DE3103518A1 - "scherentrennschalter" - Google Patents
"scherentrennschalter"Info
- Publication number
- DE3103518A1 DE3103518A1 DE19813103518 DE3103518A DE3103518A1 DE 3103518 A1 DE3103518 A1 DE 3103518A1 DE 19813103518 DE19813103518 DE 19813103518 DE 3103518 A DE3103518 A DE 3103518A DE 3103518 A1 DE3103518 A1 DE 3103518A1
- Authority
- DE
- Germany
- Prior art keywords
- contact part
- contact
- scissors
- scissor
- disconnector according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000000969 carrier Substances 0.000 claims abstract description 7
- 230000005540 biological transmission Effects 0.000 claims description 29
- 238000009423 ventilation Methods 0.000 claims description 13
- 230000013011 mating Effects 0.000 description 3
- 239000004020 conductor Substances 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- HEFNNWSXXWATRW-UHFFFAOYSA-N Ibuprofen Chemical compound CC(C)CC1=CC=C(C(C)C(O)=O)C=C1 HEFNNWSXXWATRW-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H31/00—Air-break switches for high tension without arc-extinguishing or arc-preventing means
- H01H31/34—Air-break switches for high tension without arc-extinguishing or arc-preventing means with movable contact adapted to engage an overhead transmission line, e.g. for branching
- H01H31/36—Contact moved by pantograph
Landscapes
- Gas-Insulated Switchgears (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19813103518 DE3103518A1 (de) | 1981-02-03 | 1981-02-03 | "scherentrennschalter" |
| ZA82647A ZA82647B (en) | 1981-02-03 | 1982-02-02 | Pantograph disconnector |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19813103518 DE3103518A1 (de) | 1981-02-03 | 1981-02-03 | "scherentrennschalter" |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3103518A1 true DE3103518A1 (de) | 1982-08-12 |
| DE3103518C2 DE3103518C2 (enExample) | 1983-01-13 |
Family
ID=6123890
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19813103518 Granted DE3103518A1 (de) | 1981-02-03 | 1981-02-03 | "scherentrennschalter" |
Country Status (2)
| Country | Link |
|---|---|
| DE (1) | DE3103518A1 (enExample) |
| ZA (1) | ZA82647B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2025045356A1 (en) * | 2023-08-29 | 2025-03-06 | Hitachi Energy Ltd | Equipotential connection structure, switchgear device comprising the same, and method for manufacturing the same |
Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1074116B (de) * | 1956-01-31 | 1960-01-28 | Siemens Schuckertwerke Aktitr gesellschaft Berlin und Erlangen | Emstutzer Scherentrennschalter |
| DE1080660B (de) * | 1958-10-10 | 1960-04-28 | Licentia Gmbh | Scherentrenner |
| DE1129586B (enExample) * | 1953-10-23 | 1962-05-17 | Elin-Union Aktiengesellschaft Für Elektrische Industrie | |
| DE1191459B (de) * | 1963-09-02 | 1965-04-22 | Licentia Gmbh | Scherentrenner-Kontakt |
| DE1959966U (de) * | 1965-11-05 | 1967-05-11 | Siemens Ag | Hochspannungstrennschalter. |
| DE1240156B (de) * | 1965-08-19 | 1967-05-11 | Siemens Ag | Kontaktanordnung, insbesondere fuer Scherentrenner |
| DE1244910B (de) * | 1965-08-05 | 1967-07-20 | Licentia Gmbh | Greifervorrichtung fuer Einsaeulen-Scherentrennschalter |
| DE2336543A1 (de) * | 1973-07-18 | 1975-02-06 | Bbc Brown Boveri & Cie | Scherentrennschalter |
-
1981
- 1981-02-03 DE DE19813103518 patent/DE3103518A1/de active Granted
-
1982
- 1982-02-02 ZA ZA82647A patent/ZA82647B/xx unknown
Patent Citations (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1129586B (enExample) * | 1953-10-23 | 1962-05-17 | Elin-Union Aktiengesellschaft Für Elektrische Industrie | |
| DE1074116B (de) * | 1956-01-31 | 1960-01-28 | Siemens Schuckertwerke Aktitr gesellschaft Berlin und Erlangen | Emstutzer Scherentrennschalter |
| DE1080660B (de) * | 1958-10-10 | 1960-04-28 | Licentia Gmbh | Scherentrenner |
| DE1085942B (de) * | 1958-10-10 | 1960-07-28 | Licentia Gmbh | Scherentrenner |
| DE1191459B (de) * | 1963-09-02 | 1965-04-22 | Licentia Gmbh | Scherentrenner-Kontakt |
| DE1244910B (de) * | 1965-08-05 | 1967-07-20 | Licentia Gmbh | Greifervorrichtung fuer Einsaeulen-Scherentrennschalter |
| DE1240156B (de) * | 1965-08-19 | 1967-05-11 | Siemens Ag | Kontaktanordnung, insbesondere fuer Scherentrenner |
| DE1959966U (de) * | 1965-11-05 | 1967-05-11 | Siemens Ag | Hochspannungstrennschalter. |
| DE2336543A1 (de) * | 1973-07-18 | 1975-02-06 | Bbc Brown Boveri & Cie | Scherentrennschalter |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2025045356A1 (en) * | 2023-08-29 | 2025-03-06 | Hitachi Energy Ltd | Equipotential connection structure, switchgear device comprising the same, and method for manufacturing the same |
Also Published As
| Publication number | Publication date |
|---|---|
| ZA82647B (en) | 1983-01-26 |
| DE3103518C2 (enExample) | 1983-01-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3615707C2 (enExample) | ||
| EP1096606A1 (de) | Anschlussklemme | |
| EP0568755A1 (de) | Kontaktvorrichtung | |
| DE4409612C2 (de) | Elektrische Vorrichtung zum Verbinden elektrischer Leiter, insbesondere Reihenklemme | |
| EP0122465A2 (de) | Elektrischer Schalter oder Taster mit zwei grossflächigen Betätigungswippen | |
| EP0532881A2 (de) | Vorrichtung zur elektrischen Verbindung von parallel angeordneten Stromschienen | |
| EP0616401A1 (de) | Stromschienenpaket | |
| DE4018978A1 (de) | Schiebeschalter | |
| DE3103518A1 (de) | "scherentrennschalter" | |
| EP1423862B1 (de) | Schaltkontaktanordnung mit einer einrichtung zur verstärkung einer zwischen schaltkontakten wirkenden kontaktkraft | |
| EP0515009A1 (de) | Mit Löschgas arbeitender Mehrstellungs-Drehschalter | |
| AT405000B (de) | Feldabstandhalter für hochspannungs-freileitungen mit bündelleitern | |
| DE8614175U1 (de) | Raumfachwerk, insbesondere für den Ausstellungs- und Innenausbau | |
| WO2003052893A2 (de) | Durchführung | |
| DE19635366A1 (de) | Bewegbare Kontaktanordnung für einen Niederspannungs-Leistungsschalter mit einem Schwenklager | |
| DE10260402B4 (de) | Einrichtung zur Herstellung einer unter Kontaktkraft gehaltenen stromleitenden Überbrückung und elektrisches Erdungsgerät mit einer derartigen Einrichtung | |
| DE2452944A1 (de) | Tastenschaltersystem | |
| DE2946227C2 (de) | Drehkontakt, insbesondere für Hochspannungs-Drehtrennschalter | |
| EP1002326B1 (de) | Sicherung mit kodierung | |
| EP1289085A1 (de) | Steckmodul für einen Niederspannungsverteiler | |
| EP0393338B1 (de) | Anordnung zum Kontaktieren einer planaren Mikrowellenschaltung in einem Hohlleiter oder Gehäuse | |
| DE29604726U1 (de) | Stromzuführung für armförmige bewegliche Kontakte eines Niederspannungs-Schutzschalters | |
| DE4208371C2 (de) | Elektrisches Installationsgerät | |
| DE29615566U1 (de) | Bewegbare Schaltkontaktanordnung mit einem Kontakthebel aufnehmenden Kontakthebelträger | |
| EP0690527A1 (de) | Anschlussvorrichtung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8331 | Complete revocation |