DE3111238A1 - Substituierte triazolylmethyl-oxirane, verfahren zu ihrer herstellung sowie ihre verwendung als zwischenprodukte - Google Patents
Substituierte triazolylmethyl-oxirane, verfahren zu ihrer herstellung sowie ihre verwendung als zwischenprodukteInfo
- Publication number
- DE3111238A1 DE3111238A1 DE19813111238 DE3111238A DE3111238A1 DE 3111238 A1 DE3111238 A1 DE 3111238A1 DE 19813111238 DE19813111238 DE 19813111238 DE 3111238 A DE3111238 A DE 3111238A DE 3111238 A1 DE3111238 A1 DE 3111238A1
- Authority
- DE
- Germany
- Prior art keywords
- carbon atoms
- formula
- substituted
- atoms
- different halogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 22
- -1 METHYL OXIRANES Chemical class 0.000 title claims description 8
- 238000004519 manufacturing process Methods 0.000 title description 10
- 239000013067 intermediate product Substances 0.000 title description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 16
- 239000003085 diluting agent Substances 0.000 claims abstract description 6
- ANXKZXRDXAZQJT-UHFFFAOYSA-M methyl sulfate;trimethylsulfanium Chemical compound C[S+](C)C.COS([O-])(=O)=O ANXKZXRDXAZQJT-UHFFFAOYSA-M 0.000 claims abstract description 5
- 125000000547 substituted alkyl group Chemical group 0.000 claims abstract description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 41
- 125000005843 halogen group Chemical group 0.000 claims description 20
- 125000000217 alkyl group Chemical group 0.000 claims description 17
- 229910052736 halogen Inorganic materials 0.000 claims description 13
- 150000002367 halogens Chemical group 0.000 claims description 13
- 230000012010 growth Effects 0.000 claims description 11
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 10
- 239000000126 substance Substances 0.000 claims description 10
- 125000004995 haloalkylthio group Chemical group 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 125000001188 haloalkyl group Chemical group 0.000 claims description 8
- 239000003960 organic solvent Substances 0.000 claims description 6
- 230000001105 regulatory effect Effects 0.000 claims description 5
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- 230000015572 biosynthetic process Effects 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 239000000543 intermediate Substances 0.000 claims description 4
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 4
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims description 4
- 238000003786 synthesis reaction Methods 0.000 claims description 4
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 3
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 3
- DKWOHBPRFZIUQL-UHFFFAOYSA-N dimethyl-methylidene-oxo-$l^{6}-sulfane Chemical compound C[S+](C)([CH2-])=O DKWOHBPRFZIUQL-UHFFFAOYSA-N 0.000 claims description 3
- 230000000855 fungicidal effect Effects 0.000 claims description 3
- 125000003107 substituted aryl group Chemical group 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 abstract description 12
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 abstract description 10
- 125000000753 cycloalkyl group Chemical group 0.000 abstract description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 239000007795 chemical reaction product Substances 0.000 abstract 1
- LGRLWUINFJPLSH-UHFFFAOYSA-N methanide Chemical compound [CH3-] LGRLWUINFJPLSH-UHFFFAOYSA-N 0.000 abstract 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- 241000196324 Embryophyta Species 0.000 description 11
- 239000000460 chlorine Substances 0.000 description 11
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 10
- 229910052731 fluorine Inorganic materials 0.000 description 10
- 239000011737 fluorine Substances 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 9
- 125000001309 chloro group Chemical group Cl* 0.000 description 9
- 239000004480 active ingredient Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 6
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- 239000003995 emulsifying agent Substances 0.000 description 6
- 230000009036 growth inhibition Effects 0.000 description 6
- 230000017066 negative regulation of growth Effects 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- WWVKKAMHZCVYIT-UHFFFAOYSA-N 1-(2h-triazol-4-yl)ethanol Chemical class CC(O)C1=CNN=N1 WWVKKAMHZCVYIT-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 238000011065 in-situ storage Methods 0.000 description 4
- 150000002989 phenols Chemical class 0.000 description 4
- 230000008635 plant growth Effects 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- BPLKQGGAXWRFOE-UHFFFAOYSA-M trimethylsulfoxonium iodide Chemical compound [I-].C[S+](C)(C)=O BPLKQGGAXWRFOE-UHFFFAOYSA-M 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- 244000068988 Glycine max Species 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 239000005662 Paraffin oil Substances 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 235000021536 Sugar beet Nutrition 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- UHZZMRAGKVHANO-UHFFFAOYSA-M chlormequat chloride Chemical compound [Cl-].C[N+](C)(C)CCCl UHZZMRAGKVHANO-UHFFFAOYSA-M 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- 125000005283 haloketone group Chemical group 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- UDPGUMQDCGORJQ-UHFFFAOYSA-N (2-chloroethyl)phosphonic acid Chemical compound OP(O)(=O)CCCl UDPGUMQDCGORJQ-UHFFFAOYSA-N 0.000 description 1
- LBPYWVSTVGUTHZ-UHFFFAOYSA-N 1-(2-tert-butyl-3-methyloxiran-2-yl)-1,2,4-triazole Chemical compound CC1OC1(C(C)(C)C)N1N=CN=C1 LBPYWVSTVGUTHZ-UHFFFAOYSA-N 0.000 description 1
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 1
- MPNXSZJPSVBLHP-UHFFFAOYSA-N 2-chloro-n-phenylpyridine-3-carboxamide Chemical compound ClC1=NC=CC=C1C(=O)NC1=CC=CC=C1 MPNXSZJPSVBLHP-UHFFFAOYSA-N 0.000 description 1
- ANHAEBWRQNIPEV-UHFFFAOYSA-N 2-chloroethyl dihydrogen phosphate Chemical compound OP(O)(=O)OCCCl ANHAEBWRQNIPEV-UHFFFAOYSA-N 0.000 description 1
- FMWWRALTYIWZEB-UHFFFAOYSA-N 3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-one Chemical compound CC(C)(C)C(=O)CN1C=NC=N1 FMWWRALTYIWZEB-UHFFFAOYSA-N 0.000 description 1
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 241000219146 Gossypium Species 0.000 description 1
- 240000002024 Gossypium herbaceum Species 0.000 description 1
- 235000004341 Gossypium herbaceum Nutrition 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229920001213 Polysorbate 20 Polymers 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- GZRYBYIBLHMWCD-UHFFFAOYSA-N dimethyl(methylidene)-$l^{4}-sulfane Chemical compound CS(C)=C GZRYBYIBLHMWCD-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 125000002071 phenylalkoxy group Chemical group 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Epoxy Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (10)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
DE19813111238 DE3111238A1 (de) | 1981-03-21 | 1981-03-21 | Substituierte triazolylmethyl-oxirane, verfahren zu ihrer herstellung sowie ihre verwendung als zwischenprodukte |
US06/352,689 US4499281A (en) | 1981-03-21 | 1982-02-26 | Substituted triazolylmethyl-oxiranes and their use as intermediates for fungicides |
DE8282101800T DE3266271D1 (en) | 1981-03-21 | 1982-03-08 | Substituted triazolylmethyl oxiranes, process for their preparation and their application as intermediates |
AT82101800T ATE15673T1 (de) | 1981-03-21 | 1982-03-08 | Substituierte triazolylmethyl-oxirane, verfahren zu ihrer herstellung sowie ihre verwendung als zwischenprodukte. |
EP82101800A EP0061051B1 (de) | 1981-03-21 | 1982-03-08 | Substituierte Triazolylmethyl-oxirane, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Zwischenprodukte |
JP57040977A JPS57159779A (en) | 1981-03-21 | 1982-03-17 | Substituted triazolylmethyl-oxirane and manufacture |
IL65283A IL65283A (en) | 1981-03-21 | 1982-03-18 | Substituted triazolylmethyloxiranes,their preparation and their use as intermediates |
HU82841A HU189702B (en) | 1981-03-21 | 1982-03-19 | Process for preparing new triazolyl-methyl-oxirane derivatives |
ZA821856A ZA821856B (en) | 1981-03-21 | 1982-03-19 | Substituted triazolymethyl-oxiranes, processes for their preparation, and their use as intermediates |
BR8201535A BR8201535A (pt) | 1981-03-21 | 1982-03-19 | Processo para a preparacao de triazolilmetil-oxiranos substituidos,bem como sua aplicacao |
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
DE19813111238 DE3111238A1 (de) | 1981-03-21 | 1981-03-21 | Substituierte triazolylmethyl-oxirane, verfahren zu ihrer herstellung sowie ihre verwendung als zwischenprodukte |
Publications (1)
Publication Number | Publication Date |
---|---|
DE3111238A1 true DE3111238A1 (de) | 1982-10-07 |
Family
ID=6127994
Family Applications (2)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DE19813111238 Withdrawn DE3111238A1 (de) | 1981-03-21 | 1981-03-21 | Substituierte triazolylmethyl-oxirane, verfahren zu ihrer herstellung sowie ihre verwendung als zwischenprodukte |
DE8282101800T Expired DE3266271D1 (en) | 1981-03-21 | 1982-03-08 | Substituted triazolylmethyl oxiranes, process for their preparation and their application as intermediates |
Family Applications After (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DE8282101800T Expired DE3266271D1 (en) | 1981-03-21 | 1982-03-08 | Substituted triazolylmethyl oxiranes, process for their preparation and their application as intermediates |
Country Status (9)
Cited By (15)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
EP0223327A1 (en) | 1985-08-07 | 1987-05-27 | Imperial Chemical Industries Plc | Triazolylmethyl-tert.-butyl-carbinol derivatives, processes for their preparation and their use as plant growth regulators |
EP0315850A3 (en) * | 1987-11-07 | 1990-01-24 | Basf Aktiengesellschaft | Method for influencing plant growth by azolyl methyl oxiranes |
EP0388871A1 (de) * | 1989-03-21 | 1990-09-26 | BASF Aktiengesellschaft | Herbizide und pflanzenwachstumsregulierende Azolylmethyloxirane |
WO2011003527A1 (de) | 2009-07-08 | 2011-01-13 | Bayer Cropscience Ag | Phenyl(oxy/thio)alkanol-derivate |
WO2011003528A2 (de) | 2009-07-08 | 2011-01-13 | Bayer Cropscience Aktiengesellschaft | Substituierte phenyl(oxy/thio)alkanol-derivate |
WO2012072547A1 (de) | 2010-11-30 | 2012-06-07 | Bayer Cropscience Ag | Pyrimidin- derivate und ihre verwendung als schädlingsbekämpfungsmittel |
WO2014167009A1 (en) | 2013-04-12 | 2014-10-16 | Bayer Cropscience Ag | Novel triazole derivatives |
WO2014167008A1 (en) | 2013-04-12 | 2014-10-16 | Bayer Cropscience Ag | Novel triazolinthione derivatives |
WO2016156294A1 (en) | 2015-04-02 | 2016-10-06 | Bayer Cropscience Aktiengesellschaft | Triazol derivatives as fungicides |
WO2016156290A1 (en) | 2015-04-02 | 2016-10-06 | Bayer Cropscience Aktiengesellschaft | Novel 5-substituted imidazole derivatives |
US9668481B2 (en) | 2013-04-12 | 2017-06-06 | Bayer Cropscience Aktiengesellschaft | Triazole derivatives |
WO2018050456A1 (en) | 2016-09-13 | 2018-03-22 | Bayer Cropscience Aktiengesellschaft | Active compound combinations comprising a 5-substituted imidazole derivative |
WO2018060073A1 (en) | 2016-09-29 | 2018-04-05 | Bayer Cropscience Aktiengesellschaft | Novel 5-substituted imidazole derivatives |
WO2018060075A1 (en) | 2016-09-29 | 2018-04-05 | Bayer Cropscience Aktiengesellschaft | 1 -[2-(1 -chlorocyclopropyl)-2-hydroxy-3-(3-phenyl-1,2-oxazol-5-yl)propyl]-1h-imidazole-5-carbonitrile derivatives and related compounds as fungicides for crop protection |
WO2018060074A1 (en) | 2016-09-29 | 2018-04-05 | Bayer Cropscience Aktiengesellschaft | Novel 5-substituted imidazolylmethyl derivatives |
Families Citing this family (18)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
AU542623B2 (en) * | 1980-05-16 | 1985-02-28 | Bayer Aktiengesellschaft | 1-hydroxyethyl-azole derivatives |
US5395942A (en) * | 1980-06-02 | 1995-03-07 | Zeneca Limited | Heterocyclic compounds |
US5466821A (en) * | 1981-03-18 | 1995-11-14 | Zeneca Limited | Heterocyclic compounds |
DE3202601A1 (de) * | 1982-01-27 | 1983-08-04 | Bayer Ag, 5090 Leverkusen | Substituierte 1 -hydroxyalkyl-azolyl-derivate, verfahren zu ihrer herstellung sowie ihrer verwendung als fungizide und pflanzenwachstumsregulatoren |
DE3202613A1 (de) * | 1982-01-27 | 1983-08-04 | Bayer Ag, 5090 Leverkusen | Antimykotische mittel |
IL68433A (en) * | 1982-05-14 | 1986-04-29 | Basf Ag | Azolylmethyloxiranes,their manufacture and their use as fungicides and in pharmaceutical compositions |
DE3242222A1 (de) * | 1982-11-15 | 1984-05-17 | Bayer Ag, 5090 Leverkusen | Hydroxyalkinyl-azolyl-derivate |
KR840007402A (ko) * | 1983-01-06 | 1984-12-07 | 아놀드 자일러 에른스트 알테르 | 치환된 할로겐오아졸일프로판 유도체의 제조방법 |
DE3307216A1 (de) * | 1983-03-02 | 1984-09-06 | Bayer Ag, 5090 Leverkusen | Fungizide mittel |
DE3307217A1 (de) * | 1983-03-02 | 1984-09-06 | Bayer Ag, 5090 Leverkusen | Substituierte 1,3-diazolyl-2-propanole, verfahren zu ihrer herstellung und ihre verwendung als antimykotische mittel |
GB8322983D0 (en) * | 1983-08-26 | 1983-09-28 | Pfizer Ltd | Triazole antifungal agents |
DE3537817A1 (de) * | 1985-10-24 | 1987-04-30 | Bayer Ag | Verfahren zur herstellung von oxiranen |
DE3630129A1 (de) * | 1986-09-04 | 1988-03-17 | Bayer Ag | Mercapto-substituierte hydroxyethyl-(triazol-1-yl)-derivate |
JPH0739396B2 (ja) * | 1988-01-14 | 1995-05-01 | 呉羽化学工業株式会社 | 新規アゾール置換シクロアルカノール誘導体、その製造法及び該誘導体の農園芸用殺菌剤としての利用 |
US5095028A (en) * | 1988-01-14 | 1992-03-10 | Kureha Kagaku Kogyo Kabushiki Kaisha | 2-(4-chlorobenzyl)-1-(1H-imidazole-1-ylmethyl)-1-cyclohexanol and cycloheptanol |
DE3803833A1 (de) * | 1988-02-09 | 1989-08-17 | Bayer Ag | Substituierte azolylmethyloxirane |
US5134152A (en) * | 1989-12-07 | 1992-07-28 | Sankyo Company, Limited | Oxetane derivatives and their use as anti-fungal or fungicidal agents |
JP2576709Y2 (ja) * | 1993-09-27 | 1998-07-16 | 重松工業株式会社 | 電動式コンテナキャリヤ |
Family Cites Families (9)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3156554A (en) * | 1959-08-10 | 1964-11-10 | Research Corp | Method of controlling relative stem growth of plants |
IL29492A (en) * | 1967-02-23 | 1974-05-16 | Amchem Prod | Processes and compositions for the regulation of plant growth |
DE2851116A1 (de) * | 1978-11-25 | 1980-06-12 | Bayer Ag | Hydroxyethyl-azole, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
DE2908378A1 (de) * | 1979-03-03 | 1980-09-11 | Hoechst Ag | Derivate des 1,2,4-triazols |
IL60470A0 (en) * | 1979-07-04 | 1980-09-16 | Pfizer | Imidazole derivatives,their preparation and pharmaceutical compositions containing them |
DE2935354A1 (de) * | 1979-09-01 | 1981-03-19 | Bayer Ag, 5090 Leverkusen | Triglycidyl-triazolidin-3,5-dione und verfahren zu ihrer herstellung |
GB2078719B (en) * | 1980-06-02 | 1984-04-26 | Ici Ltd | Heterocyclic compounds |
DE3027623A1 (de) * | 1980-07-21 | 1982-02-18 | Bayer Ag, 5090 Leverkusen | Neue glycidyl-1,2,4-triazolidin-3,5-dione und ein verfahren zu ihrer herstellung |
DE3279417D1 (en) * | 1981-03-18 | 1989-03-09 | Ici Plc | Triazole compounds, a process for preparing them, their use as plant fungicides and fungicidal compositions containing them |
-
1981
- 1981-03-21 DE DE19813111238 patent/DE3111238A1/de not_active Withdrawn
-
1982
- 1982-02-26 US US06/352,689 patent/US4499281A/en not_active Expired - Fee Related
- 1982-03-08 EP EP82101800A patent/EP0061051B1/de not_active Expired
- 1982-03-08 AT AT82101800T patent/ATE15673T1/de active
- 1982-03-08 DE DE8282101800T patent/DE3266271D1/de not_active Expired
- 1982-03-17 JP JP57040977A patent/JPS57159779A/ja active Granted
- 1982-03-18 IL IL65283A patent/IL65283A/xx unknown
- 1982-03-19 HU HU82841A patent/HU189702B/hu not_active IP Right Cessation
- 1982-03-19 BR BR8201535A patent/BR8201535A/pt unknown
- 1982-03-19 ZA ZA821856A patent/ZA821856B/xx unknown
Cited By (17)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
EP0223327A1 (en) | 1985-08-07 | 1987-05-27 | Imperial Chemical Industries Plc | Triazolylmethyl-tert.-butyl-carbinol derivatives, processes for their preparation and their use as plant growth regulators |
EP0315850A3 (en) * | 1987-11-07 | 1990-01-24 | Basf Aktiengesellschaft | Method for influencing plant growth by azolyl methyl oxiranes |
EP0388871A1 (de) * | 1989-03-21 | 1990-09-26 | BASF Aktiengesellschaft | Herbizide und pflanzenwachstumsregulierende Azolylmethyloxirane |
WO2011003527A1 (de) | 2009-07-08 | 2011-01-13 | Bayer Cropscience Ag | Phenyl(oxy/thio)alkanol-derivate |
WO2011003528A2 (de) | 2009-07-08 | 2011-01-13 | Bayer Cropscience Aktiengesellschaft | Substituierte phenyl(oxy/thio)alkanol-derivate |
WO2012072547A1 (de) | 2010-11-30 | 2012-06-07 | Bayer Cropscience Ag | Pyrimidin- derivate und ihre verwendung als schädlingsbekämpfungsmittel |
US9822099B2 (en) | 2013-04-12 | 2017-11-21 | Bayer Cropscience Aktiengesellschaft | Triazole derivatives |
WO2014167008A1 (en) | 2013-04-12 | 2014-10-16 | Bayer Cropscience Ag | Novel triazolinthione derivatives |
US9550752B2 (en) | 2013-04-12 | 2017-01-24 | Bayer Cropscience Aktiengesellschaft | Triazolinthione derivatives |
US9668481B2 (en) | 2013-04-12 | 2017-06-06 | Bayer Cropscience Aktiengesellschaft | Triazole derivatives |
WO2014167009A1 (en) | 2013-04-12 | 2014-10-16 | Bayer Cropscience Ag | Novel triazole derivatives |
WO2016156294A1 (en) | 2015-04-02 | 2016-10-06 | Bayer Cropscience Aktiengesellschaft | Triazol derivatives as fungicides |
WO2016156290A1 (en) | 2015-04-02 | 2016-10-06 | Bayer Cropscience Aktiengesellschaft | Novel 5-substituted imidazole derivatives |
WO2018050456A1 (en) | 2016-09-13 | 2018-03-22 | Bayer Cropscience Aktiengesellschaft | Active compound combinations comprising a 5-substituted imidazole derivative |
WO2018060073A1 (en) | 2016-09-29 | 2018-04-05 | Bayer Cropscience Aktiengesellschaft | Novel 5-substituted imidazole derivatives |
WO2018060075A1 (en) | 2016-09-29 | 2018-04-05 | Bayer Cropscience Aktiengesellschaft | 1 -[2-(1 -chlorocyclopropyl)-2-hydroxy-3-(3-phenyl-1,2-oxazol-5-yl)propyl]-1h-imidazole-5-carbonitrile derivatives and related compounds as fungicides for crop protection |
WO2018060074A1 (en) | 2016-09-29 | 2018-04-05 | Bayer Cropscience Aktiengesellschaft | Novel 5-substituted imidazolylmethyl derivatives |
Also Published As
Publication number | Publication date |
---|---|
EP0061051B1 (de) | 1985-09-18 |
IL65283A (en) | 1985-07-31 |
HU189702B (en) | 1986-07-28 |
IL65283A0 (en) | 1982-05-31 |
ZA821856B (en) | 1983-02-23 |
EP0061051A1 (de) | 1982-09-29 |
JPS6360024B2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1988-11-22 |
US4499281A (en) | 1985-02-12 |
ATE15673T1 (de) | 1985-10-15 |
DE3266271D1 (en) | 1985-10-24 |
BR8201535A (pt) | 1983-02-08 |
JPS57159779A (en) | 1982-10-01 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE3111238A1 (de) | Substituierte triazolylmethyl-oxirane, verfahren zu ihrer herstellung sowie ihre verwendung als zwischenprodukte | |
EP0124009B1 (de) | Verfahren zur Herstellung von Oxiranen | |
EP0110048B1 (de) | Substituierte 1-Hydroxyethyl-triazolyl-Derivate | |
EP0000752B1 (de) | Alpha-azolysulfide, -sulfoxide und -sulfone, deren Salze und Metallkomplexe, Verfahren zu ihrer Herstellung, sowie sie enthaltende Mittel zur Pilzbekämpfung | |
DE3202604A1 (de) | Ether-derivate von substituierten 1-hydroxyalkyl-azolen, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide und pflanzenwachstumsregulatoren | |
DE3202601A1 (de) | Substituierte 1 -hydroxyalkyl-azolyl-derivate, verfahren zu ihrer herstellung sowie ihrer verwendung als fungizide und pflanzenwachstumsregulatoren | |
EP0054865B1 (de) | Substituierte 1-Azolyl-butan-2-one, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide sowie als Zwischenprodukte | |
DD142838A5 (de) | Fungizide mittel | |
EP0019189B1 (de) | Fungizide Mittel, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide | |
DE2350122A1 (de) | 1-propyl-1,2,4-triazolyl-derivate und deren salze, verfahren zu ihrer herstellung und ihre verwendung als fungizide | |
EP0124011B1 (de) | Verfahren zur Herstellung von Oxiranen | |
DE3311702A1 (de) | Fungizide mittel, verfahren zu ihrer herstellung und deren verwendung | |
DD208534A5 (de) | Fungizide mittel | |
CH633276A5 (de) | Fungizides und bakterizides mittel sowie verfahren zur herstellung neuer 1-azolyl-4-hydroxy-butan-derivate. | |
DE3315510A1 (de) | Verfahren zur herstellung von oxiranen | |
DE3440117A1 (de) | Substituierte azolylcyclopropyl-azolylmethyl-carbinol-derivate | |
DE3008477A1 (de) | 3,3-dimethyl-1-phenoxy-butan-2-ole, verfahren zu ihrer herstellung sowie ihre verwendung als zwischenprodukte | |
DE2334352A1 (de) | Im heterocyclus halogenierte triazolderivate, verfahren zu ihrer herstellung und ihre verwendung als fungizide | |
EP0057864B1 (de) | 2-Azolylmethyl-1,3-dioxolan- und -dioxan-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide | |
DE3005899A1 (de) | Derivate des 1,2,4-triazols und imidazols, verfahren zu ihrer herstellung und ihre verwendung als schaedlingsbekaempfungsmittel | |
DD219653A5 (de) | Fungizide mittel | |
EP0290907B1 (de) | Verfahren zur Herstellung von Acetylenepoxiden und deren Verwendung | |
DE3321158A1 (de) | Azolylmethyl-thienyl-carbinol-derivate | |
DE3021516A1 (de) | 4-substituierte 3,3-dimethyl-butan-2-one, verfahren zu ihrer herstellung sowie ihre verwendung als zwischenprodukte | |
EP0096801B1 (de) | Azolylmethyl-ketone, Verfahren zu ihrer Herstellung und ihre Verwendung als Zwischenprodukte |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
8130 | Withdrawal |