DE3145060A1 - "vorrichtung zur einstellbaren und loesbaren verbindung einer mehrzahl laenglicher bauelemente" - Google Patents
"vorrichtung zur einstellbaren und loesbaren verbindung einer mehrzahl laenglicher bauelemente"Info
- Publication number
- DE3145060A1 DE3145060A1 DE19813145060 DE3145060A DE3145060A1 DE 3145060 A1 DE3145060 A1 DE 3145060A1 DE 19813145060 DE19813145060 DE 19813145060 DE 3145060 A DE3145060 A DE 3145060A DE 3145060 A1 DE3145060 A1 DE 3145060A1
- Authority
- DE
- Germany
- Prior art keywords
- primary
- socket
- bushing
- connecting parts
- pair
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 230000007774 longterm Effects 0.000 title 1
- 230000000295 complement effect Effects 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 description 2
- LYKJEJVAXSGWAJ-UHFFFAOYSA-N compactone Natural products CC1(C)CCCC2(C)C1CC(=O)C3(O)CC(C)(CCC23)C=C LYKJEJVAXSGWAJ-UHFFFAOYSA-N 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000012858 resilient material Substances 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63H—TOYS, e.g. TOPS, DOLLS, HOOPS OR BUILDING BLOCKS
- A63H33/00—Other toys
- A63H33/04—Building blocks, strips, or similar building parts
- A63H33/06—Building blocks, strips, or similar building parts to be assembled without the use of additional elements
- A63H33/08—Building blocks, strips, or similar building parts to be assembled without the use of additional elements provided with complementary holes, grooves, or protuberances, e.g. dovetails
- A63H33/088—Building blocks, strips, or similar building parts to be assembled without the use of additional elements provided with complementary holes, grooves, or protuberances, e.g. dovetails with holes
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10T—TECHNICAL SUBJECTS COVERED BY FORMER US CLASSIFICATION
- Y10T403/00—Joints and connections
- Y10T403/32—Articulated members
- Y10T403/32254—Lockable at fixed position
- Y10T403/32262—At selected angle
- Y10T403/32319—At selected angle including pivot stud
- Y10T403/32368—At selected angle including pivot stud including radial interengaging tongue and slot or serrations
Landscapes
- Toys (AREA)
- Mutual Connection Of Rods And Tubes (AREA)
- Pivots And Pivotal Connections (AREA)
- Joining Of Building Structures In Genera (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK501080A DK150448C (da) | 1980-11-25 | 1980-11-25 | Kobling, bestaaende af et par samleled til udloeselig sammenkobling af stangformede konstruktionselementer, saerlig legetoejselementer, i forskellige indbyrdes vinkelstillinger |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3145060A1 true DE3145060A1 (de) | 1982-07-01 |
Family
ID=8138637
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19813145060 Withdrawn DE3145060A1 (de) | 1980-11-25 | 1981-11-13 | "vorrichtung zur einstellbaren und loesbaren verbindung einer mehrzahl laenglicher bauelemente" |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4430826A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS57173080A (cg-RX-API-DMAC10.html) |
| AT (1) | AT387157B (cg-RX-API-DMAC10.html) |
| AU (1) | AU552008B2 (cg-RX-API-DMAC10.html) |
| CA (1) | CA1159626A (cg-RX-API-DMAC10.html) |
| CH (1) | CH655247A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE3145060A1 (cg-RX-API-DMAC10.html) |
| DK (1) | DK150448C (cg-RX-API-DMAC10.html) |
| ES (1) | ES261633Y (cg-RX-API-DMAC10.html) |
| FR (1) | FR2494593A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB2087743B (cg-RX-API-DMAC10.html) |
| HK (1) | HK4086A (cg-RX-API-DMAC10.html) |
| IL (1) | IL64269A (cg-RX-API-DMAC10.html) |
| IT (1) | IT1195233B (cg-RX-API-DMAC10.html) |
| NL (1) | NL187986C (cg-RX-API-DMAC10.html) |
| NO (1) | NO158205C (cg-RX-API-DMAC10.html) |
| SE (1) | SE436542B (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA817862B (cg-RX-API-DMAC10.html) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1222869A (en) * | 1983-03-30 | 1987-06-16 | 284215 Alberta Limited | Connectable polygonal construction modules |
| IL76426A0 (en) * | 1985-09-19 | 1986-01-31 | Asher Gat | Assembly toys for joining cylindrical objects |
| US5020935A (en) * | 1988-04-29 | 1991-06-04 | Burn Tubes Limited | Connector |
| US5094643A (en) * | 1989-02-24 | 1992-03-10 | Interlego A.G. | Connecting device for toy construction elements |
| DE59000330D1 (de) * | 1989-02-24 | 1992-11-05 | Lego As | Bauelement fuer einen bausatz, insbesondere einen spielzeug-bausatz. |
| US5225772A (en) * | 1990-09-05 | 1993-07-06 | Schlumberger Technologies, Inc. | Automatic test equipment system using pin slice architecture |
| US5212443A (en) * | 1990-09-05 | 1993-05-18 | Schlumberger Technologies, Inc. | Event sequencer for automatic test equipment |
| US5938498A (en) * | 1994-03-18 | 1999-08-17 | Ideal Ideas, Inc. | Toy construction block system with interblock connectors for extended support structures |
| US5545070A (en) * | 1995-05-08 | 1996-08-13 | Liu; Jin-Su | Construction toy set of planar blocks with apertures and hinged connectors |
| US5826394A (en) * | 1996-11-19 | 1998-10-27 | Rokenbok Toy Company | Basic building blocks for constructing complex building structure |
| US5947787A (en) * | 1997-09-24 | 1999-09-07 | Parvia Corporation | Modular lattice substructure for a toy building set |
| US5924905A (en) * | 1997-09-24 | 1999-07-20 | Parvia Corporation | Modular terrain for a toy building set |
| US6129605A (en) * | 1997-09-24 | 2000-10-10 | Parvia Corporation | Modular base units for a toy building set |
| US5951356A (en) * | 1997-10-27 | 1999-09-14 | Parvia Corporation | Modular lattice substructure for a toy building set having columns and foundations |
| US5993283A (en) * | 1997-09-30 | 1999-11-30 | Parvia Corporation | Modular buildings for a toy building set |
| US6007401A (en) * | 1997-10-03 | 1999-12-28 | Parvia Corporation | Optoelectric remote control apparatus for guiding toy vehicles |
| US6102770A (en) * | 1997-10-03 | 2000-08-15 | Parvia Corporation | Toy vehicular electromechanical guidance apparatus |
| US5865661A (en) * | 1997-10-03 | 1999-02-02 | Parvia Corporation | Toy vehicular drive apparatus |
| US6012957A (en) * | 1997-10-27 | 2000-01-11 | Parvia Corporation | Single beam optoelectric remote control apparatus for control of toys |
| US6030270A (en) * | 1998-03-18 | 2000-02-29 | Interlego Ag | Toy building element with rotatably configured coupling means |
| TW367261B (en) * | 1998-03-18 | 1999-08-21 | Interlego Ag | A toy building element with rotatably arranged coupling means |
| US20050191939A1 (en) * | 2004-01-23 | 2005-09-01 | Sheltman David A. | Scaffold support for toy vehicle trackset |
| US7553209B1 (en) | 2005-05-17 | 2009-06-30 | Soren Christian Sorensen | Toy-building elements for variably positional toys |
| US8550868B2 (en) * | 2007-06-09 | 2013-10-08 | Dae-keun KWAK | Tube connector for assembly toy |
| KR100883384B1 (ko) * | 2007-06-09 | 2009-02-11 | 곽대근 | 조립완구용 튜브 연결체 |
| US8295182B2 (en) * | 2007-07-03 | 2012-10-23 | Credence Systems Corporation | Routed event test system and method |
| KR100902755B1 (ko) * | 2009-01-23 | 2009-06-15 | 곽대근 | 조립완구용 튜브 연결체 |
| CH702851A1 (fr) * | 2010-03-19 | 2011-09-30 | Equimodus Sarl | Kit de construction. |
| DE102012216246A1 (de) * | 2012-09-13 | 2014-03-13 | Saf-Holland Gmbh | Achslenker-Knoteneinheit |
| WO2018208202A1 (en) * | 2017-05-12 | 2018-11-15 | Strawbees Ab | Connector and system comprising a plurality of such connectors |
| KR102177389B1 (ko) | 2019-08-09 | 2020-11-11 | 배예진 | 자석과 연결체를 이용한 튜브 조립체 |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2650006A1 (de) * | 1976-10-30 | 1978-05-11 | Plastik Spritzwerk Ag Wolfhald | Knoten-verbindungselement |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1307160A (en) * | 1919-06-17 | a hptt cl | ||
| US584705A (en) * | 1897-06-15 | Air-brake hose-coupling | ||
| US1860627A (en) * | 1927-10-06 | 1932-05-31 | John Q Sherman | Toy |
| US1996722A (en) * | 1934-04-17 | 1935-04-02 | Gilbert Co A C | Constructional toy |
| US2609638A (en) * | 1946-05-22 | 1952-09-09 | Ray S Lindenmeyer | Construction toy connector |
| CH342144A (fr) * | 1958-01-17 | 1959-10-31 | Bogatyr Armand | Dispositif d'assemblage d'au moins deux barres |
| US3230643A (en) * | 1963-04-04 | 1966-01-25 | Morningstar Corp | Atomic model |
| DE1478400A1 (de) * | 1965-09-27 | 1969-05-29 | Artur Fischer | Aus zwei Bauteilen bestehender Gelenkbaustein |
| NL6811495A (cg-RX-API-DMAC10.html) * | 1965-09-27 | 1969-04-01 | ||
| ES342680A1 (es) * | 1966-07-16 | 1968-08-01 | Fischer | Perfeccionamiento en las articulaciones tipo cardan para juguetes. |
| US3495857A (en) * | 1968-04-12 | 1970-02-17 | Eugene E Hawke | Universally adjustable couplings |
| DK123277B (da) * | 1969-02-03 | 1972-06-05 | Lego Syst Billund As | Koblingsanordning mellem et hjul på en aksel. |
| DE2152341C3 (de) * | 1970-11-17 | 1980-07-31 | Otto Dr. 2000 Hamburg Schmidt | Bauspielzeug |
| US4037978A (en) * | 1974-08-23 | 1977-07-26 | B.C. Investments Ltd. | Resilient swivel connector |
| CH590676A5 (cg-RX-API-DMAC10.html) * | 1974-12-04 | 1977-08-15 | Modulo Sa | |
| GB2050495A (en) * | 1979-06-06 | 1981-01-07 | Maclaren Ltd A | Pivotable Joints |
-
1980
- 1980-11-25 DK DK501080A patent/DK150448C/da not_active IP Right Cessation
-
1981
- 1981-11-11 IL IL64269A patent/IL64269A/xx not_active IP Right Cessation
- 1981-11-12 ZA ZA817862A patent/ZA817862B/xx unknown
- 1981-11-13 DE DE19813145060 patent/DE3145060A1/de not_active Withdrawn
- 1981-11-18 GB GB8134758A patent/GB2087743B/en not_active Expired
- 1981-11-19 AT AT0498681A patent/AT387157B/de not_active IP Right Cessation
- 1981-11-19 AU AU77655/81A patent/AU552008B2/en not_active Ceased
- 1981-11-20 NL NLAANVRAGE8105268,A patent/NL187986C/xx not_active IP Right Cessation
- 1981-11-20 FR FR8121750A patent/FR2494593A1/fr active Granted
- 1981-11-23 US US06/324,088 patent/US4430826A/en not_active Expired - Lifetime
- 1981-11-23 ES ES1981261633U patent/ES261633Y/es not_active Expired
- 1981-11-24 IT IT25257/81A patent/IT1195233B/it active
- 1981-11-24 CA CA000390764A patent/CA1159626A/en not_active Expired
- 1981-11-24 SE SE8106971A patent/SE436542B/sv not_active IP Right Cessation
- 1981-11-24 NO NO813987A patent/NO158205C/no not_active IP Right Cessation
- 1981-11-24 CH CH7516/81A patent/CH655247A5/de not_active IP Right Cessation
- 1981-11-25 JP JP56187936A patent/JPS57173080A/ja active Granted
-
1986
- 1986-01-16 HK HK40/86A patent/HK4086A/xx not_active IP Right Cessation
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2650006A1 (de) * | 1976-10-30 | 1978-05-11 | Plastik Spritzwerk Ag Wolfhald | Knoten-verbindungselement |
Also Published As
| Publication number | Publication date |
|---|---|
| SE8106971L (sv) | 1982-05-26 |
| DK150448C (da) | 1987-10-12 |
| JPS57173080A (en) | 1982-10-25 |
| CH655247A5 (de) | 1986-04-15 |
| NO813987L (no) | 1982-05-26 |
| ATA498681A (de) | 1988-05-15 |
| ES261633Y (es) | 1982-12-01 |
| DK150448B (da) | 1987-03-02 |
| DK501080A (da) | 1982-05-26 |
| JPS6410237B2 (cg-RX-API-DMAC10.html) | 1989-02-21 |
| NL187986C (nl) | 1992-03-02 |
| IT1195233B (it) | 1988-10-12 |
| GB2087743B (en) | 1984-06-20 |
| AT387157B (de) | 1988-12-12 |
| CA1159626A (en) | 1984-01-03 |
| ZA817862B (en) | 1983-01-26 |
| GB2087743A (en) | 1982-06-03 |
| NO158205B (no) | 1988-04-25 |
| AU7765581A (en) | 1982-06-03 |
| ES261633U (es) | 1982-05-01 |
| NL187986B (nl) | 1991-10-01 |
| IT8125257A0 (it) | 1981-11-24 |
| AU552008B2 (en) | 1986-05-22 |
| NO158205C (no) | 1988-08-03 |
| IL64269A (en) | 1985-06-30 |
| FR2494593B1 (cg-RX-API-DMAC10.html) | 1984-12-07 |
| IL64269A0 (en) | 1982-02-28 |
| US4430826A (en) | 1984-02-14 |
| HK4086A (en) | 1986-01-24 |
| NL8105268A (nl) | 1982-06-16 |
| SE436542B (sv) | 1985-01-07 |
| FR2494593A1 (fr) | 1982-05-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3145060A1 (de) | "vorrichtung zur einstellbaren und loesbaren verbindung einer mehrzahl laenglicher bauelemente" | |
| EP0277319B1 (de) | Bauelement für Baukastensystem | |
| DE849062C (de) | Leicht loesbare Verbindung von Bauspielteilen | |
| EP0413009B1 (de) | Bauelement für einen bausatz, insbesondere einen spielzeug-bausatz | |
| DE1941987C3 (cg-RX-API-DMAC10.html) | ||
| DE2953181A1 (en) | High strength anchor assembly for fastener | |
| DE69920026T2 (de) | Spielzeugbausatz | |
| DE8123160U1 (de) | Gliederartig zusammensetzbares spielzeug aus gleichschenkelig dreieckigen hohlprismen | |
| DE3213120A1 (de) | Verbindungselement zum herstellen von zusammenstellungen von spielzeugeinheiten | |
| DE2617098A1 (de) | Kupplungsanordnung zum verbinden von mehreren leistenelementen fuer das modulartige zusammenbauen von spielzeugkoerpern | |
| DE69821310T2 (de) | Spielzeugkonstruktionsset | |
| DE2458764A1 (de) | Zusammensetzbares buegel- bzw. ringscharnier fuer griffe von taschen, koffern u. dgl. | |
| DE2904776C2 (cg-RX-API-DMAC10.html) | ||
| DE2626220C2 (de) | Verbindung von Werkstücken | |
| DE2917968A1 (de) | Bausatz zum zusammenbauen von spielmodellen | |
| DE3042185A1 (de) | Verrastbare kabelkupplung | |
| DE69929795T2 (de) | Vorrichtung gegen überklettern | |
| DE3511534A1 (de) | Biegsame welle | |
| EP1092881A2 (de) | Vorrichtung zum Befestigen oder Verbinden von Bauteilen | |
| DE2247253A1 (de) | Kabelmuffe | |
| DE69303216T2 (de) | Tischbeinanordnung | |
| EP0153633B1 (de) | Knotenpunktteil zur Verbindung einander benachbarter Bauteile | |
| DE1603603B2 (de) | Steckkupplung für Modell-, Lehr- und Spielzwecke | |
| DE814970C (de) | Rohrkupplung | |
| DE7919516U1 (de) | Verbindungsstueck fuer stellwaende |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8128 | New person/name/address of the agent |
Representative=s name: KOHLER, M., DIPL.-CHEM. DR.RER.NAT., 8000 MUENCHEN |
|
| 8127 | New person/name/address of the applicant |
Owner name: LEGO A/S, BILLUND, DK |
|
| 8128 | New person/name/address of the agent |
Representative=s name: DIEHL, H., DIPL.-PHYS. DR.RER.NAT., 8000 MUENCHEN |
|
| 8110 | Request for examination paragraph 44 | ||
| 8130 | Withdrawal |