DE2830999A1 - Verfahren zur herstellung von stereoisomeren n-aralkyl-2,6-dimethylmorpholinen - Google Patents
Verfahren zur herstellung von stereoisomeren n-aralkyl-2,6-dimethylmorpholinenInfo
- Publication number
- DE2830999A1 DE2830999A1 DE19782830999 DE2830999A DE2830999A1 DE 2830999 A1 DE2830999 A1 DE 2830999A1 DE 19782830999 DE19782830999 DE 19782830999 DE 2830999 A DE2830999 A DE 2830999A DE 2830999 A1 DE2830999 A1 DE 2830999A1
- Authority
- DE
- Germany
- Prior art keywords
- compounds
- carbon atoms
- hydrogen
- formula
- dimethylmorpholine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000004519 manufacturing process Methods 0.000 title description 2
- 239000003054 catalyst Substances 0.000 claims abstract description 21
- 239000000203 mixture Substances 0.000 claims abstract description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 13
- 239000001257 hydrogen Substances 0.000 claims abstract description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 12
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims abstract description 12
- 238000006243 chemical reaction Methods 0.000 claims abstract description 12
- 150000001875 compounds Chemical class 0.000 claims abstract description 11
- 238000000034 method Methods 0.000 claims abstract description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 9
- 238000005984 hydrogenation reaction Methods 0.000 claims abstract description 9
- 229910052763 palladium Inorganic materials 0.000 claims abstract description 7
- 229910052709 silver Inorganic materials 0.000 claims abstract description 6
- 239000004332 silver Substances 0.000 claims abstract description 6
- 238000002360 preparation method Methods 0.000 claims abstract description 5
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 abstract 1
- 150000001412 amines Chemical class 0.000 description 8
- -1 butyl- Chemical group 0.000 description 7
- 239000007795 chemical reaction product Substances 0.000 description 7
- HNVIQLPOGUDBSU-OLQVQODUSA-N (2s,6r)-2,6-dimethylmorpholine Chemical compound C[C@H]1CNC[C@@H](C)O1 HNVIQLPOGUDBSU-OLQVQODUSA-N 0.000 description 5
- 125000001931 aliphatic group Chemical group 0.000 description 5
- 150000001728 carbonyl compounds Chemical class 0.000 description 5
- 238000004821 distillation Methods 0.000 description 5
- 238000005932 reductive alkylation reaction Methods 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- HNVIQLPOGUDBSU-PHDIDXHHSA-N (2r,6r)-2,6-dimethylmorpholine Chemical compound C[C@@H]1CNC[C@@H](C)O1 HNVIQLPOGUDBSU-PHDIDXHHSA-N 0.000 description 3
- RMSGQZDGSZOJMU-UHFFFAOYSA-N 1-butyl-2-phenylbenzene Chemical group CCCCC1=CC=CC=C1C1=CC=CC=C1 RMSGQZDGSZOJMU-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000006317 isomerization reaction Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- HNVIQLPOGUDBSU-UHFFFAOYSA-N 2,6-dimethylmorpholine Chemical class CC1CNCC(C)O1 HNVIQLPOGUDBSU-UHFFFAOYSA-N 0.000 description 2
- MYHGOWDLVRDUFA-UHFFFAOYSA-N 3-phenylbutanal Chemical compound O=CCC(C)C1=CC=CC=C1 MYHGOWDLVRDUFA-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 150000004982 aromatic amines Chemical class 0.000 description 2
- AKGGYBADQZYZPD-UHFFFAOYSA-N benzylacetone Chemical compound CC(=O)CCC1=CC=CC=C1 AKGGYBADQZYZPD-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- AMIMRNSIRUDHCM-UHFFFAOYSA-N isobutyric aldehyde Natural products CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 2
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical compound CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 2
- 239000011572 manganese Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- SWELZOZIOHGSPA-UHFFFAOYSA-N palladium silver Chemical compound [Pd].[Ag] SWELZOZIOHGSPA-UHFFFAOYSA-N 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- GDYFTBPYBQUEOT-UHFFFAOYSA-N 2-benzyl-3-methylbutanal Chemical compound CC(C)C(C=O)CC1=CC=CC=C1 GDYFTBPYBQUEOT-UHFFFAOYSA-N 0.000 description 1
- ROPNSYBZOVTZBB-UHFFFAOYSA-N 2-benzylbutanal Chemical compound CCC(C=O)CC1=CC=CC=C1 ROPNSYBZOVTZBB-UHFFFAOYSA-N 0.000 description 1
- HEPHYCJJLAUKSB-UHFFFAOYSA-N 2-methyl-3-phenylpropanal Chemical compound O=CC(C)CC1=CC=CC=C1 HEPHYCJJLAUKSB-UHFFFAOYSA-N 0.000 description 1
- VLFBSPUPYFTTNF-UHFFFAOYSA-N 3-(4-methoxyphenyl)-2-methylpropanal Chemical compound COC1=CC=C(CC(C)C=O)C=C1 VLFBSPUPYFTTNF-UHFFFAOYSA-N 0.000 description 1
- HQQPOVNESMNPNH-UHFFFAOYSA-N 3-(4-propan-2-ylphenyl)butanal Chemical compound CC(C)C1=CC=C(C(C)CC=O)C=C1 HQQPOVNESMNPNH-UHFFFAOYSA-N 0.000 description 1
- QWNKGUFEJXENIX-UHFFFAOYSA-N 4-(4-tert-butylphenyl)butan-2-one Chemical compound CC(=O)CCC1=CC=C(C(C)(C)C)C=C1 QWNKGUFEJXENIX-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- XHCLAFWTIXFWPH-UHFFFAOYSA-N [O-2].[O-2].[O-2].[O-2].[O-2].[V+5].[V+5] Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[V+5].[V+5] XHCLAFWTIXFWPH-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 238000005882 aldol condensation reaction Methods 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000007037 hydroformylation reaction Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- AMWRITDGCCNYAT-UHFFFAOYSA-L manganese oxide Inorganic materials [Mn].O[Mn]=O.O[Mn]=O AMWRITDGCCNYAT-UHFFFAOYSA-L 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- GHDIHPNJQVDFBL-UHFFFAOYSA-N methoxycyclohexane Chemical compound COC1CCCCC1 GHDIHPNJQVDFBL-UHFFFAOYSA-N 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- NBBJYMSMWIIQGU-UHFFFAOYSA-N propionic aldehyde Natural products CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 125000003011 styrenyl group Chemical class [H]\C(*)=C(/[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 229910001935 vanadium oxide Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/02—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements
- C07D295/027—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements containing only one hetero ring
- C07D295/03—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements containing only one hetero ring with the ring nitrogen atoms directly attached to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/096—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782830999 DE2830999A1 (de) | 1978-07-14 | 1978-07-14 | Verfahren zur herstellung von stereoisomeren n-aralkyl-2,6-dimethylmorpholinen |
| IL57336A IL57336A (en) | 1978-07-14 | 1979-05-18 | Preparation of stereoisomeric n-aralkyl-2,6-dimethyl-morpholines |
| CA328,740A CA1122981A (en) | 1978-07-14 | 1979-05-30 | Preparation of stereoisomeric n-aralkyl-2,6-dimethyl-morpholine |
| JP7978079A JPS5515463A (en) | 1978-07-14 | 1979-06-26 | Manufacture of stereoisomeric nnaralkyll 2*66dimethylmorpholine |
| EP79102377A EP0007093B1 (de) | 1978-07-14 | 1979-07-11 | Verfahren zur Herstellung von stereoisomeren N-Aralkyl-2,6-dimethylmorpholinen |
| DE7979102377T DE2960376D1 (en) | 1978-07-14 | 1979-07-11 | Process for preparing stereoisomeric n-aralkyl-2,6-dimethylmorpholines |
| AT79102377T ATE69T1 (de) | 1978-07-14 | 1979-07-11 | Verfahren zur herstellung von stereoisomeren n-aralkyl-2,6-dimethylmorpholinen. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782830999 DE2830999A1 (de) | 1978-07-14 | 1978-07-14 | Verfahren zur herstellung von stereoisomeren n-aralkyl-2,6-dimethylmorpholinen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2830999A1 true DE2830999A1 (de) | 1980-01-31 |
Family
ID=6044396
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782830999 Withdrawn DE2830999A1 (de) | 1978-07-14 | 1978-07-14 | Verfahren zur herstellung von stereoisomeren n-aralkyl-2,6-dimethylmorpholinen |
| DE7979102377T Expired DE2960376D1 (en) | 1978-07-14 | 1979-07-11 | Process for preparing stereoisomeric n-aralkyl-2,6-dimethylmorpholines |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE7979102377T Expired DE2960376D1 (en) | 1978-07-14 | 1979-07-11 | Process for preparing stereoisomeric n-aralkyl-2,6-dimethylmorpholines |
Country Status (6)
| Country | Link |
|---|---|
| EP (1) | EP0007093B1 (cg-RX-API-DMAC10.html) |
| JP (1) | JPS5515463A (cg-RX-API-DMAC10.html) |
| AT (1) | ATE69T1 (cg-RX-API-DMAC10.html) |
| CA (1) | CA1122981A (cg-RX-API-DMAC10.html) |
| DE (2) | DE2830999A1 (cg-RX-API-DMAC10.html) |
| IL (1) | IL57336A (cg-RX-API-DMAC10.html) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4283534A (en) | 1979-04-11 | 1981-08-11 | Basf Aktiengesellschaft | Reductive alkylation of nitrogen heterocycles |
| US7105662B2 (en) * | 2001-03-16 | 2006-09-12 | Basf Akteingesellschaft | Method of producing N-substituted 2,6-dialkylmorpholines |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1220970B (it) * | 1979-08-17 | 1990-06-21 | Hoffmann La Roche | Composti eteterociclici ad azione fungicida particolare per la lotta contro la candida albicans |
| DE3105446A1 (de) * | 1981-02-14 | 1982-09-02 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von araliphatischen aldehyden und/oder aminen |
| EP0140359B1 (en) * | 1983-11-02 | 1989-01-25 | Beecham Group Plc | Morpholine derivatives |
| DE3421810A1 (de) * | 1984-06-12 | 1985-12-12 | Basf Ag, 6700 Ludwigshafen | Phenylalkylamine - bioregulatoren |
| GB8621790D0 (en) * | 1986-09-10 | 1986-10-15 | Ici Plc | Tertiary amine compounds |
| IL89997A0 (en) * | 1988-04-25 | 1989-12-15 | Lilly Co Eli | Propanamine derivatives |
| DE4009411A1 (de) * | 1990-03-23 | 1991-09-26 | Basf Ag | N-(3-phenyl-2-methylpropyl und -methylprop-2-enyl)-azaheterocyclen |
| DE102005049568A1 (de) | 2005-10-17 | 2007-04-19 | Basf Ag | Verfahren zur kontinuierlichen Hydrierung oder hydrierenden Aminierung |
| EP1999099B1 (de) | 2006-03-21 | 2012-02-15 | Basf Se | Verfahren zur herstellung eines amins |
| EP2029521B1 (de) | 2006-05-31 | 2012-07-11 | Basf Se | Verfahren zur herstellung eines amins |
| JP1615876S (cg-RX-API-DMAC10.html) * | 2017-09-28 | 2018-10-15 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE790119A (fr) * | 1971-04-15 | 1973-04-13 | Basf Ag | Procede de preparation d'amines aliphatiques et cycloaliphatiques secondaires ou tertiaires. |
| AT354187B (de) * | 1976-11-22 | 1979-12-27 | Hoffmann La Roche | Fungizides mittel |
| DE2656747C2 (de) * | 1976-12-15 | 1984-07-05 | Basf Ag, 6700 Ludwigshafen | Morpholinderivate |
| DE2700680A1 (de) * | 1977-01-08 | 1978-07-20 | Basf Ag | Verfahren zur herstellung von n-substituierten morpholiniumsalzen |
-
1978
- 1978-07-14 DE DE19782830999 patent/DE2830999A1/de not_active Withdrawn
-
1979
- 1979-05-18 IL IL57336A patent/IL57336A/xx unknown
- 1979-05-30 CA CA328,740A patent/CA1122981A/en not_active Expired
- 1979-06-26 JP JP7978079A patent/JPS5515463A/ja active Granted
- 1979-07-11 DE DE7979102377T patent/DE2960376D1/de not_active Expired
- 1979-07-11 EP EP79102377A patent/EP0007093B1/de not_active Expired
- 1979-07-11 AT AT79102377T patent/ATE69T1/de not_active IP Right Cessation
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4283534A (en) | 1979-04-11 | 1981-08-11 | Basf Aktiengesellschaft | Reductive alkylation of nitrogen heterocycles |
| US7105662B2 (en) * | 2001-03-16 | 2006-09-12 | Basf Akteingesellschaft | Method of producing N-substituted 2,6-dialkylmorpholines |
Also Published As
| Publication number | Publication date |
|---|---|
| ATE69T1 (de) | 1981-06-15 |
| EP0007093B1 (de) | 1981-05-20 |
| JPH0321547B2 (cg-RX-API-DMAC10.html) | 1991-03-22 |
| IL57336A (en) | 1983-05-15 |
| EP0007093A1 (de) | 1980-01-23 |
| JPS5515463A (en) | 1980-02-02 |
| IL57336A0 (en) | 1979-09-30 |
| DE2960376D1 (en) | 1981-08-27 |
| CA1122981A (en) | 1982-05-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2830999A1 (de) | Verfahren zur herstellung von stereoisomeren n-aralkyl-2,6-dimethylmorpholinen | |
| DE69415572T2 (de) | Verfahren zur Herstellung von Etheralkoholen durch Hydrogenolyse von zyklischem Ketal | |
| EP0263259B1 (de) | Verfahren und Katalysatorsystem zur Trimerisierung von Acetylen und Acetylenverbindungen | |
| DE2538364B2 (de) | Verfahren zur herstellung von butandiolen | |
| CH628315A5 (de) | Verfahren zur herstellung von arylsubstituierten alkoholen. | |
| EP0915839B1 (de) | Verfahren zur herstellung von 6-aminocapronitril | |
| DE3150234A1 (de) | Verfahren zur herstellung von ueberwiegend das z-isomere enthaltendem rosenoxid | |
| EP0007520B1 (de) | Verfahren zur Herstellung von cis-2,6-dimethylmorpholin | |
| EP0014963A2 (de) | Verfahren zur Herstellung von bicyclischen Enoläthern sowie Äther von 2-(3-Hydroxyprop-1-yl)-cycloalkanonen | |
| EP0026367B1 (de) | Verfahren zur Herstellung von cis-2,6-Dimethylmorpholin | |
| DE1237567B (de) | Verfahren zur Herstellung von delta 5-6-Methylsteroiden | |
| EP0017893B1 (de) | Verfahren zur Herstellung von heterocyclischen tertiären Aralkylaminen | |
| EP0100019B1 (de) | Verfahren zur Herstellung von alpha-substituierten beta-Dicarbonyl-, beta-Cyancarbonyl- und beta-Dicyanverbindungen | |
| DE1953996C3 (de) | Verfahren zur Herstellung von Dialkenyltetrahydropyranen | |
| DE3020298C2 (de) | Verfahren zur Herstellung von 2,2,4,5,5-Pentamethyl-3-formyl-3-pyrrolin | |
| DE60117846T2 (de) | Herstellung von 6-aminocaprinsäurealkylestern | |
| EP0071079B1 (de) | Verfahren zur Herstellung von 2-Trimethylsilyloxy-ethylaminen | |
| EP0027209B1 (de) | N,N-Dimethyl-N'-isobutyl-N'-Beta-hydroxyethyl-1,3-propylendiamin und Verfahren zu seiner Herstellung | |
| DE3544510A1 (de) | Verfahren zur herstellung aliphatischer tertiaerer amine | |
| DE2327510B2 (de) | Verfahren zur Herstellung von Dimethylalkylaminen aus Aldehyd-Ammoniak-Verbindungen | |
| WO1993013047A1 (de) | Verfahren zur herstellung von dibenzylamin | |
| DE4210311A1 (de) | Verfahren zur Herstellung von Aminen aus Azinen | |
| EP0010179A1 (de) | Verfahren zur Herstellung von 2.2-Dialkyl-pentan-1.5-diaminen und die Verbindungen N-(4-Cyano-2.2-diethyl-butyl)-4-cyano-2.2-diethyl-butyliden-imin und N-(4-Cyano-2-n-butyl-2-ethyl-butyl)-4-cyano-2-n-butyl-2-ethyl-butyliden-imin | |
| DE2524797C3 (de) | Verfahren zur Herstellung von tertiären Aminen | |
| EP0137418A1 (de) | Verfahren zur Herstellung von partiell hydrierten Derivaten von 2-Nitro-1,1,1-trifluoralkanen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8141 | Disposal/no request for examination |