DE2849002A1 - Verfahren zur katalytischen hydrierung von nitrobenzol - Google Patents
Verfahren zur katalytischen hydrierung von nitrobenzolInfo
- Publication number
- DE2849002A1 DE2849002A1 DE19782849002 DE2849002A DE2849002A1 DE 2849002 A1 DE2849002 A1 DE 2849002A1 DE 19782849002 DE19782849002 DE 19782849002 DE 2849002 A DE2849002 A DE 2849002A DE 2849002 A1 DE2849002 A1 DE 2849002A1
- Authority
- DE
- Germany
- Prior art keywords
- carrier
- per liter
- hydrogenation
- less
- catalyst
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 title claims abstract description 41
- 238000000034 method Methods 0.000 title claims abstract description 24
- 230000003197 catalytic effect Effects 0.000 title description 3
- 230000036571 hydration Effects 0.000 title 1
- 238000006703 hydration reaction Methods 0.000 title 1
- 239000003054 catalyst Substances 0.000 claims abstract description 56
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims abstract description 44
- 238000005984 hydrogenation reaction Methods 0.000 claims abstract description 19
- 238000001035 drying Methods 0.000 claims abstract description 11
- 229910000510 noble metal Inorganic materials 0.000 claims abstract description 9
- 230000000737 periodic effect Effects 0.000 claims abstract description 8
- 229910052723 transition metal Inorganic materials 0.000 claims abstract description 7
- 150000003624 transition metals Chemical class 0.000 claims abstract description 7
- 230000007704 transition Effects 0.000 claims abstract description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 39
- 229910052763 palladium Inorganic materials 0.000 claims description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 15
- 239000012876 carrier material Substances 0.000 claims description 14
- 229910052751 metal Inorganic materials 0.000 claims description 11
- 239000002184 metal Substances 0.000 claims description 11
- 229910052720 vanadium Inorganic materials 0.000 claims description 11
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 claims description 10
- 239000000463 material Substances 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 7
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 6
- 239000011651 chromium Substances 0.000 claims description 5
- 239000011701 zinc Substances 0.000 claims description 5
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 4
- 150000002739 metals Chemical class 0.000 claims description 4
- 229910052721 tungsten Inorganic materials 0.000 claims description 4
- 229910052725 zinc Inorganic materials 0.000 claims description 4
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 3
- 229910052797 bismuth Inorganic materials 0.000 claims description 3
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 3
- 229910052804 chromium Inorganic materials 0.000 claims description 3
- 229910052750 molybdenum Inorganic materials 0.000 claims description 3
- 229910052758 niobium Inorganic materials 0.000 claims description 3
- 239000010955 niobium Substances 0.000 claims description 3
- 229910052715 tantalum Inorganic materials 0.000 claims description 3
- 229910052719 titanium Inorganic materials 0.000 claims description 3
- 239000010936 titanium Substances 0.000 claims description 3
- 239000010937 tungsten Substances 0.000 claims description 3
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 2
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 2
- 239000011733 molybdenum Substances 0.000 claims description 2
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 2
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 2
- 229910018072 Al 2 O 3 Inorganic materials 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 abstract description 9
- 229910052739 hydrogen Inorganic materials 0.000 abstract description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract description 7
- 238000005470 impregnation Methods 0.000 abstract description 5
- 239000013543 active substance Substances 0.000 abstract description 4
- 239000002585 base Substances 0.000 description 11
- 238000004519 manufacturing process Methods 0.000 description 10
- 239000000203 mixture Substances 0.000 description 8
- 239000012266 salt solution Substances 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 239000003513 alkali Substances 0.000 description 5
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000007789 gas Substances 0.000 description 5
- OGUCKKLSDGRKSH-UHFFFAOYSA-N oxalic acid oxovanadium Chemical compound [V].[O].C(C(=O)O)(=O)O OGUCKKLSDGRKSH-UHFFFAOYSA-N 0.000 description 5
- -1 zirconium silicates Chemical class 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 4
- 230000008021 deposition Effects 0.000 description 4
- 229910052566 spinel group Inorganic materials 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000010970 precious metal Substances 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- 229910052596 spinel Inorganic materials 0.000 description 3
- 239000011029 spinel Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000001621 bismuth Chemical class 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L calcium carbonate Substances [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000013529 heat transfer fluid Substances 0.000 description 2
- 229940046892 lead acetate Drugs 0.000 description 2
- 150000002940 palladium Chemical class 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910010271 silicon carbide Inorganic materials 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical group C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 description 1
- PKQYSCBUFZOAPE-UHFFFAOYSA-N 1,2-dibenzyl-3-methylbenzene Chemical compound C=1C=CC=CC=1CC=1C(C)=CC=CC=1CC1=CC=CC=C1 PKQYSCBUFZOAPE-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- SNAAJJQQZSMGQD-UHFFFAOYSA-N aluminum magnesium Chemical compound [Mg].[Al] SNAAJJQQZSMGQD-UHFFFAOYSA-N 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 235000015243 ice cream Nutrition 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 235000012245 magnesium oxide Nutrition 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 235000012243 magnesium silicates Nutrition 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical class [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 150000001247 metal acetylides Chemical class 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- SOQBVABWOPYFQZ-UHFFFAOYSA-N oxygen(2-);titanium(4+) Chemical class [O-2].[O-2].[Ti+4] SOQBVABWOPYFQZ-UHFFFAOYSA-N 0.000 description 1
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical class [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 1
- 150000002941 palladium compounds Chemical class 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 231100000572 poisoning Toxicity 0.000 description 1
- 230000000607 poisoning effect Effects 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- ABKQFSYGIHQQLS-UHFFFAOYSA-J sodium tetrachloropalladate Chemical compound [Na+].[Na+].Cl[Pd+2](Cl)(Cl)Cl ABKQFSYGIHQQLS-UHFFFAOYSA-J 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 125000005287 vanadyl group Chemical group 0.000 description 1
- 239000004246 zinc acetate Substances 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
- 229910001928 zirconium oxide Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/30—Preparation of compounds containing amino groups bound to a carbon skeleton by reduction of nitrogen-to-oxygen or nitrogen-to-nitrogen bonds
- C07C209/32—Preparation of compounds containing amino groups bound to a carbon skeleton by reduction of nitrogen-to-oxygen or nitrogen-to-nitrogen bonds by reduction of nitro groups
- C07C209/36—Preparation of compounds containing amino groups bound to a carbon skeleton by reduction of nitrogen-to-oxygen or nitrogen-to-nitrogen bonds by reduction of nitro groups by reduction of nitro groups bound to carbon atoms of six-membered aromatic rings in presence of hydrogen-containing gases and a catalyst
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J23/00—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00
- B01J23/38—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00 of noble metals
- B01J23/54—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00 of noble metals combined with metals, oxides or hydroxides provided for in groups B01J23/02 - B01J23/36
- B01J23/56—Platinum group metals
- B01J23/64—Platinum group metals with arsenic, antimony, bismuth, vanadium, niobium, tantalum, polonium, chromium, molybdenum, tungsten, manganese, technetium or rhenium
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J23/00—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00
- B01J23/38—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00 of noble metals
- B01J23/54—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00 of noble metals combined with metals, oxides or hydroxides provided for in groups B01J23/02 - B01J23/36
- B01J23/56—Platinum group metals
- B01J23/64—Platinum group metals with arsenic, antimony, bismuth, vanadium, niobium, tantalum, polonium, chromium, molybdenum, tungsten, manganese, technetium or rhenium
- B01J23/648—Vanadium, niobium or tantalum or polonium
- B01J23/6482—Vanadium
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J37/00—Processes, in general, for preparing catalysts; Processes, in general, for activation of catalysts
- B01J37/02—Impregnation, coating or precipitation
- B01J37/0201—Impregnation
- B01J37/0205—Impregnation in several steps
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J2523/00—Constitutive chemical elements of heterogeneous catalysts
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J37/00—Processes, in general, for preparing catalysts; Processes, in general, for activation of catalysts
- B01J37/16—Reducing
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J37/00—Processes, in general, for preparing catalysts; Processes, in general, for activation of catalysts
- B01J37/16—Reducing
- B01J37/18—Reducing with gases containing free hydrogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782849002 DE2849002A1 (de) | 1978-11-11 | 1978-11-11 | Verfahren zur katalytischen hydrierung von nitrobenzol |
| AT79102930T ATE612T1 (de) | 1978-11-11 | 1979-08-13 | Verfahren zur katalytischen hydrierung von nitrobenzol. |
| DE7979102930T DE2961976D1 (en) | 1978-11-11 | 1979-08-13 | Process for the catalytic hydrogenation of nitrobenzene |
| EP79102930A EP0011090B1 (de) | 1978-11-11 | 1979-08-13 | Verfahren zur katalytischen Hydrierung von Nitrobenzol |
| US06/066,977 US4265834A (en) | 1978-11-11 | 1979-08-16 | Process for the catalytic hydrogenation of nitrobenzene |
| ES483534A ES483534A1 (es) | 1978-11-11 | 1979-08-21 | Procedimiento catalitico para la obtencion de anilina |
| CA000334269A CA1136651A (en) | 1978-11-11 | 1979-08-22 | Process for the catalytic hydrogenation of nitrobenzene |
| JP10613379A JPS5566545A (en) | 1978-11-11 | 1979-08-22 | Catalytic hydrogenation of nitrobenzene |
| BR7905432A BR7905432A (pt) | 1978-11-11 | 1979-08-23 | Processo para a hidrgenacao de nitrobenzeno |
| ZA00794454A ZA794454B (en) | 1978-11-11 | 1979-08-23 | Process for the catalytic hydrogenation of nitrobenzene |
| MX179045A MX151217A (es) | 1978-11-11 | 1979-08-23 | Composicion catalitica mejorada para la hidrogenacion de nitrobenceno |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782849002 DE2849002A1 (de) | 1978-11-11 | 1978-11-11 | Verfahren zur katalytischen hydrierung von nitrobenzol |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2849002A1 true DE2849002A1 (de) | 1980-05-22 |
Family
ID=6054430
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782849002 Withdrawn DE2849002A1 (de) | 1978-11-11 | 1978-11-11 | Verfahren zur katalytischen hydrierung von nitrobenzol |
| DE7979102930T Expired DE2961976D1 (en) | 1978-11-11 | 1979-08-13 | Process for the catalytic hydrogenation of nitrobenzene |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE7979102930T Expired DE2961976D1 (en) | 1978-11-11 | 1979-08-13 | Process for the catalytic hydrogenation of nitrobenzene |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4265834A (enExample) |
| EP (1) | EP0011090B1 (enExample) |
| JP (1) | JPS5566545A (enExample) |
| AT (1) | ATE612T1 (enExample) |
| BR (1) | BR7905432A (enExample) |
| CA (1) | CA1136651A (enExample) |
| DE (2) | DE2849002A1 (enExample) |
| ES (1) | ES483534A1 (enExample) |
| MX (1) | MX151217A (enExample) |
| ZA (1) | ZA794454B (enExample) |
Cited By (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0696574A1 (de) * | 1994-08-08 | 1996-02-14 | Bayer Ag | Verfahren zur Herstellung von aromatischen Aminen |
| EP0696573A1 (de) * | 1994-08-08 | 1996-02-14 | Bayer Ag | Verfahren zur Herstellung von aromatischen Aminen |
| WO1996036597A1 (en) * | 1995-05-19 | 1996-11-21 | Novartis Ag | Process for the catalytic hydrogenation of aromatic nitro compounds |
| EP0748790A3 (de) * | 1995-06-14 | 1998-04-08 | Bayer Ag | Verfahren und Katalysator zur Herstellung von aromatischen Aminen durch Gasphasenhydrierung |
| WO1998025881A3 (de) * | 1996-12-12 | 1998-07-30 | Bayer Ag | Verfahren zur herstellung von aromatischen aminen durch gasphasenhydrierung |
| WO1998046557A1 (de) * | 1997-04-16 | 1998-10-22 | Bayer Aktiengesellschaft | Herstellung von aromatischen aminen mittels neuer hydrierkatalysatoren |
| US5962741A (en) * | 1996-11-19 | 1999-10-05 | Novartis Ag | Process for the production of aromatic halogen-amino compounds |
| US6258982B1 (en) | 1996-09-23 | 2001-07-10 | Novartis Ag | Process for the preparation of substituted aromatic amino compounds |
| EP2246320A1 (de) | 2009-04-29 | 2010-11-03 | Bayer MaterialScience AG | Verfahren zur Herstellung von aromatischen Aminen |
| US8044244B2 (en) | 2006-09-19 | 2011-10-25 | Basf Se | Process for preparing aromatic amines in a fluidized-bed reactor |
| WO2012095356A1 (de) | 2011-01-11 | 2012-07-19 | Bayer Materialscience Ag | Verfahren zur herstellung aromatischer amine |
| DE102011081897A1 (de) | 2011-08-31 | 2013-02-28 | Bayer Materialscience Aktiengesellschaft | Katalysator und Verfahren zur Herstellung von aromatischen Aminen in der Gasphase |
| EP2653461A1 (de) | 2012-04-16 | 2013-10-23 | Bayer MaterialScience AG | Verfahren zum verbesserten Abfahren der Reaktion bei der Herstellung von aromatischen Aminen aus Nitroaromaten |
| WO2021037990A1 (de) | 2019-08-30 | 2021-03-04 | Covestro Deutschland Ag | Verfahren zur hydrierung von aromatischen nitroverbindungen |
| WO2022184614A1 (de) | 2021-03-01 | 2022-09-09 | Covestro Deutschland Ag | Verfahren zur hydrierung von aromatischen nitroverbindungen |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4469816A (en) * | 1982-12-14 | 1984-09-04 | Allied Corporation | Palladium on alumina aerogel catalyst composition and process for making same |
| US4929737A (en) * | 1988-02-03 | 1990-05-29 | Eastman Kodak Company | Hydrogenation of halonitroaromatic compounds |
| DE4039026A1 (de) * | 1990-12-07 | 1992-06-11 | Bayer Ag | Verfahren zur herstellung von anilin |
| FR2671347B1 (fr) * | 1991-01-07 | 1994-09-09 | Inst Francais Du Petrole | Reduction catalytique de composes nitroaromatiques substitues ou non en composes aminoaromatiques correspondants. |
| FR2682106B1 (fr) * | 1991-10-04 | 1993-11-26 | Rhone Poulenc Chimie | Procede d'hydrogenation en phase vapeur utilisables pour des derives aromatiques nitres. |
| DE59503894D1 (de) * | 1994-04-07 | 1998-11-19 | Bayer Ag | Verfahren zur Herstellung von Isocyanaten oder Isocyanatgemischen |
| DE59705933D1 (de) * | 1996-06-05 | 2002-02-07 | Basf Ag | Reduktive Kopplung von Nitrobenzol oder kernsubstituierten Nitrobenzolen zu den entsprechenden Azobenzolen und Azoxybenzolen mit Redoxkatalysatoren |
| US6179996B1 (en) | 1998-05-22 | 2001-01-30 | Membrane Technology And Research, Inc. | Selective purge for hydrogenation reactor recycle loop |
| DE10047435A1 (de) * | 2000-09-26 | 2002-04-11 | Degussa | Verfahren zur Herstellung von Oximen |
| DE10208254A1 (de) * | 2002-02-26 | 2003-09-04 | Bayer Ag | Katalysator |
| CN1301154C (zh) * | 2002-11-29 | 2007-02-21 | 东北师范大学 | 可再生的加氢催化剂及其制备方法 |
| DE10347439A1 (de) * | 2003-10-13 | 2005-05-04 | Bayer Materialscience Ag | Verfahren zur Herstellung von aromatischen Aminen durch heterogen katalysierte Hydrierung |
| DE10347438A1 (de) * | 2003-10-13 | 2005-05-04 | Bayer Materialscience Ag | Verfahren zur Herstellung von Di- und Polyaminen der Diphenylmethanreihe |
| DE102005006692A1 (de) * | 2005-02-15 | 2006-08-24 | Bayer Materialscience Ag | Verfahren zur Herstellung von Di-und Polyaminen der Diphenylmethanreihe |
| DE102006007619A1 (de) * | 2006-02-18 | 2007-08-23 | Bayer Materialscience Ag | Verfahren zur Herstellung von Anilin |
| DE102006011497A1 (de) * | 2006-03-14 | 2007-09-20 | Bayer Technology Services Gmbh | Verfahren und Vorrichtung zur Herstellung von aromatischen Aminen durch eine heterogen katalysierte Hydrierung |
| DE102006035203A1 (de) * | 2006-07-29 | 2008-01-31 | Bayer Materialscience Ag | Verfahren zur Herstellung von aromatischen Aminen |
| PL2155386T3 (pl) * | 2007-05-10 | 2012-07-31 | Basf Se | Sposób wytwarzania amin |
| EP2598241B1 (de) | 2010-07-30 | 2014-05-14 | Bayer Intellectual Property GmbH | Verfahren zur wiederherstellung von katalysatoraktivität |
| US9364810B2 (en) | 2010-11-18 | 2016-06-14 | Bayer Materialscience Ag | Chemical reactor with knitted wire mesh fabric as a holding device for particles |
| DE102011081898A1 (de) * | 2011-08-31 | 2013-02-28 | Bayer Materialscience Aktiengesellschaft | Verfahren zur kontinuierlichen Herstellung von Nitrobenzol |
| EP2653462A1 (de) | 2012-04-16 | 2013-10-23 | Bayer MaterialScience AG | Verfahren zum verbesserten Anfahren der Reaktion bei der Herstellung von aromatischen Aminen aus Nitroaromaten |
| EP3160630B1 (de) | 2014-06-24 | 2022-08-31 | Covestro Intellectual Property GmbH & Co. KG | Verfahren zur herstellung von chemischen produkten mit betriebsunterbrechungen |
| US10618871B2 (en) | 2016-08-17 | 2020-04-14 | Covestro Deutschland Ag | Process for producing isocyanate and at least one further chemical product in an integrated production |
| CN109562355A (zh) | 2016-08-18 | 2019-04-02 | 芝加哥大学 | 用于高效有机转化的金属氧化物负载的地球丰富的金属催化剂 |
| EP4549619A1 (en) | 2023-10-31 | 2025-05-07 | Basf Se | Preparation of amines by hydrogenation of nitro compounds using hydrogen with low deuterium content |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2823235A (en) * | 1955-05-10 | 1958-02-11 | Du Pont | Hydrogenation of nitro compounds to amines and catalyst therefor |
| US3265636A (en) * | 1963-03-26 | 1966-08-09 | Du Pont | Catalyst for the hydrogenation of nitro compounds |
| US3830847A (en) * | 1966-11-04 | 1974-08-20 | Grace W R & Co | Selective oxidation of olefins |
| US3472897A (en) * | 1966-12-22 | 1969-10-14 | Grace W R & Co | Reduction of nitrobenzene |
| US3666813A (en) * | 1969-08-27 | 1972-05-30 | Engelhard Min & Chem | Process for preparing aromatic haloamines from aromatic nitroamines |
| DE2100373C3 (de) * | 1971-01-15 | 1979-04-12 | Institut Chimitscheskich Nauk Akademii Nauk Kasachskoj Ssr | Katalysator zum Hydrieren von Nitroverbindungen |
| BE790275A (fr) * | 1971-11-19 | 1973-04-19 | Inst Francais Du Petrole | Catalyseur utilisable en particulier pour la deshydrogenation des hydrocarbures satures |
| US3804779A (en) * | 1972-10-02 | 1974-04-16 | Dart Ind Inc | Carbon supported palladium catalyst |
| US3995295A (en) * | 1975-08-28 | 1976-11-30 | Polaroid Corporation | Electro-mechanical shutter system having mechanical latch |
| US4137254A (en) * | 1977-07-27 | 1979-01-30 | Texaco, Inc. | Preparation of aromatic nitriles |
-
1978
- 1978-11-11 DE DE19782849002 patent/DE2849002A1/de not_active Withdrawn
-
1979
- 1979-08-13 DE DE7979102930T patent/DE2961976D1/de not_active Expired
- 1979-08-13 AT AT79102930T patent/ATE612T1/de not_active IP Right Cessation
- 1979-08-13 EP EP79102930A patent/EP0011090B1/de not_active Expired
- 1979-08-16 US US06/066,977 patent/US4265834A/en not_active Expired - Lifetime
- 1979-08-21 ES ES483534A patent/ES483534A1/es not_active Expired
- 1979-08-22 JP JP10613379A patent/JPS5566545A/ja active Granted
- 1979-08-22 CA CA000334269A patent/CA1136651A/en not_active Expired
- 1979-08-23 BR BR7905432A patent/BR7905432A/pt not_active IP Right Cessation
- 1979-08-23 ZA ZA00794454A patent/ZA794454B/xx unknown
- 1979-08-23 MX MX179045A patent/MX151217A/es unknown
Cited By (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0696573A1 (de) * | 1994-08-08 | 1996-02-14 | Bayer Ag | Verfahren zur Herstellung von aromatischen Aminen |
| EP0696574A1 (de) * | 1994-08-08 | 1996-02-14 | Bayer Ag | Verfahren zur Herstellung von aromatischen Aminen |
| US6096924A (en) * | 1995-05-19 | 2000-08-01 | Novartis Ag | Process for the catalytic hydrogeneration of aromatic nitro compounds |
| WO1996036597A1 (en) * | 1995-05-19 | 1996-11-21 | Novartis Ag | Process for the catalytic hydrogenation of aromatic nitro compounds |
| EP0748790A3 (de) * | 1995-06-14 | 1998-04-08 | Bayer Ag | Verfahren und Katalysator zur Herstellung von aromatischen Aminen durch Gasphasenhydrierung |
| US6258982B1 (en) | 1996-09-23 | 2001-07-10 | Novartis Ag | Process for the preparation of substituted aromatic amino compounds |
| US6197716B1 (en) | 1996-11-19 | 2001-03-06 | Novartis Ag | Process for the production of aromatic halogen-amino compounds |
| US5962741A (en) * | 1996-11-19 | 1999-10-05 | Novartis Ag | Process for the production of aromatic halogen-amino compounds |
| CN1128784C (zh) * | 1996-12-12 | 2003-11-26 | 拜尔公司 | 气相氢化法生产芳香胺类的方法 |
| WO1998025881A3 (de) * | 1996-12-12 | 1998-07-30 | Bayer Ag | Verfahren zur herstellung von aromatischen aminen durch gasphasenhydrierung |
| DE19715746A1 (de) * | 1997-04-16 | 1998-10-22 | Bayer Ag | Herstellung von aromatischen Aminen mittels neuer Hydrierkatalysatoren |
| WO1998046557A1 (de) * | 1997-04-16 | 1998-10-22 | Bayer Aktiengesellschaft | Herstellung von aromatischen aminen mittels neuer hydrierkatalysatoren |
| US8044244B2 (en) | 2006-09-19 | 2011-10-25 | Basf Se | Process for preparing aromatic amines in a fluidized-bed reactor |
| EP2246320A1 (de) | 2009-04-29 | 2010-11-03 | Bayer MaterialScience AG | Verfahren zur Herstellung von aromatischen Aminen |
| DE102009019436A1 (de) | 2009-04-29 | 2010-11-04 | Bayer Materialscience Ag | Verfahren zur Herstellung von aromatischen Aminen |
| WO2012095356A1 (de) | 2011-01-11 | 2012-07-19 | Bayer Materialscience Ag | Verfahren zur herstellung aromatischer amine |
| CN103313963A (zh) * | 2011-01-11 | 2013-09-18 | 拜耳知识产权有限责任公司 | 制备芳族胺的方法 |
| US9139510B2 (en) | 2011-01-11 | 2015-09-22 | Bayer Intellectual Property Gmbh | Process for preparing aromatic amines |
| CN103313963B (zh) * | 2011-01-11 | 2015-11-25 | 拜耳知识产权有限责任公司 | 制备芳族胺的方法 |
| DE102011081897A1 (de) | 2011-08-31 | 2013-02-28 | Bayer Materialscience Aktiengesellschaft | Katalysator und Verfahren zur Herstellung von aromatischen Aminen in der Gasphase |
| WO2013030221A1 (de) | 2011-08-31 | 2013-03-07 | Bayer Intellectual Property Gmbh | Katalysator und verfahren zur herstellung von aromatischen aminen in der gasphase |
| CN103781547A (zh) * | 2011-08-31 | 2014-05-07 | 拜耳知识产权有限责任公司 | 用于在气相中制备芳香胺的催化剂和方法 |
| EP2653461A1 (de) | 2012-04-16 | 2013-10-23 | Bayer MaterialScience AG | Verfahren zum verbesserten Abfahren der Reaktion bei der Herstellung von aromatischen Aminen aus Nitroaromaten |
| WO2013156409A1 (de) | 2012-04-16 | 2013-10-24 | Bayer Materialscience Ag | Verfahren zum verbesserten abfahren der reaktion bei der herstellung von aromatischen aminen aus nitroaromaten |
| WO2021037990A1 (de) | 2019-08-30 | 2021-03-04 | Covestro Deutschland Ag | Verfahren zur hydrierung von aromatischen nitroverbindungen |
| WO2022184614A1 (de) | 2021-03-01 | 2022-09-09 | Covestro Deutschland Ag | Verfahren zur hydrierung von aromatischen nitroverbindungen |
Also Published As
| Publication number | Publication date |
|---|---|
| ZA794454B (en) | 1980-09-24 |
| US4265834A (en) | 1981-05-05 |
| BR7905432A (pt) | 1980-05-20 |
| DE2961976D1 (en) | 1982-03-11 |
| MX151217A (es) | 1984-10-11 |
| ATE612T1 (de) | 1982-02-15 |
| JPS5566545A (en) | 1980-05-20 |
| CA1136651A (en) | 1982-11-30 |
| EP0011090B1 (de) | 1982-01-27 |
| ES483534A1 (es) | 1980-05-16 |
| JPH0234938B2 (enExample) | 1990-08-07 |
| EP0011090A1 (de) | 1980-05-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2849002A1 (de) | Verfahren zur katalytischen hydrierung von nitrobenzol | |
| DE68907164T2 (de) | Verfahren zur Herstellung von Allylacetat. | |
| EP0915821B1 (de) | Verfahren zur selektiven herstellung von essigsäure und dafür geeignete katalysatoren | |
| EP1189694A1 (de) | Katalysatoren für die gasphasenoxidation von ethylen und essigsäure zu vinylacetat, verfahren zu ihrer herstellung und ihre verwendung | |
| EP1399255A2 (de) | Ruthenium-katalysatoren auf einem träger auf sio2-basis für die katalytische hydrierung von sacchariden | |
| EP0764463A2 (de) | Palladium-haltiger Trägerkatalysator zur selektiven katalytischen Hydrierung von Acetylen in Kohlenwasserstoffströmen | |
| DE3632255A1 (de) | Verfahren zur herstellung von furan durch decarbonylierung von furfural | |
| DE19745902A1 (de) | Verfahren zur selektiven Herstellung von Essigsäure durch katalytische Oxidation von Ethan | |
| DE3801755A1 (de) | Ruthenium-traegerkatalysator, seine herstellung und sein einsatz bei der herstellung von gegebenenfalls substituiertem cyclohexylamin und gegebenenfalls substituiertem dicyclohexylamin | |
| EP1042066B1 (de) | Verfahren zur herstellung oxidischer katalysatoren, die kupfer in einer oxidationsstufe grösser als 0 enthalten | |
| DE2536273C2 (de) | Katalysator zur Hydrierung von Acetylenalkoholen | |
| DE10024437A1 (de) | Verfahren zur selektiven Herstellung von Essigsäure durch katalytische Oxidation von Ethan | |
| DE3538129A1 (de) | Traegerkatalysatoren und hydrierverfahren unter verwendung dieser traegerkatalysatoren | |
| DE10061555A1 (de) | Schalenkatalysator für die Hydrierung von Maleinsäureanhydrid und verwandten Verbindungen zu gamma-Butyrolacton und Tetrahydrofuran und Derivaten davon | |
| EP1383601A2 (de) | Verfahren zur hydrierung von carbonylverbindungen | |
| DE69503761T2 (de) | Verfahren zur herstellung von gamma-butyrolacton | |
| DE10061553A1 (de) | Poröser Katalysator für die Hydrierung von Maleinsäureanhydrid zu Tetrahydrofuran | |
| EP0482445B1 (de) | Verfahren zur Hydrierung von Acetylenalkoholen | |
| EP1406887B1 (de) | Verfahren zur selektiven herstellung von tetrahydrofuran durch hydrierung von maleinsäureanhydrid | |
| DE3940125A1 (de) | Verfahren zur herstellung von vinylacetat | |
| DE2602894C2 (de) | Hydrierungskatalysator | |
| DE3717111C2 (de) | Kupferoxid, Zinkoxid und Aluminiumoxid enthaltender Katalysator zur Tieftemperaturkonvertierung | |
| DE3913839A1 (de) | Verfahren zur hydrierung von acetylenalkoholen | |
| DE19860489A1 (de) | Verfahren zur Hydrierung von Aldehyden | |
| DE68913694T2 (de) | Verfahren zur Herstellung von Glykolaldehyd. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |