DE2722117C2 - - Google Patents
Info
- Publication number
- DE2722117C2 DE2722117C2 DE2722117A DE2722117A DE2722117C2 DE 2722117 C2 DE2722117 C2 DE 2722117C2 DE 2722117 A DE2722117 A DE 2722117A DE 2722117 A DE2722117 A DE 2722117A DE 2722117 C2 DE2722117 C2 DE 2722117C2
- Authority
- DE
- Germany
- Prior art keywords
- carbamate
- isocyanate
- general formula
- mol
- carbamic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 47
- 239000012948 isocyanate Substances 0.000 claims description 45
- 150000002513 isocyanates Chemical class 0.000 claims description 43
- 238000000034 method Methods 0.000 claims description 43
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 33
- -1 aralkyl ester Chemical class 0.000 claims description 21
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 21
- 239000001569 carbon dioxide Substances 0.000 claims description 20
- 239000002904 solvent Substances 0.000 claims description 18
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 claims description 16
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 claims description 15
- 230000008569 process Effects 0.000 claims description 14
- 125000003118 aryl group Chemical group 0.000 claims description 10
- DRNXZGJGRSUXHW-UHFFFAOYSA-N silyl carbamate Chemical compound NC(=O)O[SiH3] DRNXZGJGRSUXHW-UHFFFAOYSA-N 0.000 claims description 10
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 claims description 9
- 125000005843 halogen group Chemical group 0.000 claims description 9
- 239000005049 silicon tetrachloride Substances 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 239000003795 chemical substances by application Substances 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- 238000010438 heat treatment Methods 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 125000000524 functional group Chemical group 0.000 claims description 5
- 239000005054 phenyltrichlorosilane Substances 0.000 claims description 5
- 150000003141 primary amines Chemical class 0.000 claims description 5
- ORVMIVQULIKXCP-UHFFFAOYSA-N trichloro(phenyl)silane Chemical compound Cl[Si](Cl)(Cl)C1=CC=CC=C1 ORVMIVQULIKXCP-UHFFFAOYSA-N 0.000 claims description 5
- 150000003512 tertiary amines Chemical class 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000007791 liquid phase Substances 0.000 claims description 3
- LIKFHECYJZWXFJ-UHFFFAOYSA-N dimethyldichlorosilane Chemical compound C[Si](C)(Cl)Cl LIKFHECYJZWXFJ-UHFFFAOYSA-N 0.000 claims description 2
- 238000012986 modification Methods 0.000 claims description 2
- 230000004048 modification Effects 0.000 claims description 2
- 230000003472 neutralizing effect Effects 0.000 claims description 2
- 239000011541 reaction mixture Substances 0.000 description 27
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 24
- 238000006243 chemical reaction Methods 0.000 description 20
- 150000001412 amines Chemical class 0.000 description 18
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 15
- 230000015572 biosynthetic process Effects 0.000 description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- 238000010992 reflux Methods 0.000 description 12
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 12
- 238000004519 manufacturing process Methods 0.000 description 11
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 8
- 238000002329 infrared spectrum Methods 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 239000000543 intermediate Substances 0.000 description 7
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 7
- 239000000376 reactant Substances 0.000 description 7
- 239000005051 trimethylchlorosilane Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 238000010521 absorption reaction Methods 0.000 description 6
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 235000011089 carbon dioxide Nutrition 0.000 description 5
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 238000002347 injection Methods 0.000 description 5
- 239000007924 injection Substances 0.000 description 5
- DZGWFCGJZKJUFP-UHFFFAOYSA-N tyramine Chemical compound NCCC1=CC=C(O)C=C1 DZGWFCGJZKJUFP-UHFFFAOYSA-N 0.000 description 5
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 4
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 4
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- 229910052710 silicon Inorganic materials 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000001819 mass spectrum Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- SOWDBKWCDADBQY-UHFFFAOYSA-N trichlorosilyl carbamate Chemical compound NC(=O)O[Si](Cl)(Cl)Cl SOWDBKWCDADBQY-UHFFFAOYSA-N 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- 229940008841 1,6-hexamethylene diisocyanate Drugs 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- RQMWTTLUOXUKQW-UHFFFAOYSA-N 2-isocyanatoethoxy(trimethyl)silane Chemical compound C[Si](C)(C)OCCN=C=O RQMWTTLUOXUKQW-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- RJUFJBKOKNCXHH-UHFFFAOYSA-N Methyl propionate Chemical compound CCC(=O)OC RJUFJBKOKNCXHH-UHFFFAOYSA-N 0.000 description 2
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical class Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 230000008034 disappearance Effects 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 229910052736 halogen Chemical group 0.000 description 2
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical compound O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- MWZPENIJLUWBSY-VIFPVBQESA-N methyl L-tyrosinate Chemical compound COC(=O)[C@@H](N)CC1=CC=C(O)C=C1 MWZPENIJLUWBSY-VIFPVBQESA-N 0.000 description 2
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 2
- 239000012454 non-polar solvent Substances 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 229910000077 silane Inorganic materials 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 2
- 229960003732 tyramine Drugs 0.000 description 2
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 2
- WYTZZXDRDKSJID-UHFFFAOYSA-N (3-aminopropyl)triethoxysilane Chemical compound CCO[Si](OCC)(OCC)CCCN WYTZZXDRDKSJID-UHFFFAOYSA-N 0.000 description 1
- OQURWGJAWSLGQG-UHFFFAOYSA-N 1-isocyanatopropane Chemical compound CCCN=C=O OQURWGJAWSLGQG-UHFFFAOYSA-N 0.000 description 1
- 229940082584 3-(triethoxysilyl)propylamine Drugs 0.000 description 1
- 101100037762 Caenorhabditis elegans rnh-2 gene Proteins 0.000 description 1
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical compound NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 1
- 239000005046 Chlorosilane Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- IHKYSGJNHVOROF-FVGYRXGTSA-N N=C=O.COC(=O)[C@@H](N)CC1=CC=C(O)C=C1 Chemical compound N=C=O.COC(=O)[C@@H](N)CC1=CC=C(O)C=C1 IHKYSGJNHVOROF-FVGYRXGTSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- DORHGRMBOUREIV-UHFFFAOYSA-N [4-(2-isocyanatoethyl)phenoxy]-trimethylsilane Chemical compound C[Si](C)(C)OC1=CC=C(CCN=C=O)C=C1 DORHGRMBOUREIV-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- BLORRZQTHNGFTI-ZZMNMWMASA-L calcium-L-ascorbate Chemical compound [Ca+2].OC[C@H](O)[C@H]1OC(=O)C(O)=C1[O-].OC[C@H](O)[C@H]1OC(=O)C(O)=C1[O-] BLORRZQTHNGFTI-ZZMNMWMASA-L 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 150000001793 charged compounds Chemical class 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- KQIFRYIYNPGWEK-UHFFFAOYSA-N cyclohexylazanium;n-cyclohexylcarbamate Chemical compound NC1CCCCC1.OC(=O)NC1CCCCC1 KQIFRYIYNPGWEK-UHFFFAOYSA-N 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- MROCJMGDEKINLD-UHFFFAOYSA-N dichlorosilane Chemical class Cl[SiH2]Cl MROCJMGDEKINLD-UHFFFAOYSA-N 0.000 description 1
- 125000005442 diisocyanate group Chemical group 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- JIYXHCMRGZVYMA-UHFFFAOYSA-N dimethylcarbamic acid;n-methylmethanamine Chemical compound C[NH2+]C.CN(C)C([O-])=O JIYXHCMRGZVYMA-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- RDZPTECJBXIQHH-UHFFFAOYSA-N methanamine;methyl carbamate Chemical compound NC.COC(N)=O RDZPTECJBXIQHH-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000000197 pyrolysis Methods 0.000 description 1
- 230000036632 reaction speed Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 150000004756 silanes Chemical class 0.000 description 1
- 150000003376 silicon Chemical class 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- FDNAPBUWERUEDA-UHFFFAOYSA-N silicon tetrachloride Chemical compound Cl[Si](Cl)(Cl)Cl FDNAPBUWERUEDA-UHFFFAOYSA-N 0.000 description 1
- 229920005573 silicon-containing polymer Polymers 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 238000013519 translation Methods 0.000 description 1
- FRGPKMWIYVTFIQ-UHFFFAOYSA-N triethoxy(3-isocyanatopropyl)silane Chemical compound CCO[Si](OCC)(OCC)CCCN=C=O FRGPKMWIYVTFIQ-UHFFFAOYSA-N 0.000 description 1
- RDEKHAYBXPYQJQ-UHFFFAOYSA-N trimethylsilyl n,n-dimethylcarbamate Chemical compound CN(C)C(=O)O[Si](C)(C)C RDEKHAYBXPYQJQ-UHFFFAOYSA-N 0.000 description 1
- GHLWPMXJVBXAGW-UHFFFAOYSA-N trimethylsilyl n-cyclohexylcarbamate Chemical compound C[Si](C)(C)OC(=O)NC1CCCCC1 GHLWPMXJVBXAGW-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C263/00—Preparation of derivatives of isocyanic acid
- C07C263/04—Preparation of derivatives of isocyanic acid from or via carbamates or carbamoyl halides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/025—Silicon compounds without C-silicon linkages
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/18—Compounds having one or more C—Si linkages as well as one or more C—O—Si linkages
- C07F7/1896—Compounds having one or more Si-O-acyl linkages
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/687,160 US4064151A (en) | 1976-05-17 | 1976-05-17 | Halosilyl carbamates |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2722117A1 DE2722117A1 (de) | 1977-11-24 |
| DE2722117C2 true DE2722117C2 (cg-RX-API-DMAC10.html) | 1989-02-16 |
Family
ID=24759320
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772722117 Granted DE2722117A1 (de) | 1976-05-17 | 1977-05-16 | Verfahren zur herstellung von isocyanaten und/oder isothiocyanaten und neue halogensilylcarbamate |
Country Status (14)
| Country | Link |
|---|---|
| US (2) | US4064151A (cg-RX-API-DMAC10.html) |
| JP (2) | JPS52139020A (cg-RX-API-DMAC10.html) |
| AU (1) | AU513403B2 (cg-RX-API-DMAC10.html) |
| BE (1) | BE854693A (cg-RX-API-DMAC10.html) |
| BR (1) | BR7703145A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1096876A (cg-RX-API-DMAC10.html) |
| CH (1) | CH620672A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2722117A1 (cg-RX-API-DMAC10.html) |
| DK (1) | DK213077A (cg-RX-API-DMAC10.html) |
| FR (2) | FR2351986A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1573170A (cg-RX-API-DMAC10.html) |
| IL (1) | IL52094A0 (cg-RX-API-DMAC10.html) |
| NL (1) | NL7705410A (cg-RX-API-DMAC10.html) |
| SE (1) | SE442994B (cg-RX-API-DMAC10.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE102009045849A1 (de) * | 2009-10-20 | 2011-04-21 | Technische Universität Bergakademie Freiberg | Verfahren zur Herstellung von Oligo- und Polysiloxanen |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4192815A (en) * | 1978-06-22 | 1980-03-11 | Glushakov Sergei N | Method of preparing isocyanates |
| US4785080A (en) * | 1981-03-30 | 1988-11-15 | Baker Instruments Corporation | Labeled analytes |
| US4378428A (en) * | 1981-03-30 | 1983-03-29 | Baker Instruments Corporation | Method for carrying out non-isotopic immunoassays, labeled analytes and kits for use in such assays |
| US4467089A (en) * | 1982-03-04 | 1984-08-21 | Air Products And Chemicals, Inc. | Carbamate and carbonate salts of tertiary amines |
| US4400526A (en) * | 1982-09-30 | 1983-08-23 | Union Carbide Corporation | Hydrogen bearing silyl carbamates |
| US4496754A (en) * | 1982-12-28 | 1985-01-29 | Union Carbide Corporation | Silyl carbamates and synthesis thereof |
| US4876323A (en) * | 1984-02-27 | 1989-10-24 | Midwest Research Institute | α-substituted acrylic acid esters, their polymers and method of synthesizing same |
| US4704466A (en) * | 1984-02-27 | 1987-11-03 | Midwest Research Institute | α-substituted acrylic acid esters |
| US4736046A (en) * | 1985-12-23 | 1988-04-05 | The Dow Chemical Company | β-isocyanato organosilanes |
| US5166243A (en) * | 1986-06-30 | 1992-11-24 | Union Carbide Chemicals & Plastics Technology Corporation | Polyorganosiloxane cross-linkers for RTV sealants |
| US5189205A (en) * | 1992-03-16 | 1993-02-23 | Monsanto Compamy | Process for preparing isocyanates |
| US5298651A (en) * | 1992-10-15 | 1994-03-29 | Monsanto Company | Process for preparing isocyanates using phosphazine catalysts |
| US5233010A (en) * | 1992-10-15 | 1993-08-03 | Monsanto Company | Process for preparing isocyanate and carbamate ester products |
| US5349081A (en) * | 1993-01-21 | 1994-09-20 | Monsanto Company | Process for preparing isocyanates |
| US5393910A (en) * | 1993-10-20 | 1995-02-28 | Osi Specialties, Inc. | Process for making isocyanatoorganosilanes |
| US5451697A (en) * | 1993-12-27 | 1995-09-19 | Monsanto Company | Process for preparing isocyanates |
| JP4171530B2 (ja) * | 1996-04-15 | 2008-10-22 | 三井化学ポリウレタン株式会社 | ケイ素含有イソシアネート化合物の製造方法 |
| US6008396A (en) * | 1997-04-11 | 1999-12-28 | Osi Specialties, Inc. | Hot oil process for producing isocyanato organosilanes |
| US7825243B2 (en) * | 2005-06-03 | 2010-11-02 | Momentive Performance Materials Inc. | Process for the production of isocyanatosilane and silylisocyanurate |
| US7060849B1 (en) | 2005-09-15 | 2006-06-13 | General Electric Company | Method for production of isocyanatosilanes |
| US7938887B2 (en) * | 2008-01-08 | 2011-05-10 | Board Of Regents, The University Of Texas System | Acidic gas capture by diamines |
| WO2009107796A1 (ja) * | 2008-02-29 | 2009-09-03 | 日産化学工業株式会社 | カルボキシル基を有するイソチオシアナト化合物の製造方法 |
| AU2009346379B2 (en) * | 2009-05-22 | 2015-12-10 | Board Of Regents, The University Of Texas System | Acidic gas capture by diamines |
| US8816078B2 (en) * | 2010-01-12 | 2014-08-26 | Board Of Regents, The University Of Texas System | Acidic gas removal by aqueous amine solvents |
| CN109503647B (zh) * | 2017-09-15 | 2021-09-21 | 张家港市国泰华荣化工新材料有限公司 | 3-异氰酸酯基丙基三甲氧基硅烷的制法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3642854A (en) * | 1967-04-26 | 1972-02-15 | Vladimir Petrovich Kozjukov | Method for production of isocyanates |
| US3821218A (en) * | 1967-09-20 | 1974-06-28 | Gen Electric | Nitrogen-containing organosilicon materials |
| DE1768860A1 (de) * | 1968-07-09 | 1972-01-13 | Bayer Ag | Verfahren zur Herstellung von mono- und polyfunktionellen Derivaten der Kohlensaeure |
| DE2241154A1 (de) * | 1972-08-22 | 1974-03-07 | Bayer Ag | Verfahren zur herstellung von isocyanaten |
-
1976
- 1976-05-17 US US05/687,160 patent/US4064151A/en not_active Expired - Lifetime
-
1977
- 1977-05-04 SE SE7705190A patent/SE442994B/xx not_active IP Right Cessation
- 1977-05-16 FR FR7714948A patent/FR2351986A1/fr active Granted
- 1977-05-16 CA CA278,460A patent/CA1096876A/en not_active Expired
- 1977-05-16 JP JP5553777A patent/JPS52139020A/ja active Granted
- 1977-05-16 GB GB20471/77A patent/GB1573170A/en not_active Expired
- 1977-05-16 NL NL7705410A patent/NL7705410A/xx unknown
- 1977-05-16 CH CH606777A patent/CH620672A5/fr not_active IP Right Cessation
- 1977-05-16 BE BE177622A patent/BE854693A/xx unknown
- 1977-05-16 BR BR3145/77A patent/BR7703145A/pt unknown
- 1977-05-16 IL IL52094A patent/IL52094A0/xx unknown
- 1977-05-16 DE DE19772722117 patent/DE2722117A1/de active Granted
- 1977-05-16 DK DK213077A patent/DK213077A/da unknown
- 1977-05-17 AU AU25188/77A patent/AU513403B2/en not_active Expired
- 1977-09-23 FR FR7728842A patent/FR2351955A1/fr active Granted
- 1977-12-19 US US05/862,208 patent/US4130576A/en not_active Expired - Lifetime
-
1982
- 1982-03-23 JP JP57044792A patent/JPS6033436B2/ja not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE102009045849A1 (de) * | 2009-10-20 | 2011-04-21 | Technische Universität Bergakademie Freiberg | Verfahren zur Herstellung von Oligo- und Polysiloxanen |
| DE102009045849B4 (de) | 2009-10-20 | 2018-03-08 | Technische Universität Bergakademie Freiberg | Verfahren zur Herstellung von Oligo- und Polysiloxanen |
Also Published As
| Publication number | Publication date |
|---|---|
| US4130576A (en) | 1978-12-19 |
| CH620672A5 (cg-RX-API-DMAC10.html) | 1980-12-15 |
| FR2351955B1 (cg-RX-API-DMAC10.html) | 1980-12-05 |
| CA1096876A (en) | 1981-03-03 |
| BR7703145A (pt) | 1978-01-31 |
| US4064151A (en) | 1977-12-20 |
| JPS57181089A (en) | 1982-11-08 |
| SE442994B (sv) | 1986-02-10 |
| JPS5757020B2 (cg-RX-API-DMAC10.html) | 1982-12-02 |
| JPS6033436B2 (ja) | 1985-08-02 |
| FR2351986B1 (cg-RX-API-DMAC10.html) | 1980-12-05 |
| NL7705410A (nl) | 1977-11-21 |
| IL52094A0 (en) | 1977-07-31 |
| FR2351986A1 (fr) | 1977-12-16 |
| AU2518877A (en) | 1978-11-23 |
| BE854693A (fr) | 1977-11-16 |
| GB1573170A (en) | 1980-09-17 |
| AU513403B2 (en) | 1980-11-27 |
| DK213077A (da) | 1977-11-18 |
| FR2351955A1 (fr) | 1977-12-16 |
| SE7705190L (sv) | 1977-11-18 |
| JPS52139020A (en) | 1977-11-19 |
| DE2722117A1 (de) | 1977-11-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2722117C2 (cg-RX-API-DMAC10.html) | ||
| DE2758937C2 (cg-RX-API-DMAC10.html) | ||
| EP0212058B1 (de) | N-Silylpropyl-N'Acyl-Harnstoffe und Verfahren zur Herstellung | |
| EP0483480B1 (de) | Verfahren zur Herstellung von Methacryloxy-oder Acryloxygruppen enthaltende Organosilanen | |
| EP0895996A2 (de) | Verfahren zur Herstellung von Organosiliciumdisulfanen hoher Reinheit | |
| DE3020446C2 (cg-RX-API-DMAC10.html) | ||
| DE69022491T3 (de) | Herstellung von Tertiär-Kohlenwasserstoff-Silyl-Verbindungen. | |
| EP0074001A1 (de) | Aminoorganoaminosilane, Verfahren zu deren Herstellung und deren Verwendung | |
| DE1768588B1 (de) | Verfahren zur Alkylierung von Silicium- und Zinnderivaten | |
| DE3703484C1 (cg-RX-API-DMAC10.html) | ||
| CH661928A5 (de) | Verfahren zur herstellung funktionell substituierter silane. | |
| DE1158071B (de) | Verfahren zur Herstellung von ª†-Aminoisobutylgruppen enthaltenden siliciumorganischen Verbindungen | |
| DE2550187C3 (de) | Verfahren zur Herstellung von Dichlorsilan durch Disproportionierung von Trichlorsilan in Gegenwart von N-substituiertem Pyrrolidon | |
| DE1668425A1 (de) | Verfahren zur Herstellung von Diorganoantimonacylaten | |
| DE69930733T2 (de) | Herstellung von substituierten (amino)alkoxysilanen | |
| DE69221586T2 (de) | Verfahren zur Herstellung von Oximinosilanverbindung | |
| DE69505332T2 (de) | Verfahren zur Herstellung von Amidverbindungen | |
| DE2807230C3 (de) | Verfahren zur Herstellung von Alkoxymethylsilazanen | |
| DE2045440C3 (de) | Verfahren zur Herstellung von trisubstituierten Chlorsulfenylharnstoffen | |
| EP3653578A1 (de) | Tetrakis(trichlorsilyl) german, verfahren zu dessen herstellung und dessen verwendung | |
| DE69811358T2 (de) | Verfahren zur herstellung von 1-chlorocarbonyl-4-piperidinopiperidin oder dem hydrochlorid davon | |
| CA1108174A (en) | Method for preparing halosily carbamates and isocyanates derived therefrom | |
| DE3600502A1 (de) | Verfahren zur herstellung olefinischer silazane | |
| DE1668076C3 (de) | Verfahren zur Herstellung von Isocyanatocarbonsäuretrialkylsilylestern | |
| DE69017290T2 (de) | Organosiliciumverbindungen und Verfahren zu ihrer Herstellung. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8128 | New person/name/address of the agent |
Representative=s name: JUNG, E., DIPL.-CHEM. DR.PHIL. SCHIRDEWAHN, J., DI |
|
| 8125 | Change of the main classification |
Ipc: C07C118/00 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |