DE2932092A1 - Styrylfarbstoffe - Google Patents
StyrylfarbstoffeInfo
- Publication number
- DE2932092A1 DE2932092A1 DE19792932092 DE2932092A DE2932092A1 DE 2932092 A1 DE2932092 A1 DE 2932092A1 DE 19792932092 DE19792932092 DE 19792932092 DE 2932092 A DE2932092 A DE 2932092A DE 2932092 A1 DE2932092 A1 DE 2932092A1
- Authority
- DE
- Germany
- Prior art keywords
- substituted
- alkyl
- radicals
- ring
- dye
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000975 dye Substances 0.000 title claims description 56
- -1 alkenyl radical Chemical class 0.000 claims description 33
- 239000000460 chlorine Substances 0.000 claims description 25
- 238000004043 dyeing Methods 0.000 claims description 20
- 229920002239 polyacrylonitrile Polymers 0.000 claims description 13
- 150000005840 aryl radicals Chemical class 0.000 claims description 11
- 150000003254 radicals Chemical class 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 150000001450 anions Chemical class 0.000 claims description 9
- 239000000835 fiber Substances 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- 229910052799 carbon Inorganic materials 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 150000001299 aldehydes Chemical class 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 229920000728 polyester Polymers 0.000 claims description 5
- 150000003839 salts Chemical group 0.000 claims description 5
- 238000009833 condensation Methods 0.000 claims description 4
- 230000005494 condensation Effects 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 235000021190 leftovers Nutrition 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 239000004952 Polyamide Substances 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 3
- 125000000068 chlorophenyl group Chemical group 0.000 claims description 3
- 239000003086 colorant Substances 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 239000000976 ink Substances 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 229920002647 polyamide Polymers 0.000 claims description 3
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims description 2
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 2
- 244000198134 Agave sisalana Species 0.000 claims description 2
- 244000060011 Cocos nucifera Species 0.000 claims description 2
- 235000013162 Cocos nucifera Nutrition 0.000 claims description 2
- 240000000491 Corchorus aestuans Species 0.000 claims description 2
- 235000011777 Corchorus aestuans Nutrition 0.000 claims description 2
- 235000010862 Corchorus capsularis Nutrition 0.000 claims description 2
- 229920000742 Cotton Polymers 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- DXNQLZJOTVNBOZ-UHFFFAOYSA-N [O]C(=O)Nc1ccccc1 Chemical group [O]C(=O)Nc1ccccc1 DXNQLZJOTVNBOZ-UHFFFAOYSA-N 0.000 claims description 2
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims description 2
- 239000003054 catalyst Substances 0.000 claims description 2
- 229920002301 cellulose acetate Polymers 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 239000010985 leather Substances 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 14
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 14
- 239000000243 solution Substances 0.000 description 13
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000002351 wastewater Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 229920001131 Pulp (paper) Polymers 0.000 description 10
- ONIKNECPXCLUHT-UHFFFAOYSA-N 2-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1Cl ONIKNECPXCLUHT-UHFFFAOYSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- 238000010186 staining Methods 0.000 description 8
- FKNQCJSGGFJEIZ-UHFFFAOYSA-N 4-methylpyridine Chemical compound CC1=CC=NC=C1 FKNQCJSGGFJEIZ-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 238000004040 coloring Methods 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 125000001424 substituent group Chemical group 0.000 description 6
- 229920005989 resin Polymers 0.000 description 5
- 239000011347 resin Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 229940037003 alum Drugs 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 229920000151 polyglycol Polymers 0.000 description 3
- 239000010695 polyglycol Substances 0.000 description 3
- YVBIDCBDRUUGEA-UHFFFAOYSA-N 4-[benzyl(ethyl)amino]benzaldehyde Chemical compound C=1C=C(C=O)C=CC=1N(CC)CC1=CC=CC=C1 YVBIDCBDRUUGEA-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- 150000001242 acetic acid derivatives Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- YOCIQNIEQYCORH-UHFFFAOYSA-M chembl2028361 Chemical compound [Na+].OC1=CC=C2C=C(S([O-])(=O)=O)C=CC2=C1N=NC1=CC=CC=C1 YOCIQNIEQYCORH-UHFFFAOYSA-M 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000005034 decoration Methods 0.000 description 2
- 150000002334 glycols Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 239000004310 lactic acid Substances 0.000 description 2
- 235000014655 lactic acid Nutrition 0.000 description 2
- 229920005610 lignin Polymers 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 2
- 239000003495 polar organic solvent Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000005504 styryl group Chemical group 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- ONDPHDOFVYQSGI-UHFFFAOYSA-N zinc nitrate Chemical compound [Zn+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ONDPHDOFVYQSGI-UHFFFAOYSA-N 0.000 description 2
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical compound O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 description 1
- IZPNVUYQWBZYEA-UHFFFAOYSA-N 1,4-dimethylpyridin-1-ium Chemical compound CC1=CC=[N+](C)C=C1 IZPNVUYQWBZYEA-UHFFFAOYSA-N 0.000 description 1
- LJHMBIINLKLHSI-UHFFFAOYSA-M 1-benzyl-4-methylpyridin-1-ium;chloride Chemical compound [Cl-].C1=CC(C)=CC=[N+]1CC1=CC=CC=C1 LJHMBIINLKLHSI-UHFFFAOYSA-M 0.000 description 1
- JYYNAJVZFGKDEQ-UHFFFAOYSA-N 2,4-Dimethylpyridine Chemical class CC1=CC=NC(C)=C1 JYYNAJVZFGKDEQ-UHFFFAOYSA-N 0.000 description 1
- FTARHDNLYRKITK-UHFFFAOYSA-M 2-(2-methylpyridin-1-ium-1-yl)ethanol;chloride Chemical compound [Cl-].CC1=CC=CC=[N+]1CCO FTARHDNLYRKITK-UHFFFAOYSA-M 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- AZDVZDGCALJELV-UHFFFAOYSA-M 2-(4-methylpyridin-1-ium-1-yl)ethanol;chloride Chemical compound [Cl-].CC1=CC=[N+](CCO)C=C1 AZDVZDGCALJELV-UHFFFAOYSA-M 0.000 description 1
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 1
- MNNZINNZIQVULG-UHFFFAOYSA-N 2-chloroethylbenzene Chemical compound ClCCC1=CC=CC=C1 MNNZINNZIQVULG-UHFFFAOYSA-N 0.000 description 1
- FCYVWWWTHPPJII-UHFFFAOYSA-N 2-methylidenepropanedinitrile Chemical compound N#CC(=C)C#N FCYVWWWTHPPJII-UHFFFAOYSA-N 0.000 description 1
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- MNFZZNNFORDXSV-UHFFFAOYSA-N 4-(diethylamino)benzaldehyde Chemical compound CCN(CC)C1=CC=C(C=O)C=C1 MNFZZNNFORDXSV-UHFFFAOYSA-N 0.000 description 1
- BGNGWHSBYQYVRX-UHFFFAOYSA-N 4-(dimethylamino)benzaldehyde Chemical compound CN(C)C1=CC=C(C=O)C=C1 BGNGWHSBYQYVRX-UHFFFAOYSA-N 0.000 description 1
- GDKRKWOVNXZJRF-UHFFFAOYSA-N 4-(n-methylanilino)benzaldehyde Chemical compound C=1C=C(C=O)C=CC=1N(C)C1=CC=CC=C1 GDKRKWOVNXZJRF-UHFFFAOYSA-N 0.000 description 1
- RFOTWKAIOZQWPO-UHFFFAOYSA-M 4-methyl-1-(2-phenylethyl)pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC(C)=CC=[N+]1CCC1=CC=CC=C1 RFOTWKAIOZQWPO-UHFFFAOYSA-M 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 101100129500 Caenorhabditis elegans max-2 gene Proteins 0.000 description 1
- IMROMDMJAWUWLK-UHFFFAOYSA-N Ethenol Chemical compound OC=C IMROMDMJAWUWLK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical class CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 1
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- GYSIGNCFCHZROO-JANZRGBASA-N Neochrom Natural products CC(=C/C=C/C=C(C)/C=C/C=C(C)/C(=C=C1C(C)(C)CC(O)CC1(C)O)C)C=CC=C(/C)C2OC3(C)CC(O)CC(C)(C)C3=C2 GYSIGNCFCHZROO-JANZRGBASA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 150000001449 anionic compounds Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- POJOORKDYOPQLS-UHFFFAOYSA-L barium(2+) 5-chloro-2-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methylbenzenesulfonate Chemical compound [Ba+2].C1=C(Cl)C(C)=CC(N=NC=2C3=CC=CC=C3C=CC=2O)=C1S([O-])(=O)=O.C1=C(Cl)C(C)=CC(N=NC=2C3=CC=CC=C3C=CC=2O)=C1S([O-])(=O)=O POJOORKDYOPQLS-UHFFFAOYSA-L 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- JBIROUFYLSSYDX-UHFFFAOYSA-M benzododecinium chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 JBIROUFYLSSYDX-UHFFFAOYSA-M 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 150000001767 cationic compounds Chemical class 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 150000001983 dialkylethers Chemical class 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 230000022244 formylation Effects 0.000 description 1
- 238000006170 formylation reaction Methods 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 238000010409 ironing Methods 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 150000003893 lactate salts Chemical class 0.000 description 1
- 125000005395 methacrylic acid group Chemical group 0.000 description 1
- 229940095102 methyl benzoate Drugs 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000002891 organic anions Chemical class 0.000 description 1
- 125000001477 organic nitrogen group Chemical group 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- RAIYODFGMLZUDF-UHFFFAOYSA-N piperidin-1-ium;acetate Chemical compound CC([O-])=O.C1CC[NH2+]CC1 RAIYODFGMLZUDF-UHFFFAOYSA-N 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical class CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- STZCRXQWRGQSJD-UHFFFAOYSA-N sodium;4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonic acid Chemical compound [Na+].C1=CC(N(C)C)=CC=C1N=NC1=CC=C(S(O)(=O)=O)C=C1 STZCRXQWRGQSJD-UHFFFAOYSA-N 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 229920001864 tannin Polymers 0.000 description 1
- 235000018553 tannin Nutrition 0.000 description 1
- 239000001648 tannin Substances 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
- 150000003513 tertiary aromatic amines Chemical class 0.000 description 1
- YODZTKMDCQEPHD-UHFFFAOYSA-N thiodiglycol Chemical compound OCCSCCO YODZTKMDCQEPHD-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B23/00—Methine or polymethine dyes, e.g. cyanine dyes
- C09B23/14—Styryl dyes
- C09B23/145—Styryl dyes the ethylene chain carrying an heterocyclic residue, e.g. heterocycle-CH=CH-C6H5
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Paper (AREA)
- Coloring (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792932092 DE2932092A1 (de) | 1979-08-08 | 1979-08-08 | Styrylfarbstoffe |
| EP80104229A EP0023991B1 (de) | 1979-08-08 | 1980-07-18 | Styrylfarbstoffe, ihre Herstellung und ihre Verwendung zum Färben von insbesondere Papier |
| DE8080104229T DE3064403D1 (en) | 1979-08-08 | 1980-07-18 | Styryl dyestuffs, their preparation and their use in dyeing paper in particular |
| US06/170,412 US4558133A (en) | 1979-08-08 | 1980-07-21 | p-(Pyridinium-vinyl)-N,N-(disubstituted-aniline salts for dyeing paper and their preparation |
| JP10725980A JPS5626956A (en) | 1979-08-08 | 1980-08-06 | Styryl dyes* their manufacture and their use particularly in dyeing paper |
| ES494064A ES494064A0 (es) | 1979-08-08 | 1980-08-07 | Procedimiento para la obtencion de colorantes estirilicos |
| BR8004973A BR8004973A (pt) | 1979-08-08 | 1980-08-07 | Corantes estirilicos,sua preparacao e seu emprego para o tingimento de especialmente papel |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792932092 DE2932092A1 (de) | 1979-08-08 | 1979-08-08 | Styrylfarbstoffe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2932092A1 true DE2932092A1 (de) | 1981-02-26 |
Family
ID=6077895
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19792932092 Withdrawn DE2932092A1 (de) | 1979-08-08 | 1979-08-08 | Styrylfarbstoffe |
| DE8080104229T Expired DE3064403D1 (en) | 1979-08-08 | 1980-07-18 | Styryl dyestuffs, their preparation and their use in dyeing paper in particular |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8080104229T Expired DE3064403D1 (en) | 1979-08-08 | 1980-07-18 | Styryl dyestuffs, their preparation and their use in dyeing paper in particular |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4558133A (enExample) |
| EP (1) | EP0023991B1 (enExample) |
| JP (1) | JPS5626956A (enExample) |
| BR (1) | BR8004973A (enExample) |
| DE (2) | DE2932092A1 (enExample) |
| ES (1) | ES494064A0 (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5194984A (en) * | 1991-06-10 | 1993-03-16 | General Electric Company | Stilbazolium salt and optically non-linear devices incorporating same |
| DE19524134A1 (de) * | 1995-07-03 | 1997-01-09 | Bayer Ag | Verfahren zum Reduzieren der Toxizität von Restflotten und neue kationische Farbstoffe |
| US5912257A (en) * | 1995-09-06 | 1999-06-15 | The Research Foundation Of State University Of New York | Two-photon upconverting dyes and applications |
| TW593658B (en) * | 2002-12-31 | 2004-06-21 | Ind Tech Res Inst | Fluorescent recording media dye, and fluorescent recording media |
Family Cites Families (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2742463A (en) * | 1956-04-17 | Dichlqrostyrylpyridinium compound | ||
| US2808407A (en) * | 1957-10-01 | New imidazolium compounds | ||
| US2280253A (en) * | 1935-04-26 | 1942-04-21 | Gen Aniline & Film Corp | Dyestuffs of the methine series |
| US2112140A (en) * | 1935-07-10 | 1938-03-22 | Eastman Kodak Co | Process for preparing carbocyanine dyes |
| US2255077A (en) * | 1938-03-21 | 1941-09-09 | Du Pont Film Mfg Corp | Filter dyes for color photography |
| BE442515A (enExample) * | 1940-07-30 | |||
| US2494032A (en) * | 1946-06-03 | 1950-01-10 | Eastman Kodak Co | Styryl dyes |
| US2558777A (en) * | 1946-10-15 | 1951-07-03 | Schering Corp | Halogenated hydroxystilbazoles and derivatives thereof |
| US2780577A (en) * | 1951-05-26 | 1957-02-05 | Burroughs Wellcome Co | Inhibiting polymethylene diquaternary curariform activity by alpha-stilbazoline derivatives |
| US3085935A (en) * | 1961-04-24 | 1963-04-16 | Burroughs Wellcome Co | Method for the elimination of nematode infestations |
| US3177116A (en) * | 1962-01-26 | 1965-04-06 | American Cyanamid Co | Anthelmintic compositions containing substituted styrylpyridinium compounds and method of administering same |
| US3152042A (en) * | 1962-01-26 | 1964-10-06 | American Cyanamid Co | Styrylquinolinium compositions used as anthelmintics |
| US3179559A (en) * | 1962-01-26 | 1965-04-20 | American Cyanamid Co | Anthelmintic compositions of styrylpyridinium compounds and method of administering the same |
| US3582332A (en) * | 1966-02-01 | 1971-06-01 | Ncr Co | Photographic process |
| US3855210A (en) * | 1969-02-03 | 1974-12-17 | Itek Corp | Improved bis(hydroxyalkyl) styryl dye compounds and photosensitive media containing such compounds |
| FR2087210A5 (en) * | 1970-05-11 | 1971-12-31 | Kodak Pathe | Silver halide complex - contg cyanine dye for photography |
| US3705895A (en) * | 1970-11-04 | 1972-12-12 | American Cyanamid Co | Process for the direct synthesis of styrylpyridinium chlorides |
| US3833863A (en) * | 1971-12-27 | 1974-09-03 | Eastman Kodak Co | Styryl and arylbutadienyl dye lasers |
| US3974147A (en) * | 1973-04-02 | 1976-08-10 | Minnesota Mining And Manufacturing Company | Reduced styryl dyes |
| JPS5042863A (enExample) * | 1973-08-20 | 1975-04-18 | ||
| JPS5911619B2 (ja) * | 1973-09-27 | 1984-03-16 | 富士写真フイルム株式会社 | スチリルおよびブタジエニル染料の製法 |
-
1979
- 1979-08-08 DE DE19792932092 patent/DE2932092A1/de not_active Withdrawn
-
1980
- 1980-07-18 EP EP80104229A patent/EP0023991B1/de not_active Expired
- 1980-07-18 DE DE8080104229T patent/DE3064403D1/de not_active Expired
- 1980-07-21 US US06/170,412 patent/US4558133A/en not_active Expired - Lifetime
- 1980-08-06 JP JP10725980A patent/JPS5626956A/ja active Granted
- 1980-08-07 BR BR8004973A patent/BR8004973A/pt unknown
- 1980-08-07 ES ES494064A patent/ES494064A0/es active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5626956A (en) | 1981-03-16 |
| ES8106323A1 (es) | 1981-08-01 |
| US4558133A (en) | 1985-12-10 |
| EP0023991A1 (de) | 1981-02-18 |
| BR8004973A (pt) | 1981-02-17 |
| DE3064403D1 (en) | 1983-09-01 |
| ES494064A0 (es) | 1981-08-01 |
| JPH0310668B2 (enExample) | 1991-02-14 |
| EP0023991B1 (de) | 1983-07-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2714653C3 (de) | Kationische Styrylfarbstoffe und Verfahren zum Färben mit diesen Farbstoffen | |
| DE2711521C3 (de) | Verfahren zum Färben von Papiermaterial | |
| EP0023991B1 (de) | Styrylfarbstoffe, ihre Herstellung und ihre Verwendung zum Färben von insbesondere Papier | |
| EP0024322B1 (de) | Kationische Azofarbstoffe, ihre Herstellung, ihre Verwendung zum Färben von synthetischen und natürlichen Materialien und sie enthaltende Mittel | |
| EP0051187B1 (de) | Kationische Styrylfarbstoffe, ihre Herstellung und ihre Verwendung zum Färben von natürlichen und synthetischen kationisch anfärbbaren Substraten | |
| EP0037491B1 (de) | Dimethinfarbstoffe, ihre Herstellung und ihre Verwendung zum Färben von synthetischen und natürlichen Materialien | |
| DE2929285C2 (de) | Kationische Oxazinfarbstoffe | |
| DE60022876T2 (de) | Triphendioxazin-verbindungen | |
| DE2533428C2 (enExample) | ||
| EP0752494A1 (de) | Verfahren zum Reduzieren der Toxizität von Restflotten und neue kationische Farbstoffe | |
| DE3138182A1 (de) | Kationische farbstoffe, ihre herstellung und verwendung | |
| EP0012300B1 (de) | Farbige polymere Verbindungen, Verfahren zu deren Herstellung und ihre Verwendung beim Färben von Papier | |
| DE2031202A1 (de) | Hydrazonfarbstoffe | |
| DE2850706C3 (de) | Kationische Monoazofarbstoffe, Verfahren zu deren Herstellung und Verfahren zum Färben und Bedrucken | |
| EP0060468B1 (de) | Verfahren zum Färben von Papier und gefärbtes Papier | |
| DE1569734B2 (de) | Mischungen von methinfarbstoffen | |
| EP0556556B1 (de) | Basische Azofarbstoffe mit einer Kupplungskomponente aus der Hydroxynaphthalincarbonsäurereihe | |
| DE2023632C3 (de) | Basische Anthrachinonfarbstoffe, ihre Herstellung und Verwendung | |
| DE3625576A1 (de) | Basische, sulfonsaeuregruppenhaltige monoazo- oder disazoverbindungen | |
| EP0292433B1 (de) | Kationische Verbindungen | |
| DE3717869A1 (de) | Triazinhaltige monoazoverbindungen | |
| EP0114043A2 (de) | Farbstoffmischungen und ihre Verwendung zum Färben von Papier | |
| DE1103485B (de) | Verfahren zur Herstellung basischer Styrylfarbstoffe | |
| DE2726437A1 (de) | Hydrazonfarbstoffe | |
| DE3540090A1 (de) | Kationische isothiazolazoverbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |