DE3318401A1 - Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten polyarylensulfiden - Google Patents
Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten polyarylensulfidenInfo
- Publication number
- DE3318401A1 DE3318401A1 DE19833318401 DE3318401A DE3318401A1 DE 3318401 A1 DE3318401 A1 DE 3318401A1 DE 19833318401 DE19833318401 DE 19833318401 DE 3318401 A DE3318401 A DE 3318401A DE 3318401 A1 DE3318401 A1 DE 3318401A1
- Authority
- DE
- Germany
- Prior art keywords
- mol
- sulfides
- formula
- aromatic
- organic solvent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000000034 method Methods 0.000 title claims description 19
- 238000004519 manufacturing process Methods 0.000 title description 5
- 150000003568 thioethers Chemical class 0.000 title 1
- 150000004763 sulfides Chemical class 0.000 claims description 26
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 18
- 229920000412 polyarylene Polymers 0.000 claims description 17
- 239000003513 alkali Substances 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 125000003118 aryl group Chemical group 0.000 claims description 9
- 229910052757 nitrogen Inorganic materials 0.000 claims description 8
- ZWXPDGCFMMFNRW-UHFFFAOYSA-N N-methylcaprolactam Chemical compound CN1CCCCCC1=O ZWXPDGCFMMFNRW-UHFFFAOYSA-N 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 239000003495 polar organic solvent Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 239000003960 organic solvent Substances 0.000 claims description 5
- 150000001491 aromatic compounds Chemical class 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 4
- 239000006184 cosolvent Substances 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- 229910001854 alkali hydroxide Inorganic materials 0.000 claims description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Chemical group 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- -1 halogen aromatic compounds Chemical class 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 229910052979 sodium sulfide Inorganic materials 0.000 claims description 3
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 150000003857 carboxamides Chemical class 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 150000003951 lactams Chemical class 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 23
- PBKONEOXTCPAFI-UHFFFAOYSA-N 1,2,4-trichlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1 PBKONEOXTCPAFI-UHFFFAOYSA-N 0.000 description 21
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 19
- 239000011734 sodium Substances 0.000 description 12
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 11
- 239000000203 mixture Substances 0.000 description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- 229940117389 dichlorobenzene Drugs 0.000 description 10
- 239000002904 solvent Substances 0.000 description 9
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 8
- 239000000155 melt Substances 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 230000000052 comparative effect Effects 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 239000004734 Polyphenylene sulfide Substances 0.000 description 4
- 229910052977 alkali metal sulfide Inorganic materials 0.000 description 4
- TWKKUWBBCHHMLT-UHFFFAOYSA-N disodium;sulfide;trihydrate Chemical compound O.O.O.[Na+].[Na+].[S-2] TWKKUWBBCHHMLT-UHFFFAOYSA-N 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- 229920000069 polyphenylene sulfide Polymers 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 125000006413 ring segment Chemical group 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- SWJPEBQEEAHIGZ-UHFFFAOYSA-N 1,4-dibromobenzene Chemical compound BrC1=CC=C(Br)C=C1 SWJPEBQEEAHIGZ-UHFFFAOYSA-N 0.000 description 2
- GWCFTYITFDWLAY-UHFFFAOYSA-N 1-ethylazepan-2-one Chemical compound CCN1CCCCCC1=O GWCFTYITFDWLAY-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- DPLVEEXVKBWGHE-UHFFFAOYSA-N potassium sulfide Chemical compound [S-2].[K+].[K+] DPLVEEXVKBWGHE-UHFFFAOYSA-N 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- NAQWICRLNQSPPW-UHFFFAOYSA-N 1,2,3,4-tetrachloronaphthalene Chemical compound C1=CC=CC2=C(Cl)C(Cl)=C(Cl)C(Cl)=C21 NAQWICRLNQSPPW-UHFFFAOYSA-N 0.000 description 1
- LHOGNQZQKDZOBP-UHFFFAOYSA-N 1,2,3-trichloro-4-methylbenzene Chemical compound CC1=CC=C(Cl)C(Cl)=C1Cl LHOGNQZQKDZOBP-UHFFFAOYSA-N 0.000 description 1
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 1
- QEPTXDCPBXMWJC-UHFFFAOYSA-N 1,2,3-trichloronaphthalene Chemical compound C1=CC=C2C(Cl)=C(Cl)C(Cl)=CC2=C1 QEPTXDCPBXMWJC-UHFFFAOYSA-N 0.000 description 1
- JHBKHLUZVFWLAG-UHFFFAOYSA-N 1,2,4,5-tetrachlorobenzene Chemical compound ClC1=CC(Cl)=C(Cl)C=C1Cl JHBKHLUZVFWLAG-UHFFFAOYSA-N 0.000 description 1
- FWAJPSIPOULHHH-UHFFFAOYSA-N 1,2,4-tribromobenzene Chemical compound BrC1=CC=C(Br)C(Br)=C1 FWAJPSIPOULHHH-UHFFFAOYSA-N 0.000 description 1
- UZYYBZNZSSNYSA-UHFFFAOYSA-N 1,2,4-trichloro-3-methylbenzene Chemical compound CC1=C(Cl)C=CC(Cl)=C1Cl UZYYBZNZSSNYSA-UHFFFAOYSA-N 0.000 description 1
- MRJBOPVWPORBKZ-UHFFFAOYSA-N 1,2,4-trichloronaphthalene Chemical compound C1=CC=CC2=C(Cl)C(Cl)=CC(Cl)=C21 MRJBOPVWPORBKZ-UHFFFAOYSA-N 0.000 description 1
- AAUJSCRITBXDJH-UHFFFAOYSA-N 1,2,6-trichloronaphthalene Chemical compound ClC1=C(Cl)C=CC2=CC(Cl)=CC=C21 AAUJSCRITBXDJH-UHFFFAOYSA-N 0.000 description 1
- PNHUHPSIWGBXDF-UHFFFAOYSA-N 1,3,5-trichloro-2,4-dihydrotriazine Chemical compound ClN1CC(Cl)=CN(Cl)N1 PNHUHPSIWGBXDF-UHFFFAOYSA-N 0.000 description 1
- OFHDZEYCBJGZEF-UHFFFAOYSA-N 1,4-dibromo-2-(4-methylphenyl)benzene Chemical compound C1=CC(C)=CC=C1C1=CC(Br)=CC=C1Br OFHDZEYCBJGZEF-UHFFFAOYSA-N 0.000 description 1
- OMHJVVBCCMLFMY-UHFFFAOYSA-N 1,4-dibromo-2-ethylbenzene Chemical compound CCC1=CC(Br)=CC=C1Br OMHJVVBCCMLFMY-UHFFFAOYSA-N 0.000 description 1
- MHQCPXUMZCNOSF-UHFFFAOYSA-N 1,4-dibromo-2-phenylbenzene Chemical compound BrC1=CC=C(Br)C(C=2C=CC=CC=2)=C1 MHQCPXUMZCNOSF-UHFFFAOYSA-N 0.000 description 1
- BFGDCPOTPZOVHM-UHFFFAOYSA-N 1,4-dichloro-2-cyclohexylbenzene Chemical compound ClC1=CC=C(Cl)C(C2CCCCC2)=C1 BFGDCPOTPZOVHM-UHFFFAOYSA-N 0.000 description 1
- GAHDDNITQFTXQC-UHFFFAOYSA-N 1,4-dichloro-2-hexylbenzene Chemical compound CCCCCCC1=CC(Cl)=CC=C1Cl GAHDDNITQFTXQC-UHFFFAOYSA-N 0.000 description 1
- KFAKZJUYBOYVKA-UHFFFAOYSA-N 1,4-dichloro-2-methylbenzene Chemical compound CC1=CC(Cl)=CC=C1Cl KFAKZJUYBOYVKA-UHFFFAOYSA-N 0.000 description 1
- BTGSQYQDTHZFCM-UHFFFAOYSA-N 1-bromo-4-chloro-2-ethylbenzene Chemical compound CCC1=CC(Cl)=CC=C1Br BTGSQYQDTHZFCM-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- FUNUTBJJKQIVSY-UHFFFAOYSA-N 2,4-Dichlorotoluene Chemical compound CC1=CC=C(Cl)C=C1Cl FUNUTBJJKQIVSY-UHFFFAOYSA-N 0.000 description 1
- CWZVGUOYTWYNJC-UHFFFAOYSA-N 2,4-dibromo-1-propan-2-ylbenzene Chemical compound CC(C)C1=CC=C(Br)C=C1Br CWZVGUOYTWYNJC-UHFFFAOYSA-N 0.000 description 1
- BBBFSPBYVBEIJU-UHFFFAOYSA-N 2,4-dichloro-1-(4-methylphenyl)benzene Chemical compound C1=CC(C)=CC=C1C1=CC=C(Cl)C=C1Cl BBBFSPBYVBEIJU-UHFFFAOYSA-N 0.000 description 1
- UADLUJIUAQAUHR-UHFFFAOYSA-N 2,5-dichloro-5,6-dimethylcyclohexa-1,3-diene Chemical group CC1C=C(Cl)C=CC1(C)Cl UADLUJIUAQAUHR-UHFFFAOYSA-N 0.000 description 1
- KKQWHYGECTYFIA-UHFFFAOYSA-N 2,5-dichlorobiphenyl Chemical compound ClC1=CC=C(Cl)C(C=2C=CC=CC=2)=C1 KKQWHYGECTYFIA-UHFFFAOYSA-N 0.000 description 1
- MZDTUPMGADIXBA-UHFFFAOYSA-N 2,6-dichloro-5,6-dimethylcyclohexa-1,3-diene Chemical group CC1C=CC(Cl)=CC1(C)Cl MZDTUPMGADIXBA-UHFFFAOYSA-N 0.000 description 1
- XWUCFAJNVTZRLE-UHFFFAOYSA-N 7-thiabicyclo[2.2.1]hepta-1,3,5-triene Chemical compound C1=C(S2)C=CC2=C1 XWUCFAJNVTZRLE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 238000010101 extrusion blow moulding Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000006082 mold release agent Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- AHKSSQDILPRNLA-UHFFFAOYSA-N rubidium(1+);sulfide Chemical compound [S-2].[Rb+].[Rb+] AHKSSQDILPRNLA-UHFFFAOYSA-N 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 150000004684 trihydrates Chemical class 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G75/00—Macromolecular compounds obtained by reactions forming a linkage containing sulfur with or without nitrogen, oxygen, or carbon in the main chain of the macromolecule
- C08G75/02—Polythioethers
- C08G75/0204—Polyarylenethioethers
- C08G75/025—Preparatory processes
- C08G75/0254—Preparatory processes using metal sulfides
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G75/00—Macromolecular compounds obtained by reactions forming a linkage containing sulfur with or without nitrogen, oxygen, or carbon in the main chain of the macromolecule
- C08G75/02—Polythioethers
- C08G75/0204—Polyarylenethioethers
- C08G75/0231—Polyarylenethioethers containing chain-terminating or chain-branching agents
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833318401 DE3318401A1 (de) | 1983-05-20 | 1983-05-20 | Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten polyarylensulfiden |
| DE8484105162T DE3473285D1 (en) | 1983-05-20 | 1984-05-08 | Process for the preparation of high-molecular polyarylene sulfides which may be branched |
| EP84105162A EP0126369B2 (de) | 1983-05-20 | 1984-05-08 | Verfahren zur Herstellung von hochmolekularen, gegebenenfalls verzweigten Polyarylensulfiden |
| JP59097626A JPS59221332A (ja) | 1983-05-20 | 1984-05-17 | 高分子量の任意に分枝鎖状であつてもよいポリ硫化アリ−レン類の製造方法 |
| CA000454636A CA1248689A (en) | 1983-05-20 | 1984-05-18 | Process for the preparation of high molecular weight, optionally branched polyarylene sulphides |
| US06/815,532 US4663430A (en) | 1983-05-20 | 1986-01-02 | Process for the preparation of high molecular weight polyarylene sulphide in the absence of water |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833318401 DE3318401A1 (de) | 1983-05-20 | 1983-05-20 | Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten polyarylensulfiden |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3318401A1 true DE3318401A1 (de) | 1984-11-22 |
| DE3318401C2 DE3318401C2 (enExample) | 1991-01-17 |
Family
ID=6199485
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19833318401 Granted DE3318401A1 (de) | 1983-05-20 | 1983-05-20 | Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten polyarylensulfiden |
| DE8484105162T Expired DE3473285D1 (en) | 1983-05-20 | 1984-05-08 | Process for the preparation of high-molecular polyarylene sulfides which may be branched |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8484105162T Expired DE3473285D1 (en) | 1983-05-20 | 1984-05-08 | Process for the preparation of high-molecular polyarylene sulfides which may be branched |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4663430A (enExample) |
| EP (1) | EP0126369B2 (enExample) |
| JP (1) | JPS59221332A (enExample) |
| CA (1) | CA1248689A (enExample) |
| DE (2) | DE3318401A1 (enExample) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0215259A1 (de) * | 1985-08-13 | 1987-03-25 | Bayer Ag | Verfahren zur Herstellung von hochmolekularen, gegebenenfalls verzweigten Polyarylensulfiden |
| US4804689A (en) * | 1986-07-02 | 1989-02-14 | Bayer Aktiengesellschaft | Process for holding and foaming thermoplastic polyphenylene sulphide articles and the resultant products |
| US4816335A (en) * | 1985-03-22 | 1989-03-28 | Kureha Kagaku Kogyo Kabushiki Kaisha | High-quality polyarylene-thioether fibers and method for production thereof |
| US5288848A (en) * | 1985-08-17 | 1994-02-22 | Bayer Aktiengesellschaft | Process for preparation of high molecular weight, optionally branched polyarylene sulphides |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3587463D1 (de) * | 1984-08-07 | 1993-08-26 | Bayer Ag | Polyphenylensulfide, verfahren zur herstellung der polyphenylensulfide und deren verwendung. |
| JPH0621168B2 (ja) * | 1985-08-27 | 1994-03-23 | 呉羽化学工業株式会社 | 溶融結晶化温度の高いポリアリ−レンチオエ−テルの製造法 |
| JPH0649761B2 (ja) * | 1985-12-18 | 1994-06-29 | 東ソー株式会社 | ポリフエニレンサルフアイドの製造方法 |
| DE3701068A1 (de) * | 1987-01-16 | 1988-07-28 | Bayer Ag | Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten polyarylensulfiden |
| US4786711A (en) * | 1987-01-23 | 1988-11-22 | Phillips Petroleum Company | P-phenylene sulfide polymer preparation with dehydrated mixture of alkali metal hydroxide and excess alkali metal bisulfide |
| US4882416A (en) * | 1987-02-24 | 1989-11-21 | Phillips Petroleum Company | Preparation of poly arylene sulfide with specified ratio of sulfur source to cyclic organic amide |
| US4767841A (en) * | 1987-02-24 | 1988-08-30 | Phillips Petroleum Company | Arylene sulfide polymer preparation from dehydrated admixture comprising sulfur source, cyclic amide solvent and water |
| DE3730690A1 (de) * | 1987-09-12 | 1989-03-23 | Bayer Ag | Verfahren zur herstellung von aromatischen polyetherketonen |
| DE3808496A1 (de) * | 1988-03-15 | 1989-09-28 | Bayer Ag | Neue hochmolekulare, gegebenenfalls verzweigte co-polyarylensulfide, verfahren zu deren herstellung und deren verwendung |
| DE3808738A1 (de) * | 1988-03-16 | 1989-10-05 | Bayer Ag | Ueberzuege mit polyarylensulfiden |
| MY109689A (en) * | 1988-08-05 | 1997-04-30 | Idemitsu Petrochemical Company Ltd | Polyarlene sulfides, a process for preparing the same and a resin composition containing the same. |
| US5231163A (en) * | 1988-08-05 | 1993-07-27 | Idemitsu Petrochemical Company, Ltd. | Polyarylene sulfide from aromatic compound having at least three functional groups |
| US5155207A (en) * | 1988-12-29 | 1992-10-13 | Phillips Petroleum Company | Arylene sulfide polymers and articles of manufacture |
| JP3019106B2 (ja) * | 1990-10-08 | 2000-03-13 | 東ソー株式会社 | ポリアリ―レンスルフィドの製造方法 |
| EP0547718B1 (en) * | 1991-12-17 | 1999-03-17 | Tonen Chemical Corporation | Process for the preparation of polyarylene sulfide |
Citations (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3524835A (en) * | 1963-11-27 | 1970-08-18 | Phillips Petroleum Co | Heat treatment of poly(arylene sulfide) resins |
| US3790536A (en) * | 1972-09-18 | 1974-02-05 | Phillips Petroleum Co | Arylene sulfide polymer process |
| US3839301A (en) * | 1973-07-23 | 1974-10-01 | Phillips Petroleum Co | Poly(arylene sulfide) resin heat treatment and curing |
| DE2623333A1 (de) * | 1975-05-27 | 1976-12-09 | Phillips Petroleum Co | Verfahren zur herstellung von arylensulfidpolymeren |
| DE2623363A1 (de) * | 1975-05-27 | 1976-12-09 | Phillips Petroleum Co | Verfahren zum herstellen von verzweigten arylensulfidpolymeren |
| DE2623362A1 (de) * | 1975-05-27 | 1976-12-09 | Phillips Petroleum Co | Verfahren zur herstellung von arylensulfidpolymeren |
| US4038259A (en) * | 1975-05-27 | 1977-07-26 | Phillips Petroleum Company | Production of p-phenylene sulfide polymers |
| US4038260A (en) * | 1975-05-27 | 1977-07-26 | Phillips Petroleum Company | Production of p-phenylene sulfide polymers |
| US4056515A (en) * | 1976-03-30 | 1977-11-01 | Phillips Petroleum Company | Continuous reaction for preparation of arylene sulfide polymer |
| US4060520A (en) * | 1976-03-30 | 1977-11-29 | Phillips Petroleum Company | Continuous reaction for preparation of arylene sulfide polymer |
| US4064114A (en) * | 1975-05-27 | 1977-12-20 | Phillips Petroleum Company | Production of arylene sulfide polymers |
| US4116947A (en) * | 1977-04-29 | 1978-09-26 | Phillips Petroleum Company | Branched arylene sulfide polymer production |
| DE2453749B2 (de) * | 1973-11-19 | 1979-09-06 | Phillips Petroleum Co., Bartlesville, Okla. (V.St.A.) | Verfahren zur Herstellung eines P-Phenylensulfidpolymeren und dessen Verwendung |
| DE2453485B2 (de) * | 1973-11-19 | 1980-02-28 | Phillips Petroleum Co., Bartlesville, Okla. (V.St.A.) | Phenylensulfidpolymere, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE2930797A1 (de) * | 1979-07-28 | 1981-02-12 | Bayer Ag | Verfahren zur herstellung von polyarylensulfiden |
| DE2930710A1 (de) * | 1979-07-28 | 1981-02-19 | Bayer Ag | Verfahren zur herstellung von polyarylensulfiden |
| DE3030488A1 (de) * | 1979-08-14 | 1981-03-26 | Phillips Petroleum Co., Bartlesville, Okla. | Verfahren zur herstellung von verzweigten arylensulfidpolymeren |
| DE3019732A1 (de) * | 1980-05-23 | 1981-12-03 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von polyarylensulfiden |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3354129A (en) * | 1963-11-27 | 1967-11-21 | Phillips Petroleum Co | Production of polymers from aromatic compounds |
| US4232142A (en) * | 1965-09-24 | 1980-11-04 | Imperial Chemical Industries Limited | Production of polyarylene ether sulphones and ketones |
| DE3120538A1 (de) * | 1981-05-22 | 1982-12-09 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von polyarylensulfiden |
| US4368321A (en) * | 1981-09-01 | 1983-01-11 | Phillips Petroleum Company | Elevated, declining pressure dehydration of poly(arylene sulfide) prepolymerization mixture |
| US4371671A (en) * | 1981-09-01 | 1983-02-01 | Phillips Petroleum Company | Controlled, elevated pressure dehydration of poly(arylene sulfide) prepolymerization mixture |
| US4373090A (en) * | 1982-02-16 | 1983-02-08 | Phillips Petroleum Company | Arylene sulfide polymer preparation |
| JPS59189125A (ja) * | 1983-04-11 | 1984-10-26 | Kureha Chem Ind Co Ltd | 芳香族スルフイド重合体の製造方法 |
| US4495332A (en) * | 1982-07-29 | 1985-01-22 | Kureha Kagaku Kogyo Kabushiki Kaisha | Process for producing aromatic sulfide polymers |
| DE3338501A1 (de) * | 1983-10-22 | 1985-05-02 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten polyarylensulfiden |
| DE3410642A1 (de) * | 1984-03-23 | 1985-09-26 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten polyarylensulfiden |
-
1983
- 1983-05-20 DE DE19833318401 patent/DE3318401A1/de active Granted
-
1984
- 1984-05-08 EP EP84105162A patent/EP0126369B2/de not_active Expired - Lifetime
- 1984-05-08 DE DE8484105162T patent/DE3473285D1/de not_active Expired
- 1984-05-17 JP JP59097626A patent/JPS59221332A/ja active Pending
- 1984-05-18 CA CA000454636A patent/CA1248689A/en not_active Expired
-
1986
- 1986-01-02 US US06/815,532 patent/US4663430A/en not_active Expired - Fee Related
Patent Citations (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3524835A (en) * | 1963-11-27 | 1970-08-18 | Phillips Petroleum Co | Heat treatment of poly(arylene sulfide) resins |
| US3790536A (en) * | 1972-09-18 | 1974-02-05 | Phillips Petroleum Co | Arylene sulfide polymer process |
| US3839301A (en) * | 1973-07-23 | 1974-10-01 | Phillips Petroleum Co | Poly(arylene sulfide) resin heat treatment and curing |
| DE2453485B2 (de) * | 1973-11-19 | 1980-02-28 | Phillips Petroleum Co., Bartlesville, Okla. (V.St.A.) | Phenylensulfidpolymere, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE2453749B2 (de) * | 1973-11-19 | 1979-09-06 | Phillips Petroleum Co., Bartlesville, Okla. (V.St.A.) | Verfahren zur Herstellung eines P-Phenylensulfidpolymeren und dessen Verwendung |
| DE2623362A1 (de) * | 1975-05-27 | 1976-12-09 | Phillips Petroleum Co | Verfahren zur herstellung von arylensulfidpolymeren |
| US4064114A (en) * | 1975-05-27 | 1977-12-20 | Phillips Petroleum Company | Production of arylene sulfide polymers |
| US4038259A (en) * | 1975-05-27 | 1977-07-26 | Phillips Petroleum Company | Production of p-phenylene sulfide polymers |
| US4038261A (en) * | 1975-05-27 | 1977-07-26 | Phillips Petroleum Company | Production of branched arylene sulfide polymers |
| US4038260A (en) * | 1975-05-27 | 1977-07-26 | Phillips Petroleum Company | Production of p-phenylene sulfide polymers |
| DE2623333A1 (de) * | 1975-05-27 | 1976-12-09 | Phillips Petroleum Co | Verfahren zur herstellung von arylensulfidpolymeren |
| DE2623363A1 (de) * | 1975-05-27 | 1976-12-09 | Phillips Petroleum Co | Verfahren zum herstellen von verzweigten arylensulfidpolymeren |
| US4038262A (en) * | 1975-05-27 | 1977-07-26 | Phillips Petroleum Company | Production of arylene sulfide polymers |
| US4060520A (en) * | 1976-03-30 | 1977-11-29 | Phillips Petroleum Company | Continuous reaction for preparation of arylene sulfide polymer |
| US4056515A (en) * | 1976-03-30 | 1977-11-01 | Phillips Petroleum Company | Continuous reaction for preparation of arylene sulfide polymer |
| US4116947A (en) * | 1977-04-29 | 1978-09-26 | Phillips Petroleum Company | Branched arylene sulfide polymer production |
| DE2930797A1 (de) * | 1979-07-28 | 1981-02-12 | Bayer Ag | Verfahren zur herstellung von polyarylensulfiden |
| DE2930710A1 (de) * | 1979-07-28 | 1981-02-19 | Bayer Ag | Verfahren zur herstellung von polyarylensulfiden |
| DE3030488A1 (de) * | 1979-08-14 | 1981-03-26 | Phillips Petroleum Co., Bartlesville, Okla. | Verfahren zur herstellung von verzweigten arylensulfidpolymeren |
| US4282347A (en) * | 1979-08-14 | 1981-08-04 | Phillips Petroleum Company | Preparation of branched polymers of arylene sulfide |
| DE3019732A1 (de) * | 1980-05-23 | 1981-12-03 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von polyarylensulfiden |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4816335A (en) * | 1985-03-22 | 1989-03-28 | Kureha Kagaku Kogyo Kabushiki Kaisha | High-quality polyarylene-thioether fibers and method for production thereof |
| EP0215259A1 (de) * | 1985-08-13 | 1987-03-25 | Bayer Ag | Verfahren zur Herstellung von hochmolekularen, gegebenenfalls verzweigten Polyarylensulfiden |
| US5118786A (en) * | 1985-08-13 | 1992-06-02 | Bayer Aktiengesellschaft | Process for the preparation of high molecular weight, optionally branched polyarylene sulphides |
| US5288848A (en) * | 1985-08-17 | 1994-02-22 | Bayer Aktiengesellschaft | Process for preparation of high molecular weight, optionally branched polyarylene sulphides |
| US4804689A (en) * | 1986-07-02 | 1989-02-14 | Bayer Aktiengesellschaft | Process for holding and foaming thermoplastic polyphenylene sulphide articles and the resultant products |
Also Published As
| Publication number | Publication date |
|---|---|
| EP0126369A1 (de) | 1984-11-28 |
| EP0126369B1 (de) | 1988-08-10 |
| JPS59221332A (ja) | 1984-12-12 |
| CA1248689A (en) | 1989-01-10 |
| US4663430A (en) | 1987-05-05 |
| EP0126369B2 (de) | 1991-12-18 |
| DE3473285D1 (en) | 1988-09-15 |
| DE3318401C2 (enExample) | 1991-01-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0109637B1 (de) | Verfahren zur Herstellung von hochmolekularen gegebenenfalls verzweigten Polyarylensulfiden | |
| DE3318401C2 (enExample) | ||
| EP0142024B1 (de) | Verfahren zur Herstellung von hochmolekularen, gegebenenfalls verzweigten Polyarylensulfiden | |
| JPH0651792B2 (ja) | ポリ(p−フエニレンスルフイド)の改良製造方法 | |
| EP0121206B1 (de) | Verfahren zur Herstellung von gegebenenfalls verzweigten Polyarylensulfiden | |
| DE3428984A1 (de) | Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten polyarylensulfiden | |
| EP0162210B1 (de) | Verfahren zur Herstellung von hochmolekularen, gegebenenfalls verzweigten Polyarylensulfiden | |
| DE3428986C2 (enExample) | ||
| EP0121205B1 (de) | Verfahren zur Hestellung von gegebenenfalls verzweigten Polyarylensulfiden | |
| EP0108978B1 (de) | Verfahren zur Herstellung von gegebenenfalls verzweigten Polyarylensulfiden | |
| DE3339233A1 (de) | Verfahren zur herstellung von gegebenenfalls verzweigten polyarylensulfiden mit verminderter korrosivitaet | |
| EP0193827B1 (de) | Verfahren zur Herstellung von hochmolekularen Polyarylensulfiden | |
| EP0170921A1 (de) | Faserverstärktes bzw. gefülltes Polyphenylensulfid | |
| EP0215259B1 (de) | Verfahren zur Herstellung von hochmolekularen, gegebenenfalls verzweigten Polyarylensulfiden | |
| DE3738142A1 (de) | Verfahren zur herstellung von polyarylensulfiden mit definiert einstellbaren schmelzviskositaeten | |
| DE3215259A1 (de) | Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten polyarylensulfiden | |
| EP0279217B1 (de) | Verfahren zur Herstellung von Polyarylensulfiden mit regelbaren Schmelzviskositäten | |
| EP0316740A2 (de) | Verfahren zur Herstellung von hochmolekularen, gegebenenfalls verzweigten Polyarylensulfiden | |
| EP0355646A2 (de) | Verfahren zur Herstellung von unverzweigten Polyarylensulfiden mit verbesserter Farbqualität und Farbstabilität | |
| DE3428985C2 (enExample) | ||
| DE4105552A1 (de) | Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten, polyarylensulfiden | |
| EP0305815A2 (de) | Faserverstärktes Polyphenylensulfid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |