DE3022258C2 - Thermoplastische Polymermasse - Google Patents
Thermoplastische PolymermasseInfo
- Publication number
- DE3022258C2 DE3022258C2 DE19803022258 DE3022258A DE3022258C2 DE 3022258 C2 DE3022258 C2 DE 3022258C2 DE 19803022258 DE19803022258 DE 19803022258 DE 3022258 A DE3022258 A DE 3022258A DE 3022258 C2 DE3022258 C2 DE 3022258C2
- Authority
- DE
- Germany
- Prior art keywords
- component
- weight
- block copolymer
- composition according
- polymer composition
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920001169 thermoplastic Polymers 0.000 title claims description 101
- 239000000203 mixture Substances 0.000 claims description 283
- 229920001400 block copolymer Polymers 0.000 claims description 268
- 229920000642 polymer Polymers 0.000 claims description 175
- 229920001577 copolymer Polymers 0.000 claims description 61
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 60
- -1 aromatic vinyl compound Chemical class 0.000 claims description 54
- 229920000728 polyester Polymers 0.000 claims description 40
- 238000004132 cross linking Methods 0.000 claims description 37
- 239000004416 thermosoftening plastic Substances 0.000 claims description 36
- 230000001070 adhesive effect Effects 0.000 claims description 30
- 229920002635 polyurethane Polymers 0.000 claims description 29
- 239000004814 polyurethane Substances 0.000 claims description 29
- 150000001875 compounds Chemical class 0.000 claims description 27
- 239000000853 adhesive Substances 0.000 claims description 24
- 150000001991 dicarboxylic acids Chemical class 0.000 claims description 24
- 239000004417 polycarbonate Substances 0.000 claims description 23
- 239000004952 Polyamide Substances 0.000 claims description 21
- 229920002647 polyamide Polymers 0.000 claims description 21
- 229920002554 vinyl polymer Polymers 0.000 claims description 21
- 238000000465 moulding Methods 0.000 claims description 20
- 229920000412 polyarylene Polymers 0.000 claims description 20
- 150000001993 dienes Chemical class 0.000 claims description 19
- 239000000178 monomer Substances 0.000 claims description 17
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 16
- 229920000554 ionomer Polymers 0.000 claims description 16
- 229920002292 Nylon 6 Polymers 0.000 claims description 15
- 150000002170 ethers Chemical class 0.000 claims description 15
- 229910021645 metal ion Inorganic materials 0.000 claims description 15
- 229920000058 polyacrylate Polymers 0.000 claims description 14
- 229920000515 polycarbonate Polymers 0.000 claims description 14
- 229910052751 metal Inorganic materials 0.000 claims description 13
- 239000002184 metal Substances 0.000 claims description 13
- 229920000193 polymethacrylate Polymers 0.000 claims description 13
- 229920000098 polyolefin Polymers 0.000 claims description 13
- 229920002451 polyvinyl alcohol Polymers 0.000 claims description 13
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 claims description 12
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 10
- 239000000654 additive Substances 0.000 claims description 10
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 claims description 10
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 claims description 10
- 229920002492 poly(sulfone) Polymers 0.000 claims description 10
- 229920001955 polyphenylene ether Polymers 0.000 claims description 10
- 239000004800 polyvinyl chloride Substances 0.000 claims description 10
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 10
- 229920006324 polyoxymethylene Polymers 0.000 claims description 9
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 8
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 claims description 7
- 125000003118 aryl group Chemical group 0.000 claims description 7
- 150000002736 metal compounds Chemical class 0.000 claims description 7
- 150000002825 nitriles Chemical class 0.000 claims description 7
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 claims description 7
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims description 7
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 claims description 6
- 229920002302 Nylon 6,6 Polymers 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 150000003568 thioethers Chemical class 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 229920001707 polybutylene terephthalate Polymers 0.000 claims description 5
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 claims description 4
- 239000005038 ethylene vinyl acetate Substances 0.000 claims description 4
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 4
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 claims description 4
- 239000011976 maleic acid Substances 0.000 claims description 4
- 229920000139 polyethylene terephthalate Polymers 0.000 claims description 4
- 239000005020 polyethylene terephthalate Substances 0.000 claims description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 3
- 150000008064 anhydrides Chemical class 0.000 claims description 3
- 229920006242 ethylene acrylic acid copolymer Polymers 0.000 claims description 3
- 229920005648 ethylene methacrylic acid copolymer Polymers 0.000 claims description 3
- 239000001530 fumaric acid Substances 0.000 claims description 3
- 238000010559 graft polymerization reaction Methods 0.000 claims description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 2
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims 1
- 238000003763 carbonization Methods 0.000 claims 1
- 229920006344 thermoplastic copolyester Polymers 0.000 claims 1
- 239000000306 component Substances 0.000 description 254
- 230000000052 comparative effect Effects 0.000 description 96
- 239000000047 product Substances 0.000 description 59
- 238000002156 mixing Methods 0.000 description 57
- 239000003921 oil Substances 0.000 description 42
- 239000004793 Polystyrene Substances 0.000 description 29
- 230000000704 physical effect Effects 0.000 description 29
- 239000000126 substance Substances 0.000 description 27
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 23
- 239000000463 material Substances 0.000 description 23
- 230000000875 corresponding effect Effects 0.000 description 21
- 238000012360 testing method Methods 0.000 description 21
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 18
- 238000005299 abrasion Methods 0.000 description 17
- 229920002223 polystyrene Polymers 0.000 description 15
- 239000008188 pellet Substances 0.000 description 14
- 238000004519 manufacturing process Methods 0.000 description 13
- 239000000243 solution Substances 0.000 description 13
- 238000000034 method Methods 0.000 description 12
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 11
- 238000007792 addition Methods 0.000 description 11
- 239000003431 cross linking reagent Substances 0.000 description 11
- 238000001746 injection moulding Methods 0.000 description 11
- 150000002739 metals Chemical class 0.000 description 11
- 239000004734 Polyphenylene sulfide Substances 0.000 description 10
- 229920000069 polyphenylene sulfide Polymers 0.000 description 10
- 229920005989 resin Polymers 0.000 description 10
- 239000011347 resin Substances 0.000 description 10
- 229920003048 styrene butadiene rubber Polymers 0.000 description 10
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 9
- 229920006347 Elastollan Polymers 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 150000002334 glycols Chemical class 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- 229920000219 Ethylene vinyl alcohol Polymers 0.000 description 8
- 239000000470 constituent Substances 0.000 description 8
- 238000007654 immersion Methods 0.000 description 8
- 239000002075 main ingredient Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000004721 Polyphenylene oxide Substances 0.000 description 7
- 125000004018 acid anhydride group Chemical group 0.000 description 7
- 229920005601 base polymer Polymers 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 238000000576 coating method Methods 0.000 description 7
- 230000006835 compression Effects 0.000 description 7
- 238000007906 compression Methods 0.000 description 7
- 150000001990 dicarboxylic acid derivatives Chemical class 0.000 description 7
- 125000001142 dicarboxylic acid group Chemical group 0.000 description 7
- 229920001519 homopolymer Polymers 0.000 description 7
- 239000003607 modifier Substances 0.000 description 7
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- 229910052782 aluminium Inorganic materials 0.000 description 6
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 6
- 239000011248 coating agent Substances 0.000 description 6
- 238000000748 compression moulding Methods 0.000 description 6
- 229920005669 high impact polystyrene Polymers 0.000 description 6
- 239000004797 high-impact polystyrene Substances 0.000 description 6
- 238000004898 kneading Methods 0.000 description 6
- 230000014759 maintenance of location Effects 0.000 description 6
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 6
- 229920013636 polyphenyl ether polymer Polymers 0.000 description 6
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical class OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 5
- 239000004698 Polyethylene Substances 0.000 description 5
- 230000008901 benefit Effects 0.000 description 5
- 241001233037 catfish Species 0.000 description 5
- 230000006872 improvement Effects 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 230000004048 modification Effects 0.000 description 5
- 238000012986 modification Methods 0.000 description 5
- 229920000573 polyethylene Polymers 0.000 description 5
- 239000004926 polymethyl methacrylate Substances 0.000 description 5
- 239000003381 stabilizer Substances 0.000 description 5
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 5
- HMUNWXXNJPVALC-UHFFFAOYSA-N 1-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C(CN1CC2=C(CC1)NN=N2)=O HMUNWXXNJPVALC-UHFFFAOYSA-N 0.000 description 4
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 4
- YJLUBHOZZTYQIP-UHFFFAOYSA-N 2-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1=NN=C(O1)CC(=O)N1CC2=C(CC1)NN=N2 YJLUBHOZZTYQIP-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- JHWNWJKBPDFINM-UHFFFAOYSA-N Laurolactam Chemical compound O=C1CCCCCCCCCCCN1 JHWNWJKBPDFINM-UHFFFAOYSA-N 0.000 description 4
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 4
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 4
- 229920000299 Nylon 12 Polymers 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 4
- 150000001336 alkenes Chemical class 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 150000001735 carboxylic acids Chemical class 0.000 description 4
- 229920001971 elastomer Polymers 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 238000001125 extrusion Methods 0.000 description 4
- 125000000524 functional group Chemical group 0.000 description 4
- 239000003365 glass fiber Substances 0.000 description 4
- 229920000578 graft copolymer Polymers 0.000 description 4
- 229920001903 high density polyethylene Polymers 0.000 description 4
- 239000004700 high-density polyethylene Substances 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 239000010687 lubricating oil Substances 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 4
- 238000006068 polycondensation reaction Methods 0.000 description 4
- 229920005862 polyol Polymers 0.000 description 4
- 150000003077 polyols Chemical class 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 125000000547 substituted alkyl group Chemical group 0.000 description 4
- 229910052717 sulfur Inorganic materials 0.000 description 4
- 239000011593 sulfur Substances 0.000 description 4
- SXAMGRAIZSSWIH-UHFFFAOYSA-N 2-[3-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,2,4-oxadiazol-5-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1=NOC(=N1)CC(=O)N1CC2=C(CC1)NN=N2 SXAMGRAIZSSWIH-UHFFFAOYSA-N 0.000 description 3
- WWSJZGAPAVMETJ-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-3-ethoxypyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2)OCC WWSJZGAPAVMETJ-UHFFFAOYSA-N 0.000 description 3
- FYELSNVLZVIGTI-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-5-ethylpyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C=NN(C=1CC)CC(=O)N1CC2=C(CC1)NN=N2 FYELSNVLZVIGTI-UHFFFAOYSA-N 0.000 description 3
- YLZOPXRUQYQQID-UHFFFAOYSA-N 3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]propan-1-one Chemical compound N1N=NC=2CN(CCC=21)CCC(=O)N1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F YLZOPXRUQYQQID-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000004709 Chlorinated polyethylene Substances 0.000 description 3
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 3
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 3
- 229920000571 Nylon 11 Polymers 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 239000004372 Polyvinyl alcohol Substances 0.000 description 3
- 229910008423 Si—B Inorganic materials 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000004433 Thermoplastic polyurethane Substances 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 238000007259 addition reaction Methods 0.000 description 3
- 239000012790 adhesive layer Substances 0.000 description 3
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000008199 coating composition Substances 0.000 description 3
- 239000007822 coupling agent Substances 0.000 description 3
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 3
- 125000005442 diisocyanate group Chemical group 0.000 description 3
- 150000002009 diols Chemical class 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 150000004679 hydroxides Chemical class 0.000 description 3
- 239000012948 isocyanate Substances 0.000 description 3
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 3
- 150000002642 lithium compounds Chemical class 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 239000004014 plasticizer Substances 0.000 description 3
- 239000002861 polymer material Substances 0.000 description 3
- 238000006116 polymerization reaction Methods 0.000 description 3
- 238000012545 processing Methods 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 239000005060 rubber Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 229920002803 thermoplastic polyurethane Polymers 0.000 description 3
- 229920001567 vinyl ester resin Polymers 0.000 description 3
- 230000004584 weight gain Effects 0.000 description 3
- 235000019786 weight gain Nutrition 0.000 description 3
- LDXJRKWFNNFDSA-UHFFFAOYSA-N 2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]ethanone Chemical compound C1CN(CC2=NNN=C21)CC(=O)N3CCN(CC3)C4=CN=C(N=C4)NCC5=CC(=CC=C5)OC(F)(F)F LDXJRKWFNNFDSA-UHFFFAOYSA-N 0.000 description 2
- JQMFQLVAJGZSQS-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)NC1=CC2=C(NC(O2)=O)C=C1 JQMFQLVAJGZSQS-UHFFFAOYSA-N 0.000 description 2
- ZRPAUEVGEGEPFQ-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]pyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2 ZRPAUEVGEGEPFQ-UHFFFAOYSA-N 0.000 description 2
- SBYMUDUGTIKLCR-UHFFFAOYSA-N 2-chloroethenylbenzene Chemical compound ClC=CC1=CC=CC=C1 SBYMUDUGTIKLCR-UHFFFAOYSA-N 0.000 description 2
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 2
- CONKBQPVFMXDOV-QHCPKHFHSA-N 6-[(5S)-5-[[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C[C@H]1CN(C(O1)=O)C1=CC2=C(NC(O2)=O)C=C1 CONKBQPVFMXDOV-QHCPKHFHSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 239000004925 Acrylic resin Substances 0.000 description 2
- 229920000178 Acrylic resin Polymers 0.000 description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 2
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- KCXZNSGUUQJJTR-UHFFFAOYSA-N Di-n-hexyl phthalate Chemical compound CCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCC KCXZNSGUUQJJTR-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- 239000004831 Hot glue Substances 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 238000004566 IR spectroscopy Methods 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 2
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 2
- NIPNSKYNPDTRPC-UHFFFAOYSA-N N-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 NIPNSKYNPDTRPC-UHFFFAOYSA-N 0.000 description 2
- 239000004677 Nylon Substances 0.000 description 2
- 229930040373 Paraformaldehyde Natural products 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 229920002433 Vinyl chloride-vinyl acetate copolymer Polymers 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 125000005250 alkyl acrylate group Chemical group 0.000 description 2
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 125000002843 carboxylic acid group Chemical group 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000007334 copolymerization reaction Methods 0.000 description 2
- 238000005336 cracking Methods 0.000 description 2
- 229920006037 cross link polymer Polymers 0.000 description 2
- 238000005238 degreasing Methods 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 229960002380 dibutyl phthalate Drugs 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 125000003700 epoxy group Chemical group 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 230000009477 glass transition Effects 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- 229920001684 low density polyethylene Polymers 0.000 description 2
- 239000004702 low-density polyethylene Substances 0.000 description 2
- 229920003145 methacrylic acid copolymer Polymers 0.000 description 2
- 125000005397 methacrylic acid ester group Chemical group 0.000 description 2
- 125000005395 methacrylic acid group Chemical group 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 2
- 229920001778 nylon Polymers 0.000 description 2
- BNJOQKFENDDGSC-UHFFFAOYSA-N octadecanedioic acid Chemical compound OC(=O)CCCCCCCCCCCCCCCCC(O)=O BNJOQKFENDDGSC-UHFFFAOYSA-N 0.000 description 2
- 239000005022 packaging material Substances 0.000 description 2
- 230000000737 periodic effect Effects 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000012994 photoredox catalyst Substances 0.000 description 2
- WLJVNTCWHIRURA-UHFFFAOYSA-N pimelic acid Chemical compound OC(=O)CCCCCC(O)=O WLJVNTCWHIRURA-UHFFFAOYSA-N 0.000 description 2
- 229920000570 polyether Polymers 0.000 description 2
- 239000002685 polymerization catalyst Substances 0.000 description 2
- 230000000379 polymerizing effect Effects 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 238000003825 pressing Methods 0.000 description 2
- 239000010734 process oil Substances 0.000 description 2
- 238000007151 ring opening polymerisation reaction Methods 0.000 description 2
- 238000001175 rotational moulding Methods 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- TYFQFVWCELRYAO-UHFFFAOYSA-N suberic acid Chemical compound OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- LWBHHRRTOZQPDM-UHFFFAOYSA-N undecanedioic acid Chemical compound OC(=O)CCCCCCCCCC(O)=O LWBHHRRTOZQPDM-UHFFFAOYSA-N 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- XPNGNIFUDRPBFJ-UHFFFAOYSA-N (2-methylphenyl)methanol Chemical compound CC1=CC=CC=C1CO XPNGNIFUDRPBFJ-UHFFFAOYSA-N 0.000 description 1
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical compound C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 description 1
- ZQHJVIHCDHJVII-OWOJBTEDSA-N (e)-2-chlorobut-2-enedioic acid Chemical compound OC(=O)\C=C(\Cl)C(O)=O ZQHJVIHCDHJVII-OWOJBTEDSA-N 0.000 description 1
- BGJSXRVXTHVRSN-UHFFFAOYSA-N 1,3,5-trioxane Chemical compound C1OCOCO1 BGJSXRVXTHVRSN-UHFFFAOYSA-N 0.000 description 1
- KPZGRMZPZLOPBS-UHFFFAOYSA-N 1,3-dichloro-2,2-bis(chloromethyl)propane Chemical compound ClCC(CCl)(CCl)CCl KPZGRMZPZLOPBS-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- OHVLMTFVQDZYHP-UHFFFAOYSA-N 1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-2-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]ethanone Chemical compound N1N=NC=2CN(CCC=21)C(CN1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)=O OHVLMTFVQDZYHP-UHFFFAOYSA-N 0.000 description 1
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- WJFKNYWRSNBZNX-UHFFFAOYSA-N 10H-phenothiazine Chemical compound C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- XXZCIYUJYUESMD-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-3-(morpholin-4-ylmethyl)pyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2)CN1CCOCC1 XXZCIYUJYUESMD-UHFFFAOYSA-N 0.000 description 1
- WZFUQSJFWNHZHM-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 WZFUQSJFWNHZHM-UHFFFAOYSA-N 0.000 description 1
- CFVWNXQPGQOHRJ-UHFFFAOYSA-N 2-methylpropyl prop-2-enoate Chemical compound CC(C)COC(=O)C=C CFVWNXQPGQOHRJ-UHFFFAOYSA-N 0.000 description 1
- DXIJHCSGLOHNES-UHFFFAOYSA-N 3,3-dimethylbut-1-enylbenzene Chemical compound CC(C)(C)C=CC1=CC=CC=C1 DXIJHCSGLOHNES-UHFFFAOYSA-N 0.000 description 1
- ULKFLOVGORAZDI-UHFFFAOYSA-N 3,3-dimethyloxetan-2-one Chemical compound CC1(C)COC1=O ULKFLOVGORAZDI-UHFFFAOYSA-N 0.000 description 1
- RGUZWBOJHNWZOK-UHFFFAOYSA-N 3,6-dimethylbenzene-1,2-diol Chemical compound CC1=CC=C(C)C(O)=C1O RGUZWBOJHNWZOK-UHFFFAOYSA-N 0.000 description 1
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 1
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- FOUXQJGTPNXLTP-UHFFFAOYSA-N Cl.C(C)(=O)OC=C.Cl Chemical compound Cl.C(C)(=O)OC=C.Cl FOUXQJGTPNXLTP-UHFFFAOYSA-N 0.000 description 1
- 229920000089 Cyclic olefin copolymer Polymers 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- PYGXAGIECVVIOZ-UHFFFAOYSA-N Dibutyl decanedioate Chemical compound CCCCOC(=O)CCCCCCCCC(=O)OCCCC PYGXAGIECVVIOZ-UHFFFAOYSA-N 0.000 description 1
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- IMROMDMJAWUWLK-UHFFFAOYSA-N Ethenol Chemical compound OC=C IMROMDMJAWUWLK-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- 239000005057 Hexamethylene diisocyanate Substances 0.000 description 1
- 239000005058 Isophorone diisocyanate Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 101100113998 Mus musculus Cnbd2 gene Proteins 0.000 description 1
- 239000006057 Non-nutritive feed additive Substances 0.000 description 1
- 239000004727 Noryl Substances 0.000 description 1
- 229920001207 Noryl Polymers 0.000 description 1
- 229920000305 Nylon 6,10 Polymers 0.000 description 1
- 239000004419 Panlite Substances 0.000 description 1
- 229920002319 Poly(methyl acrylate) Polymers 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004820 Pressure-sensitive adhesive Substances 0.000 description 1
- 229920013632 Ryton Polymers 0.000 description 1
- 239000004736 Ryton® Substances 0.000 description 1
- 229910003902 SiCl 4 Inorganic materials 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 229920003182 Surlyn® Polymers 0.000 description 1
- YSMRWXYRXBRSND-UHFFFAOYSA-N TOTP Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C YSMRWXYRXBRSND-UHFFFAOYSA-N 0.000 description 1
- LEHOTFFKMJEONL-UHFFFAOYSA-N Uric Acid Chemical compound N1C(=O)NC(=O)C2=C1NC(=O)N2 LEHOTFFKMJEONL-UHFFFAOYSA-N 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical class C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000005396 acrylic acid ester group Chemical group 0.000 description 1
- 229920006397 acrylic thermoplastic Polymers 0.000 description 1
- XECAHXYUAAWDEL-UHFFFAOYSA-N acrylonitrile butadiene styrene Chemical compound C=CC=C.C=CC#N.C=CC1=CC=CC=C1 XECAHXYUAAWDEL-UHFFFAOYSA-N 0.000 description 1
- 239000004676 acrylonitrile butadiene styrene Substances 0.000 description 1
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 description 1
- 229920001893 acrylonitrile styrene Polymers 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 238000005267 amalgamation Methods 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 238000010539 anionic addition polymerization reaction Methods 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- FQUNFJULCYSSOP-UHFFFAOYSA-N bisoctrizole Chemical compound N1=C2C=CC=CC2=NN1C1=CC(C(C)(C)CC(C)(C)C)=CC(CC=2C(=C(C=C(C=2)C(C)(C)CC(C)(C)C)N2N=C3C=CC=CC3=N2)O)=C1O FQUNFJULCYSSOP-UHFFFAOYSA-N 0.000 description 1
- 238000000071 blow moulding Methods 0.000 description 1
- MPMBRWOOISTHJV-UHFFFAOYSA-N but-1-enylbenzene Chemical compound CCC=CC1=CC=CC=C1 MPMBRWOOISTHJV-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229940043430 calcium compound Drugs 0.000 description 1
- 150000001674 calcium compounds Chemical class 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 235000019241 carbon black Nutrition 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- KRGNPJFAKZHQPS-UHFFFAOYSA-N chloroethene;ethene Chemical group C=C.ClC=C KRGNPJFAKZHQPS-UHFFFAOYSA-N 0.000 description 1
- 239000011247 coating layer Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 150000005676 cyclic carbonates Chemical class 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 125000002993 cycloalkylene group Chemical group 0.000 description 1
- ILUAAIDVFMVTAU-UHFFFAOYSA-N cyclohex-4-ene-1,2-dicarboxylic acid Chemical compound OC(=O)C1CC=CCC1C(O)=O ILUAAIDVFMVTAU-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000032798 delamination Effects 0.000 description 1
- YICSVBJRVMLQNS-UHFFFAOYSA-N dibutyl phenyl phosphate Chemical compound CCCCOP(=O)(OCCCC)OC1=CC=CC=C1 YICSVBJRVMLQNS-UHFFFAOYSA-N 0.000 description 1
- 125000002897 diene group Chemical group 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000002118 epoxides Chemical class 0.000 description 1
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 description 1
- 229920001038 ethylene copolymer Polymers 0.000 description 1
- 229920005680 ethylene-methyl methacrylate copolymer Polymers 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical compound O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- LNMQRPPRQDGUDR-UHFFFAOYSA-N hexyl prop-2-enoate Chemical compound CCCCCCOC(=O)C=C LNMQRPPRQDGUDR-UHFFFAOYSA-N 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 239000012784 inorganic fiber Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- NIMLQBUJDJZYEJ-UHFFFAOYSA-N isophorone diisocyanate Chemical compound CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1 NIMLQBUJDJZYEJ-UHFFFAOYSA-N 0.000 description 1
- 238000005304 joining Methods 0.000 description 1
- 238000003475 lamination Methods 0.000 description 1
- 150000002605 large molecules Chemical class 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 230000001050 lubricating effect Effects 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- UEGPKNKPLBYCNK-UHFFFAOYSA-L magnesium acetate Chemical compound [Mg+2].CC([O-])=O.CC([O-])=O UEGPKNKPLBYCNK-UHFFFAOYSA-L 0.000 description 1
- 239000011654 magnesium acetate Substances 0.000 description 1
- 229940069446 magnesium acetate Drugs 0.000 description 1
- 235000011285 magnesium acetate Nutrition 0.000 description 1
- 150000002681 magnesium compounds Chemical class 0.000 description 1
- DTGRQRFFKHYRJG-UHFFFAOYSA-N magnesium tetrahydrate Chemical compound O.O.O.O.[Mg+2] DTGRQRFFKHYRJG-UHFFFAOYSA-N 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 1
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- 201000002266 mite infestation Diseases 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 238000006011 modification reaction Methods 0.000 description 1
- 239000012778 molding material Substances 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 229920006113 non-polar polymer Polymers 0.000 description 1
- 230000006911 nucleation Effects 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 238000005453 pelletization Methods 0.000 description 1
- YWAKXRMUMFPDSH-UHFFFAOYSA-N pentene Chemical compound CCCC=C YWAKXRMUMFPDSH-UHFFFAOYSA-N 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 229950000688 phenothiazine Drugs 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- PMJHHCWVYXUKFD-UHFFFAOYSA-N piperylene Natural products CC=CC=C PMJHHCWVYXUKFD-UHFFFAOYSA-N 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920006112 polar polymer Polymers 0.000 description 1
- 229920001083 polybutene Polymers 0.000 description 1
- 229920001748 polybutylene Polymers 0.000 description 1
- 229920001610 polycaprolactone Polymers 0.000 description 1
- 239000004632 polycaprolactone Substances 0.000 description 1
- 229920006393 polyether sulfone Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 229920005990 polystyrene resin Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 150000003112 potassium compounds Chemical class 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- SCUZVMOVTVSBLE-UHFFFAOYSA-N prop-2-enenitrile;styrene Chemical compound C=CC#N.C=CC1=CC=CC=C1 SCUZVMOVTVSBLE-UHFFFAOYSA-N 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- 238000010526 radical polymerization reaction Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000012779 reinforcing material Substances 0.000 description 1
- 239000012260 resinous material Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 150000003388 sodium compounds Chemical class 0.000 description 1
- 229920006132 styrene block copolymer Polymers 0.000 description 1
- 229920003066 styrene-(meth)acrylic acid ester copolymer Polymers 0.000 description 1
- 125000003375 sulfoxide group Chemical group 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- ISXSCDLOGDJUNJ-UHFFFAOYSA-N tert-butyl prop-2-enoate Chemical compound CC(C)(C)OC(=O)C=C ISXSCDLOGDJUNJ-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000012815 thermoplastic material Substances 0.000 description 1
- 229920005992 thermoplastic resin Polymers 0.000 description 1
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- XZZNDPSIHUTMOC-UHFFFAOYSA-N triphenyl phosphate Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=O)OC1=CC=CC=C1 XZZNDPSIHUTMOC-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229940089401 xylon Drugs 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 150000003752 zinc compounds Chemical class 0.000 description 1
- 150000007934 α,β-unsaturated carboxylic acids Chemical class 0.000 description 1
- PAPBSGBWRJIAAV-UHFFFAOYSA-N ε-Caprolactone Chemical compound O=C1CCCCCO1 PAPBSGBWRJIAAV-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F287/00—Macromolecular compounds obtained by polymerising monomers on to block polymers
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L51/00—Compositions of graft polymers in which the grafted component is obtained by reactions only involving carbon-to-carbon unsaturated bonds; Compositions of derivatives of such polymers
- C08L51/006—Compositions of graft polymers in which the grafted component is obtained by reactions only involving carbon-to-carbon unsaturated bonds; Compositions of derivatives of such polymers grafted on to block copolymers containing at least one sequence of polymer obtained by reactions only involving carbon-to-carbon unsaturated bonds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Description
Zu Polyurethanen, die erfindungsgemäß als Komponente B verwendbar sind, gehören Polymere, die Urethanbindungen als wiederkehrende Einheit In ihrem Molekül enthalten. Die Polyurethane werden in typischer Weise nach ihrer jeweiligen Art in solche des vergießbaren Typs (casting type), Mischtyps (blend type) und thermoplastischen Typs unterteilt. Erfindungsgemäß kann als Komponente B ein thermoplatisches Polyurethan eingesetzt werden.
Die Polyacrylate oder Polymethacrylate, die als Komponente B erfindungsgemäß eingesetzt werden können, umfassen Polymersubsianzen, die überwiegend Einheiten von AlkylacTylaten oder Alkylmethacrylaten mit Alkylgruppen mit 1 bis 12 Kohlenstoffatomen enthalten. Diese Polymersubstanzen werden normalerweise als »Acrylharze« oder »Methacrylharze« bezeichnet. Allgemein gesagt, enthalten die Polyacrylate oder Polymethacrylate 50 Gew.-% oder mehr der Einheiten von Alkylacrylaten oder Alkylmethacrylaten. Die Polyacrylate bzw. Polymethacrylate können allgemein mit Hilfe einer radikalischen Polymerisationsmethode hergestellt werden.
Das Zahlenmittel des Molekulargewichts der erfindungsgemäß verwendeten Polyacrylate oder Polymeth-
'-'/Ie vorstehend erwähnt können erfindungsgemäße Polymermassen, die als Komponente B Polyacrylate oder
Probe | Handelsname | Styrolgehalt | Schmelzfluß- |
Nr. | indsx1) | ||
(Gew.-%) | (g/10 min) | ||
SB-I | Tufprene A | 40 | 11,0 |
SB-2 | SoIpreneT-414 | 40 | 5,3 |
SB-3 | Asaprene T-431 | 30 | 10,3 |
SB-4 | KR-Ol | 80 | 5,3 |
SB-8 | 80 | 80 | 4,2 |
SB-9 | 80 | 80 | 7,2 |
SB-10 | 74 | 74 | 8,4 |
SB-II | 80 | 70 | 12,5 |
Herstellung von modifizierten Blockcopolymeren
Probe Nr. des | Grund-Copolymeres | Art | Styrol- | Modifiziertes Blockcopolymeres | Schmelznuß |
modifizierten | Probe | gehalt | Anteil des um | index2) | |
Blockcopolymeren | Nr. | gesetzten Malein | |||
(Gew.-%) | säureanhydrids | (g/10 min) | |||
handelsüblich | 40 | (Gew.-Teile) | 7,2 | ||
M-Ia | SB-I | handelsüblich | 40 | 0,70 | 7,8 |
M-Ib | SB-I | handelsüblich | 40 | 1,10 | 3,8 |
M-2a | S3-2 | handelsüblich | 40 | 0,52 | 4,7 |
M-2b | SB-2 | handelsüblich | 30 | 0,51 | 9,0 |
M-3a | SB-3 | handelsüblich | 78 | 0,42 | 4,1 |
M-4a | SB-4 | B1-S1-B2-S2 | 40 | 1,10 | 18,2 |
M-5a | SB-5 | BrSi -B 2-S2 | 40 | 0,25 | 16,5 |
M-5b | SB-5 | B1-S1-B2-S2 | 42 | 0,70 | 9,3 |
M-6a | SB-6 | B1-S1-B2-S1 | 38 | 0,53 | ■71 |
M-7a | SB-7 | Sj-Bi-S2 | 80 | 0,70 | 3,1 |
M-8a | SB-8 | S VS2 | 80 | 0,86 | 3,3 |
M-8b | SB-8 | ^1-S2 | 80 | 1,20 | 5,3 |
M-9a | SB-9 | S1-B1-S2 | 74 | ö,93 | 6,6 |
M-IOa | SB-IO | S1-B1-S2 | 80 | 0,70 | 10,1 |
M-Ha | SB-Il | Radialstruktur | 30 | 0,50 | 4,2 |
M-12a | SB-12 | 1,5 |
70 | 0 | 0 | 46 |
0 | 70 | 0 | 24 |
0 | 0 | 70 | - |
30 | 30 | 30 | 30 |
94 | 96 | 93 | 95 |
1862 | 2029 | 784 | 1960 |
1666 | 1754 | 706 | 1735 |
390 | 390 | 350 | 390 |
931 | 1039 | 304 | 981 |
588 | 706 | 118 | 666,4 |
27 | 20 | 42 | 22 |
Zusammensetzung: | 20 | 0 | 0 | 0 | 13,2 | - |
modifiziertes Blockcopolymeres (M-5a) | ||||||
(Gew.-Teile) | 0 | 20 | 0 | 0 | 6,3 | 80 |
ionisch vemetztes Produkt (M-5c) | ||||||
(Gew.-Teile) | 0 | 0 | 20 | 0 | ||
unmodifiziertes Blockcopolymeres (SB-5) | 12,5 | |||||
(Gew.-Teile) | OA OV |
80 | so | 100 | ||
Ny!on-o (Gcw.-Tciiei | 5782 | |||||
Physikalische Eigenschaften: | 107 | |||||
(bei 25° C) | 11,6 | 13,5 | 5,6 | 3,5 | 15,8 | |
Izod-Schlagfestigkeit (kg - cm/cm, | ||||||
mit Kerbe) | 5684 | 5841 | 4410 | 7448 | ||
Zugfestigkeit (N/cm3) | 110 | 105 | 60 | 130 | ||
Dehnung(%) | 14,3 | 16,4 | 55,2 | - | ||
Durchsichtigkeit, Trübung (%) | ||||||
modifiziertes Blockcopolymeres (M-8a) (Gew.-Teile) |
Beispiel | Nr. | Vergleichs beispiel III-l |
Beispiel
3-3 |
Vergleichs beispiel III-2 |
|
ionisches Vernetzungsprodukt (M-8c) (Gew.-Teile) |
Beispiel
3-1 |
Beispiel
3-2 |
||||
Zusammensetzung: | 0 | 70 | 0 | |||
Komponente A: | 70 | 0 | 0 | 0 | 0 | |
0 | 70 | |||||
4,0 | 4,6 | 2,3 | 4,7 | 2,5 |
3332 | 3528 | 2548 | 3283 | 2401 |
20 | 19 | 13 | 17 | 12 |
15,0 | 15,8 | 48,0 | 22,6 | 51,5 |
(bei 25° C)
Zugfestigkeit (N/cm2)
Bruchdehnung (%)
Durchsichtigkeli, Trübung (%)
Beispiel | Nr. |
Beispiel
4-2 |
Vergleichs
beispiel IV-2 |
Beispie.!
4-3 |
Vergleichs-
'jrispiel IV-3 |
|
Beispiel
4-1 |
Vergleichs
beispiel IV-I |
|||||
Zusammensetzung: | 20 | 0 | 25 | 0 | ||
modifiziertes Blockcopolymeres (M-2a) (Gew.-Teile) |
25 | 0 | 0 | 20 | 0 | 25 |
unmodifiziertes Blockcopolymeres (SB-2) (Gew.-Teile) |
0 | 25 | 0 | 0 | 0 | 0 |
N-6/N-6,6-Copolymeres (Gew.-Teile) | 75 | 75 | 80 | 80 | 0 | 0 |
Nylon-12 (Gew.-Teile) | 0 | 0 | 0 | 0 | 75 | 72 |
Nylon-11 (Gew.-Teile) | 0 | 0 | 7,8 | 3,1 | 9,4 | 3,2 |
Izod-Schlagfestigkeit (kg - cm/cm, Kerbe) | 9,5 | 4,3 | ||||
Beispiel | Nr. | Vergleichs | Bezugs- |
Beispiel | Beispiel | beispiel | be'.spiel |
5-1 | 5-2 | V-I | |
80 | 80 | 80 | 100 |
20 | 0 | 0 | 0 |
0 | 20 | 0 | 0 |
0 | 0 | 2C- | 0 |
5018 | 5204 | 4900 | 5537 |
35 | 29 | 25 | 22 |
4,6 | 5,4 | 2,3 | 2,0 |
150 | 152 | 150 | 160 |
Beispiel Nr. | Vet?leichsbeispiel VI-I | Bcxiigsbeiipiel |
Beispiel 6-1 | 0 | 100 |
80 | 80 | 0 |
0 | 20 | 0 |
20 | 92 | 84 |
93 | 343 | 255 |
411,6 | 1372 | 1666 |
1960 | 550 | 950 |
700 | ||
anstieges (Öl Nr. JIS 3, 22 h)
Tabelle 12 | Beispiel Nr. | Vergleichs | Bezugs- | Bezugs | Bezugs |
Beispiel | beispiel | beispiei | beispiel | beispiel | |
7-1 | VII-I | ||||
Zusammensetzung, | 0 | 100 | 0 | 0 | |
Mischungsverhältnis: | 20 | ||||
modifb-eries B!~-!c-"po!yiEeres | 20 | 0 | 100 | 0 | |
(M-Ia) (Gew.-Teile) | 80 | ||||
unmodifiziertes Blockcopolymeres | 80 | 0 | 0 | 100 | |
(SB-I) (Gew.-Teile) | 80 | ||||
Potyester (P-2) (Gew.-Teile) | 74 (75) | >500 (>5000) | >500 P>5000) | 6 (60) | |
Physikalische Eigenschaften: | 8 (80) | 372,4 | 225,4 | 196 | 941 |
Schmelzviskosität, Pa ■ s (Poise) | 686 | ||||
Klabfestigkeit unter Zugscherkraft | 3,2 | 16,0 | 5,3 | 2,7 | |
(N/cm2) | 8,6 | ||||
Adhäsionskraft im T-Schältest | |||||
(kg/25 mm) | |||||
Beispiel
Beispiel |
Nr.
8-1 |
Vergleichs
beispiel VIII-I |
80 | 0 | |
0 | 80 | |
20 | 20 | |
25,6 | 47,6 |
Komponente B: Art | ELASTOLLAN*) | PARAPRENE*) | ELASTOLLAN*) | ELASTOLLAN*) | PARAPRENI | I*) ELASTOLLAN*) | - | - | (—N |
E185FNAT | P-22SM | EI85FNAT | EI85FNAT | P-22SM | E185FNAT | ||||
Menge (Gew.-Teile) | 75 | 75 | 75 | 75 | 75 | 100 | - | - |
ΓΟ
NJ |
Komponente A: Probe | M-6a | M-6a | M-6b | SB-6 | SB-6 | — | SB-6 | M-6a | to |
(Typ) | modifiziert | modifiziert | ionisch vernetzt | unmodifiziert | unmodifiziert | unmodifi | modifi | CX) | |
ziert | ziert | ||||||||
Menge (Gew.-Teile) | 25 | 25 | 25 | 25 | 25 | - | 100 | 100 | |
Physikeil. Eigenschaften: | |||||||||
Härte (JIS) | 85 | 84 | 86 | 85 | 84 | 85 | 85 | 86 | |
300%-Modul (kg/cm^) | 75 | 58 | 82 | 76 | 57 | 105 | 23 | 26 | |
Zugfestigkeit (N/cm2) | 3410,4 | 3626 | 3557,4 | 2397,2 | 2646 | 3949,4 | 1391,5 | 1646,4 | |
Dehnung (%) | 670 | 630 | 620 | 720 | 640 | 600 | 1000 | 970 | |
Beibehaltungsfaktor | 83 | 85 | 84 | 74 | 75 | 69 | _ | _ | |
der Zugfestigkeit | |||||||||
nach 30tägigem Eintauchen | |||||||||
in heißes Wasser (80° C) | |||||||||
Beispiel 10-1
X-I
Menge (Gew.-Teile) | 15 | 15 | - |
Komponente A: Probe Nr. | M-6a | SB-6 | SB-6 |
Art | modifiziert | unmodifiziert | unmodifiziert |
Menge (Gew.-Teile) | 85 | 85 | 100 |
Physikalische Eigenschaften. | |||
Härte (JIS) | 84 | 84 | 85 |
Zugfestigkeit. (N/cm2) | 1205,4 | 833 | 1392 |
Ölbeständigkeit | 36 | 54 | 73 |
(Rate des Gewichtsanstiegs) (%) | |||
Picco-Abrieb (cmV80 Durchgänge) | 0,018 | 0,031 | 0,057 |
Beispiel 11-1
Komponente B: Probe Nr. | M-8b | SB-8 | SB-8 |
Art | modifiziert | unmodifiziert | unmodifiziert |
Menge (Gew.-Teile) | 80 | 80 | 100 |
as Physikalische Eigenschaften: | |||
Izod-Schlagfestigkeit | 2,8 | 2,1 | 1,8 |
(kg · cm/cm, Kerbe) | TA |
Beispiel | Beispiel | Beispiel | Vergleichs | Vergleichs | Vergleichs |
Beispiel | 12-2 | 12-3 | beispiel | beispiel | beispiel |
12-1 | XIl-I | XH-2 | XII-3 | ||
Tabelle 18 | Beispiel | Beispiel | Beispiel | Beispiel | Beispiel | Vergleichs | Vsrgleichs- | Vergleichs | Vergleichs | Bezugs | I % |
Beispiel | 13-2 | 13-3 | 13-4 | 13-5 | beispiel | beispiel | beispiel | beispiel | beispiel | WJ O |
|
13-1 | XIII-I | XIII-2 | XIII-3 | XIII-4 | rO | ||||||
K> | |||||||||||
NJ | |||||||||||
Zusammensetzung, | M-7a | M-IOa | M-3a | M-7c | SB-7 | SB-7 | SB-IO | SB-3 | OO | ||
Mischungsverhältnis | M-7a | modifiziert | modifiziert | modifiziert | ionisch | unmodifi- | unmodifi- | unmodifi- | numodifi- | - | |
Komponente A: Probe Nr. | modifiziert | vernetzt | ziert | ziert | ziert | ziert | |||||
Art | 10 | 25 | 30 | 25 | 25 | 10 | 25 | 30 | - | ||
25 | 90 | 75 | 70 | 75 | 75 | 90 | 75 | 70 | 100 | ||
Menge (Gew.-Teile) | 75 | ||||||||||
Komponente B: Menge (Gew.-Teile) | |||||||||||
(EVAL-EP-E) | 10,2 | 7,3 | 43 | 3,6 | 26,8 | 28,5 | 27,8 | 23,3 | 28,4 | ||
Physikalische Eigenschaften: | 5,8 | ||||||||||
Schmelzindex (200° C, | 16,5 | 11,3 | 104,1 | 91,5 | 6,3 | 3,3 | 3,4 | 6,8 | 2,4 | ||
Belastung 5 kg) (g/10 min) | 97,5 | ||||||||||
Izod-Schlagfestigkeit | 4145,4 | 3881 | 3184 | 3440 | 3351,6 | 4096,4 | 3391 | 3077 | 4802 | ||
(kg · cm/cm, Kerbe) | 3332 | ||||||||||
Zugfestigkeit an der Streckgrenze | 3293 | 3136 | 2558 | 2842 | 3087 | 3822 | 3057,6 | 3028 | 4410 | ||
(N/cm*) | 2793 | 80 | 25 | 50 | 55 | 10 | 26 | 23 | 7 | 200 | |
Zug-Reißfestigkeit (N/cm2) | 60 | 1,8 | _ | _ | 3,4 | 0,3 | _ | 1,2 | 1,0 | 0,1 | |
Reißdehnung (%) | 3,3 | oder | |||||||||
T-Schälfestigkeit gegenüber | weniger | ||||||||||
Polyäthylen hoher Dichte | |||||||||||
(kg/25 mm) (gemäß JIS K-6854) | |||||||||||
Mischungsverhältnis | Beispiel | Beispiel 14-2 | Vergleichs | Vergleichs | Bezugsbeispiel | Bezugsbeispiel | |
Probe Nr. | Beispiel 14-1 | beispiel XlV-I | beispiel XIV-2 | ||||
Art | |||||||
Zusammensetzung, | Mange (Gew.-Teile) | M-7a | SB-7 | SB-7 | M-7a | SB-7 | |
Komponente A: | Menge (Gew.-Teile) | M-7a | modifiziert | unmodifiziert | unmodifiziert | modifiziert | modifiziert |
modifiziert | 90 | 75 | 90 | 100 | 100 | ||
75 | 10 | 25 | 10 | - | - | ||
Komponente B: | 25 | ||||||
83 | 86 | 85 | 84 | 84 | 81 |
647 | 372,4 | 402 | 264,6 | 235 | 206 |
1186 | 1391,6 | 931 | 1156,4 | 1597,4 | 1401,4 |
900 | 950 | 1000 | 1000 | 1010 | 1050 |
25 | 44 | 49 | 55 | 56 | 74 |
M-7a | M-IOa | M-7d | SB-7 | SB-IO | - |
modifiziert | modifiziert | ionisch vernetzt | unmodifiziert | unmodifiziert | |
25 | 25 | 25 | 25 | 25 | - |
75 | 75 | 75 | 75 | 75 | 100 |
4,5 | 2,1 | 5,0 | 3,2 | 1,5 | 1,3 |
2538 | 2744 | 2665,6 | 2195 | 2460 | 7056 |
12 | 5 | 10 | 6 | 4 | 3 |
M-7a | SB-7 |
modifiziert | unmodifiziert |
15 | 15 |
85 | 85 |
Beispiel | 17-1 | Beispiel | 17-2 | Beispiel | 17-3 | Vergleichs | Vergleichs | Vergieichs- |
Beispiel | beispiel | beispiel | beispiel | |||||
XVlI-I | XVII-2 | XVII-3 | ||||||
Zusammensetzung, Mischungsverhältnis |
8 | 40 | 70 | - | - | - |
M-7a (modifiziert) (Gew.-Teile) |
- | - | - | 8 | 40 | 70 |
SB-7 (unmodifiziert) (Gew.-Teile) |
92 | 60 | 30 | 92 | 60 | 30 |
PMMA-Harz (Gew.-Teile) |
3,7 | 7,6 | 13,5 | 0,7 | 3.1 | 3,4 |
Schälfestigkeit (gemäß JIS-K 6854) (kg/25 mm) |
||||||
Komponente A: Probe Nr. | M-Ib | M-Ib | SB-I | SB-I | SB-I 1 | - |
Art | modifiziert | modifiziert | unraodi- | unmodi- | unmodi- ■ | |
fiziert | fi ziert | fiziert I | - | |||
Menge | 75 | 80 | 75 | 80 | '00 I | |
(Gew.-Teüe) | 1 | |||||
Komponente B: Art | Polyvinyl | Vinylchlorid- | Polyvinyl | Vinylchlorid- | 2,6 | |
chlorid | Vinylacetat- | chlorid | Vinylacetat- | I | 74 I | |
Copolymeres1) | Copolymeres1) | I | 1 | |||
Menge | 15 | 20 | 15 | 20 | ■ | |
(Gew.-Teile) | ||||||
Zusatz: Art | Dibutyl- | - | Dibutyl- | - | ||
phthalat | phthalat | |||||
Menge | 10 | - | 10 | - | ||
(Gew.-Teile) | ||||||
Physikalische Eigenschaften: | ||||||
Durchsichtigkeit, Trübung (%) | 7,2 | 9,8 | 25,4 | 21,2 | ||
Ölbeständigkeit2) | 41 | 44 | 66 | 61 | ||
(Rate des Gewichtsanstiegs) (%) |
PO | Polyoxymethylen |
PC | Polycarbonat |
PS | Polysulfon |
NR | Nitrilharz |
PPE | Polyphenylenäther |
GPPE |
mit Styrol gepfropfter
Polyphenylenäther |
PPS | Polyphenylensulfid |
PBT | Polybutylenterephthalat |
TPET |
thermoplastischer
Polyester |
PA | Polyamid |
ABS |
Acrylnitril-Butadien-
Styrol-Copolymeres |
HIBS |
kautschukmodifiziertes
hochschlagfestes Polystyrol |
Beispiel 22- | Vergleichsbetspiel | |
XXII- | ||
1 2 | 1 2 | |
Art des Blockcopolymeren | modifiziertes | unmodifiziertes |
Blockcopolymeres | Blockcopolymeres | |
(M-Ha) | (SB-Il) | |
Art des thermoplastischen | PO NR | PO NR |
Polymeren1) | ||
Dart-Schlagfestigkeit (kg · cm)2) 220 150 | Keine Bestimmune möe- |
10 | 20 | 20 | 10 |
PC | PS | GPPE | PPS |
70 | 60 | 65 | 70 |
ABS | HIPS | Polystyrol | HIPS |
20 | 20 | 15 | 20 |
45J | 18,5 | 34,1 | 15,7 |
30 | Tabelle 31 | 22 258 | Beispiel 25-2 |
M-5b 10 |
|||
Komponente A (Gew.-Teile) |
Beispiel 25-1 | PPE 70 |
|
Komponente B (Gew.-Teile) |
M-Ha 20 |
20 | |
Glasfasern1) (Gew.-Teile) |
PS 40 |
21,5 | |
Izod-Schlagfestigkeit (kg ■ cm/cm, Kerbe) |
40 | ||
9,1 | |||
die bleibende Verformung (compression set) wurden bestimmt. Die Ergebnisse sind in der nachstehenden
Tabelle 32 gezeigt.
Hinblick auf die Zugfestigkeit. Abriebbeständigkeit und bleibende Verformungsbeständigkeit den Vergleichsmassen überlegen, die das unmodifizierte Blockcopolymere enthalten. Außerdem ist die Wärmebeständigkeit
der erfindungsgemäßen Zusammensetzungen, weiche die ionischen Vernetzungsprodukte der modifizierten
Blockcopolymeren enthalten, verbessert.
PPE | PPS | PC | PS | PO | PC | PS |
+ PBT*) | + PA7) | |||||
1333 | 1303,4 | 1264 | 1225 | 911,4 | 999,6 | 950,6 |
160 | 140 | 130 | 130 | 80 | 100 | 90 |
21 | 19 | 17 | 20 | 18 | 19 | 19 | 20 | 36 | 30 | 34 | 38 | 32 | 34 | 27 |
35 | 31 | 25 | 32 | 29 | 28 | 32 | 35 | 58 | 53 | 47 | 51 | 54 | 51 | 63 |
13 | 11 | 10 | 11 | 12 | 11 | 11 | 13 | - | - | - | - | - | - | - |
23 | 20 | 13 | 21 | 21 | 18 | 21 | 22 | _ | _ | — | _ | _ |
Verhältnis der Zugfestigkeit bei 70° C der 1,45 1,35 1,35 1,45 1,35 1,35 1,40 1,40
Beispiel 29-
1 2 |
M-7a | 3 |
Vergleichsbeispiel
XXIX- 1 2 3 |
SB-7 | SB-3 | Bezugsbeispiel | SB-3 | |
Art der Kompor.snte A | M-7a | 70 | M-3? | SB-7 | 70 | 90 | M-3s | 100 |
Menge (Gew.-Teile) | 80 | 30 | 90 | 80 | 30 | 10 | 100 | - |
Menge der Komponente B
(Ionomeres) (Gew.-Teile) |
20 | 92 | 10 | 20 | 90 | 85 | — | 21 |
Härte (HS) (JIS) | 90 | 715,4 | 86 | 88 | 421,4 | 294 | 84 | 206 |
300%-Modul (N/crrP) | 656,6 | 1470 | 490 | 362,6 | 745 | 980 | 235 | 1401,4 |
Zugfestigkeit (N/cmJ). | 1401,4 | 630 | 1666 | 813,4 | 760 | 740 | 1597,4 | 1050 |
Bruchdehnung (%) | 720 | 15 | 700 | 850 | 59 | 68 | 1010 | 74 |
Ölbeständigkeit (%)*)
(Rate des Gewichtsanstiegs) |
21 | bei Raumtemperatur | 33 | 64 | 56 | |||
*) 24stündiges Eintauchen in Öl nach JIS Nr. 3 |
Beispiel
1 |
30-
2 |
3 | 4 |
Vergleichsbeispiel XXX-
1 2 3 |
SB-7 | 4 |
Bezugs
beispiel |
Beispiel
30-5 |
|
Zusammensetzung | 40 | ||||||||
Art der Komponente A | M-7a | M-IOa | M-7a | M-7a | SB-7 SB-IO | 60 | SB-7 | - | M-7e |
Menge der Komponente A
(Gew.-Teile) |
20 | 30 | 40 | 30 | 20 30 | 30 | - | 20 | |
Menge des lonomeren
{Komponente B) (Gew.-Teile) |
80 | 70 | 60 | 50 | 80 70 | 50 | 100 | 80 | |
Polyäthylen niederer Dichte
(Komponente C), Menge (Gew.-Teile) |
20 | 1872 | 20 | ||||||
Physikalische Eigenschaften | 360 | ||||||||
Zugfestigkeit <i !/cm2) | 2509 | 2254 | 2019 | 2107 | 2273,6 2283,4 | 1,0 | 1940,4 | 3165,4 | 2656 |
Bruchdehnung (%) | 380 | 310 | 370 | 330 | 390 290 | 330 | 440 | 370 | |
Klebeschäl- vor dem | 3,5 | 3,3 | 5,3 | 3,1 | 1,1 0,9 | 0,5 | 3,4 | ||
Claims (1)
- Patentansprüche:s a) 1 bis 99 Gew.-Tellen einer Komponente A aus mindestens einem modifizierten Blockcopolymeren aus mindestens einem modifizierten Blockcopolymeren aus mindestens einer aromatischen Vinylverblndung und mindestens einem konjugierten Dien, auf das mindestens eine Molekoleinheit aufgepfropft ist, die ■■ Reste einer ungesättigten Dicarbonsäure enthält,b) 99 bis 1 Gew.-Teilen einer Komponente B aus mindestens einem thermoplastischen Polymeren mit Irt polaren Gruppen, gegebenenfallsc) 1 bis 100 Gew.-Teilen, bezogen auf 100 Gew.-Telle der Gesamtmenge der Komponenten A und B, einer Komponente C aus mindestens einem Polymeren aus der Gruppe der Styrolpolymeren und Polyolefine und gegebenenfallsd) sonstigen üblichen Zusätzen, dadurch gekennzeichnet, daß die Komponente A aus mindestens ■s einem durch Pfropfen mit wenigstens einer ungesättigten Dicarbonsäure oder deren Derivat modifizierten Blockcopolymeren aus mindestens einer aromatischen Vinylverbindung und mindestens einem konjugierten Dien und/oder dessen ionischen Vernetzungsprodukt mit mindestens einem einwertigen, zweiwertigen oder dreiwertigen Metallion besteht.J" 2. Polymermasse nach Anspruch 1, dadurch gekennzeichnet, daß das thermoplastische Polymere mit po!a- .ren Gruppen (Komponente B) aus der Gruppe der Polyamide, thermoplastischen Polyester, Polyurethane, Polymeren des Vinylalkohole, Polyacrylate, Polymethacrylate, chlorierten Kohlenwasserstoffpolymeren, Polyoxymethylen-Polymeren, Polycarbonate, Polyarylenäther, Polyarylensulfide, ungesättigten Nitrilpolymeren, polysulfone oder lonomeren ausgewählt Ist.3. Polymermasse nach Anspruch 1 oder 2, dadurch gekennzeichnet, daß der Anteil der aufgepfropften ungesättigten Dicarbonsäure oder deren Derivat an dem modifizierten Blockcopolymeren der Komponente A 0,05 bis 20 Gew.-Teile pro 100 Gew.-Telle des modifizierten Blockcopolymeren beträgt.4. Polymermasse nach einem der Ansprüche 1 bis 3, dadurch gekennzeichnet, daß das Derivat der ungesättigten Dicarbonsäure ein Dicarbonsäureanhydrld ist.Mi 5. Polymermasse nach Anspruch 1 oder 2, dadurch gekennzeichnet, daß der Anteil der aromatischenVinylverblndung in dem Blockcopolymeren aus aromatischer Vinylverbindung und konjugiertem Dien in Komponente A S bis 70 Gew-%, bezogen auf das Gewicht des Blockcopolymer :n, beträgt.6. Polymermasse nach Anspruch 1 oder 2, dadurch gekennzeichnet, daß der Anteil der aromatischen 'Vinylverbindung in dem Blockcopolymeren aus aromatischer Vinylverbindung und konjugiertem Dien InKomponente A Ober 70 Gew.-96 bis 95 Gew.-«, bezogen auf das Gewicht des Blockcopolymeren, beträgt.7. Pdyrnermasse nach Anspruch ! oder 2, dadurch gekennzeichnet, daß in dem ionischen Vernetzungsproduki: des modifizierten Blockcopolymeren der Komponente A das Molverhältnis der Metalikomponente in der Metaliverbindung zu der Dicarbonsäure oder deren Derivat 0.1 bis 3,0 beträgt.8. Polymermasse nach Anspruch 1 oder 2, dadurch gekennzeichnet, daß die ungesättigte Dicarbonsäure *> oder deren Derivat mindestens eine Verbindung aus der Gruppe Maleinsäure, Fumarsäure und Maleinsäureanhydrid ist.9. Polymermasse nach Anspruch 2. dadurch gekennzeichnet, daß das Polyamid in Komponente B mindestens eines der Polyamide Nylon-6, Nylon-6,6 bzw. ein Copolymeres von Nylon-6 bzw. Nylon-6,6 ist.10. Polymermasse nach Anspruch 2, dadurch gekennzeichnet, daß als thermoplastischer Polyester in *i Komponente B Poly(äthylenterephthalat) oder Poly(butylen-terephthalat) vorliegt.II. Polymermasse nach Anspruch 2, dadurch gekennzeichnet, daß als thermoplastischer Polyester In Komponente B ein thermoplastischer Copolyester vorliegt, der im wesentlichen aus mindestens einem Alkylenglycol mit 2 bis 10 Kohlenstoffatomen als Glycolkomponente und mindestens zwei Dicarbonsäuren, die aus der Gruppe (i) Terephthalsäure, (ii) Isophthalsäure und (ill) aliphatischen Carbonsäuren mit 2 bis 20."' Kohlenstoffatomen, ausgewählt sind, als Dlcarbonsäurekomponente, gebildet ist.12. Polymermasse nach Anspruch 2, dadurch gekennzeichnet, daß als Polyurethan In Komponente B ein Polyurethan des vollständig thermoplastischen Typs vorliegt, das sich von einem Dilsocyanat und einer Dihydroxyverblndung im Molverhältnis (NCO/OH) von Dilsocyanat zur Dihydroxy verbindung von mehr als 0,95 bis 1 ableitet.-'·* 13. Polymermasse nach Anspruch 2, dadurch gekennzeichnet, daß als Polyurethan In Komponente B einPolyurethan des unvollständig thermoplastischen Typs vorliegt, das von einer Dlisocyanatverbindüng und einer Dlhydroxyverblndung Im Molverhältnis (NCO/OH) von Dilsocyanat zu Dlhydroxyverblndung von mehr als 1 bis weniger als 1,1 abgeleitet ist.14. Polymermasse nach Anspruch 2, dadurch gekennzeichnet, daß als Vlnylalkohol-Polymeres in Kompo-'■" nente B ein verseiftes Äthylen-Vlnylacetat-Copolymeres vorliegt.15. Polymermasse nach Anspruch 14, dadurch gekennzeichnet, daß der Vinylucetatgehalt des Älhylen-Vinylacetat-Copolymeren 0,5 bis 80 Mol-% beträgt.16. Polymermasse nach Anspruch 15, dadurch gekennzeichnet, daß der Verselfungsgrad des Vlnylacetats 10 bis 100 MoI-* beträgt.'·· 17. Polymermasse nach Anspruch 2, dadurch gekennzeichnet, daß als chloriertes Kohlenwasserstoffpoly-meres In Komponente B mindestens ein Polymeres aus der Gruppe von Polyvinylchlorid und Copolymeren des Vinylchlorids und anderen damit copolymerisierbaren Monomeren vorliegt.18. Polymermasse nach Anspruch 2, dadurch gekennzeichnet, daß die chlorierten KohlenwasserstoffDolv-meren chlorierte Polyolefine sind.19. Polymermasse nach Anspruch 2, dadurch gekennzeichnet, daß als Polyarylenäther in Komponente B gepfropfte Polyphenylenäther vorliegen, die durch Pfropfpolymerisation von aromatischen Vinylverbindungen auf Polyphenylenäther mit der Struktureinheitworin R1 und R2 unabhängig voneinander Alkylgruppen mit 1 bis 4 Kohlenstoffatomen, substituierte Alk/I-gruppen oder Halogenatome bedeuten, erhältlich sind.20. Polymermasse nach Anspruch 2, dadurch gekennzeichnet, daß als Ionomerelin Komponente B ionische Vernetzungsprodukte von Äthylen-Acrylsäure-Copolymeren oder Äthylen-Methacrylsäure-Copolymeren mit mindestens einem ein-, zwei- oder dreiwertigen Metallion vorliegen.21. Polymermasse nach Anspruch 1 oder 2, dadurch gekennzeichnet, daß sie 1 Gew.-% bis weniger als 50 Gew.-% der Komponente A und mehr als 50 Gew.-* bis 99 Gew.-« der Komponente B enthält.22. Polyment?asse nach Anspruch I oder 2, dadurch gekennzeichnet, daß sie 50 bis 99 Gew.-^ der Komponente A und 1 bis 50 Gew.-« der Komponente B enthält.23. Verwendung einer thermoplastischen Polymermasse nach einem der Ansprüche 1 bis 22 als thermoplastisches Klebemittel oder als Formmasse.
Applications Claiming Priority (11)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
JP7349279A JPS55165931A (en) | 1979-06-13 | 1979-06-13 | Novel thermoplastic polymer composition |
JP1721680A JPS56115355A (en) | 1980-02-16 | 1980-02-16 | Thermoplastic polymer composition |
JP1721280A JPS56115339A (en) | 1980-02-16 | 1980-02-16 | Composition of hydrocarbon polymer containing chlorine |
JP1721180A JPS56115348A (en) | 1980-02-16 | 1980-02-16 | Thermoplastic polymer composition |
JP1721380A JPS56115352A (en) | 1980-02-16 | 1980-02-16 | Polyurethane polymer composition |
JP1721480A JPS56115349A (en) | 1980-02-16 | 1980-02-16 | Acrylic resin polymer composition |
JP1721780A JPS56115350A (en) | 1980-02-16 | 1980-02-16 | Modified block copolymer composition |
JP1721580A JPS56115344A (en) | 1980-02-16 | 1980-02-16 | Vinyl alcohol polymer composition |
JP1721080A JPS56115347A (en) | 1980-02-16 | 1980-02-16 | Block copolymer composition |
JP2058280A JPS56118454A (en) | 1980-02-22 | 1980-02-22 | Polyamide-containing polymer composition |
JP2056880A JPS56118447A (en) | 1980-02-22 | 1980-02-22 | Ionomer-containing thermoplastic polymer composition |
Publications (2)
Publication Number | Publication Date |
---|---|
DE3022258A1 DE3022258A1 (de) | 1981-01-08 |
DE3022258C2 true DE3022258C2 (de) | 1986-01-23 |
Family
ID=27581854
Family Applications (2)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DE19803022258 Expired DE3022258C2 (de) | 1979-06-13 | 1980-06-13 | Thermoplastische Polymermasse |
DE19803050459 Expired DE3050459C2 (de) | 1979-06-13 | 1980-06-13 | Thermoplastische Polymermasse und deren Verwendung |
Family Applications After (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DE19803050459 Expired DE3050459C2 (de) | 1979-06-13 | 1980-06-13 | Thermoplastische Polymermasse und deren Verwendung |
Country Status (2)
Country | Link |
---|---|
DE (2) | DE3022258C2 (de) |
GB (1) | GB2053238B (de) |
Families Citing this family (23)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US5272208A (en) * | 1981-08-13 | 1993-12-21 | Asahi Kasei Kogyo Kabushiki Kaisha | Modified block copolymer composition |
US5278246A (en) * | 1981-08-13 | 1994-01-11 | Asahi Kasei Kogyo Kabushiki Kaisha | Modified block copolymer and a process for producing the same |
US5272209A (en) * | 1981-08-13 | 1993-12-21 | Asahi Kasei Kogyo Kabushiki Kaisha | Modified block copolymer composition |
JPS5827740A (ja) * | 1981-08-13 | 1983-02-18 | Asahi Chem Ind Co Ltd | 変性ブロツク共重合体組成物 |
US4628072A (en) * | 1981-08-13 | 1986-12-09 | Asahi Kasei Kogyo Kabushiki Kaisha | Modified block copolymer composition |
US4377647A (en) * | 1981-11-16 | 1983-03-22 | Shell Oil Company | Polymer blend composition |
US4535127A (en) * | 1983-03-23 | 1985-08-13 | Asahi Kasei Kogyo Kabushiki Kaisha | Polyacetal copolymers and process for production thereof |
US4954568A (en) * | 1985-08-16 | 1990-09-04 | Shell Oil Company | Impact resistant blends of thermoplastic polyesters and modified block copolymers |
JPS62174262A (ja) * | 1985-10-28 | 1987-07-31 | Toyobo Co Ltd | 熱可塑性重合体組成物 |
US4772653A (en) * | 1985-11-08 | 1988-09-20 | Amoco Corporation | Stain resistant cookware from blends comprising an interpolymer of an unsaturated dicarboxylic acid compound |
CA1326720C (en) * | 1987-12-31 | 1994-02-01 | Michael John Modic | Impact resistant blends of polar thermoplastic polymers and modified block copolymers |
JPH01308445A (ja) * | 1989-05-01 | 1989-12-13 | Asahi Chem Ind Co Ltd | 変性ブロック共重合体組成物 |
JPH02651A (ja) * | 1989-05-01 | 1990-01-05 | Asahi Chem Ind Co Ltd | 変性ブロック共重合体の組成物 |
DE4217470A1 (de) * | 1992-05-27 | 1993-12-02 | Buna Ag | Thermoplastische Formmassen |
JP3107679B2 (ja) * | 1993-04-02 | 2000-11-13 | オイレス工業株式会社 | ポリアセタール樹脂組成物および摺動部材 |
US5602202A (en) * | 1994-01-14 | 1997-02-11 | Minnesota Mining And Manufacturing Company | Methods of using acrylate-containing polymer blends |
WO1995019393A1 (en) * | 1994-01-14 | 1995-07-20 | Minnesota Mining And Manufacturing Company | Acrylate-containing polymer blends |
US5677376A (en) * | 1994-01-14 | 1997-10-14 | Minnesota Mining And Manufacturing Company | Acrylate-containing polymer blends |
US5506298A (en) * | 1994-04-12 | 1996-04-09 | National Starch And Chemical Investment Holding Corporation | Polyamide graft-modified rubbery block copolymer compositions |
US5605964A (en) * | 1995-06-22 | 1997-02-25 | Minnesota Mining And Manufacturing Company | Acrylate-containing polymer blends and methods of using |
US5623010A (en) * | 1995-06-22 | 1997-04-22 | Minnesota Mining And Manufacturing Company | Acrylate-containing polymer blends and methods of using |
US6066686A (en) * | 1996-07-05 | 2000-05-23 | Daicel Chemical Industries, Ltd. | Polycarbonate compositions |
US6756446B2 (en) * | 2002-10-15 | 2004-06-29 | Solvay Engineered Polymers | Engineered polyolefin materials with enhanced surface durability |
Family Cites Families (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4007311A (en) * | 1975-11-06 | 1977-02-08 | Shell Oil Company | Polyacrylate-grafted block copolymer adhesive compositions |
US4033888A (en) * | 1976-10-18 | 1977-07-05 | Shell Oil Company | Dispersant VI improver |
-
1980
- 1980-06-09 GB GB8018766A patent/GB2053238B/en not_active Expired
- 1980-06-13 DE DE19803022258 patent/DE3022258C2/de not_active Expired
- 1980-06-13 DE DE19803050459 patent/DE3050459C2/de not_active Expired
Also Published As
Publication number | Publication date |
---|---|
DE3050459C2 (de) | 1987-02-26 |
DE3022258A1 (de) | 1981-01-08 |
GB2053238B (en) | 1983-05-05 |
GB2053238A (en) | 1981-02-04 |
DE3050459A1 (de) | 1982-09-16 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE3022258C2 (de) | Thermoplastische Polymermasse | |
DE3688466T2 (de) | End-modifiziertes blockkopolymer und dieses kopolymer enthaltende zusammensetzung. | |
DE3037520C2 (de) | ||
DE3280472T2 (de) | Modifiziertes Blockcopolymer | |
DE69033210T2 (de) | (Modifiziertes) hydriertes Dien-Blockcopolymer und dieses enthaltende Zusammensetzung | |
DE69507429T2 (de) | Polymeremischungen enthaltend ein halogeniertes Polymer und einen zur Kompatibilität gepfropften aliphatischen Polyester | |
EP0286734B1 (de) | Gepfropfte lineare Polyethylene mit geringer Dichte, Verfahren zu ihrer Herstellung und ihre Verwendungen | |
DE3780768T2 (de) | Loesungsmittelbestaendige polyphenylenaetherharzmasse. | |
DE69013723T2 (de) | Thermoplastische Harzzusammensetzung. | |
DE69603734T2 (de) | Blockcopolymere von Polyolefinen mit Polyurethanen, Copolyestern oder Copolyamiden und ihre Verwendung | |
DE69401224T2 (de) | Thermoplastische Harzzusammensetzung und Verfahren zur Herstellung von Harz des modifizierten Polyolefin-Typs | |
DE3787275T2 (de) | Schlagzähe Polyamidharz-Zusammensetzung und Verfahren zu deren Herstellung. | |
DE3687303T2 (de) | Thermoplastische polymerzusammensetzung. | |
DE69120113T2 (de) | Oberflächenbehandlung eines geformten thermoplastischen Polyphenylenäthergegenstandes | |
DE2330022C2 (de) | Thermoplastische Massen auf Basis von thermoplastischem Material, Olefinpolymerisat und einem reaktionsfähigen anorganischen Füllstoff | |
DE69511615T2 (de) | Polyamidmatrix mit darin dispergierten Polyolefinkörnern enthaltendes Harzverbundmaterial | |
DE69519617T2 (de) | Elektrische Kabel mit flammhemmender Beschichtung auf Basis von Polyamiden | |
DE2551014A1 (de) | Thermoplastische pfropfmischcopolymerisate und verfahren zu ihrer herstellung | |
DE69012370T2 (de) | Harzzusammensetzung. | |
DE4209881C2 (de) | Polyphenylenether-Copolymer und dieses enthaltende thermoplastische Harzzusammensetzungen | |
EP0462471A2 (de) | Verwendung von thermoplastischen Zusammensetzungen aus Polyurethanen und partiell vernetzten Alkylacrylatcopolymeren | |
JPS6230225B2 (de) | ||
EP0805827A1 (de) | Funktionalisierte polymere, verfahren zu ihrer herstellung und ihre verwendung in thermoplastischen formmassen | |
DE3650420T2 (de) | Schlagfeste Polymerzusammensetzungen. | |
DE3831348A1 (de) | Schlagzaehe thermoplastische formmassen auf basis von polyphenylenether-pfropfcopolymeren und polyamiden sowie verfahren zu ihrer herstellung |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
OAP | Request for examination filed | ||
OD | Request for examination | ||
8172 | Supplementary division/partition in: |
Ref country code: DE Ref document number: 3050459 Format of ref document f/p: P |
|
Q171 | Divided out to: |
Ref country code: DE Ref document number: 3050459 |
|
8128 | New person/name/address of the agent |
Representative=s name: VON FUENER, A., DIPL.-CHEM. DR.RER.NAT. EBBINGHAUS |
|
8128 | New person/name/address of the agent |
Representative=s name: STREHL, P., DIPL.-ING. DIPL.-WIRTSCH.-ING. SCHUEBE |
|
D2 | Grant after examination | ||
8364 | No opposition during term of opposition | ||
AH | Division in |
Ref country code: DE Ref document number: 3050459 Format of ref document f/p: P |