DE3305202A1 - Verfahren zur herstellung von fluorierten nitroalkanen - Google Patents
Verfahren zur herstellung von fluorierten nitroalkanenInfo
- Publication number
- DE3305202A1 DE3305202A1 DE19833305202 DE3305202A DE3305202A1 DE 3305202 A1 DE3305202 A1 DE 3305202A1 DE 19833305202 DE19833305202 DE 19833305202 DE 3305202 A DE3305202 A DE 3305202A DE 3305202 A1 DE3305202 A1 DE 3305202A1
- Authority
- DE
- Germany
- Prior art keywords
- mol
- nitroethane
- difluoro
- olefin
- hydrogen fluoride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000004519 manufacturing process Methods 0.000 title 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 claims description 27
- 150000001336 alkenes Chemical class 0.000 claims description 26
- 238000006243 chemical reaction Methods 0.000 claims description 19
- 238000000034 method Methods 0.000 claims description 19
- 229910000040 hydrogen fluoride Inorganic materials 0.000 claims description 15
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims description 14
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 10
- 229910017604 nitric acid Inorganic materials 0.000 claims description 10
- 239000000460 chlorine Substances 0.000 claims description 6
- 238000005260 corrosion Methods 0.000 claims description 6
- 230000007797 corrosion Effects 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- 239000011737 fluorine Substances 0.000 claims description 5
- 125000004971 nitroalkyl group Chemical group 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 239000007864 aqueous solution Substances 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 125000001188 haloalkyl group Chemical group 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical compound [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 claims description 2
- UNKYHDBKTMMJKY-UHFFFAOYSA-N 1,1-dichloro-1-fluoro-2-nitropropane Chemical compound [O-][N+](=O)C(C)C(F)(Cl)Cl UNKYHDBKTMMJKY-UHFFFAOYSA-N 0.000 claims 1
- QEIZZZUXHGSLPS-UHFFFAOYSA-N 1,1-difluoro-2-nitroethane Chemical compound [O-][N+](=O)CC(F)F QEIZZZUXHGSLPS-UHFFFAOYSA-N 0.000 claims 1
- NHPDTTNVDXMRHS-UHFFFAOYSA-N 1-bromo-1-fluoro-2-nitroethane Chemical compound [O-][N+](=O)CC(F)Br NHPDTTNVDXMRHS-UHFFFAOYSA-N 0.000 claims 1
- BPAYPRQVFRQOKR-UHFFFAOYSA-N 1-chloro-1,1-difluoro-2-nitropropane Chemical compound [O-][N+](=O)C(C)C(F)(F)Cl BPAYPRQVFRQOKR-UHFFFAOYSA-N 0.000 claims 1
- QDFSJOQEGXSQLN-UHFFFAOYSA-N 2,2-difluoro-1-nitropropane Chemical compound CC(F)(F)C[N+]([O-])=O QDFSJOQEGXSQLN-UHFFFAOYSA-N 0.000 claims 1
- UENGBOCGGKLVJJ-UHFFFAOYSA-N 2-chloro-1-(2,4-difluorophenyl)ethanone Chemical compound FC1=CC=C(C(=O)CCl)C(F)=C1 UENGBOCGGKLVJJ-UHFFFAOYSA-N 0.000 claims 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- BQCIDUSAKPWEOX-UHFFFAOYSA-N 1,1-Difluoroethene Chemical compound FC(F)=C BQCIDUSAKPWEOX-UHFFFAOYSA-N 0.000 description 3
- 229910000831 Steel Inorganic materials 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 230000002363 herbicidal effect Effects 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000010959 steel Substances 0.000 description 3
- JIKDQMLRRHUBKY-UHFFFAOYSA-N 1,1,1-trifluoro-2-nitroethane Chemical compound [O-][N+](=O)CC(F)(F)F JIKDQMLRRHUBKY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- -1 Polyethylene Polymers 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N Propene Chemical compound CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- LWDGFGTYBDRKHU-UPHRSURJSA-N (e)-1,2-dichloro-1-fluoroethene Chemical compound F\C(Cl)=C/Cl LWDGFGTYBDRKHU-UPHRSURJSA-N 0.000 description 1
- FFTOUVYEKNGDCM-OWOJBTEDSA-N (e)-1,3,3-trifluoroprop-1-ene Chemical compound F\C=C\C(F)F FFTOUVYEKNGDCM-OWOJBTEDSA-N 0.000 description 1
- MIZLGWKEZAPEFJ-UHFFFAOYSA-N 1,1,2-trifluoroethene Chemical compound FC=C(F)F MIZLGWKEZAPEFJ-UHFFFAOYSA-N 0.000 description 1
- QAERDLQYXMEHEB-UHFFFAOYSA-N 1,1,3,3,3-pentafluoroprop-1-ene Chemical compound FC(F)=CC(F)(F)F QAERDLQYXMEHEB-UHFFFAOYSA-N 0.000 description 1
- QGYLHZMNVGBXDQ-UHFFFAOYSA-N 1,1-dichloro-2,3,3,3-tetrafluoroprop-1-ene Chemical compound ClC(Cl)=C(F)C(F)(F)F QGYLHZMNVGBXDQ-UHFFFAOYSA-N 0.000 description 1
- MSHXSYMNYJAOSS-UHFFFAOYSA-N 1,1-dichloro-2-fluoroethene Chemical compound FC=C(Cl)Cl MSHXSYMNYJAOSS-UHFFFAOYSA-N 0.000 description 1
- UAZUEJTXWAXSMA-UHFFFAOYSA-N 1,1-dichlorobut-1-ene Chemical compound CCC=C(Cl)Cl UAZUEJTXWAXSMA-UHFFFAOYSA-N 0.000 description 1
- LGXVIGDEPROXKC-UHFFFAOYSA-N 1,1-dichloroethene Chemical compound ClC(Cl)=C LGXVIGDEPROXKC-UHFFFAOYSA-N 0.000 description 1
- ZAIDIVBQUMFXEC-UHFFFAOYSA-N 1,1-dichloroprop-1-ene Chemical compound CC=C(Cl)Cl ZAIDIVBQUMFXEC-UHFFFAOYSA-N 0.000 description 1
- CYICOSUAVXTZOD-UHFFFAOYSA-N 1,1-difluorobut-1-ene Chemical compound CCC=C(F)F CYICOSUAVXTZOD-UHFFFAOYSA-N 0.000 description 1
- YHLIEGBCOUQKHU-UHFFFAOYSA-N 1,1-difluoroprop-1-ene Chemical compound CC=C(F)F YHLIEGBCOUQKHU-UHFFFAOYSA-N 0.000 description 1
- UPVJEODAZWTJKZ-UHFFFAOYSA-N 1,2-dichloro-1,2-difluoroethene Chemical compound FC(Cl)=C(F)Cl UPVJEODAZWTJKZ-UHFFFAOYSA-N 0.000 description 1
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 1
- CJENPNUXCMYXPT-UHFFFAOYSA-N 1-chloro-1,2-difluoroethene Chemical compound FC=C(F)Cl CJENPNUXCMYXPT-UHFFFAOYSA-N 0.000 description 1
- KQBWUCNIYWMKEK-UHFFFAOYSA-N 1-chloro-1-fluorobut-1-ene Chemical compound CCC=C(F)Cl KQBWUCNIYWMKEK-UHFFFAOYSA-N 0.000 description 1
- FPBWSPZHCJXUBL-UHFFFAOYSA-N 1-chloro-1-fluoroethene Chemical compound FC(Cl)=C FPBWSPZHCJXUBL-UHFFFAOYSA-N 0.000 description 1
- BLEZTPDKUBSTII-UHFFFAOYSA-N 1-chloro-1-fluoroprop-1-ene Chemical compound CC=C(F)Cl BLEZTPDKUBSTII-UHFFFAOYSA-N 0.000 description 1
- FALCMQXTWHPRIH-UHFFFAOYSA-N 2,3-dichloroprop-1-ene Chemical compound ClCC(Cl)=C FALCMQXTWHPRIH-UHFFFAOYSA-N 0.000 description 1
- PNLQPWWBHXMFCA-UHFFFAOYSA-N 2-chloroprop-1-ene Chemical compound CC(Cl)=C PNLQPWWBHXMFCA-UHFFFAOYSA-N 0.000 description 1
- NGOCAPPEAVAHQM-UHFFFAOYSA-N 2-fluoroprop-1-ene Chemical compound CC(F)=C NGOCAPPEAVAHQM-UHFFFAOYSA-N 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 238000010471 Markovnikov's rule Methods 0.000 description 1
- 101100010166 Mus musculus Dok3 gene Proteins 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical compound ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- INLLPKCGLOXCIV-UHFFFAOYSA-N bromoethene Chemical compound BrC=C INLLPKCGLOXCIV-UHFFFAOYSA-N 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- UUAGAQFQZIEFAH-UHFFFAOYSA-N chlorotrifluoroethylene Chemical compound FC(F)=C(F)Cl UUAGAQFQZIEFAH-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- VMKJWLXVLHBJNK-UHFFFAOYSA-N cyanuric fluoride Chemical compound FC1=NC(F)=NC(F)=N1 VMKJWLXVLHBJNK-UHFFFAOYSA-N 0.000 description 1
- QDGONURINHVBEW-UHFFFAOYSA-N dichlorodifluoroethylene Chemical compound FC(F)=C(Cl)Cl QDGONURINHVBEW-UHFFFAOYSA-N 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000012025 fluorinating agent Substances 0.000 description 1
- 238000003682 fluorination reaction Methods 0.000 description 1
- XUCNUKMRBVNAPB-UHFFFAOYSA-N fluoroethene Chemical compound FC=C XUCNUKMRBVNAPB-UHFFFAOYSA-N 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- HCDGVLDPFQMKDK-UHFFFAOYSA-N hexafluoropropylene Chemical compound FC(F)=C(F)C(F)(F)F HCDGVLDPFQMKDK-UHFFFAOYSA-N 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical compound FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 description 1
- 229960002415 trichloroethylene Drugs 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C201/00—Preparation of esters of nitric or nitrous acid or of compounds containing nitro or nitroso groups bound to a carbon skeleton
- C07C201/06—Preparation of nitro compounds
- C07C201/14—Preparation of nitro compounds by formation of nitro groups together with reactions not involving the formation of nitro groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/07—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms
- C07C205/08—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms having nitro groups bound to acyclic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833305202 DE3305202A1 (de) | 1983-02-16 | 1983-02-16 | Verfahren zur herstellung von fluorierten nitroalkanen |
| US06/575,636 US4518812A (en) | 1983-02-16 | 1984-01-31 | Process for the preparation of fluorinated nitroalkanes |
| EP84101133A EP0116885B1 (de) | 1983-02-16 | 1984-02-04 | Verfahren zur Herstellung von fluorierten Nitroalkanen |
| DE8484101133T DE3461923D1 (en) | 1983-02-16 | 1984-02-04 | Process for the preparation of fluorinated nitroalkanes |
| JP59023061A JPS59155340A (ja) | 1983-02-16 | 1984-02-13 | 弗素化ニトロアルカンの製法 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833305202 DE3305202A1 (de) | 1983-02-16 | 1983-02-16 | Verfahren zur herstellung von fluorierten nitroalkanen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3305202A1 true DE3305202A1 (de) | 1984-08-16 |
Family
ID=6190903
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19833305202 Withdrawn DE3305202A1 (de) | 1983-02-16 | 1983-02-16 | Verfahren zur herstellung von fluorierten nitroalkanen |
| DE8484101133T Expired DE3461923D1 (en) | 1983-02-16 | 1984-02-04 | Process for the preparation of fluorinated nitroalkanes |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8484101133T Expired DE3461923D1 (en) | 1983-02-16 | 1984-02-04 | Process for the preparation of fluorinated nitroalkanes |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4518812A (enExample) |
| EP (1) | EP0116885B1 (enExample) |
| JP (1) | JPS59155340A (enExample) |
| DE (2) | DE3305202A1 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0381130A3 (en) * | 1989-01-31 | 1990-10-31 | Takeda Chemical Industries, Ltd. | Production of alpha-unsaturated amines |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3622976A1 (de) * | 1986-07-09 | 1988-01-21 | Bayer Ag | Fluor enthaltende dimethylolnitromethane, verfahren zu ihrer herstellung sowie ihre verwendung |
| US5364989A (en) * | 1989-01-31 | 1994-11-15 | Takeda Chemical Industries, Ltd. | 1,1,1-trichloro-2-nitroethane production |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL58977C (enExample) * | 1940-07-24 | |||
| US2864853A (en) * | 1956-08-07 | 1958-12-16 | Purdue Research Foundation | Process for the production of haloalkane nitrates |
| US3118004A (en) * | 1962-05-23 | 1964-01-14 | Pennsalt Chemicals Corp | Fluorinated organic iodides |
| JPH0768302B2 (ja) * | 1987-07-07 | 1995-07-26 | 出光石油化学株式会社 | 液状ポリイソプレン及びその製造方法 |
-
1983
- 1983-02-16 DE DE19833305202 patent/DE3305202A1/de not_active Withdrawn
-
1984
- 1984-01-31 US US06/575,636 patent/US4518812A/en not_active Expired - Lifetime
- 1984-02-04 DE DE8484101133T patent/DE3461923D1/de not_active Expired
- 1984-02-04 EP EP84101133A patent/EP0116885B1/de not_active Expired
- 1984-02-13 JP JP59023061A patent/JPS59155340A/ja active Granted
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0381130A3 (en) * | 1989-01-31 | 1990-10-31 | Takeda Chemical Industries, Ltd. | Production of alpha-unsaturated amines |
Also Published As
| Publication number | Publication date |
|---|---|
| EP0116885A1 (de) | 1984-08-29 |
| JPH0527614B2 (enExample) | 1993-04-21 |
| EP0116885B1 (de) | 1987-01-07 |
| DE3461923D1 (en) | 1987-02-12 |
| JPS59155340A (ja) | 1984-09-04 |
| US4518812A (en) | 1985-05-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0036123B1 (de) | Verfahren zur Herstellung von hochreinen teilfluorierten Äthanen | |
| EP0562435B1 (de) | Verfahren zur Herstellung von 3,5-Difluoranilin | |
| DE1074267B (de) | Verfahren zur Herstellung von fluorhaltigen Telomeren | |
| DE3305201A1 (de) | Verfahren zur herstellung von fluorierten nitroalkanen | |
| DE1468680C3 (de) | Verfahren zur Herstellung chlorfluorierter Derivate des Äthylens oder des Äthans | |
| DE1104496B (de) | Verfahren zur Herstellung von 1-Chlor-2, 2, 2-trifluoraethan | |
| DE3017154A1 (de) | Verfahren zur herstellung von 2-chlor-1,1,1,2,3,3,3,-heptafluor-propan | |
| DE19654720A1 (de) | Verfahren zur Herstellung von Hexafluorethan | |
| DE69207818T2 (de) | Verfahren zur Herstellung von einer Fluorverbindung | |
| DE2708190C2 (de) | Verfahren zur Herstellung von m-Brom-benzotrifluoriden | |
| EP0116885B1 (de) | Verfahren zur Herstellung von fluorierten Nitroalkanen | |
| EP0567872A1 (de) | Verfahren zur Herstellung von Hexafluorbutan und dabei zugängliche Zwischenprodukte | |
| DE60007111T2 (de) | Herstellung von ausgewählten fluorolefinen | |
| CH629167A5 (de) | Verfahren zur herstellung von brom-fluorkohlenwasserstoffen. | |
| DE69605708T2 (de) | Reinigung von Pentafluorethan | |
| DE3012005A1 (de) | 2,3-dichlor-2-trifluormethyl-1,1,1,3,4,4,5,5,5-nonafluorpentan und verfahren zu seiner herstellung | |
| DE3710631C2 (enExample) | ||
| DE2548970A1 (de) | Trichlormethyl-trifluormethyl-benzole | |
| DE2920591C2 (enExample) | ||
| EP0407990A1 (de) | Verfahren zur Herstellung von 1,1,1-Trifluor-2,2-dichlorethan unter erhöhtem Druck | |
| DE2549095A1 (de) | Trichlormethyl-trifluormethyl-benzol | |
| DE3332017A1 (de) | Verfahren zur herstellung von 3,4-dichlorbenzotrihalogeniden | |
| DE2644594A1 (de) | Fluorsubstitution in 1,1,1-trihalogenalkanen | |
| DE1668554C (de) | Verfahren zur Herstellung von Fluorolefinen | |
| DE2659712A1 (de) | Verfahren zur herstellung von 1,1-difluoraethylen aus acetylen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |