DE3049461A1 - Verfahren zur herstellung von monochlormethylketonen - Google Patents
Verfahren zur herstellung von monochlormethylketonenInfo
- Publication number
- DE3049461A1 DE3049461A1 DE19803049461 DE3049461A DE3049461A1 DE 3049461 A1 DE3049461 A1 DE 3049461A1 DE 19803049461 DE19803049461 DE 19803049461 DE 3049461 A DE3049461 A DE 3049461A DE 3049461 A1 DE3049461 A1 DE 3049461A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- dimethyl
- dichloro
- chloro
- mol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000004519 manufacturing process Methods 0.000 title abstract description 5
- 238000000034 method Methods 0.000 claims abstract description 15
- SUNMBRGCANLOEG-UHFFFAOYSA-N monochloromethyl ketone Natural products ClCC(=O)CCl SUNMBRGCANLOEG-UHFFFAOYSA-N 0.000 claims abstract description 12
- 238000005903 acid hydrolysis reaction Methods 0.000 claims abstract description 7
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 6
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 claims abstract description 5
- 125000000547 substituted alkyl group Chemical group 0.000 claims abstract description 5
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 claims abstract description 4
- 229940031826 phenolate Drugs 0.000 claims abstract description 4
- 229910001413 alkali metal ion Inorganic materials 0.000 claims abstract description 3
- 229910001420 alkaline earth metal ion Inorganic materials 0.000 claims abstract description 3
- 238000006243 chemical reaction Methods 0.000 claims description 14
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 abstract description 9
- 239000000543 intermediate Substances 0.000 abstract description 5
- 150000005840 aryl radicals Chemical class 0.000 abstract description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract description 3
- 230000015572 biosynthetic process Effects 0.000 abstract description 2
- 238000003786 synthesis reaction Methods 0.000 abstract description 2
- 125000006193 alkinyl group Chemical group 0.000 abstract 1
- 125000002837 carbocyclic group Chemical group 0.000 abstract 1
- 229910052799 carbon Inorganic materials 0.000 abstract 1
- 239000000417 fungicide Substances 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 18
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 238000010626 work up procedure Methods 0.000 description 11
- IUVCFHHAEHNCFT-INIZCTEOSA-N 2-[(1s)-1-[4-amino-3-(3-fluoro-4-propan-2-yloxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-6-fluoro-3-(3-fluorophenyl)chromen-4-one Chemical compound C1=C(F)C(OC(C)C)=CC=C1C(C1=C(N)N=CN=C11)=NN1[C@@H](C)C1=C(C=2C=C(F)C=CC=2)C(=O)C2=CC(F)=CC=C2O1 IUVCFHHAEHNCFT-INIZCTEOSA-N 0.000 description 10
- 150000001875 compounds Chemical class 0.000 description 10
- QHZJYDNPXMNLMV-UHFFFAOYSA-N 1,1-dichloro-3,3-dimethylpenta-1,4-diene Chemical compound C=CC(C)(C)C=C(Cl)Cl QHZJYDNPXMNLMV-UHFFFAOYSA-N 0.000 description 7
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical class CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- 235000019253 formic acid Nutrition 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- NESLWCLHZZISNB-UHFFFAOYSA-M sodium phenolate Chemical compound [Na+].[O-]C1=CC=CC=C1 NESLWCLHZZISNB-UHFFFAOYSA-M 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- ZMTGFOBMYYRLFG-UHFFFAOYSA-N 1-chloro-3,3-dimethylpent-4-en-2-one Chemical compound C=CC(C)(C)C(=O)CCl ZMTGFOBMYYRLFG-UHFFFAOYSA-N 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical class CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- BOUDVNGHXLOFPV-UHFFFAOYSA-N (1-chloro-3,3-dimethylpenta-1,4-dien-2-yl)oxybenzene Chemical compound C=CC(C)(C)C(=CCl)OC1=CC=CC=C1 BOUDVNGHXLOFPV-UHFFFAOYSA-N 0.000 description 4
- PKRFQAWEVJJQIE-UHFFFAOYSA-N 1,1-dichloro-3,3-dimethylbut-1-ene Chemical compound CC(C)(C)C=C(Cl)Cl PKRFQAWEVJJQIE-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 4
- 150000004707 phenolate Chemical class 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- AXOLUEXMIKZJNV-UHFFFAOYSA-N 1,1,5-trichloro-3,3-dimethylpent-1-ene Chemical compound ClCCC(C)(C)C=C(Cl)Cl AXOLUEXMIKZJNV-UHFFFAOYSA-N 0.000 description 3
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- -1 acetone Chemical compound 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 150000002576 ketones Chemical group 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- RRDJFSJPPIHJHT-UHFFFAOYSA-N (1-chloro-3,3-dimethylpent-1-en-2-yl)oxybenzene Chemical compound CCC(C)(C)C(=CCl)OC1=CC=CC=C1 RRDJFSJPPIHJHT-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- YQBCWYLQVVPACB-UHFFFAOYSA-N 1-(2,2-dichloroethenyl)-1-methylcyclohexane Chemical compound ClC(Cl)=CC1(C)CCCCC1 YQBCWYLQVVPACB-UHFFFAOYSA-N 0.000 description 2
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 2
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 description 2
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 150000007980 azole derivatives Chemical class 0.000 description 2
- YXVFYQXJAXKLAK-UHFFFAOYSA-N biphenyl-4-ol Chemical compound C1=CC(O)=CC=C1C1=CC=CC=C1 YXVFYQXJAXKLAK-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 2
- 150000008379 phenol ethers Chemical class 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- CAQOAOMIFHZPKH-UHFFFAOYSA-N (1-chloro-3,3-dimethylbut-1-en-2-yl)oxybenzene Chemical compound CC(C)(C)C(=CCl)OC1=CC=CC=C1 CAQOAOMIFHZPKH-UHFFFAOYSA-N 0.000 description 1
- XRPLUPRJHDFQPM-UHFFFAOYSA-N (1-chloro-3-methylbut-1-en-2-yl)oxybenzene Chemical compound CC(C)C(=CCl)OC1=CC=CC=C1 XRPLUPRJHDFQPM-UHFFFAOYSA-N 0.000 description 1
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- QIAGELDPFDREAO-UHFFFAOYSA-N 1,1,4-trichloro-3,3-bis(chloromethyl)but-1-ene Chemical compound ClCC(CCl)(CCl)C=C(Cl)Cl QIAGELDPFDREAO-UHFFFAOYSA-N 0.000 description 1
- GABFKYZMXLDZNL-UHFFFAOYSA-N 1,1,4-trichloro-3,3-dimethylbut-1-ene Chemical compound ClCC(C)(C)C=C(Cl)Cl GABFKYZMXLDZNL-UHFFFAOYSA-N 0.000 description 1
- KYNPXVVQNPGSSL-UHFFFAOYSA-N 1,1,4-trichloro-3,3-dimethylpent-1-ene Chemical compound CC(Cl)C(C)(C)C=C(Cl)Cl KYNPXVVQNPGSSL-UHFFFAOYSA-N 0.000 description 1
- OHHICJQEDCMLKC-UHFFFAOYSA-N 1,1-dichloro-3,3,4-trimethylpent-1-ene Chemical compound CC(C)C(C)(C)C=C(Cl)Cl OHHICJQEDCMLKC-UHFFFAOYSA-N 0.000 description 1
- GRJPYTQPGRYWDW-UHFFFAOYSA-N 1,1-dichloro-3,3-diethylpent-1-ene Chemical compound CCC(CC)(CC)C=C(Cl)Cl GRJPYTQPGRYWDW-UHFFFAOYSA-N 0.000 description 1
- KBMGNDWCYUGWFC-UHFFFAOYSA-N 1,1-dichloro-3,3-dimethyloct-1-ene Chemical compound CCCCCC(C)(C)C=C(Cl)Cl KBMGNDWCYUGWFC-UHFFFAOYSA-N 0.000 description 1
- FWWDARKGGUNRPN-UHFFFAOYSA-N 1,1-dichloro-3-methylbut-1-ene Chemical compound CC(C)C=C(Cl)Cl FWWDARKGGUNRPN-UHFFFAOYSA-N 0.000 description 1
- VOKJAXLHHKZFCO-UHFFFAOYSA-N 1,1-dichloro-5-fluoro-3,3-dimethylpent-1-ene Chemical compound FCCC(C)(C)C=C(Cl)Cl VOKJAXLHHKZFCO-UHFFFAOYSA-N 0.000 description 1
- UAZUEJTXWAXSMA-UHFFFAOYSA-N 1,1-dichlorobut-1-ene Chemical compound CCC=C(Cl)Cl UAZUEJTXWAXSMA-UHFFFAOYSA-N 0.000 description 1
- LGXVIGDEPROXKC-UHFFFAOYSA-N 1,1-dichloroethene Chemical compound ClC(Cl)=C LGXVIGDEPROXKC-UHFFFAOYSA-N 0.000 description 1
- CYSGHNMQYZDMIA-UHFFFAOYSA-N 1,3-Dimethyl-2-imidazolidinon Chemical compound CN1CCN(C)C1=O CYSGHNMQYZDMIA-UHFFFAOYSA-N 0.000 description 1
- MSOVRDSJWIJMEZ-UHFFFAOYSA-N 1-(1-chloro-3,3-dimethylbut-1-en-2-yl)oxy-3-methylbenzene Chemical compound CC1=CC=CC(OC(=CCl)C(C)(C)C)=C1 MSOVRDSJWIJMEZ-UHFFFAOYSA-N 0.000 description 1
- JWMRVYRBVJQYBX-UHFFFAOYSA-N 1-(2,2-dichloroethenyl)-1-ethylcyclopentane Chemical compound ClC(Cl)=CC1(CC)CCCC1 JWMRVYRBVJQYBX-UHFFFAOYSA-N 0.000 description 1
- DFIRQGQKDJSMSS-UHFFFAOYSA-N 1-(2,2-dichloroethenyl)-1-methylcyclopropane Chemical compound ClC(Cl)=CC1(C)CC1 DFIRQGQKDJSMSS-UHFFFAOYSA-N 0.000 description 1
- ULSAJQMHTGKPIY-UHFFFAOYSA-N 1-chloro-3,3-dimethylbutan-2-one Chemical compound CC(C)(C)C(=O)CCl ULSAJQMHTGKPIY-UHFFFAOYSA-N 0.000 description 1
- JCPJSXNGVDBQLC-UHFFFAOYSA-N 1-chloro-4-(1-chloro-3,3-dimethylpenta-1,4-dien-2-yl)oxybenzene Chemical compound C=CC(C)(C)C(=CCl)OC1=CC=C(Cl)C=C1 JCPJSXNGVDBQLC-UHFFFAOYSA-N 0.000 description 1
- ZIUZMUXWOZDVQO-UHFFFAOYSA-N 1-chloro-4-(5,5-dichloro-3,3-dimethylpent-4-enoxy)benzene Chemical compound ClC(Cl)=CC(C)(C)CCOC1=CC=C(Cl)C=C1 ZIUZMUXWOZDVQO-UHFFFAOYSA-N 0.000 description 1
- LINPIYWFGCPVIE-UHFFFAOYSA-N 2,4,6-trichlorophenol Chemical compound OC1=C(Cl)C=C(Cl)C=C1Cl LINPIYWFGCPVIE-UHFFFAOYSA-N 0.000 description 1
- RPUUVUJVFMDHKC-UHFFFAOYSA-N 2,4-dichloro-1-(4,4-dichloro-2,2-dimethylbut-3-enyl)benzene Chemical compound ClC(Cl)=CC(C)(C)CC1=CC=C(Cl)C=C1Cl RPUUVUJVFMDHKC-UHFFFAOYSA-N 0.000 description 1
- HFZWRUODUSTPEG-UHFFFAOYSA-N 2,4-dichlorophenol Chemical compound OC1=CC=C(Cl)C=C1Cl HFZWRUODUSTPEG-UHFFFAOYSA-N 0.000 description 1
- NVWVWEWVLBKPSM-UHFFFAOYSA-N 2,4-difluorophenol Chemical compound OC1=CC=C(F)C=C1F NVWVWEWVLBKPSM-UHFFFAOYSA-N 0.000 description 1
- HIGGFWFRAWSMBR-UHFFFAOYSA-N 2-Methyl-3-hexanone Chemical compound CCCC(=O)C(C)C HIGGFWFRAWSMBR-UHFFFAOYSA-N 0.000 description 1
- IGYXYGDEYHNFFT-UHFFFAOYSA-N 2-chloro-4-fluorophenol Chemical compound OC1=CC=C(F)C=C1Cl IGYXYGDEYHNFFT-UHFFFAOYSA-N 0.000 description 1
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 1
- HFHFGHLXUCOHLN-UHFFFAOYSA-N 2-fluorophenol Chemical compound OC1=CC=CC=C1F HFHFGHLXUCOHLN-UHFFFAOYSA-N 0.000 description 1
- FYYOTZLMLLTWAP-UHFFFAOYSA-N 3,3-dimethylpent-4-enoic acid Chemical compound C=CC(C)(C)CC(O)=O FYYOTZLMLLTWAP-UHFFFAOYSA-N 0.000 description 1
- YYFLDZZDOUDZQM-UHFFFAOYSA-N 3-[1-[[4-(3-phenylquinolin-2-yl)phenyl]methyl]piperidin-4-yl]-1h-benzimidazol-2-one Chemical compound O=C1NC2=CC=CC=C2N1C(CC1)CCN1CC(C=C1)=CC=C1C1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 YYFLDZZDOUDZQM-UHFFFAOYSA-N 0.000 description 1
- ICVFJPSNAUMFCW-UHFFFAOYSA-N 4-Chloro-4'-biphenylol Chemical compound C1=CC(O)=CC=C1C1=CC=C(Cl)C=C1 ICVFJPSNAUMFCW-UHFFFAOYSA-N 0.000 description 1
- GZFGOTFRPZRKDS-UHFFFAOYSA-N 4-bromophenol Chemical compound OC1=CC=C(Br)C=C1 GZFGOTFRPZRKDS-UHFFFAOYSA-N 0.000 description 1
- RHPUJHQBPORFGV-UHFFFAOYSA-N 4-chloro-2-methylphenol Chemical compound CC1=CC(Cl)=CC=C1O RHPUJHQBPORFGV-UHFFFAOYSA-N 0.000 description 1
- RHMPLDJJXGPMEX-UHFFFAOYSA-N 4-fluorophenol Chemical compound OC1=CC=C(F)C=C1 RHMPLDJJXGPMEX-UHFFFAOYSA-N 0.000 description 1
- HAJHZTMAUJPJIJ-UHFFFAOYSA-N 5,5-dichloro-3,3-dimethylpent-4-en-2-one Chemical compound CC(=O)C(C)(C)C=C(Cl)Cl HAJHZTMAUJPJIJ-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 241000231258 Suillus granulatus Species 0.000 description 1
- 238000006959 Williamson synthesis reaction Methods 0.000 description 1
- ZAMIAHZZOYBLDK-UHFFFAOYSA-N [2-chloro-1-(1-methylcyclohexyl)ethenoxy]benzene Chemical compound C=1C=CC=CC=1OC(=CCl)C1(C)CCCCC1 ZAMIAHZZOYBLDK-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 238000007171 acid catalysis Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000003851 azoles Chemical class 0.000 description 1
- 125000003943 azolyl group Chemical group 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 125000002573 ethenylidene group Chemical group [*]=C=C([H])[H] 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 150000002560 ketene acetals Chemical class 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- YWAKXRMUMFPDSH-UHFFFAOYSA-N pentene Chemical compound CCCC=C YWAKXRMUMFPDSH-UHFFFAOYSA-N 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229910001414 potassium ion Inorganic materials 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- ZGJADVGJIVEEGF-UHFFFAOYSA-M potassium;phenoxide Chemical compound [K+].[O-]C1=CC=CC=C1 ZGJADVGJIVEEGF-UHFFFAOYSA-M 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/29—Saturated compounds containing keto groups bound to rings
- C07C49/327—Saturated compounds containing keto groups bound to rings containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/25—Preparation of halogenated hydrocarbons by splitting-off hydrogen halides from halogenated hydrocarbons
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/26—Preparation of halogenated hydrocarbons by reactions involving an increase in the number of carbon atoms in the skeleton
- C07C17/263—Preparation of halogenated hydrocarbons by reactions involving an increase in the number of carbon atoms in the skeleton by condensation reactions
- C07C17/269—Preparation of halogenated hydrocarbons by reactions involving an increase in the number of carbon atoms in the skeleton by condensation reactions of only halogenated hydrocarbons
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/20—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring
- C07C43/225—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/51—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by pyrolysis, rearrangement or decomposition
- C07C45/511—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by pyrolysis, rearrangement or decomposition involving transformation of singly bound oxygen functional groups to >C = O groups
- C07C45/513—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by pyrolysis, rearrangement or decomposition involving transformation of singly bound oxygen functional groups to >C = O groups the singly bound functional group being an etherified hydroxyl group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/04—Saturated compounds containing keto groups bound to acyclic carbon atoms
- C07C49/16—Saturated compounds containing keto groups bound to acyclic carbon atoms containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/20—Unsaturated compounds containing keto groups bound to acyclic carbon atoms
- C07C49/213—Unsaturated compounds containing keto groups bound to acyclic carbon atoms containing six-membered aromatic rings
- C07C49/217—Unsaturated compounds containing keto groups bound to acyclic carbon atoms containing six-membered aromatic rings having unsaturation outside the aromatic rings
- C07C49/223—Unsaturated compounds containing keto groups bound to acyclic carbon atoms containing six-membered aromatic rings having unsaturation outside the aromatic rings polycyclic
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/20—Unsaturated compounds containing keto groups bound to acyclic carbon atoms
- C07C49/227—Unsaturated compounds containing keto groups bound to acyclic carbon atoms containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/20—Unsaturated compounds containing keto groups bound to acyclic carbon atoms
- C07C49/255—Unsaturated compounds containing keto groups bound to acyclic carbon atoms containing ether groups, groups, groups, or groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803049461 DE3049461A1 (de) | 1980-12-30 | 1980-12-30 | Verfahren zur herstellung von monochlormethylketonen |
| US06/329,959 US4460793A (en) | 1980-12-30 | 1981-12-11 | Preparation of monochloromethyl ketones |
| DE8181110565T DE3163425D1 (en) | 1980-12-30 | 1981-12-18 | Process for the production of monochloromethyl ketones |
| EP81110565A EP0055427B1 (de) | 1980-12-30 | 1981-12-18 | Verfahren zur Herstellung von Monochlormethylketonen |
| AT81110565T ATE7292T1 (de) | 1980-12-30 | 1981-12-18 | Verfahren zur herstellung von monochlormethylketonen. |
| JP56208266A JPS57134433A (en) | 1980-12-30 | 1981-12-24 | Manufacture of monochloromethyl ketones |
| IL64662A IL64662A (en) | 1980-12-30 | 1981-12-28 | Preparation of monochloromethyl ketones and the novel 1-chloro-3,3-dimethylpent-4-en-2-one produced thereby |
| CA000393322A CA1169434A (en) | 1980-12-30 | 1981-12-29 | Process for the preparation of monochloromethyl ketones |
| BR8108490A BR8108490A (pt) | 1980-12-30 | 1981-12-29 | Processo para a preparacao de monoclorometilcetonas |
| DK581481A DK154639C (da) | 1980-12-30 | 1981-12-29 | Fremgangsmaade til fremstilling af monochlormethylketoner |
| HU813981A HU191236B (en) | 1980-12-30 | 1981-12-29 | Process for preparing monochloro-methyl-ketone derivatives |
| ZA818995A ZA818995B (en) | 1980-12-30 | 1981-12-29 | Process for the preparation of monochloromethyl ketones |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803049461 DE3049461A1 (de) | 1980-12-30 | 1980-12-30 | Verfahren zur herstellung von monochlormethylketonen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3049461A1 true DE3049461A1 (de) | 1982-09-09 |
Family
ID=6120530
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803049461 Withdrawn DE3049461A1 (de) | 1980-12-30 | 1980-12-30 | Verfahren zur herstellung von monochlormethylketonen |
| DE8181110565T Expired DE3163425D1 (en) | 1980-12-30 | 1981-12-18 | Process for the production of monochloromethyl ketones |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8181110565T Expired DE3163425D1 (en) | 1980-12-30 | 1981-12-18 | Process for the production of monochloromethyl ketones |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4460793A (enExample) |
| EP (1) | EP0055427B1 (enExample) |
| JP (1) | JPS57134433A (enExample) |
| AT (1) | ATE7292T1 (enExample) |
| BR (1) | BR8108490A (enExample) |
| CA (1) | CA1169434A (enExample) |
| DE (2) | DE3049461A1 (enExample) |
| DK (1) | DK154639C (enExample) |
| HU (1) | HU191236B (enExample) |
| IL (1) | IL64662A (enExample) |
| ZA (1) | ZA818995B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0224076A1 (de) | 1985-11-15 | 1987-06-03 | Bayer Ag | Azolyletherketone und -alkohole |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS58144342A (ja) * | 1982-02-22 | 1983-08-27 | Shiyouno Tamie | ハロメチルケトン類の製造法 |
| DE3222221A1 (de) * | 1982-06-12 | 1983-12-15 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 5-aryloxy-1-chlor-3,3-dimethyl-pentan-2-onen |
| CA1269994A (en) * | 1985-04-05 | 1990-06-05 | Noritada Matsuo | Method for producing cyclopropanecarboxylic acid derivatives |
| US5441713A (en) * | 1988-04-29 | 1995-08-15 | Nalco Fuel Tech | Hardness suppression in urea solutions |
| CN116573995A (zh) * | 2023-05-04 | 2023-08-11 | 上海惠和化德生物科技有限公司 | 一氯频呐酮的制备方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1829869A (en) * | 1930-04-23 | 1931-11-03 | Du Pont | Process of forming cyclic alcohols and ketones |
| US2988537A (en) * | 1958-10-21 | 1961-06-13 | Du Pont | Art and composition |
| US3277068A (en) * | 1962-07-31 | 1966-10-04 | Leo A Wall | Perfluorovinylphenylethers and their polymers |
| US3294820A (en) * | 1963-03-04 | 1966-12-27 | American Cyanamid Co | Process for preparing halomethyl vinyl ketones |
| US4195033A (en) * | 1975-05-16 | 1980-03-25 | Imperial Chemical Industries Limited | 1-Acetyl or 1-cyano-2(2,2-dichlorovinyl)-3,3-dimethyl cyclopropane |
| DE2716896B1 (de) * | 1977-04-16 | 1978-11-02 | Bayer Ag | Verfahren zur Herstellung von 1-Chlor-3,3-dimethyl-butan-2-on |
| DE2716895C2 (de) * | 1977-04-16 | 1985-09-19 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von monohalogenierten Ketonen |
-
1980
- 1980-12-30 DE DE19803049461 patent/DE3049461A1/de not_active Withdrawn
-
1981
- 1981-12-11 US US06/329,959 patent/US4460793A/en not_active Expired - Lifetime
- 1981-12-18 DE DE8181110565T patent/DE3163425D1/de not_active Expired
- 1981-12-18 EP EP81110565A patent/EP0055427B1/de not_active Expired
- 1981-12-18 AT AT81110565T patent/ATE7292T1/de not_active IP Right Cessation
- 1981-12-24 JP JP56208266A patent/JPS57134433A/ja active Granted
- 1981-12-28 IL IL64662A patent/IL64662A/xx unknown
- 1981-12-29 BR BR8108490A patent/BR8108490A/pt unknown
- 1981-12-29 CA CA000393322A patent/CA1169434A/en not_active Expired
- 1981-12-29 ZA ZA818995A patent/ZA818995B/xx unknown
- 1981-12-29 DK DK581481A patent/DK154639C/da not_active IP Right Cessation
- 1981-12-29 HU HU813981A patent/HU191236B/hu not_active IP Right Cessation
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0224076A1 (de) | 1985-11-15 | 1987-06-03 | Bayer Ag | Azolyletherketone und -alkohole |
Also Published As
| Publication number | Publication date |
|---|---|
| DK154639C (da) | 1989-05-08 |
| DK581481A (da) | 1982-07-01 |
| CA1169434A (en) | 1984-06-19 |
| JPS57134433A (en) | 1982-08-19 |
| ZA818995B (en) | 1982-12-29 |
| ATE7292T1 (de) | 1984-05-15 |
| US4460793A (en) | 1984-07-17 |
| DK154639B (da) | 1988-12-05 |
| IL64662A0 (en) | 1982-03-31 |
| EP0055427A1 (de) | 1982-07-07 |
| JPH0158171B2 (enExample) | 1989-12-11 |
| DE3163425D1 (en) | 1984-06-07 |
| HU191236B (en) | 1987-01-28 |
| EP0055427B1 (de) | 1984-05-02 |
| IL64662A (en) | 1985-03-31 |
| BR8108490A (pt) | 1982-10-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2858248C2 (enExample) | ||
| DE1298514B (de) | Verfahren zur Herstellung von Perfluoralkyl-alkyl-aethern | |
| DE2741764A1 (de) | Verfahren zur herstellung von m-phenoxybenzaldehyd | |
| EP0008734A1 (de) | Verfahren zur Herstellung von 4-Fluoro-3-phenoxy-toluol | |
| DE3049461A1 (de) | Verfahren zur herstellung von monochlormethylketonen | |
| EP0116323A1 (de) | Verfahren zur Herstellung von aromatischen Aldehyden | |
| EP0001980B1 (de) | Verfahren zur Herstellung von Halogenvinyl-gamma-butyrolactonen, sowie Zwischenprodukte und ihre Herstellung | |
| DE1793500C2 (de) | Verfahren zur Herstellung fluorier ter Allyl oder Vinyl ather | |
| EP0095047A1 (de) | Verfahren zur Herstellung von 3-vinylsubstituierten 2,2-Dimethylcyclopropan-1-carbonsäuren bzw. ihren Estern und neue Zwischenprodukte dafür | |
| EP0056933B1 (de) | Verfahren zur Herstellung von 1-Aryloxy-methylketonen | |
| EP0290903B1 (de) | Beta-Fluoracyl-beta-halogenvinylalkylether | |
| EP0523668B1 (de) | Verfahren zur Herstellung von Difluorbenzaldehyden | |
| DE2358690C3 (de) | Substituierte Succindialdehydmonoacetale und ein Verfahren zu ihrer Herstellung | |
| DE2802281A1 (de) | Neue phenylen-bis-diketone, ihre herstellung und deren verwendung | |
| EP0080096B1 (de) | Alkylcycloalkyl-imidazolylmethyl-ketone und Verfahren zu ihrer Herstellung | |
| EP0048370A1 (de) | Verfahren zur Herstellung von trans-3-(Z-2-Chlor-2-aryl-vinyl)-2,2-dimethyl-cyclopropan-1-carbon-säure-derivaten, neue Zwischenprodukte hierfür, Verfahren zu deren Herstellung und Verwendung von Zwischenprodukten in Schädlingsbekämpfungsmitteln | |
| EP0118082B1 (de) | Phenoxyacetylene und Verfahren zu ihrer Herstellung | |
| DE3836159A1 (de) | Neue fluor enthaltende und an der ch(pfeil abwaerts)3(pfeil abwaerts)-gruppe gegebenenfalls halogenierte acetophenone und deren herstellung aus neuen fluor enthaltenden benzonitrilen | |
| EP0010183B1 (de) | 3,3-Bisfluoromethyl-butan-2-on und Verfahren zu dessen Herstellung | |
| DE2658496A1 (de) | Verfahren zur herstellung von diphenylaethern | |
| EP0780362A1 (de) | 3,3-Dioxy-4,4,4-trifluorbuttersäure-Derivate | |
| DE3725941A1 (de) | Ester von arylperfluoralkylcarbinolen, verfahren zur herstellung dieser verbindungen und der zugrundeliegenden arylbisperfluoralkylcarbinole | |
| DE3021516A1 (de) | 4-substituierte 3,3-dimethyl-butan-2-one, verfahren zu ihrer herstellung sowie ihre verwendung als zwischenprodukte | |
| CH527833A (de) | Verfahren zur Herstellung von symmetrischen 1,3,5-Trithianverbindungen | |
| DE1283820B (de) | Verfahren zur Herstellung von Perfluor-alkyl-alkyl-aethern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |