DE3311697A1 - Reifenfelge sowie aus reifen und felge bestehendes fahrzeugrad - Google Patents
Reifenfelge sowie aus reifen und felge bestehendes fahrzeugradInfo
- Publication number
- DE3311697A1 DE3311697A1 DE19833311697 DE3311697A DE3311697A1 DE 3311697 A1 DE3311697 A1 DE 3311697A1 DE 19833311697 DE19833311697 DE 19833311697 DE 3311697 A DE3311697 A DE 3311697A DE 3311697 A1 DE3311697 A1 DE 3311697A1
- Authority
- DE
- Germany
- Prior art keywords
- rim
- bead
- tire
- axis
- elevations
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000011324 bead Substances 0.000 claims description 103
- 238000012549 training Methods 0.000 claims description 10
- 230000015572 biosynthetic process Effects 0.000 claims description 3
- RICLFGYGYQXUFH-UHFFFAOYSA-N buspirone hydrochloride Chemical compound [H+].[Cl-].C1C(=O)N(CCCCN2CCN(CC2)C=2N=CC=CN=2)C(=O)CC21CCCC2 RICLFGYGYQXUFH-UHFFFAOYSA-N 0.000 claims 1
- 238000006073 displacement reaction Methods 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 230000008901 benefit Effects 0.000 description 2
- 238000007789 sealing Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 230000004323 axial length Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 239000013536 elastomeric material Substances 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 230000003313 weakening effect Effects 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B60—VEHICLES IN GENERAL
- B60B—VEHICLE WHEELS; CASTORS; AXLES FOR WHEELS OR CASTORS; INCREASING WHEEL ADHESION
- B60B21/00—Rims
- B60B21/10—Rims characterised by the form of tyre-seat or flange, e.g. corrugated
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Tires In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT20495/82A IT1154505B (it) | 1982-03-31 | 1982-03-31 | Cerchio per pneumatici ed assemblaggio col corrispondente pneumatico |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3311697A1 true DE3311697A1 (de) | 1983-10-13 |
Family
ID=11167797
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19833311697 Withdrawn DE3311697A1 (de) | 1982-03-31 | 1983-03-30 | Reifenfelge sowie aus reifen und felge bestehendes fahrzeugrad |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4502521A (enExample) |
| JP (1) | JPS58180303A (enExample) |
| AR (1) | AR230220A1 (enExample) |
| AT (1) | AT386567B (enExample) |
| BR (1) | BR8301763A (enExample) |
| CA (1) | CA1211776A (enExample) |
| CH (1) | CH653622A5 (enExample) |
| DE (1) | DE3311697A1 (enExample) |
| ES (1) | ES271526Y (enExample) |
| FR (1) | FR2524396B1 (enExample) |
| GB (1) | GB2117332B (enExample) |
| GR (1) | GR78158B (enExample) |
| IT (1) | IT1154505B (enExample) |
| SE (1) | SE447644B (enExample) |
| TR (1) | TR21698A (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3320938A1 (de) * | 1982-06-11 | 1983-12-22 | Società Pneumatici Pirelli S.p.A., 20123 Milano | Felge fuer fahrzeugreifen |
| WO1999021727A1 (de) | 1997-10-27 | 1999-05-06 | Michelin Kronprinz Werke Gmbh | Geschweisstes fahrzeugrad |
| DE19962833A1 (de) * | 1999-12-23 | 2001-06-28 | Continental Teves Ag & Co Ohg | SWT-Reifen |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2567457B1 (fr) * | 1984-07-13 | 1989-03-31 | Michelin & Cie | Jante de securite comportant un bossage de retenue axiale du bourrelet de grande hauteur, et ensemble pneumatique utilisant une telle jante |
| DE3467867D1 (en) * | 1984-10-05 | 1988-01-14 | Goodyear Tire & Rubber | Vehicle rim |
| US4606390A (en) * | 1985-08-22 | 1986-08-19 | The Goodyear Tire & Rubber Company | Vehicle rim with tire bead retaining humps |
| GB8617729D0 (en) * | 1986-07-19 | 1986-08-28 | Sp Tyres Uk Ltd | Vehicle wheels |
| EP0432139B1 (en) * | 1986-07-23 | 1997-05-28 | Wacom Company, Ltd. | Position designating device |
| GB8702889D0 (en) * | 1987-02-10 | 1987-03-18 | Sp Tyres Uk Ltd | Wheel rim |
| DE307667T1 (de) * | 1987-08-24 | 1991-09-05 | Wacom Co., Ltd., Saitama | Koordinateneingabesystem mit einem eingabeschreibstift. |
| JPH0723041B2 (ja) * | 1988-12-29 | 1995-03-15 | 株式会社ブリヂストン | タイヤ・ホイール組立体 |
| DE3924600A1 (de) * | 1989-07-25 | 1991-01-31 | Sp Reifenwerke Gmbh | Radfelge fuer fahrzeugluftreifen |
| JP3150685B2 (ja) * | 1990-08-06 | 2001-03-26 | 株式会社ワコム | 可変容量コンデンサ |
| EP0607757B1 (en) * | 1993-01-15 | 1996-08-14 | REYNOLDS WHEELS S.p.A. | Method of fashioning wheels for motor vehicles and the wheels obtained by such a method |
| FR2748695B1 (fr) * | 1996-05-15 | 1998-06-26 | Michelin & Cie | Roue avec jante ayant des sieges inclines vers l'exterieur |
| GB2431141B (en) | 2005-10-12 | 2009-07-29 | Gkn Offhighway Systems Ltd | Wheel construction |
| ATE537012T1 (de) * | 2008-04-04 | 2011-12-15 | Gkn Land Systems Ltd | Radaufbau |
| ATE520546T1 (de) * | 2008-12-02 | 2011-09-15 | Gkn Land Systems Ltd | Radaufbau |
| US8757231B2 (en) * | 2009-01-26 | 2014-06-24 | E. I. Du Pont De Nemours And Company | Elastomer tire sealing ring |
| WO2010140249A1 (ja) * | 2009-06-05 | 2010-12-09 | 中央精機株式会社 | 自動車用ホイール |
| US9481205B2 (en) * | 2011-12-08 | 2016-11-01 | Weld Racing, Llc | Vehicle wheel |
| US20170080749A1 (en) * | 2015-09-23 | 2017-03-23 | Raymond Anderson Scruggs | Optimized Rim For Robust Pneumatic Bicycle Wheel Functionality |
| US11780274B2 (en) * | 2020-01-17 | 2023-10-10 | Wheel Pros Llc | Wheel beadlock design |
| DE202020100517U1 (de) * | 2020-01-30 | 2021-05-04 | Maxion Wheels Holding Gmbh | Felge für Fahrzeugrad und Fahrzeugrad hiermit |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2405141A1 (de) * | 1974-01-31 | 1975-08-14 | Kronprinz Ag | Fahrzeugrad mit tiefbettfelge |
| DE2853633A1 (de) * | 1977-12-19 | 1979-06-28 | Goodyear Tire & Rubber | Rad fuer einen fahrzeug-luftreifen |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE482832C (de) * | 1929-09-21 | Theodor Hahl | Halbtiefbettfelge | |
| US2948568A (en) * | 1958-01-17 | 1960-08-09 | Budd Co | Wheel disk-rim assembly for tubeless tires |
| US3212548A (en) * | 1964-06-02 | 1965-10-19 | George E Drazin | Automobile safety wheel |
| GB1410914A (en) * | 1971-10-02 | 1975-10-22 | Dunlop Ltd | Vehicle wheel rims |
| DE2418751A1 (de) * | 1974-04-18 | 1976-03-18 | Guenther Manfred Pruss | Fahrzeugfelge fuer schlauchlose luftreifen, insbesondere guertelreifen |
| US3977727A (en) * | 1975-06-09 | 1976-08-31 | The B. F. Goodrich Company | Rim with bead unseat restraint |
| GB1563095A (en) * | 1975-09-24 | 1980-03-19 | Dunlop Ltd | Tyre and rim assemblies |
| US4246950A (en) * | 1979-10-11 | 1981-01-27 | The Goodyear Tire & Rubber Company | Asymmetric rim humping |
| IN155019B (enExample) * | 1979-12-06 | 1984-12-22 | Dunlop Ltd |
-
1982
- 1982-03-31 IT IT20495/82A patent/IT1154505B/it active
-
1983
- 1983-03-18 CH CH1493/83A patent/CH653622A5/it not_active IP Right Cessation
- 1983-03-28 GR GR70913A patent/GR78158B/el unknown
- 1983-03-29 GB GB08308590A patent/GB2117332B/en not_active Expired
- 1983-03-29 TR TR21698A patent/TR21698A/xx unknown
- 1983-03-30 US US06/480,329 patent/US4502521A/en not_active Expired - Fee Related
- 1983-03-30 DE DE19833311697 patent/DE3311697A1/de not_active Withdrawn
- 1983-03-30 CA CA000424853A patent/CA1211776A/en not_active Expired
- 1983-03-30 BR BR8301763A patent/BR8301763A/pt not_active IP Right Cessation
- 1983-03-30 AR AR292588A patent/AR230220A1/es active
- 1983-03-30 SE SE8301796A patent/SE447644B/sv not_active IP Right Cessation
- 1983-03-31 JP JP58056796A patent/JPS58180303A/ja active Granted
- 1983-03-31 AT AT0114783A patent/AT386567B/de not_active IP Right Cessation
- 1983-03-31 FR FR8305330A patent/FR2524396B1/fr not_active Expired
- 1983-03-31 ES ES1983271526U patent/ES271526Y/es not_active Expired
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2405141A1 (de) * | 1974-01-31 | 1975-08-14 | Kronprinz Ag | Fahrzeugrad mit tiefbettfelge |
| DE2853633A1 (de) * | 1977-12-19 | 1979-06-28 | Goodyear Tire & Rubber | Rad fuer einen fahrzeug-luftreifen |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3320938A1 (de) * | 1982-06-11 | 1983-12-22 | Società Pneumatici Pirelli S.p.A., 20123 Milano | Felge fuer fahrzeugreifen |
| WO1999021727A1 (de) | 1997-10-27 | 1999-05-06 | Michelin Kronprinz Werke Gmbh | Geschweisstes fahrzeugrad |
| DE19962833A1 (de) * | 1999-12-23 | 2001-06-28 | Continental Teves Ag & Co Ohg | SWT-Reifen |
Also Published As
| Publication number | Publication date |
|---|---|
| CA1211776A (en) | 1986-09-23 |
| ES271526Y (es) | 1984-04-01 |
| IT1154505B (it) | 1987-01-21 |
| CH653622A5 (it) | 1986-01-15 |
| TR21698A (tr) | 1985-03-06 |
| GB2117332A (en) | 1983-10-12 |
| AT386567B (de) | 1988-09-12 |
| ATA114783A (de) | 1988-02-15 |
| FR2524396B1 (fr) | 1985-08-23 |
| AR230220A1 (es) | 1984-03-01 |
| BR8301763A (pt) | 1983-09-06 |
| ES271526U (es) | 1983-10-01 |
| SE8301796D0 (sv) | 1983-03-30 |
| SE447644B (sv) | 1986-12-01 |
| JPS58180303A (ja) | 1983-10-21 |
| GR78158B (enExample) | 1984-09-26 |
| IT8220495A0 (it) | 1982-03-31 |
| JPH0547402B2 (enExample) | 1993-07-16 |
| GB2117332B (en) | 1985-12-18 |
| US4502521A (en) | 1985-03-05 |
| FR2524396A1 (fr) | 1983-10-07 |
| GB8308590D0 (en) | 1983-05-05 |
| SE8301796L (sv) | 1983-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3311697A1 (de) | Reifenfelge sowie aus reifen und felge bestehendes fahrzeugrad | |
| DE3050922C2 (enExample) | ||
| DE1953289C3 (de) | Gürtelluftreifen mit radialer Karkasse | |
| DE3320938C2 (de) | Tiefbettfelge für Fahrzeugreifen | |
| DE69200820T2 (de) | Gewebeverstärkte Versteifungen für Luftfedern. | |
| EP4225594B1 (de) | Fahrzeugluftreifen mit umfangsrille | |
| DE2211054A1 (de) | Luftreifen fur Fahrzeugrader | |
| DE602004010149T2 (de) | Verstärkungsschicht für eine reifenlauffläche | |
| DE69106310T2 (de) | Luftreifen. | |
| DE2724996B2 (de) | Reifen-Felgen-Anordnung | |
| DE102020214281A1 (de) | Fahrzeugluftreifen mit Umfangsrille | |
| EP3974208B1 (de) | Fahrzeugreifen | |
| DE2201623A1 (de) | Fahrzeugreifen mit einer radialen Karkasse,einer Laufflaeche und einem Guertel zwischen der Karkasse und der Laufflaeche | |
| DE2909427A1 (de) | Unsymmetrischer reifen mit radialkarkasse | |
| DE2950718A1 (de) | Luftreifen-radfelgenanordnung | |
| DE2921377A1 (de) | Hochleistungs-luftreifen in radialbauweise | |
| DE3426511C2 (enExample) | ||
| DE2853633C2 (de) | Rad für einen Luftreifen | |
| DE60117070T2 (de) | Luftreifen mit asymmetrischer Gürtelstruktur und Verfahren zum Aufziehen eines Reifens auf einem Fahrzeug | |
| DE2920285C2 (enExample) | ||
| DE60204935T2 (de) | Reifen mit multiplen Karkassenlagen und Reifenwülsten mit einer speziellen Struktur | |
| DE2930835A1 (de) | Reifen-radfelgen-anordnung | |
| DE2910381A1 (de) | Hydraulischer stossdaempfer | |
| EP0588781B1 (de) | Fahrzeugreifen | |
| DE2909391C2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8127 | New person/name/address of the applicant |
Owner name: PIRELLI COORDINAMENTO PNEUMATICI S.P.A., MAILAND/M |
|
| 8110 | Request for examination paragraph 44 | ||
| 8130 | Withdrawal |