DE3113473A1 - Reaktive diszoverbindungen und verfahren zum anfaerben von celluslosefasern unter verwendung dieser verbindungen - Google Patents
Reaktive diszoverbindungen und verfahren zum anfaerben von celluslosefasern unter verwendung dieser verbindungenInfo
- Publication number
- DE3113473A1 DE3113473A1 DE19813113473 DE3113473A DE3113473A1 DE 3113473 A1 DE3113473 A1 DE 3113473A1 DE 19813113473 DE19813113473 DE 19813113473 DE 3113473 A DE3113473 A DE 3113473A DE 3113473 A1 DE3113473 A1 DE 3113473A1
- Authority
- DE
- Germany
- Prior art keywords
- substituted
- parts
- general formula
- sulfo
- compound according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 15
- 239000000835 fiber Substances 0.000 title description 12
- 238000004040 coloring Methods 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims description 38
- -1 disazo compound Chemical class 0.000 claims description 27
- 238000004043 dyeing Methods 0.000 claims description 19
- 239000002253 acid Substances 0.000 claims description 18
- 229910052801 chlorine Inorganic materials 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 125000003545 alkoxy group Chemical group 0.000 claims description 11
- 229910052731 fluorine Inorganic materials 0.000 claims description 10
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 7
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 229920003043 Cellulose fiber Polymers 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 5
- 229920002554 vinyl polymer Polymers 0.000 claims description 5
- 125000006414 CCl Chemical group ClC* 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 3
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 2
- 125000005184 naphthylamino group Chemical class C1(=CC=CC2=CC=CC=C12)N* 0.000 claims 1
- 239000000243 solution Substances 0.000 description 30
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 28
- 239000000975 dye Substances 0.000 description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 26
- 239000011734 sodium Substances 0.000 description 22
- 239000000460 chlorine Substances 0.000 description 21
- 229910000029 sodium carbonate Inorganic materials 0.000 description 14
- 239000011230 binding agent Substances 0.000 description 10
- 239000000203 mixture Substances 0.000 description 9
- 239000000463 material Substances 0.000 description 8
- 229920000297 Rayon Polymers 0.000 description 7
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 7
- 239000004202 carbamide Substances 0.000 description 7
- 238000010438 heat treatment Methods 0.000 description 7
- 239000000344 soap Substances 0.000 description 7
- 238000010186 staining Methods 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000003112 inhibitor Substances 0.000 description 6
- 230000007935 neutral effect Effects 0.000 description 6
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 6
- 229920000742 Cotton Polymers 0.000 description 5
- 239000012736 aqueous medium Substances 0.000 description 5
- 239000004744 fabric Substances 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- JVMSQRAXNZPDHF-UHFFFAOYSA-N 2,4-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C(N)=C1 JVMSQRAXNZPDHF-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 230000008878 coupling Effects 0.000 description 4
- 238000010168 coupling process Methods 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 4
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 4
- 239000002964 rayon Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 3
- 239000001045 blue dye Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000007598 dipping method Methods 0.000 description 3
- 150000002367 halogens Chemical group 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 229910017053 inorganic salt Inorganic materials 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 235000010288 sodium nitrite Nutrition 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000004094 surface-active agent Substances 0.000 description 3
- GVBHCMNXRKOJRH-UHFFFAOYSA-N 2,4,5,6-tetrachloropyrimidine Chemical compound ClC1=NC(Cl)=C(Cl)C(Cl)=N1 GVBHCMNXRKOJRH-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000003945 anionic surfactant Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000000661 sodium alginate Substances 0.000 description 2
- 235000010413 sodium alginate Nutrition 0.000 description 2
- 229940005550 sodium alginate Drugs 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- XAQCYASNAMYTQA-UHFFFAOYSA-N 2,4-diamino-5-methylbenzenesulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=C(N)C=C1N XAQCYASNAMYTQA-UHFFFAOYSA-N 0.000 description 1
- VOPSFYWMOIKYEM-UHFFFAOYSA-N 2,5-diaminobenzene-1,4-disulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=C(N)C=C1S(O)(=O)=O VOPSFYWMOIKYEM-UHFFFAOYSA-N 0.000 description 1
- HEAHMJLHQCESBZ-UHFFFAOYSA-N 2,5-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(N)C(S(O)(=O)=O)=C1 HEAHMJLHQCESBZ-UHFFFAOYSA-N 0.000 description 1
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 description 1
- YADSWTKOIHUSDX-UHFFFAOYSA-N 4,6-diaminobenzene-1,3-disulfonic acid Chemical compound NC1=CC(N)=C(S(O)(=O)=O)C=C1S(O)(=O)=O YADSWTKOIHUSDX-UHFFFAOYSA-N 0.000 description 1
- MOMKYJPSVWEWPM-UHFFFAOYSA-N 4-(chloromethyl)-2-(4-methylphenyl)-1,3-thiazole Chemical compound C1=CC(C)=CC=C1C1=NC(CCl)=CS1 MOMKYJPSVWEWPM-UHFFFAOYSA-N 0.000 description 1
- ZUQOBHTUMCEQBG-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-1,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(N)=CC=C(S(O)(=O)=O)C2=C1 ZUQOBHTUMCEQBG-UHFFFAOYSA-N 0.000 description 1
- APRRQJCCBSJQOQ-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(N)=CC(S(O)(=O)=O)=CC2=C1 APRRQJCCBSJQOQ-UHFFFAOYSA-N 0.000 description 1
- GOYNRDSJTYLXBU-UHFFFAOYSA-N 5-chloro-2,4,6-trifluoropyrimidine Chemical compound FC1=NC(F)=C(Cl)C(F)=N1 GOYNRDSJTYLXBU-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241001366278 Leptotes marina Species 0.000 description 1
- OAICVXFJPJFONN-IGMARMGPSA-N Phosphorus-31 Chemical group [31P] OAICVXFJPJFONN-IGMARMGPSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004566 building material Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 238000010014 continuous dyeing Methods 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- AFOSIXZFDONLBT-UHFFFAOYSA-N divinyl sulfone Chemical compound C=CS(=O)(=O)C=C AFOSIXZFDONLBT-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- SQYUJKVKVFILNB-UHFFFAOYSA-N methyl 2-amino-4-[(2,5-dichlorophenyl)carbamoyl]benzoate Chemical compound C1=C(N)C(C(=O)OC)=CC=C1C(=O)NC1=CC(Cl)=CC=C1Cl SQYUJKVKVFILNB-UHFFFAOYSA-N 0.000 description 1
- 239000010446 mirabilite Substances 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000008149 soap solution Substances 0.000 description 1
- 235000015424 sodium Nutrition 0.000 description 1
- 235000019983 sodium metaphosphate Nutrition 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- RSIJVJUOQBWMIM-UHFFFAOYSA-L sodium sulfate decahydrate Chemical compound O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].[O-]S([O-])(=O)=O RSIJVJUOQBWMIM-UHFFFAOYSA-L 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- NVBFHJWHLNUMCV-UHFFFAOYSA-N sulfamide Chemical compound NS(N)(=O)=O NVBFHJWHLNUMCV-UHFFFAOYSA-N 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 229910000406 trisodium phosphate Inorganic materials 0.000 description 1
- 235000019801 trisodium phosphate Nutrition 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/44—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring
- C09B62/4401—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring with two or more reactive groups at least one of them being directly attached to a heterocyclic system and at least one of them being directly attached to a non-heterocyclic system
- C09B62/4403—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring with two or more reactive groups at least one of them being directly attached to a heterocyclic system and at least one of them being directly attached to a non-heterocyclic system the heterocyclic system being a triazine ring
- C09B62/4411—Azo dyes
- C09B62/4415—Disazo or polyazo dyes
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/44—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring
- C09B62/4401—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring with two or more reactive groups at least one of them being directly attached to a heterocyclic system and at least one of them being directly attached to a non-heterocyclic system
- C09B62/4424—Azo dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4618880A JPS56155250A (en) | 1980-04-10 | 1980-04-10 | Reactive dis-azo compound, production thereof and dyeing method employing the same |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3113473A1 true DE3113473A1 (de) | 1982-02-04 |
Family
ID=12740065
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19813113473 Withdrawn DE3113473A1 (de) | 1980-04-10 | 1981-04-03 | Reaktive diszoverbindungen und verfahren zum anfaerben von celluslosefasern unter verwendung dieser verbindungen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4425270A (en:Method) |
| JP (1) | JPS56155250A (en:Method) |
| CH (1) | CH645914A5 (en:Method) |
| DE (1) | DE3113473A1 (en:Method) |
| GB (1) | GB2076006B (en:Method) |
Cited By (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0084314A3 (en) * | 1982-01-15 | 1984-01-04 | Bayer Ag | Reactive disazo dyes |
| EP0128340A1 (de) * | 1983-05-18 | 1984-12-19 | Bayer Ag | Disazoreaktivfarbstoffe |
| EP0134193A1 (de) * | 1983-07-29 | 1985-03-13 | Ciba-Geigy Ag | Reaktivfarbstoffe, deren Herstellung und Verwendung |
| EP0141776A1 (de) * | 1983-08-30 | 1985-05-15 | Ciba-Geigy Ag | Reaktivfarbstoffe, deren Herstellung und Verwendung |
| EP0167490A1 (de) * | 1984-07-05 | 1986-01-08 | Ciba-Geigy Ag | Reaktivfarbstoffe, deren Herstellung und Verwendung |
| EP0174275A1 (de) * | 1984-08-30 | 1986-03-12 | Ciba-Geigy Ag | Verfahren zum Färben oder Bedrucken von textilen Fasermaterialien mit Reaktivfarbstoffen |
| EP0192067A1 (de) * | 1985-02-02 | 1986-08-27 | Bayer Ag | Disazofarbstoffe |
| EP0186812A3 (en) * | 1984-12-20 | 1986-09-17 | Bayer Ag | Reactive dyes |
| EP0198350A1 (de) * | 1985-04-13 | 1986-10-22 | Bayer Ag | Disazoreaktivfarbstoffe |
| EP0198349A1 (de) * | 1985-04-13 | 1986-10-22 | Bayer Ag | Disazoreaktivfarbstoffe |
| EP0264878A1 (en) * | 1986-10-20 | 1988-04-27 | Mitsubishi Kasei Corporation | Water-soluble disazo colorants |
| US5233026A (en) * | 1984-09-26 | 1993-08-03 | Ciba-Geigy Corporation | Azo dyes containing chloro-s-triazine and vinylsulfonyl type fiber-reactive groups |
| US5241057A (en) * | 1982-01-15 | 1993-08-31 | Bayer Aktiengesellshaft | Amino disazo dyestuffs containing a fluoropyrimidinyl or a fluorotriazinyl reactive group |
| EP0694589A1 (de) * | 1994-07-25 | 1996-01-31 | Hoechst Aktiengesellschaft | Wasserlösliche Disazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe |
| EP1887046A3 (en) * | 2006-08-09 | 2009-11-04 | Everlight USA, Inc. | Reactive dyes containing an alkylthio-s-triazinyl reactive group |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3019936A1 (de) * | 1980-05-24 | 1981-12-03 | Hoechst Ag, 6000 Frankfurt | Wasserloesliche farbige verbindungen, verfahren zu deren herstellung und ihre verwendung als farbstoffe |
| DE3033611A1 (de) * | 1980-09-06 | 1982-04-29 | Hoechst Ag, 6000 Frankfurt | Wasserloesliche disazoverbindungen, verfahren zu deren herstellung und ihre verwendung als farbstoffe |
| DE3120187A1 (de) * | 1981-05-21 | 1982-12-09 | Hoechst Ag, 6000 Frankfurt | Wasserloesliche disazoverbindungen, verfahren zu deren herstellung und ihre verwendung als farbstoffe |
| DE3327713A1 (de) * | 1983-07-29 | 1985-02-07 | Hoechst Ag, 6230 Frankfurt | Wasserloesliche disazoverbindungen, verfahren zu deren herstellung und ihre verwendung als farbstoffe |
| CH663215A5 (de) * | 1984-04-09 | 1987-11-30 | Mitsubishi Chem Ind | Reaktive azofarbstoffe. |
| US4843149A (en) * | 1984-11-20 | 1989-06-27 | Sumitomo Chemical Company, Limited | Fiber reactive yellow dye of acetoacetonilide having vinyl sulfone-type reactive group |
| DE3536688A1 (de) * | 1985-10-15 | 1987-04-16 | Hoechst Ag | Wasserloesliche disazoverbindungen, verfahren zu deren herstellung und ihre verwendung als farbstoffe |
| EP0322457B1 (en) * | 1987-06-30 | 1994-06-08 | Mitsubishi Chemical Corporation | Water-soluble reactive dye mixture and process for dyeing cellulose fibers using same |
| DE3889828D1 (de) * | 1987-09-21 | 1994-07-07 | Ciba Geigy | Verfahren zum Färben oder Bedrucken von Fasermaterial aus natürlichen oder synthetischen Polyamiden mit Reaktivfarbstoffen. |
| FR2655995A1 (fr) * | 1989-12-16 | 1991-06-21 | Sandoz Sa | Nouveaux composes disazouiques, leur preparation et leur utilisation comme colorants reactifs. |
| ES2111731T3 (es) * | 1992-03-05 | 1998-03-16 | Ciba Geigy Ag | Colorantes reactivos, procedimiento para su preparacion y su empleo. |
| BR9303266A (pt) * | 1992-08-14 | 1994-03-08 | Sandoz Ag | Compostos e seus sais ou misturas de fais compostos ou sais,processos para sua preparacao,e processo para tingimento ou estampagem de um substrato organico |
| CN102329522B (zh) * | 2011-09-29 | 2016-08-03 | 天津德凯化工股份有限公司 | 一种活性染料及其制备方法 |
| CN102433026A (zh) * | 2011-09-29 | 2012-05-02 | 天津德凯化工股份有限公司 | 纯棉或棉毛混纺织品染色用黑色活性染料及其制备方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2860128A (en) | 1956-07-03 | 1958-11-11 | Ciba Ltd | Triazine disazo-dyestuffs |
| CH449818A (de) | 1961-05-23 | 1968-01-15 | Ciba Geigy | Verfahren zur Herstellung neuer Disazofarbstoffe |
| DE1644184C3 (de) | 1966-12-05 | 1974-03-28 | Bayer Ag, 5090 Leverkusen | Reaktivfarbstoffe, Verfahren zu deren Herstellung und Verwendung zum Färben und Bedrucken cellulosehaltiger Materialien |
| GB1386625A (en) | 1972-06-14 | 1975-03-12 | Ici Ltd | Reactive disazo dyestuffs |
| US4145340A (en) | 1973-01-30 | 1979-03-20 | Imperial Chemical Industries Limited | Water-soluble reactive monoazo dye containing a nonylphenoxy, chlorotriazine group |
| CH601437A5 (en:Method) | 1975-04-24 | 1978-07-14 | Sandoz Ag | |
| CH637679A5 (de) | 1977-07-22 | 1983-08-15 | Bayer Ag | Faserreaktive disazofarbstoffe. |
-
1980
- 1980-04-10 JP JP4618880A patent/JPS56155250A/ja active Granted
-
1981
- 1981-03-27 GB GB8109722A patent/GB2076006B/en not_active Expired
- 1981-04-02 US US06/250,431 patent/US4425270A/en not_active Expired - Fee Related
- 1981-04-03 DE DE19813113473 patent/DE3113473A1/de not_active Withdrawn
- 1981-04-09 CH CH239481A patent/CH645914A5/de not_active IP Right Cessation
Cited By (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5241057A (en) * | 1982-01-15 | 1993-08-31 | Bayer Aktiengesellshaft | Amino disazo dyestuffs containing a fluoropyrimidinyl or a fluorotriazinyl reactive group |
| EP0084314A3 (en) * | 1982-01-15 | 1984-01-04 | Bayer Ag | Reactive disazo dyes |
| EP0128340A1 (de) * | 1983-05-18 | 1984-12-19 | Bayer Ag | Disazoreaktivfarbstoffe |
| EP0208331A3 (en) * | 1983-07-29 | 1987-08-26 | Ciba-Geigy Ag | Reactive dyes, their preparation and their use |
| EP0134193A1 (de) * | 1983-07-29 | 1985-03-13 | Ciba-Geigy Ag | Reaktivfarbstoffe, deren Herstellung und Verwendung |
| EP0141776A1 (de) * | 1983-08-30 | 1985-05-15 | Ciba-Geigy Ag | Reaktivfarbstoffe, deren Herstellung und Verwendung |
| EP0167490A1 (de) * | 1984-07-05 | 1986-01-08 | Ciba-Geigy Ag | Reaktivfarbstoffe, deren Herstellung und Verwendung |
| US5047514A (en) * | 1984-08-30 | 1991-09-10 | Ciba-Geigy Corporation | Bireactive primary disazo dyes containing 1-amino-8-hydroxynaphthalene-3,6 Disulfonic acid as coupling component |
| EP0174275A1 (de) * | 1984-08-30 | 1986-03-12 | Ciba-Geigy Ag | Verfahren zum Färben oder Bedrucken von textilen Fasermaterialien mit Reaktivfarbstoffen |
| US5233026A (en) * | 1984-09-26 | 1993-08-03 | Ciba-Geigy Corporation | Azo dyes containing chloro-s-triazine and vinylsulfonyl type fiber-reactive groups |
| EP0186812A3 (en) * | 1984-12-20 | 1986-09-17 | Bayer Ag | Reactive dyes |
| EP0192067A1 (de) * | 1985-02-02 | 1986-08-27 | Bayer Ag | Disazofarbstoffe |
| EP0198350A1 (de) * | 1985-04-13 | 1986-10-22 | Bayer Ag | Disazoreaktivfarbstoffe |
| EP0198349A1 (de) * | 1985-04-13 | 1986-10-22 | Bayer Ag | Disazoreaktivfarbstoffe |
| EP0264878A1 (en) * | 1986-10-20 | 1988-04-27 | Mitsubishi Kasei Corporation | Water-soluble disazo colorants |
| EP0694589A1 (de) * | 1994-07-25 | 1996-01-31 | Hoechst Aktiengesellschaft | Wasserlösliche Disazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe |
| EP1887046A3 (en) * | 2006-08-09 | 2009-11-04 | Everlight USA, Inc. | Reactive dyes containing an alkylthio-s-triazinyl reactive group |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS56155250A (en) | 1981-12-01 |
| GB2076006B (en) | 1984-06-06 |
| GB2076006A (en) | 1981-11-25 |
| US4425270A (en) | 1984-01-10 |
| CH645914A5 (de) | 1984-10-31 |
| JPH0341503B2 (en:Method) | 1991-06-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3113473A1 (de) | Reaktive diszoverbindungen und verfahren zum anfaerben von celluslosefasern unter verwendung dieser verbindungen | |
| EP0040790B2 (de) | Verfahren zum Färben und Bedrucken von Hydroxy- und/oder Carbonamidgruppen enthaltenden Fasermaterialien | |
| EP0882836A2 (de) | Verfahren zum Vernetzen von cellulosehaltigen Fasermaterialien | |
| DE2500062C2 (de) | Faserreaktive Tetrazofarbstoffe und ihre Verwendung | |
| EP0028788B1 (de) | Kupferkomplex-Formazanverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| EP0887386B1 (de) | Verfahren zum Färben oder Bedrucken von cellulosehaltigen Fasermaterialien und neue Reaktivfarbstoffe | |
| JPH0340068B2 (en:Method) | ||
| EP0124797B1 (de) | Wasserlösliche Monoazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| EP0170612B1 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| DE69702963T2 (de) | Faserreaktive farbstoffe | |
| CH624139A5 (en:Method) | ||
| DE3217388A1 (de) | Wasserloesliche disazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe | |
| DE3118074A1 (de) | Monoazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe | |
| EP0832940B1 (de) | Farbstoffmischungen, Verfahren zu deren Herstellung und deren Verwendung | |
| DE3141908A1 (de) | Wasserloesliche pyridon-azoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe | |
| DE2757681C2 (de) | Phenylazopyridon-Verbindung, Verfahren zu deren Herstellung, ihre Verwendung zum Färben oder Bedrucken von Fasermaterial aus natürlicher oder regenerierter Cellulose oder aus natürlichen, regenerierten oder synthetischen Polyamiden | |
| DE2505497C3 (de) | Verwendung eines Farbstoffs mit Phosphor- und/oder Phosphonsäureestergruppen zum Färben von Wolle oder Nylon | |
| EP0122881B1 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| EP0134197B1 (de) | Reaktivfarbstoffe der Disazoreihe, deren Herstellung und Verwendung | |
| DE2814206A1 (de) | Reaktivfarbstoffe, verfahren zu ihrer herstellung und ihre verwendung zum faerben von textilmaterialien | |
| KR840001857B1 (ko) | 반응성 디스아조 화합물의 제조방법 | |
| CH635858A5 (de) | Faserreaktive azofarbstoffe, sowie deren herstellung. | |
| EP0012411A1 (de) | Anthrachinon-Reaktivfarbstoffe sowie deren Verwendung zum Färben von OH- oder amidgruppenhaltigen Materialien | |
| DE3202548A1 (de) | Faerbeverfahren unter verwendung salzhaltiger schaeume | |
| KR840001858B1 (ko) | 반응성 디스아조 화합물의 제조방법 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8128 | New person/name/address of the agent |
Representative=s name: TUERK, D., DIPL.-CHEM. DR.RER.NAT. GILLE, C., DIPL |
|
| 8139 | Disposal/non-payment of the annual fee |