DE2756516A1 - Wasch- und reinigungsmittel - Google Patents
Wasch- und reinigungsmittelInfo
- Publication number
- DE2756516A1 DE2756516A1 DE19772756516 DE2756516A DE2756516A1 DE 2756516 A1 DE2756516 A1 DE 2756516A1 DE 19772756516 DE19772756516 DE 19772756516 DE 2756516 A DE2756516 A DE 2756516A DE 2756516 A1 DE2756516 A1 DE 2756516A1
- Authority
- DE
- Germany
- Prior art keywords
- contain
- washing
- acid
- detergents
- means according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 239000003599 detergent Substances 0.000 title claims description 25
- 238000005406 washing Methods 0.000 claims description 33
- 239000012459 cleaning agent Substances 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 12
- 239000004094 surface-active agent Substances 0.000 claims description 11
- 239000003513 alkali Substances 0.000 claims description 7
- 239000003760 tallow Substances 0.000 claims description 6
- 239000000654 additive Substances 0.000 claims description 4
- 150000002191 fatty alcohols Chemical class 0.000 claims description 4
- 239000001226 triphosphate Substances 0.000 claims description 4
- 229920002134 Carboxymethyl cellulose Polymers 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 125000000129 anionic group Chemical group 0.000 claims description 3
- 239000001768 carboxy methyl cellulose Substances 0.000 claims description 3
- 239000008112 carboxymethyl-cellulose Substances 0.000 claims description 3
- 235000011178 triphosphate Nutrition 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 claims description 2
- 235000010948 carboxy methyl cellulose Nutrition 0.000 claims description 2
- 125000002091 cationic group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 230000000996 additive effect Effects 0.000 claims 1
- 125000006294 amino alkylene group Chemical group 0.000 claims 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical group [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims 1
- UNXRWKVEANCORM-UHFFFAOYSA-N triphosphoric acid Chemical compound OP(O)(=O)OP(O)(=O)OP(O)(O)=O UNXRWKVEANCORM-UHFFFAOYSA-N 0.000 claims 1
- -1 alkali carbonates Chemical class 0.000 description 14
- 239000000126 substance Substances 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 7
- 150000007513 acids Chemical class 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 238000000034 method Methods 0.000 description 7
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 150000001447 alkali salts Chemical class 0.000 description 5
- 239000004744 fabric Substances 0.000 description 5
- 229910019142 PO4 Inorganic materials 0.000 description 4
- UBWXUGDQUBIEIZ-QNTYDACNSA-N nandrolone phenpropionate Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@H]4CCC(=O)C=C4CC3)CC[C@@]21C)C(=O)CCC1=CC=CC=C1 UBWXUGDQUBIEIZ-QNTYDACNSA-N 0.000 description 4
- 239000000344 soap Substances 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 229920000388 Polyphosphate Polymers 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000004140 cleaning Methods 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- FSBVERYRVPGNGG-UHFFFAOYSA-N dimagnesium dioxido-bis[[oxido(oxo)silyl]oxy]silane hydrate Chemical compound O.[Mg+2].[Mg+2].[O-][Si](=O)O[Si]([O-])([O-])O[Si]([O-])=O FSBVERYRVPGNGG-UHFFFAOYSA-N 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 239000000391 magnesium silicate Substances 0.000 description 3
- 229910052919 magnesium silicate Inorganic materials 0.000 description 3
- 235000019792 magnesium silicate Nutrition 0.000 description 3
- 239000002736 nonionic surfactant Substances 0.000 description 3
- 235000021317 phosphate Nutrition 0.000 description 3
- 239000001205 polyphosphate Substances 0.000 description 3
- 235000011176 polyphosphates Nutrition 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 235000019832 sodium triphosphate Nutrition 0.000 description 3
- RZTGKNWFRVUWMJ-UHFFFAOYSA-N 3-phosphonopentane-1,3,5-tricarboxylic acid Chemical compound OC(=O)CCC(P(O)(O)=O)(C(O)=O)CCC(O)=O RZTGKNWFRVUWMJ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- 101100399296 Mus musculus Lime1 gene Proteins 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- 239000004115 Sodium Silicate Substances 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 235000011941 Tilia x europaea Nutrition 0.000 description 2
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Natural products CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 2
- FRCICXIVPRNPLM-UHFFFAOYSA-N [amino(phosphono)methyl]phosphonic acid Chemical compound OP(=O)(O)C(N)P(O)(O)=O FRCICXIVPRNPLM-UHFFFAOYSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 239000003945 anionic surfactant Substances 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 2
- 229940071161 dodecylbenzenesulfonate Drugs 0.000 description 2
- 238000012851 eutrophication Methods 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000004571 lime Substances 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 239000012418 sodium perborate tetrahydrate Substances 0.000 description 2
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 2
- 229910052911 sodium silicate Inorganic materials 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- IBDSNZLUHYKHQP-UHFFFAOYSA-N sodium;3-oxidodioxaborirane;tetrahydrate Chemical compound O.O.O.O.[Na+].[O-]B1OO1 IBDSNZLUHYKHQP-UHFFFAOYSA-N 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 239000003643 water by type Substances 0.000 description 2
- GPCTYPSWRBUGFH-UHFFFAOYSA-N (1-amino-1-phosphonoethyl)phosphonic acid Chemical compound OP(=O)(O)C(N)(C)P(O)(O)=O GPCTYPSWRBUGFH-UHFFFAOYSA-N 0.000 description 1
- LIFHMKCDDVTICL-UHFFFAOYSA-N 6-(chloromethyl)phenanthridine Chemical compound C1=CC=C2C(CCl)=NC3=CC=CC=C3C2=C1 LIFHMKCDDVTICL-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 241000195493 Cryptophyta Species 0.000 description 1
- QEVGZEDELICMKH-UHFFFAOYSA-N Diglycolic acid Chemical compound OC(=O)COCC(O)=O QEVGZEDELICMKH-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical class OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 description 1
- 101001096355 Homo sapiens Replication factor C subunit 3 Proteins 0.000 description 1
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 description 1
- 101100400378 Mus musculus Marveld2 gene Proteins 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 235000019484 Rapeseed oil Nutrition 0.000 description 1
- 102100037855 Replication factor C subunit 3 Human genes 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- ZUBJEHHGZYTRPH-KTKRTIGZSA-N [(z)-octadec-9-enyl] hydrogen sulfate Chemical compound CCCCCCCC\C=C/CCCCCCCCOS(O)(=O)=O ZUBJEHHGZYTRPH-KTKRTIGZSA-N 0.000 description 1
- NYRAVIYBIHCEGB-UHFFFAOYSA-N [K].[Ca] Chemical compound [K].[Ca] NYRAVIYBIHCEGB-UHFFFAOYSA-N 0.000 description 1
- BFDMEODWJJUORJ-UHFFFAOYSA-N [dimethylamino(phosphono)methyl]phosphonic acid Chemical compound CN(C)C(P(O)(O)=O)P(O)(O)=O BFDMEODWJJUORJ-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical class OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Chemical class 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- 230000009918 complex formation Effects 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- VFNGKCDDZUSWLR-UHFFFAOYSA-N disulfuric acid Chemical compound OS(=O)(=O)OS(O)(=O)=O VFNGKCDDZUSWLR-UHFFFAOYSA-N 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 229940043264 dodecyl sulfate Drugs 0.000 description 1
- 239000003651 drinking water Substances 0.000 description 1
- 235000020188 drinking water Nutrition 0.000 description 1
- 229960004585 etidronic acid Drugs 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- LPTIRUACFKQDHZ-UHFFFAOYSA-N hexadecyl sulfate;hydron Chemical compound CCCCCCCCCCCCCCCCOS(O)(=O)=O LPTIRUACFKQDHZ-UHFFFAOYSA-N 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- NBZBKCUXIYYUSX-UHFFFAOYSA-N iminodiacetic acid Chemical class OC(=O)CNCC(O)=O NBZBKCUXIYYUSX-UHFFFAOYSA-N 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000002563 ionic surfactant Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910001425 magnesium ion Inorganic materials 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- MBKDYNNUVRNNRF-UHFFFAOYSA-N medronic acid Chemical class OP(O)(=O)CP(O)(O)=O MBKDYNNUVRNNRF-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- YLGXILFCIXHCMC-JHGZEJCSSA-N methyl cellulose Chemical compound COC1C(OC)C(OC)C(COC)O[C@H]1O[C@H]1C(OC)C(OC)C(OC)OC1COC YLGXILFCIXHCMC-JHGZEJCSSA-N 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical class OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- HWGNBUXHKFFFIH-UHFFFAOYSA-I pentasodium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O HWGNBUXHKFFFIH-UHFFFAOYSA-I 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920001444 polymaleic acid Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- KCXFHTAICRTXLI-UHFFFAOYSA-M propane-1-sulfonate Chemical compound CCCS([O-])(=O)=O KCXFHTAICRTXLI-UHFFFAOYSA-M 0.000 description 1
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000011347 resin Chemical class 0.000 description 1
- 229920005989 resin Chemical class 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 230000009919 sequestration Effects 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical class O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- IWMMSZLFZZPTJY-UHFFFAOYSA-M sodium;3-(dodecylamino)propane-1-sulfonate Chemical compound [Na+].CCCCCCCCCCCCNCCCS([O-])(=O)=O IWMMSZLFZZPTJY-UHFFFAOYSA-M 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000005728 strengthening Methods 0.000 description 1
- 239000002352 surface water Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 150000004685 tetrahydrates Chemical class 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 125000002264 triphosphate group Chemical class [H]OP(=O)(O[H])OP(=O)(O[H])OP(=O)(O[H])O* 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 239000002888 zwitterionic surfactant Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/36—Organic compounds containing phosphorus
- C11D3/365—Organic compounds containing phosphorus containing carboxyl groups
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (16)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19772756516 DE2756516A1 (de) | 1977-12-19 | 1977-12-19 | Wasch- und reinigungsmittel |
| GB7847278A GB2010310B (en) | 1977-12-19 | 1978-12-05 | Detergent and cleansing compositions |
| CA000318139A CA1121246A (en) | 1977-12-19 | 1978-12-07 | Detergent and cleansing compositions |
| CH1272378A CH640564A5 (de) | 1977-12-19 | 1978-12-14 | Wasch- und reinigungsmittel. |
| FI783854A FI62556C (fi) | 1977-12-19 | 1978-12-15 | Builderaemnehaltiga tvaett- och rengoeringsmedel |
| NL7812220A NL7812220A (nl) | 1977-12-19 | 1978-12-15 | Was- en reinigingsmiddelen. |
| JP15429378A JPS5490309A (en) | 1977-12-19 | 1978-12-15 | Cleaning agent and detergent |
| IT52312/78A IT1106828B (it) | 1977-12-19 | 1978-12-15 | Composizione di lavaggio e pulitura |
| LU80664A LU80664A1 (de) | 1977-12-19 | 1978-12-15 | Wasch-und reinigungsmittel |
| AT0903278A AT375672B (de) | 1977-12-19 | 1978-12-18 | Wasch- und reinigungsmittel |
| NO784265A NO784265L (no) | 1977-12-19 | 1978-12-18 | Vaske- og rensemiddel. |
| DK567278A DK567278A (da) | 1977-12-19 | 1978-12-18 | Vaske og rensemiddel |
| BE192391A BE872852A (fr) | 1977-12-19 | 1978-12-18 | Produits de lavage et de nettoyage |
| SE7813004A SE7813004L (sv) | 1977-12-19 | 1978-12-18 | Tvett- och rengoringsmedel |
| FR7835708A FR2411886A1 (fr) | 1977-12-19 | 1978-12-19 | Produits de lavage et de nettoyage |
| US06/130,156 US4265776A (en) | 1977-12-19 | 1980-03-13 | Detergent and cleaning compositions |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19772756516 DE2756516A1 (de) | 1977-12-19 | 1977-12-19 | Wasch- und reinigungsmittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2756516A1 true DE2756516A1 (de) | 1979-06-21 |
Family
ID=6026520
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772756516 Ceased DE2756516A1 (de) | 1977-12-19 | 1977-12-19 | Wasch- und reinigungsmittel |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4265776A (enExample) |
| JP (1) | JPS5490309A (enExample) |
| AT (1) | AT375672B (enExample) |
| BE (1) | BE872852A (enExample) |
| CA (1) | CA1121246A (enExample) |
| CH (1) | CH640564A5 (enExample) |
| DE (1) | DE2756516A1 (enExample) |
| DK (1) | DK567278A (enExample) |
| FI (1) | FI62556C (enExample) |
| FR (1) | FR2411886A1 (enExample) |
| GB (1) | GB2010310B (enExample) |
| IT (1) | IT1106828B (enExample) |
| LU (1) | LU80664A1 (enExample) |
| NL (1) | NL7812220A (enExample) |
| NO (1) | NO784265L (enExample) |
| SE (1) | SE7813004L (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4325828A (en) * | 1980-03-27 | 1982-04-20 | Lever Brothers Company | Detergent bleach compositions |
| US4515596A (en) * | 1982-07-27 | 1985-05-07 | Ciba-Geigy Corporation | Process for aftertreating dyed fibrous material made of or containing cellulose |
| JPH0268662U (enExample) * | 1988-11-10 | 1990-05-24 | ||
| US20060191851A1 (en) * | 2005-02-25 | 2006-08-31 | Mizuno William G | Method for treating feedwater, feedwater treatment composition, and apparatus for treating feedwater |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3383323A (en) * | 1962-09-04 | 1968-05-14 | Monsanto Co | Amino tri-lower alkylidenephosphonic acid builders for synthetic detergents |
| US3297578A (en) * | 1963-07-26 | 1967-01-10 | Monsanto Co | Bleaching, sterilizing, disinfecting, and deterging compositions |
| US3368978A (en) * | 1964-12-28 | 1968-02-13 | Monsanto Co | Builder compositions and detergent compositions using same |
| DE1252838B (enExample) * | 1965-04-01 | |||
| CA790610A (en) * | 1965-12-28 | 1968-07-23 | T. Quimby Oscar | Diphosphonate compounds and detergent compositions |
| USB542190I5 (enExample) * | 1966-04-13 | |||
| US3925228A (en) * | 1973-01-11 | 1975-12-09 | Colgate Palmolive Co | Carbonate built detergents |
| US3914162A (en) | 1973-06-25 | 1975-10-21 | Monsanto Co | Compositions and process for the electrodeposition of metals |
| US4029696A (en) * | 1976-04-09 | 1977-06-14 | Benckiser-Knapsack Gmbh | N-hydroxy alkane amino alkane diphosphonic acids, process of producing same, and compositions for and method of using same |
-
1977
- 1977-12-19 DE DE19772756516 patent/DE2756516A1/de not_active Ceased
-
1978
- 1978-12-05 GB GB7847278A patent/GB2010310B/en not_active Expired
- 1978-12-07 CA CA000318139A patent/CA1121246A/en not_active Expired
- 1978-12-14 CH CH1272378A patent/CH640564A5/de not_active IP Right Cessation
- 1978-12-15 IT IT52312/78A patent/IT1106828B/it active
- 1978-12-15 JP JP15429378A patent/JPS5490309A/ja active Granted
- 1978-12-15 NL NL7812220A patent/NL7812220A/xx not_active Application Discontinuation
- 1978-12-15 FI FI783854A patent/FI62556C/fi not_active IP Right Cessation
- 1978-12-15 LU LU80664A patent/LU80664A1/de unknown
- 1978-12-18 NO NO784265A patent/NO784265L/no unknown
- 1978-12-18 SE SE7813004A patent/SE7813004L/xx unknown
- 1978-12-18 AT AT0903278A patent/AT375672B/de not_active IP Right Cessation
- 1978-12-18 DK DK567278A patent/DK567278A/da not_active Application Discontinuation
- 1978-12-18 BE BE192391A patent/BE872852A/xx unknown
- 1978-12-19 FR FR7835708A patent/FR2411886A1/fr active Granted
-
1980
- 1980-03-13 US US06/130,156 patent/US4265776A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| LU80664A1 (de) | 1979-07-20 |
| ATA903278A (de) | 1984-01-15 |
| GB2010310B (en) | 1982-03-10 |
| US4265776A (en) | 1981-05-05 |
| JPS5490309A (en) | 1979-07-18 |
| JPS5643279B2 (enExample) | 1981-10-12 |
| BE872852A (fr) | 1979-06-18 |
| CA1121246A (en) | 1982-04-06 |
| AT375672B (de) | 1984-08-27 |
| FR2411886A1 (fr) | 1979-07-13 |
| IT1106828B (it) | 1985-11-18 |
| FI783854A7 (fi) | 1979-06-20 |
| DK567278A (da) | 1979-06-20 |
| NL7812220A (nl) | 1979-06-21 |
| CH640564A5 (de) | 1984-01-13 |
| GB2010310A (en) | 1979-06-27 |
| IT7852312A0 (it) | 1978-12-15 |
| FI62556B (fi) | 1982-09-30 |
| FR2411886B1 (enExample) | 1983-01-21 |
| SE7813004L (sv) | 1979-06-20 |
| NO784265L (no) | 1979-06-20 |
| FI62556C (fi) | 1983-01-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69424986T2 (de) | Spülmittelzusammensetzungen | |
| DE2029598A1 (enExample) | ||
| DE2825879B2 (de) | Maskierung von Ca+ + und Mg+ + in wäßrigen Lösungen mit Mischungen von Zeolithen | |
| DE1617172B2 (de) | Seif enzusam mensetzungen | |
| CH641834A5 (de) | Wasch- und reinigungsmittel. | |
| DE2756516A1 (de) | Wasch- und reinigungsmittel | |
| DE3884338T2 (de) | Reinigungsmittel. | |
| DE2456633A1 (de) | Reinigungsmittelzusammensetzungen | |
| DE2161699B2 (de) | Wasch- und Reinigungsmittel | |
| DE2327141A1 (de) | Gerueststoffe fuer wasch- und reinigungsmittel | |
| DE69022515T3 (de) | Bei niedrigen Temperaturen wirksame Bleichmittelzusammensetzungen für Textilien. | |
| DE1617177A1 (de) | Fluessiges Waschmittel | |
| DE2125249A1 (de) | Gerüstsubstanzen für Wasch- und Reinigungsmittel | |
| DE2453982A1 (de) | Waschmittelmischung | |
| DE2401062A1 (de) | Phosphatfreie waschmittelmischungen | |
| DE3726326A1 (de) | Verbesserte wasch- und reinigungsmittel fuer textilien (ii) | |
| DE2311121A1 (de) | Verwendung von salzen der cis-2.5disubstituierten tetrahydrofurane als sequestrierungsmittel und diese enthaltende detergens-zubereitungen | |
| DE2131017C3 (de) | Äthylendiamin-mono-beta-propionsäuretri(methylenphosphonsäure) | |
| DD220328A1 (de) | Waschhilfsmittel zur weissgradverstaerkung | |
| DE2437662A1 (de) | Wasch- und reinigungsmittel | |
| DE2250633A1 (de) | Wasch- und reinigungsmittelmischung mit gewebeweichmachenden eigenschaften | |
| DE2346539C2 (de) | Wasch- und Reinigungsmittel | |
| DE3008054A1 (de) | Wasch- und reinigungsmittel | |
| DE2230452A1 (de) | Grundstoffansatz fuer wasch- und reinigungsmittel | |
| DE1216471B (de) | Waschmittel in fester oder fluessiger Form |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8131 | Rejection |