DE3015359A1 - Verfahren zur herstellung von 1-(4-hydroxy-phenyl)-butan-3-on sowie neue zwischenprodukte dieses verfahrens - Google Patents
Verfahren zur herstellung von 1-(4-hydroxy-phenyl)-butan-3-on sowie neue zwischenprodukte dieses verfahrensInfo
- Publication number
- DE3015359A1 DE3015359A1 DE19803015359 DE3015359A DE3015359A1 DE 3015359 A1 DE3015359 A1 DE 3015359A1 DE 19803015359 DE19803015359 DE 19803015359 DE 3015359 A DE3015359 A DE 3015359A DE 3015359 A1 DE3015359 A1 DE 3015359A1
- Authority
- DE
- Germany
- Prior art keywords
- tert
- butan
- hydroxy
- phenyl
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 16
- 238000004519 manufacturing process Methods 0.000 title description 10
- NJGBTKGETPDVIK-UHFFFAOYSA-N raspberry ketone Chemical compound CC(=O)CCC1=CC=C(O)C=C1 NJGBTKGETPDVIK-UHFFFAOYSA-N 0.000 title description 9
- 239000013067 intermediate product Substances 0.000 title description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 22
- 238000006243 chemical reaction Methods 0.000 claims description 13
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical compound CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 3
- 230000003197 catalytic effect Effects 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 239000003054 catalyst Substances 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- VWMVAQHMFFZQGD-UHFFFAOYSA-N p-Hydroxybenzyl acetone Natural products CC(=O)CC1=CC=C(O)C=C1 VWMVAQHMFFZQGD-UHFFFAOYSA-N 0.000 description 8
- 239000007858 starting material Substances 0.000 description 7
- RGHHSNMVTDWUBI-UHFFFAOYSA-N 4-hydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1 RGHHSNMVTDWUBI-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 6
- 239000000543 intermediate Substances 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 235000011121 sodium hydroxide Nutrition 0.000 description 4
- KCYWYUHGFVVENH-UHFFFAOYSA-N 4-[4-[(2-methylpropan-2-yl)oxy]phenyl]butan-2-one Chemical compound CC(=O)CCC1=CC=C(OC(C)(C)C)C=C1 KCYWYUHGFVVENH-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 239000011814 protection agent Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- 238000002211 ultraviolet spectrum Methods 0.000 description 2
- 239000011787 zinc oxide Substances 0.000 description 2
- OCNIKEFATSKIBE-NSCUHMNNSA-N (e)-4-(4-hydroxyphenyl)but-3-en-2-one Chemical compound CC(=O)\C=C\C1=CC=C(O)C=C1 OCNIKEFATSKIBE-NSCUHMNNSA-N 0.000 description 1
- MOHYOXXOKFQHDC-UHFFFAOYSA-N 1-(chloromethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1 MOHYOXXOKFQHDC-UHFFFAOYSA-N 0.000 description 1
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 1
- FETIWDPIODONQB-UHFFFAOYSA-N 1-methyl-4-[(2-methylpropan-2-yl)oxy]benzene Chemical compound CC1=CC=C(OC(C)(C)C)C=C1 FETIWDPIODONQB-UHFFFAOYSA-N 0.000 description 1
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical class CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 1
- ZQMMVTTVTQGDFP-UHFFFAOYSA-N 4-(2-methylbutan-2-yloxy)benzaldehyde Chemical compound CCC(C)(C)OC1=CC=C(C=O)C=C1 ZQMMVTTVTQGDFP-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- VWSFZYXXQDKXKQ-UHFFFAOYSA-N 4-[(2-methylpropan-2-yl)oxy]benzaldehyde Chemical compound CC(C)(C)OC1=CC=C(C=O)C=C1 VWSFZYXXQDKXKQ-UHFFFAOYSA-N 0.000 description 1
- XROREUWMQJGCFF-UHFFFAOYSA-N 4-[4-(2-methylbutan-2-yloxy)phenyl]but-3-en-2-one Chemical compound CCC(C)(C)OC1=CC=C(C=CC(C)=O)C=C1 XROREUWMQJGCFF-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 238000005798 acetal elimination reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000005661 deetherification reaction Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000006056 electrooxidation reaction Methods 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 1
- 229940031826 phenolate Drugs 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 229910052761 rare earth metal Inorganic materials 0.000 description 1
- 150000002910 rare earth metals Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000009183 running Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000037072 sun protection Effects 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Substances CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/20—Unsaturated compounds containing keto groups bound to acyclic carbon atoms
- C07C49/255—Unsaturated compounds containing keto groups bound to acyclic carbon atoms containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/62—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by hydrogenation of carbon-to-carbon double or triple bonds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/673—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by change of size of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/72—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction of compounds containing >C = O groups with the same or other compounds containing >C = O groups
- C07C45/73—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction of compounds containing >C = O groups with the same or other compounds containing >C = O groups combined with hydrogenation
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/72—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction of compounds containing >C = O groups with the same or other compounds containing >C = O groups
- C07C45/74—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction of compounds containing >C = O groups with the same or other compounds containing >C = O groups combined with dehydration
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803015359 DE3015359A1 (de) | 1980-04-22 | 1980-04-22 | Verfahren zur herstellung von 1-(4-hydroxy-phenyl)-butan-3-on sowie neue zwischenprodukte dieses verfahrens |
| DE8181102697T DE3160927D1 (en) | 1980-04-22 | 1981-04-09 | Process for the preparation of 1-(4-hydroxyphenyl)-3-butanone and intermediate compounds for this process |
| EP81102697A EP0038480B1 (de) | 1980-04-22 | 1981-04-09 | Verfahren zur Herstellung von 1-(4-Hydroxy-phenyl)-butan-3-on sowie neue Zwischenprodukte dieses Verfahrens |
| JP5932281A JPS56166143A (en) | 1980-04-22 | 1981-04-21 | Manufacture of 1-(4-hydroxy-phenyl)-butane- 3-one and novel intermediate thereby |
| US06/798,361 US4908481A (en) | 1980-04-22 | 1985-11-18 | Preparation of 1-(4-hydroxy-phenyl)-butan-3-one and novel intermediates |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803015359 DE3015359A1 (de) | 1980-04-22 | 1980-04-22 | Verfahren zur herstellung von 1-(4-hydroxy-phenyl)-butan-3-on sowie neue zwischenprodukte dieses verfahrens |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3015359A1 true DE3015359A1 (de) | 1981-10-29 |
Family
ID=6100601
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803015359 Withdrawn DE3015359A1 (de) | 1980-04-22 | 1980-04-22 | Verfahren zur herstellung von 1-(4-hydroxy-phenyl)-butan-3-on sowie neue zwischenprodukte dieses verfahrens |
| DE8181102697T Expired DE3160927D1 (en) | 1980-04-22 | 1981-04-09 | Process for the preparation of 1-(4-hydroxyphenyl)-3-butanone and intermediate compounds for this process |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8181102697T Expired DE3160927D1 (en) | 1980-04-22 | 1981-04-09 | Process for the preparation of 1-(4-hydroxyphenyl)-3-butanone and intermediate compounds for this process |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4908481A (enExample) |
| EP (1) | EP0038480B1 (enExample) |
| JP (1) | JPS56166143A (enExample) |
| DE (2) | DE3015359A1 (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3824518A1 (de) * | 1988-07-20 | 1990-01-25 | Bayer Ag | Verfahren zur herstellung von 4,4-dimethyl-1-(p-chlor-phenyl)-pentan-3-on |
| US5132357A (en) * | 1990-06-01 | 1992-07-21 | Endter Norman G | Tread rubber employing high structured carbon black and tires using same |
| FR2729386B1 (fr) * | 1995-01-12 | 1997-04-04 | Robertet Sa | Procede de preparation de derives de la butanone |
| DE19523450A1 (de) * | 1995-06-28 | 1997-01-02 | Bayer Ag | Verfahren zur Herstellung von Aryliden-substituierten Alkylcycloalkanonen |
| AU735610B2 (en) * | 1997-08-19 | 2001-07-12 | Shell Internationale Research Maatschappij B.V. | Apparatus for amorphous bonding of tubulars |
| AU2014321143B2 (en) * | 2013-09-12 | 2018-01-18 | Thales Australia Limited | Burn rate modifier |
| RU2637312C1 (ru) * | 2016-12-08 | 2017-12-04 | Федеральное государственное бюджетное учреждение науки Новосибирский институт органической химии им. Н.Н. Ворожцова Сибирского отделения Российской академии наук (НИОХ СО РАН) | Способ получения кетона малины |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE702894C (de) * | 1939-02-09 | 1941-02-19 | I G Farbenindustrie Akt Ges | Verfahren zur Herstellung von Oxyketonen |
| US3098874A (en) * | 1958-07-03 | 1963-07-23 | Dragoco Gerberding Co Gmbh | Process of preparing 1-(4-hydroxy phenyl)-butanone- |
| DE1098951B (de) * | 1958-07-03 | 1961-02-09 | Dragoco Gerberding Co Gmbh | Verfahren zur Herstellung von 1-(4-Oxyphenyl)-butanon-(3) |
| NL6407943A (enExample) * | 1964-07-11 | 1966-01-12 | ||
| GB1094417A (en) * | 1965-09-10 | 1967-12-13 | H E Daniel Ltd | Method of producing 1-(4 methoxy-phenyl)- butanone- (3) and 1-(4 hydroxy-phenyl)- butanone- (3) |
| US3997608A (en) * | 1973-07-05 | 1976-12-14 | Richardson-Merrell Inc. | N-substituted-dihydroxyphenethylamines |
| CH593224A5 (enExample) * | 1973-10-30 | 1977-11-30 | Taisho Pharmaceutical Co Ltd | |
| GB1479297A (en) * | 1974-07-04 | 1977-07-13 | Beecham Group Ltd | 4-substituted butan-2-ones but-3-en-2-ones butan-2-ols and but-3-en-2-ols and pharmaceutical compositions containing them |
| FR2430938A1 (fr) * | 1978-07-11 | 1980-02-08 | Oreal | Nouvelles oxybenzylidenes bornanones, leur procede de preparation, et compositions cosmetiques les contenant |
| US4218468A (en) * | 1978-11-13 | 1980-08-19 | Mobil Oil Corporation | Ketone insecticides |
| US4271319A (en) * | 1979-05-14 | 1981-06-02 | Hooker Chemicals & Plastics Corp. | Phenyl beta-chloro-alpha-hydroxy-beta-(3-trifluoromethylphenyl)ethyl ketone and process for its production |
-
1980
- 1980-04-22 DE DE19803015359 patent/DE3015359A1/de not_active Withdrawn
-
1981
- 1981-04-09 DE DE8181102697T patent/DE3160927D1/de not_active Expired
- 1981-04-09 EP EP81102697A patent/EP0038480B1/de not_active Expired
- 1981-04-21 JP JP5932281A patent/JPS56166143A/ja active Granted
-
1985
- 1985-11-18 US US06/798,361 patent/US4908481A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| JPS56166143A (en) | 1981-12-21 |
| DE3160927D1 (en) | 1983-10-27 |
| JPS6365057B2 (enExample) | 1988-12-14 |
| EP0038480B1 (de) | 1983-09-21 |
| US4908481A (en) | 1990-03-13 |
| EP0038480A1 (de) | 1981-10-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3042121C2 (enExample) | ||
| EP0038480B1 (de) | Verfahren zur Herstellung von 1-(4-Hydroxy-phenyl)-butan-3-on sowie neue Zwischenprodukte dieses Verfahrens | |
| DE2941386A1 (de) | Verfahren zur herstellung von a-methylsubstituierten carbonylverbindungen | |
| EP0014963A2 (de) | Verfahren zur Herstellung von bicyclischen Enoläthern sowie Äther von 2-(3-Hydroxyprop-1-yl)-cycloalkanonen | |
| EP0165564B1 (de) | Verfahren zur Herstellung von 4-Acylamino-2-alkylamino-phenylethern | |
| DE3821197A1 (de) | Verfahren zur herstellung von (alpha),(beta)-ungesaettigten ketonen | |
| EP0731075A1 (de) | Verfahren zur Herstellung von substituierten Cyclohexanonen | |
| DE2216974A1 (de) | Verfahren zur herstellung hoehermolekularer ungesaettigter ketone | |
| DE68904928T2 (de) | Verfahren zur herstellung von 4-aryl-disubstituierten-1-tetralonen. | |
| DE1237567B (de) | Verfahren zur Herstellung von delta 5-6-Methylsteroiden | |
| EP0194591B1 (de) | Verfahren zur Herstellung von 2-Alkyl-cyclopentanonen | |
| DE3436450A1 (de) | Verfahren zur herstellung von p-aminoethylketonen | |
| EP0320451A2 (de) | Verfahren zur Herstellung von alkylsubstituierten Phenolen oder Naphtholen | |
| DE69206216T2 (de) | Verfahren zur Herstellung von 2-Methyl-1,3-Cyclohexandion und 2-Methylresorcinol. | |
| DE2439198C2 (de) | 2,6,10-Trimethyl-dodecan-1-al und 2,6,10-Trimethyl-dodeca-4,8-dien-1-al sowie Verfahren zu ihrer Herstellung | |
| EP0436860A1 (de) | Verfahren zur Herstellung von 2-(4-Chlorphenyl)-3-methyl-buttersäure | |
| DE2921139A1 (de) | Ethylether des isocamphyl-guajakols, verfahren zu ihrer herstellung und ihre verwendung zur herstellung von 3- eckige klammer auf isocamphyl-(5) eckige klammer zu -cyclohexanol | |
| DE2719976C2 (de) | Bicyclische Aldehyde und Verfahren zu deren Herstellung | |
| EP0061669A1 (de) | Verbessertes Verfahren zur Herstellung von Cyclohexan-1,3-dionen sowie einige neue bicyclische Cyclohexan-1,3-dione | |
| EP0307777B1 (de) | Neue 2-Methyl-4-fluor- phenole und deren Herstellung | |
| DE1924844A1 (de) | Verfahren zur Herstellung von Trimethyl-2-cyclohexen-1-onen | |
| EP0591799B1 (de) | Oxidation von Hydroxybenzaldehyden zur Herstellung von Dihydroxybenzol Verbindungen | |
| EP0252389B1 (de) | 1,1-Dialkoxy-2-methyl-4,4- diacyloxy-2-butene | |
| DE2428879A1 (de) | Verfahren zur herstellung von resorcinmonoaethern | |
| DE1793037C (de) | Verfahren zur Herstellung von 2,3,6 Tnmethylphenol |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |