DE3029422C2 - Piezoelektrischer Lautsprecher - Google Patents
Piezoelektrischer LautsprecherInfo
- Publication number
- DE3029422C2 DE3029422C2 DE3029422A DE3029422A DE3029422C2 DE 3029422 C2 DE3029422 C2 DE 3029422C2 DE 3029422 A DE3029422 A DE 3029422A DE 3029422 A DE3029422 A DE 3029422A DE 3029422 C2 DE3029422 C2 DE 3029422C2
- Authority
- DE
- Germany
- Prior art keywords
- transducer element
- piezoelectric
- membrane
- diameter
- along
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000012528 membrane Substances 0.000 claims description 18
- 230000008878 coupling Effects 0.000 claims description 17
- 238000010168 coupling process Methods 0.000 claims description 17
- 238000005859 coupling reaction Methods 0.000 claims description 17
- 238000010276 construction Methods 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 230000010355 oscillation Effects 0.000 description 4
- 229910000906 Bronze Inorganic materials 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 239000010974 bronze Substances 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 description 2
- 239000002985 plastic film Substances 0.000 description 2
- 229920006255 plastic film Polymers 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- JRPBQTZRNDNNOP-UHFFFAOYSA-N barium titanate Chemical compound [Ba+2].[Ba+2].[O-][Ti]([O-])([O-])[O-] JRPBQTZRNDNNOP-UHFFFAOYSA-N 0.000 description 1
- 229910002113 barium titanate Inorganic materials 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 230000005520 electrodynamics Effects 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- WABPQHHGFIMREM-UHFFFAOYSA-N lead(0) Chemical compound [Pb] WABPQHHGFIMREM-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- LJCNRYVRMXRIQR-OLXYHTOASA-L potassium sodium L-tartrate Chemical compound [Na+].[K+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O LJCNRYVRMXRIQR-OLXYHTOASA-L 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 235000011006 sodium potassium tartrate Nutrition 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04R—LOUDSPEAKERS, MICROPHONES, GRAMOPHONE PICK-UPS OR LIKE ACOUSTIC ELECTROMECHANICAL TRANSDUCERS; DEAF-AID SETS; PUBLIC ADDRESS SYSTEMS
- H04R17/00—Piezoelectric transducers; Electrostrictive transducers
Landscapes
- Physics & Mathematics (AREA)
- Engineering & Computer Science (AREA)
- Acoustics & Sound (AREA)
- Signal Processing (AREA)
- Piezo-Electric Transducers For Audible Bands (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP54104438A JPS5911237B2 (ja) | 1979-08-16 | 1979-08-16 | 圧電スピ−カ |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3029422A1 DE3029422A1 (de) | 1981-03-26 |
| DE3029422C2 true DE3029422C2 (de) | 1986-04-03 |
Family
ID=14380661
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3029422A Expired DE3029422C2 (de) | 1979-08-16 | 1980-08-02 | Piezoelektrischer Lautsprecher |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4386241A (enExample) |
| JP (1) | JPS5911237B2 (enExample) |
| DE (1) | DE3029422C2 (enExample) |
| FR (1) | FR2463562A1 (enExample) |
| GB (1) | GB2057225B (enExample) |
| HK (1) | HK56685A (enExample) |
| SG (1) | SG33485G (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3620557A1 (de) * | 1986-06-19 | 1987-12-23 | Reinhardt Fischer | Elektroakustischer wandler |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4373119A (en) * | 1980-12-05 | 1983-02-08 | Motorola, Inc. | Adjustable transducer |
| JPS57178795U (enExample) * | 1981-05-07 | 1982-11-12 | ||
| US4414436A (en) * | 1982-04-19 | 1983-11-08 | Pioneer Speaker Components, Inc. | Narrow-frequency band acoustic transducer |
| DE3335431A1 (de) * | 1983-03-18 | 1984-09-20 | Siemens AG, 1000 Berlin und 8000 München | Wandlerplatte fuer piezoelektrische wandler und vorrichtung zu deren herstellung |
| FR2579053B1 (fr) * | 1985-03-15 | 1988-04-08 | Elno Exploit Groupe | Transducteur acousto-electrique, notamment pour microphones differentiels |
| JP2701279B2 (ja) * | 1987-12-28 | 1998-01-21 | ヤマハ株式会社 | 音響装置 |
| JP2605321B2 (ja) * | 1987-12-28 | 1997-04-30 | ヤマハ株式会社 | 音響装置 |
| JPH0220997U (enExample) * | 1988-07-26 | 1990-02-13 | ||
| US5062139A (en) * | 1989-06-05 | 1991-10-29 | Christensen Eugene J | Coaxial loud speaker system |
| US5181019A (en) * | 1991-07-02 | 1993-01-19 | Designtech International, Inc. | Weighted transducer and driving circuit with feedback |
| FR2734685B1 (fr) * | 1995-05-23 | 1997-08-14 | Silec Liaisons Elec | Haut-parleur piezoelectrique |
| US5938404A (en) * | 1997-06-05 | 1999-08-17 | Mcdonnell Douglas Helicopter Company | Oscillating air jets on aerodynamic surfaces |
| US6543719B1 (en) | 1997-06-05 | 2003-04-08 | Mcdonnell Douglas Helicopter Co. | Oscillating air jets for implementing blade variable twist, enhancing engine and blade efficiency, and reducing drag, vibration, download and ir signature |
| TW431113B (en) * | 1998-04-22 | 2001-04-21 | Hokuriku Elect Ind | Piezoelectric acoustic device |
| AT411558B (de) * | 1999-11-05 | 2004-02-25 | Akg Acoustics Gmbh | Elektroakustischer wandler |
| US6478541B1 (en) | 2001-08-16 | 2002-11-12 | The Boeing Company | Tapered/segmented flaps for rotor blade-vortex interaction (BVI) noise and vibration reduction |
| EP1471768A4 (en) * | 2002-01-30 | 2008-06-25 | Matsushita Electric Industrial Co Ltd | SPEAKER FOR PLAYBACK IN THE SUPER HIGH FREQUENCY RANGE |
| CA2748252C (en) * | 2008-12-26 | 2014-05-27 | Panasonic Electric Works Co., Ltd. | Piezoelectric speaker, piezoelectric audio device employing piezoelectric speaker, and sensor with alert device attached |
| EP2661102A4 (en) * | 2010-12-28 | 2017-11-01 | NEC Corporation | Vibration device and electronic apparatus |
| WO2012157691A1 (ja) * | 2011-05-17 | 2012-11-22 | 株式会社村田製作所 | 平面型スピーカおよびav機器 |
| US9226078B2 (en) * | 2013-03-15 | 2015-12-29 | Emo Labs, Inc. | Acoustic transducers |
| DE102017108594A1 (de) * | 2017-04-21 | 2018-10-25 | USound GmbH | Lautsprechereinheit mit einem elektrodynamischen und einem MEMS-Lautsprecher |
| KR102775780B1 (ko) | 2022-03-17 | 2025-03-06 | 썬전 샥 컴퍼니, 리미티드 | 음향출력장치 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2477596A (en) * | 1947-08-29 | 1949-08-02 | Brush Dev Co | Electromechanical transducer device |
| US2607858A (en) * | 1948-06-19 | 1952-08-19 | Bell Telephone Labor Inc | Electromechanical transducer |
| DE848206C (de) * | 1951-01-14 | 1952-09-15 | Telefunken Gmbh | Kristallautsprechersystem |
| BE518496A (enExample) * | 1952-03-18 | |||
| US2910545A (en) * | 1954-08-30 | 1959-10-27 | Gen Electric | Transducer |
| US3166730A (en) * | 1959-09-29 | 1965-01-19 | Jr James R Brown | Annular electrostrictive transducer |
| US3588381A (en) * | 1967-08-28 | 1971-06-28 | Motorola Inc | Transducer having spaced apart oppositely flexing piezoelectric members |
| US3721840A (en) * | 1971-09-14 | 1973-03-20 | Nittan Co Ltd | Sound generator |
| US3786202A (en) * | 1972-04-10 | 1974-01-15 | Motorola Inc | Acoustic transducer including piezoelectric driving element |
| GB2018548B (en) * | 1978-04-07 | 1982-06-16 | Matsushita Electric Industrial Co Ltd | Piezoelectric speaker |
-
1979
- 1979-08-16 JP JP54104438A patent/JPS5911237B2/ja not_active Expired
-
1980
- 1980-08-02 DE DE3029422A patent/DE3029422C2/de not_active Expired
- 1980-08-13 GB GB8026320A patent/GB2057225B/en not_active Expired
- 1980-08-13 FR FR8017861A patent/FR2463562A1/fr active Granted
- 1980-08-13 US US06/177,599 patent/US4386241A/en not_active Expired - Lifetime
-
1985
- 1985-05-02 SG SG33485A patent/SG33485G/en unknown
- 1985-08-01 HK HK566/85A patent/HK56685A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3620557A1 (de) * | 1986-06-19 | 1987-12-23 | Reinhardt Fischer | Elektroakustischer wandler |
Also Published As
| Publication number | Publication date |
|---|---|
| SG33485G (en) | 1986-05-02 |
| DE3029422A1 (de) | 1981-03-26 |
| GB2057225B (en) | 1983-10-12 |
| GB2057225A (en) | 1981-03-25 |
| JPS5911237B2 (ja) | 1984-03-14 |
| JPS5628600A (en) | 1981-03-20 |
| FR2463562A1 (fr) | 1981-02-20 |
| HK56685A (en) | 1985-08-09 |
| US4386241A (en) | 1983-05-31 |
| FR2463562B1 (enExample) | 1983-11-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3029422C2 (de) | Piezoelektrischer Lautsprecher | |
| DE2828148C2 (de) | Biegeanordnung | |
| DE2160176C3 (de) | Elektroakustischer Wandler | |
| DE2937942C2 (de) | Ultraschallwandler | |
| DE2946618C2 (enExample) | ||
| DE2711996C2 (de) | Elektroakustischer Wandler | |
| DE2330367A1 (de) | Elektrostatischer wandler | |
| DE2913957C3 (de) | Piezoelektrischer Lautsprecher | |
| DE2749987A1 (de) | Ultraschall-wandler | |
| DE3531325A1 (de) | Piezoelektrische schwingkoerper und mit denselben ausgestatteter lautsprecher | |
| DE3525724A1 (de) | Piezoelektrischer elektroakustischer wandler | |
| DE1512729A1 (de) | Piezoelektrischer UEbertrager | |
| DE2339433B2 (de) | Elektroakustischer Wandler nach dem elektrostatischen Prinzip | |
| DE3008638A1 (de) | Kondensatormikrophon | |
| DE2150194B2 (de) | Elektrostatischer Lautsprecher | |
| DE2126556A1 (de) | Mikrophonkapsel mit Verstärker | |
| DE2046901A1 (de) | Piezoelektrischer Wandler und Verfahren zu seiner Herstellung | |
| DE3808019A1 (de) | Ultraschall-sensor | |
| DE3143027C2 (de) | Piezoelektrischer Wandler | |
| DE3102151A1 (de) | Akustischer wandler | |
| EP0193886A2 (de) | Membran für Planarlautsprecher | |
| DE19612481A1 (de) | Elektrostatischer Wandler | |
| DE6609583U (de) | Piezoelektrischer wandler. | |
| DE2202254C2 (de) | Elektroakustischer Wandler, insbesondere Mikrophon für Fernsprechanlagen | |
| DE3620557C2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |