DE3114472A1 - Beschichtete lichtempfindliche platte fuer die elektrophotographie - Google Patents
Beschichtete lichtempfindliche platte fuer die elektrophotographieInfo
- Publication number
- DE3114472A1 DE3114472A1 DE19813114472 DE3114472A DE3114472A1 DE 3114472 A1 DE3114472 A1 DE 3114472A1 DE 19813114472 DE19813114472 DE 19813114472 DE 3114472 A DE3114472 A DE 3114472A DE 3114472 A1 DE3114472 A1 DE 3114472A1
- Authority
- DE
- Germany
- Prior art keywords
- photosensitive plate
- electron
- layered
- layer
- transport layer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 239000000049 pigment Substances 0.000 claims description 37
- 239000000758 substrate Substances 0.000 claims description 19
- 239000011230 binding agent Substances 0.000 claims description 18
- 229920001225 polyester resin Polymers 0.000 claims description 17
- 239000004645 polyester resin Substances 0.000 claims description 17
- 239000012860 organic pigment Substances 0.000 claims description 15
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 13
- 125000005575 polycyclic aromatic hydrocarbon group Chemical group 0.000 claims description 10
- BBEAQIROQSPTKN-UHFFFAOYSA-N pyrene Chemical compound C1=CC=C2C=CC3=CC=CC4=CC=C1C2=C43 BBEAQIROQSPTKN-UHFFFAOYSA-N 0.000 claims description 10
- 125000004054 acenaphthylenyl group Chemical group C1(=CC2=CC=CC3=CC=CC1=C23)* 0.000 claims description 8
- HXGDTGSAIMULJN-UHFFFAOYSA-N acetnaphthylene Natural products C1=CC(C=C2)=C3C2=CC=CC3=C1 HXGDTGSAIMULJN-UHFFFAOYSA-N 0.000 claims description 8
- 125000002080 perylenyl group Chemical group C1(=CC=C2C=CC=C3C4=CC=CC5=CC=CC(C1=C23)=C45)* 0.000 claims description 8
- CSHWQDPOILHKBI-UHFFFAOYSA-N peryrene Natural products C1=CC(C2=CC=CC=3C2=C2C=CC=3)=C3C2=CC=CC3=C1 CSHWQDPOILHKBI-UHFFFAOYSA-N 0.000 claims description 8
- GVEPBJHOBDJJJI-UHFFFAOYSA-N fluoranthrene Natural products C1=CC(C2=CC=CC=C22)=C3C2=CC=CC3=C1 GVEPBJHOBDJJJI-UHFFFAOYSA-N 0.000 claims description 7
- 239000002841 Lewis acid Substances 0.000 claims description 4
- 150000007517 lewis acids Chemical class 0.000 claims description 4
- 235000015250 liver sausages Nutrition 0.000 claims description 2
- 125000003367 polycyclic group Chemical group 0.000 claims description 2
- XYSQXZCMOLNHOI-UHFFFAOYSA-N s-[2-[[4-(acetylsulfamoyl)phenyl]carbamoyl]phenyl] 5-pyridin-1-ium-1-ylpentanethioate;bromide Chemical compound [Br-].C1=CC(S(=O)(=O)NC(=O)C)=CC=C1NC(=O)C1=CC=CC=C1SC(=O)CCCC[N+]1=CC=CC=C1 XYSQXZCMOLNHOI-UHFFFAOYSA-N 0.000 claims description 2
- NDVAMUMVOJRAJV-UHFFFAOYSA-N 10h-phenanthren-9-one Chemical compound C1=CC=C2C(=O)CC3=CC=CC=C3C2=C1 NDVAMUMVOJRAJV-UHFFFAOYSA-N 0.000 claims 1
- 230000004888 barrier function Effects 0.000 claims 1
- 239000011796 hollow space material Substances 0.000 claims 1
- 239000010410 layer Substances 0.000 description 109
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 description 47
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 34
- 239000000243 solution Substances 0.000 description 32
- YNPNZTXNASCQKK-UHFFFAOYSA-N phenanthrene Chemical compound C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 22
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 17
- 238000000034 method Methods 0.000 description 15
- 230000035945 sensitivity Effects 0.000 description 13
- 229910052782 aluminium Inorganic materials 0.000 description 9
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 9
- 230000015572 biosynthetic process Effects 0.000 description 9
- 229920001577 copolymer Polymers 0.000 description 8
- 229920006267 polyester film Polymers 0.000 description 7
- 239000000853 adhesive Substances 0.000 description 6
- 230000001070 adhesive effect Effects 0.000 description 6
- 238000010348 incorporation Methods 0.000 description 6
- 229920000642 polymer Polymers 0.000 description 6
- 229920005989 resin Polymers 0.000 description 6
- 239000011347 resin Substances 0.000 description 6
- 238000003892 spreading Methods 0.000 description 6
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Natural products C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 5
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 3
- NRCMAYZCPIVABH-UHFFFAOYSA-N Quinacridone Chemical compound N1C2=CC=CC=C2C(=O)C2=C1C=C1C(=O)C3=CC=CC=C3NC1=C2 NRCMAYZCPIVABH-UHFFFAOYSA-N 0.000 description 3
- 239000003822 epoxy resin Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 229920005668 polycarbonate resin Polymers 0.000 description 3
- 239000004431 polycarbonate resin Substances 0.000 description 3
- 229920000647 polyepoxide Polymers 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- VHQGURIJMFPBKS-UHFFFAOYSA-N 2,4,7-trinitrofluoren-9-one Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=C2C3=CC=C([N+](=O)[O-])C=C3C(=O)C2=C1 VHQGURIJMFPBKS-UHFFFAOYSA-N 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- UJOBWOGCFQCDNV-UHFFFAOYSA-N 9H-carbazole Chemical group C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- 229920000298 Cellophane Polymers 0.000 description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- 239000004820 Pressure-sensitive adhesive Substances 0.000 description 2
- 238000005299 abrasion Methods 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- WDECIBYCCFPHNR-UHFFFAOYSA-N chrysene Chemical compound C1=CC=CC2=CC=C3C4=CC=CC=C4C=CC3=C21 WDECIBYCCFPHNR-UHFFFAOYSA-N 0.000 description 2
- 238000000151 deposition Methods 0.000 description 2
- -1 dibenzophenanthrene Natural products 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- PJQYNUFEEZFYIS-UHFFFAOYSA-N perylene maroon Chemical compound C=12C3=CC=C(C(N(C)C4=O)=O)C2=C4C=CC=1C1=CC=C2C(=O)N(C)C(=O)C4=CC=C3C1=C42 PJQYNUFEEZFYIS-UHFFFAOYSA-N 0.000 description 2
- 230000001235 sensitizing effect Effects 0.000 description 2
- 229920002545 silicone oil Polymers 0.000 description 2
- 229920003048 styrene butadiene rubber Polymers 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000002344 surface layer Substances 0.000 description 2
- 229920002803 thermoplastic polyurethane Polymers 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- VYWYYJYRVSBHJQ-UHFFFAOYSA-N 3,5-dinitrobenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 VYWYYJYRVSBHJQ-UHFFFAOYSA-N 0.000 description 1
- WSQZNZLOZXSBHA-UHFFFAOYSA-N 3,8-dioxabicyclo[8.2.2]tetradeca-1(12),10,13-triene-2,9-dione Chemical compound O=C1OCCCCOC(=O)C2=CC=C1C=C2 WSQZNZLOZXSBHA-UHFFFAOYSA-N 0.000 description 1
- GHBQLFWTMLRYKN-UHFFFAOYSA-N 9-prop-2-enylcarbazole Chemical compound C1=CC=C2N(CC=C)C3=CC=CC=C3C2=C1 GHBQLFWTMLRYKN-UHFFFAOYSA-N 0.000 description 1
- 239000004925 Acrylic resin Substances 0.000 description 1
- 229920000178 Acrylic resin Polymers 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- FMMWHPNWAFZXNH-UHFFFAOYSA-N Benz[a]pyrene Chemical compound C1=C2C3=CC=CC=C3C=C(C=C3)C2=C2C3=CC=CC2=C1 FMMWHPNWAFZXNH-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XTAHYROJKCXMOF-UHFFFAOYSA-N Dihydroaceanthrylene Chemical compound C1=CC=C2C(CCC3=CC=C4)=C3C4=CC2=C1 XTAHYROJKCXMOF-UHFFFAOYSA-N 0.000 description 1
- 239000004716 Ethylene/acrylic acid copolymer Substances 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229920002845 Poly(methacrylic acid) Chemical class 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- MZZSDCJQCLYLLL-UHFFFAOYSA-N Secalonsaeure A Natural products COC(=O)C12OC3C(CC1=C(O)CC(C)C2O)C(=CC=C3c4ccc(O)c5C(=O)C6=C(O)CC(C)C(O)C6(Oc45)C(=O)OC)O MZZSDCJQCLYLLL-UHFFFAOYSA-N 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- SLGBZMMZGDRARJ-UHFFFAOYSA-N Triphenylene Natural products C1=CC=C2C3=CC=CC=C3C3=CC=CC=C3C2=C1 SLGBZMMZGDRARJ-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 1
- 150000004056 anthraquinones Chemical class 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- VGHOWOWLIXPTOA-UHFFFAOYSA-N cyclohexane;toluene Chemical compound C1CCCCC1.CC1=CC=CC=C1 VGHOWOWLIXPTOA-UHFFFAOYSA-N 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 239000004205 dimethyl polysiloxane Substances 0.000 description 1
- 238000007772 electroless plating Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- RMBPEFMHABBEKP-UHFFFAOYSA-N fluorene Chemical compound C1=CC=C2C3=C[CH]C=CC3=CC2=C1 RMBPEFMHABBEKP-UHFFFAOYSA-N 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 229920006017 homo-polyamide Polymers 0.000 description 1
- 235000019239 indanthrene blue RS Nutrition 0.000 description 1
- UHOKSCJSTAHBSO-UHFFFAOYSA-N indanthrone blue Chemical compound C1=CC=C2C(=O)C3=CC=C4NC5=C6C(=O)C7=CC=CC=C7C(=O)C6=CC=C5NC4=C3C(=O)C2=C1 UHOKSCJSTAHBSO-UHFFFAOYSA-N 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229920000554 ionomer Polymers 0.000 description 1
- QQVIHTHCMHWDBS-UHFFFAOYSA-L isophthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC(C([O-])=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-L 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- NIHNNTQXNPWCJQ-UHFFFAOYSA-N o-biphenylenemethane Natural products C1=CC=C2CC3=CC=CC=C3C2=C1 NIHNNTQXNPWCJQ-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- DGBWPZSGHAXYGK-UHFFFAOYSA-N perinone Chemical compound C12=NC3=CC=CC=C3N2C(=O)C2=CC=C3C4=C2C1=CC=C4C(=O)N1C2=CC=CC=C2N=C13 DGBWPZSGHAXYGK-UHFFFAOYSA-N 0.000 description 1
- 229920002382 photo conductive polymer Polymers 0.000 description 1
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 1
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 239000002491 polymer binding agent Substances 0.000 description 1
- 229920005672 polyolefin resin Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 230000033458 reproduction Effects 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 229920000638 styrene acrylonitrile Polymers 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000005028 tinplate Substances 0.000 description 1
- 125000005580 triphenylene group Chemical group 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 229920006337 unsaturated polyester resin Polymers 0.000 description 1
- 238000001771 vacuum deposition Methods 0.000 description 1
- 238000007738 vacuum evaporation Methods 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
- KAKZBPTYRLMSJV-UHFFFAOYSA-N vinyl-ethylene Natural products C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 1
- 238000005491 wire drawing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0601—Acyclic or carbocyclic compounds
- G03G5/0605—Carbocyclic compounds
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/043—Photoconductive layers characterised by having two or more layers or characterised by their composite structure
- G03G5/047—Photoconductive layers characterised by having two or more layers or characterised by their composite structure characterised by the charge-generation layers or charge transport layers
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Photoreceptors In Electrophotography (AREA)
- Laminated Bodies (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4676880A JPS56143439A (en) | 1980-04-11 | 1980-04-11 | Electrophotographic laminated sensitive plate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3114472A1 true DE3114472A1 (de) | 1982-01-21 |
Family
ID=12756500
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19813114472 Ceased DE3114472A1 (de) | 1980-04-11 | 1981-04-09 | Beschichtete lichtempfindliche platte fuer die elektrophotographie |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4388392A (enExample) |
| JP (1) | JPS56143439A (enExample) |
| DE (1) | DE3114472A1 (enExample) |
| GB (1) | GB2073903B (enExample) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS56143438A (en) * | 1980-04-10 | 1981-11-09 | Mita Ind Co Ltd | Improvement of electrophotographic sensitive layer |
| US5262512A (en) * | 1981-11-25 | 1993-11-16 | Xerox Corporation | Polyarylamine polyesters |
| JPS59184347A (ja) * | 1983-04-04 | 1984-10-19 | Mita Ind Co Ltd | 電子写真感光体 |
| JPS61112153A (ja) * | 1984-11-06 | 1986-05-30 | Canon Inc | 電子写真画像形成方法 |
| US4599286A (en) * | 1984-12-24 | 1986-07-08 | Xerox Corporation | Photoconductive imaging member with stabilizer in charge transfer layer |
| US4563408A (en) * | 1984-12-24 | 1986-01-07 | Xerox Corporation | Photoconductive imaging member with hydroxyaromatic antioxidant |
| US4584253A (en) * | 1984-12-24 | 1986-04-22 | Xerox Corporation | Electrophotographic imaging system |
| US4935487A (en) * | 1987-06-10 | 1990-06-19 | Xerox Corporation | Carbonate-arylamine polymer |
| US4871634A (en) * | 1987-06-10 | 1989-10-03 | Xerox Corporation | Electrophotographic elements using hydroxy functionalized arylamine compounds |
| US4818650A (en) * | 1987-06-10 | 1989-04-04 | Xerox Corporation | Arylamine containing polyhydroxy ether resins and system utilizing arylamine containing polyhydroxyl ether resins |
| US4801517A (en) * | 1987-06-10 | 1989-01-31 | Xerox Corporation | Polyarylamine compounds and systems utilizing polyarylamine compounds |
| US4806444A (en) * | 1987-06-10 | 1989-02-21 | Xerox Corporation | Arylamine polymers and systems utilizing arylamine polymers |
| US5028687A (en) * | 1987-06-10 | 1991-07-02 | Xerox Corporation | Arylamine carbonate polymer |
| US4956440A (en) * | 1987-06-10 | 1990-09-11 | Xerox Corporation | Arylamine containing polyhydroxyether resins |
| US4806443A (en) * | 1987-06-10 | 1989-02-21 | Xerox Corporation | Polyarylamine compounds and systems utilizing polyarylamine compounds |
| US4889784A (en) * | 1988-10-25 | 1989-12-26 | International Business Machines | Organic photoconductors with improved wear |
| US5069993A (en) * | 1989-12-29 | 1991-12-03 | Xerox Corporation | Photoreceptor layers containing polydimethylsiloxane copolymers |
| US5155200A (en) * | 1990-04-20 | 1992-10-13 | Xerox Corporation | Polyarylamine polymers |
| US5030532A (en) * | 1990-04-20 | 1991-07-09 | Xerox Corporation | Electrophotographic imaging member utilizing polyarylamine polymers |
| US5409792A (en) * | 1991-08-26 | 1995-04-25 | Xerox Corporation | Photoreceptor containing dissimilar charge transporting small molecule and charge transporting polymer |
| US5213928A (en) * | 1991-11-04 | 1993-05-25 | Xerox Corporation | Imaging member containing polysiloxane homopolymers |
| US5202408A (en) * | 1991-11-25 | 1993-04-13 | Xerox Corporation | Arylamine containing terpolymers with CF3 substituted moieties |
| US5356743A (en) * | 1991-11-25 | 1994-10-18 | Xerox Corporation | Electrophotographic imaging members containing polyarylamine polyesters |
| US5283143A (en) * | 1991-11-25 | 1994-02-01 | Xerox Corporation | Electrophotographic imaging member containing arylamine terpolymers with CF3 substituted moieties |
| US5830614A (en) * | 1991-12-20 | 1998-11-03 | Xerox Corporation | Multilayer organic photoreceptor employing a dual layer of charge transporting polymers |
| US5413886A (en) * | 1992-06-25 | 1995-05-09 | Xerox Corporation | Transport layers containing two or more charge transporting molecules |
| US5942360A (en) * | 1998-03-31 | 1999-08-24 | Xerox Corporation | Photoreceptor with low surface energy and process of making |
| US6366752B1 (en) | 2000-08-09 | 2002-04-02 | Xerox Corporation | Spherical silicone additive for reduced photo receptor drag and wear |
| US6645686B1 (en) | 2002-07-23 | 2003-11-11 | Xerox Corporation | Electrophotographic imaging members |
| US7166400B2 (en) * | 2003-10-28 | 2007-01-23 | Samsung Electronics Co., Ltd. | Organophotoreceptor with a hydrazone polymer charge transport material |
| US7192678B2 (en) * | 2004-07-13 | 2007-03-20 | Xerox Corporation | Photoreceptor charge transport layer composition |
| US7267917B2 (en) * | 2004-09-21 | 2007-09-11 | Xerox Corporation | Photoreceptor charge transport layer composition |
| US7588873B2 (en) * | 2007-10-23 | 2009-09-15 | Static Control Components, Inc. | Methods and apparatus for providing a liquid coating for an organic photoconductive drum |
| JP6019656B2 (ja) * | 2012-03-26 | 2016-11-02 | 富士ゼロックス株式会社 | 帯電ロールの製造方法 |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2612359A1 (de) * | 1976-03-24 | 1977-09-29 | Turlabor Ag | Elektrophotographisches aufzeichnungsmaterial |
| DE2557430B2 (de) * | 1974-12-20 | 1978-02-23 | Eastman Kodak Co, Rochester, N Y (VStA) | Elektrophotographisches aufzeichnungsmaterial |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4282298A (en) * | 1970-12-01 | 1981-08-04 | Xerox Corporation | Layered imaging member and method |
| US3953207A (en) * | 1974-10-25 | 1976-04-27 | Xerox Corporation | Composite layered photoreceptor |
| JPS5614240A (en) * | 1979-07-16 | 1981-02-12 | Konishiroku Photo Ind Co Ltd | Electrophotographic receptor |
-
1980
- 1980-04-11 JP JP4676880A patent/JPS56143439A/ja active Granted
-
1981
- 1981-04-08 US US06/252,261 patent/US4388392A/en not_active Expired - Fee Related
- 1981-04-09 GB GB8111182A patent/GB2073903B/en not_active Expired
- 1981-04-09 DE DE19813114472 patent/DE3114472A1/de not_active Ceased
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2557430B2 (de) * | 1974-12-20 | 1978-02-23 | Eastman Kodak Co, Rochester, N Y (VStA) | Elektrophotographisches aufzeichnungsmaterial |
| DE2612359A1 (de) * | 1976-03-24 | 1977-09-29 | Turlabor Ag | Elektrophotographisches aufzeichnungsmaterial |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS639212B2 (enExample) | 1988-02-26 |
| JPS56143439A (en) | 1981-11-09 |
| GB2073903B (en) | 1983-07-27 |
| US4388392A (en) | 1983-06-14 |
| GB2073903A (en) | 1981-10-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3114472A1 (de) | Beschichtete lichtempfindliche platte fuer die elektrophotographie | |
| DE2919791C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3138252C2 (enExample) | ||
| EP0001599B1 (de) | Elektrophotographisches Aufzeichnungsmaterial und dessen Verwendung in einem Kopierverfahren | |
| DE2939483C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2924865C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2737516C3 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE69610663T2 (de) | Verfahren zur Herstellung eines mehrschichtigen elektrophotograpischen Bildaufzeichnungselementes | |
| DE2635887C3 (de) | Verfahren zur Herstellung eines elektrophotographischen Aufzeichnungsmaterial | |
| DE2801913A1 (de) | Lichtempfindliches schichtmaterial fuer die elektrophotographie | |
| DE3018871A1 (de) | Geschichteter elektrophotographischer photoleiter | |
| DE2654873C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3108618A1 (de) | Lichtempfindliches schichtmaterial | |
| DE3329442A1 (de) | Elektrophotographisches aufzeichnungsmaterial und verfahren zu seiner herstellung | |
| DE19612681B4 (de) | Elektrophotographisches Aufzeichnungsmaterial und Verfahren zu dessen Herstellung | |
| DE2229517A1 (de) | Farbabsorbierendes Diapositiv und Verfahren zu seiner Herstellung | |
| DE4238413C2 (de) | Zusammensetzung für eine Ladungen tansportierende Schicht in einem elektrophotographischen Aufzeichnungsmaterial | |
| DE3034564A1 (de) | Elektrophotographische platte vom komplex-typ und deen verwendung in einem elektrophotgraphischen verfahen | |
| DE2242627C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| EP0131215B1 (de) | Elektrophotographische Aufzeichnungsmaterialien mit verbesserter Photoempfindlichkeit | |
| DE3114650C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE4028519C2 (de) | Elektrofotografisches Aufzeichnungsmaterial | |
| DE1942700A1 (de) | Elektrophotographische Platte | |
| DE2832859C2 (enExample) | ||
| DE3148967C2 (de) | Elektrophotographisches Aufzeichnungsverfahren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8128 | New person/name/address of the agent |
Representative=s name: KOHLER, M., DIPL.-CHEM. DR.RER.NAT., 8000 MUENCHEN |
|
| 8128 | New person/name/address of the agent |
Representative=s name: GLAESER, J., DIPL.-ING., PAT.-ANW., 2000 HAMBURG |
|
| 8110 | Request for examination paragraph 44 | ||
| 8131 | Rejection |