 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 235000012000 cholesterol Nutrition 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000002563 ionic surfactant Substances 0.000 description 1
- 150000004988 m-phenylenediamines Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229940055726 pantothenic acid Drugs 0.000 description 1
- 235000019161 pantothenic acid Nutrition 0.000 description 1
- 239000011713 pantothenic acid Substances 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 150000003142 primary aromatic amines Chemical class 0.000 description 1
- ZZYXNRREDYWPLN-UHFFFAOYSA-N pyridine-2,3-diamine Chemical class NC1=CC=CN=C1N ZZYXNRREDYWPLN-UHFFFAOYSA-N 0.000 description 1
- 210000004761 scalp Anatomy 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 210000004243 sweat Anatomy 0.000 description 1
- BSVBQGMMJUBVOD-UHFFFAOYSA-N trisodium borate Chemical compound [Na+].[Na+].[Na+].[O-]B([O-])[O-] BSVBQGMMJUBVOD-UHFFFAOYSA-N 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/30—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds
- A61K8/40—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds containing nitrogen
- A61K8/41—Amines
- A61K8/418—Amines containing nitro groups
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q5/00—Preparations for care of the hair
- A61Q5/06—Preparations for styling the hair, e.g. by temporary shaping or colouring
- A61Q5/065—Preparations for temporary colouring the hair, e.g. direct dyes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/14—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D295/155—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with the ring nitrogen atoms and the carbon atoms with three bonds to hetero atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Animal Behavior & Ethology (AREA)
- Birds (AREA)
- Epidemiology (AREA)
- Cosmetics (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
- Treating Waste Gases (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843425151 DE3425151A1 (de) | 1984-07-07 | 1984-07-07 | Haarfaerbemittel |
| EP85108107A EP0170069B1 (de) | 1984-07-07 | 1985-06-29 | Haarfärbemittel |
| DE8585108107T DE3573531D1 (en) | 1984-07-07 | 1985-06-29 | Hair-dyeing compositions |
| AT85108107T ATE47033T1 (de) | 1984-07-07 | 1985-06-29 | Haarfaerbemittel. |
| DK309885A DK163564C (da) | 1984-07-07 | 1985-07-05 | Haarfarvemiddel med indhold af direkte virkende haarfarvestoffer |
| JP14688685A JPS6124513A (ja) | 1984-07-07 | 1985-07-05 | 染毛剤 |
| NO852731A NO167437C (no) | 1984-07-07 | 1985-07-05 | Anvendelse av nitrobenzenderivater som direkte paatrekkende haarfarvestoffer |
| FI852675A FI80208C (fi) | 1984-07-07 | 1985-07-05 | Haorfaerger. |
| US06/752,889 US4619666A (en) | 1984-07-07 | 1985-07-08 | Hair dyes containing amino-nitrobenzoic acid or amino-nitrobenzene sulfonic acids as substantive dyes |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843425151 DE3425151A1 (de) | 1984-07-07 | 1984-07-07 | Haarfaerbemittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3425151A1 true DE3425151A1 (de) | 1986-01-16 |
Family
ID=6240139
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19843425151 Withdrawn DE3425151A1 (de) | 1984-07-07 | 1984-07-07 | Haarfaerbemittel |
| DE8585108107T Expired DE3573531D1 (en) | 1984-07-07 | 1985-06-29 | Hair-dyeing compositions |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8585108107T Expired DE3573531D1 (en) | 1984-07-07 | 1985-06-29 | Hair-dyeing compositions |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4619666A (https=) |
| EP (1) | EP0170069B1 (https=) |
| JP (1) | JPS6124513A (https=) |
| AT (1) | ATE47033T1 (https=) |
| DE (2) | DE3425151A1 (https=) |
| DK (1) | DK163564C (https=) |
| FI (1) | FI80208C (https=) |
| NO (1) | NO167437C (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1994012149A1 (de) * | 1992-12-03 | 1994-06-09 | Henkel Kommanditgesellschaft Auf Aktien | Allylamino-nitroaromaten |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3706223A1 (de) * | 1987-02-26 | 1988-09-08 | Henkel Kgaa | Haarfaerbemittel mit direktziehenden nitrodiphenylamin-derivaten |
| JPH0794372B2 (ja) * | 1987-12-22 | 1995-10-11 | ホーユー株式会社 | クリーム状染毛剤第1剤組成物 |
| US4980158A (en) * | 1989-04-04 | 1990-12-25 | Clairol Incorporated | Nitroaniline dyes with a cyano substituent group |
| US5171889A (en) * | 1990-10-31 | 1992-12-15 | Clairol Incorporated | Compositions containing nitroaniline dyes having a carbamide substituent group |
| US5042988A (en) * | 1990-10-31 | 1991-08-27 | Clairol Incorporated | Compositions containing nitroaniline dyes having a carbamide substituent group |
| DE4115983A1 (de) * | 1991-05-16 | 1992-11-19 | Henkel Kgaa | Haarfaerbemittel |
| JP3013948B2 (ja) * | 1992-03-27 | 2000-02-28 | 株式会社資生堂 | 頭髪用酸性染毛料組成物 |
| DE10036748A1 (de) * | 2000-07-28 | 2002-02-07 | Henkel Kgaa | Pyrrolylsubstituierte Nitrophenole als Direktfarbstoffe |
| WO2012021733A2 (en) * | 2010-08-12 | 2012-02-16 | Pacific Biosciences Of California, Inc. | Photodamage mitigation compounds and systems |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE204884C (https=) * | ||||
| DE418989C (de) * | 1923-12-14 | 1925-09-17 | Farbenfab Vorm Bayer F & Co | Verfahren zum Faerben von kuenstlicher Seide aus Celluloseestern und -aethern oder ihren Umwandlungsprodukten |
| FR1310072A (https=) * | 1964-06-12 | 1963-03-04 | ||
| US4417896A (en) * | 1974-11-05 | 1983-11-29 | Societe Anonyme Dite: L'oreal | Hair dye compositions and new compounds useful therein |
| US4066457A (en) * | 1974-12-10 | 1978-01-03 | Gaf Corporation | Color developer for diffusion transfer |
| LU76819A1 (https=) * | 1977-02-22 | 1978-10-18 | ||
| LU83686A1 (fr) * | 1981-10-08 | 1983-06-08 | Oreal | Composition tinctoriale pour fibres keratiniques a base de colorants nitres benzeniques |
-
1984
- 1984-07-07 DE DE19843425151 patent/DE3425151A1/de not_active Withdrawn
-
1985
- 1985-06-29 EP EP85108107A patent/EP0170069B1/de not_active Expired
- 1985-06-29 DE DE8585108107T patent/DE3573531D1/de not_active Expired
- 1985-06-29 AT AT85108107T patent/ATE47033T1/de not_active IP Right Cessation
- 1985-07-05 FI FI852675A patent/FI80208C/fi not_active IP Right Cessation
- 1985-07-05 NO NO852731A patent/NO167437C/no unknown
- 1985-07-05 JP JP14688685A patent/JPS6124513A/ja active Granted
- 1985-07-05 DK DK309885A patent/DK163564C/da not_active IP Right Cessation
- 1985-07-08 US US06/752,889 patent/US4619666A/en not_active Expired - Lifetime
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1994012149A1 (de) * | 1992-12-03 | 1994-06-09 | Henkel Kommanditgesellschaft Auf Aktien | Allylamino-nitroaromaten |
| US5685881A (en) * | 1992-12-03 | 1997-11-11 | Henkel Kommanditgesellschaft Auf Aktien | Aromatic allylaminonitro compounds, hair dye compositions containing aromatic allylaminonitio compounds, and synthetic and natural fiber dyeing process |
Also Published As
| Publication number | Publication date |
|---|---|
| EP0170069B1 (de) | 1989-10-11 |
| DK163564B (da) | 1992-03-16 |
| DK163564C (da) | 1992-08-03 |
| NO167437C (no) | 1991-11-06 |
| FI80208B (fi) | 1990-01-31 |
| DK309885D0 (da) | 1985-07-05 |
| JPS6124513A (ja) | 1986-02-03 |
| DK309885A (da) | 1986-01-08 |
| FI852675A0 (fi) | 1985-07-05 |
| JPH0469604B2 (https=) | 1992-11-06 |
| FI80208C (fi) | 1990-05-10 |
| EP0170069A1 (de) | 1986-02-05 |
| ATE47033T1 (de) | 1989-10-15 |
| NO852731L (no) | 1986-01-08 |
| NO167437B (no) | 1991-07-29 |
| FI852675L (fi) | 1986-01-08 |
| DE3573531D1 (en) | 1989-11-16 |
| US4619666A (en) | 1986-10-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0039030B1 (de) | Neue Kupplerkomponenten für Oxidationshaarfarben, deren Herstellung und Verwendung sowie diese enthaltende Haarfärbemittel | |
| DE2715680A1 (de) | Haarfaerbemittel | |
| EP0170069B1 (de) | Haarfärbemittel | |
| EP0106987B1 (de) | Haarfärbemittel | |
| EP0353531B1 (de) | Haarfärbemittel | |
| DE10036748A1 (de) | Pyrrolylsubstituierte Nitrophenole als Direktfarbstoffe | |
| EP0063736A2 (de) | Verwendung von Dihydroxypyridinen als Kupplerkomponente in Oxidationshaarfarbstoffen und Haarfärbemittel | |
| EP0106089A1 (de) | Haarfärbemittel | |
| EP0220613B1 (de) | Haarfärbemittel mit direktziehenden Nitrodiphenylamin-Derivaten | |
| DE3545245A1 (de) | Haarfaerbemittel mit direktziehenden azomethinfarbstoffen | |
| WO1990012562A1 (de) | Haarfärbemittel | |
| EP0282749B1 (de) | Haarfärbemittel mit direktziehenden Nitrodiphenylamin-Derivaten | |
| EP0280187B1 (de) | Haarfärbemittel mit direktziehenden Nitrodiphenylamin-Derivaten | |
| DE2719424A1 (de) | Haarfaerbemittel | |
| EP0583324B1 (de) | Haarfärbemittel | |
| EP0220614B1 (de) | Haarfärbemittel mit direktziehenden Nitrodiphenylamin-Derivaten | |
| EP0144740B1 (de) | Haarfärbemittel | |
| EP0280186B1 (de) | Haarfärbemittel mit direktziehenden Nitrodiphenylamin-Derivaten | |
| DE2934329A1 (de) | Neue kupplerkomponenten fuer oxidationshaarfarben, deren herstellung sowie diese enthaltende haarfaerbemittel. | |
| DE2554456A1 (de) | Haarfaerbemittel | |
| DE3045959A1 (de) | "neue kupplerkomponenten fuer oxidationshaarfarben, deren herstellung und verwendung, sowie diese enthaltende haarfaerbemittel | |
| DE3313905A1 (de) | Neue 2.4-diaminophenolether als kuppler fuer oxidationshaarfaerbemittel | |
| DE3433594A1 (de) | Aminodiphenylamine und diese enthaltende haarfaerbemittel | |
| DE4240425A1 (de) | Nitrosubstituierte Heterocyclen als Färbemittel für Fasern natürlichen Ursprungs und synthetische Fasern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8136 | Disposal/non-payment of the fee for publication/grant |