DE2721084C3 - Mischungen von optischen Aufhellern - Google Patents
Mischungen von optischen AufhellernInfo
- Publication number
- DE2721084C3 DE2721084C3 DE2721084A DE2721084A DE2721084C3 DE 2721084 C3 DE2721084 C3 DE 2721084C3 DE 2721084 A DE2721084 A DE 2721084A DE 2721084 A DE2721084 A DE 2721084A DE 2721084 C3 DE2721084 C3 DE 2721084C3
- Authority
- DE
- Germany
- Prior art keywords
- group
- formula
- hydrogen
- groups
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims description 27
- 230000003287 optical effect Effects 0.000 title claims description 14
- 150000001875 compounds Chemical class 0.000 claims description 42
- 239000001257 hydrogen Substances 0.000 claims description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims description 17
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 16
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical class [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 12
- -1 alkylene radicals Chemical class 0.000 claims description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 5
- 150000003254 radicals Chemical class 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical group OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 150000002431 hydrogen Chemical class 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 229910052717 sulfur Chemical group 0.000 claims description 3
- 125000005605 benzo group Chemical group 0.000 claims description 2
- 125000000068 chlorophenyl group Chemical group 0.000 claims description 2
- 125000004188 dichlorophenyl group Chemical group 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- 125000006203 morpholinoethyl group Chemical group [H]C([H])(*)C([H])([H])N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 claims description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims 2
- 239000011737 fluorine Substances 0.000 claims 2
- 229910052731 fluorine Inorganic materials 0.000 claims 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims 1
- 125000000278 alkyl amino alkyl group Chemical group 0.000 claims 1
- 125000002947 alkylene group Chemical group 0.000 claims 1
- 125000003710 aryl alkyl group Chemical group 0.000 claims 1
- 150000005840 aryl radicals Chemical class 0.000 claims 1
- 125000004181 carboxyalkyl group Chemical group 0.000 claims 1
- 125000004093 cyano group Chemical group *C#N 0.000 claims 1
- 125000000753 cycloalkyl group Chemical group 0.000 claims 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims 1
- 125000004663 dialkyl amino group Chemical group 0.000 claims 1
- 125000001188 haloalkyl group Chemical group 0.000 claims 1
- 229910052757 nitrogen Inorganic materials 0.000 claims 1
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- 125000004193 piperazinyl group Chemical group 0.000 claims 1
- 125000004434 sulfur atom Chemical group 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 16
- 229920000728 polyester Polymers 0.000 description 10
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- 229910052801 chlorine Inorganic materials 0.000 description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 7
- 238000000034 method Methods 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 239000004744 fabric Substances 0.000 description 6
- 239000000835 fiber Substances 0.000 description 4
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 4
- 239000004753 textile Substances 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 2
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 2
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- 241001584775 Tunga penetrans Species 0.000 description 2
- SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 description 2
- 229940081735 acetylcellulose Drugs 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229920002301 cellulose acetate Polymers 0.000 description 2
- 125000004965 chloroalkyl group Chemical group 0.000 description 2
- 238000004043 dyeing Methods 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000003855 acyl compounds Chemical class 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical group 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 238000005282 brightening Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000000378 dietary effect Effects 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001326 naphthylalkyl group Chemical group 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- UKLNMMHNWFDKNT-UHFFFAOYSA-M sodium chlorite Chemical compound [Na+].[O-]Cl=O UKLNMMHNWFDKNT-UHFFFAOYSA-M 0.000 description 1
- 229960002218 sodium chlorite Drugs 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06L—DRY-CLEANING, WASHING OR BLEACHING FIBRES, FILAMENTS, THREADS, YARNS, FABRICS, FEATHERS OR MADE-UP FIBROUS GOODS; BLEACHING LEATHER OR FURS
- D06L4/00—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs
- D06L4/60—Optical bleaching or brightening
- D06L4/65—Optical bleaching or brightening with mixtures of optical brighteners
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Detergent Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Coloring (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Paper (AREA)
Priority Applications (13)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2721084A DE2721084C3 (de) | 1977-05-11 | 1977-05-11 | Mischungen von optischen Aufhellern |
| CH498978A CH647912GA3 (enExample) | 1977-05-11 | 1978-05-08 | |
| US05/903,606 US4169810A (en) | 1977-05-11 | 1978-05-08 | Mixtures of optical brighteners |
| GB18452/78A GB1588687A (en) | 1977-05-11 | 1978-05-09 | Mixtures of optical brighteners |
| IT23196/78A IT1094602B (it) | 1977-05-11 | 1978-05-09 | Miscele di sbiancanti ottici |
| PH21123A PH15034A (en) | 1977-05-11 | 1978-05-10 | Composition of optical brighteners |
| NL7805039A NL7805039A (nl) | 1977-05-11 | 1978-05-10 | Mengsels van optische witmakers. |
| JP5455578A JPS53139635A (en) | 1977-05-11 | 1978-05-10 | Mixture consisting of optical brightener |
| BR7802937A BR7802937A (pt) | 1977-05-11 | 1978-05-10 | Misturas de aclaradores oticos,e sua aplicacao |
| CA303,000A CA1107913A (en) | 1977-05-11 | 1978-05-10 | Mixtures of optical brighteners |
| FR7813972A FR2390537A1 (fr) | 1977-05-11 | 1978-05-11 | Melanges d'azureurs optiques derivant du stilbene |
| BE187609A BE866964A (fr) | 1977-05-11 | 1978-05-11 | Melanges d'azureurs optiques derivant du stilbene |
| SE7805451A SE7805451L (sv) | 1977-05-11 | 1978-05-11 | Blandnigar av optiska klarmedel |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2721084A DE2721084C3 (de) | 1977-05-11 | 1977-05-11 | Mischungen von optischen Aufhellern |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2721084A1 DE2721084A1 (de) | 1978-11-23 |
| DE2721084B2 DE2721084B2 (de) | 1980-06-26 |
| DE2721084C3 true DE2721084C3 (de) | 1981-02-26 |
Family
ID=6008566
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2721084A Expired DE2721084C3 (de) | 1977-05-11 | 1977-05-11 | Mischungen von optischen Aufhellern |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4169810A (enExample) |
| JP (1) | JPS53139635A (enExample) |
| BE (1) | BE866964A (enExample) |
| BR (1) | BR7802937A (enExample) |
| CA (1) | CA1107913A (enExample) |
| CH (1) | CH647912GA3 (enExample) |
| DE (1) | DE2721084C3 (enExample) |
| FR (1) | FR2390537A1 (enExample) |
| GB (1) | GB1588687A (enExample) |
| IT (1) | IT1094602B (enExample) |
| NL (1) | NL7805039A (enExample) |
| PH (1) | PH15034A (enExample) |
| SE (1) | SE7805451L (enExample) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2839936C2 (de) * | 1978-09-14 | 1983-11-10 | Hoechst Ag, 6230 Frankfurt | Mischungen von optischen Aufhellern und deren Verwendung zum optischen Aufhellen |
| DE3008812A1 (de) * | 1980-03-07 | 1981-09-24 | Hoechst Ag, 6000 Frankfurt | Mischungen von optischen aufhellern |
| DE3104992A1 (de) * | 1981-02-12 | 1982-08-26 | Hoechst Ag, 6000 Frankfurt | "mischungen von optischen aufhellern" |
| US4830763A (en) * | 1987-02-26 | 1989-05-16 | Ciba-Geigy Corporation | Process for increasing the degree of whiteness of polyester-containing textile material |
| US6030443A (en) * | 1999-04-29 | 2000-02-29 | Hercules Incorporated | Paper coating composition with improved optical brightener carriers |
| US6492032B1 (en) | 2000-10-12 | 2002-12-10 | Eastman Chemical Company | Multi-component optically brightened polyolefin blend |
| US7638016B2 (en) * | 2005-02-19 | 2009-12-29 | International Paper Company | Method for treating kraft pulp with optical brighteners after chlorine bleaching to increase brightness |
| US7682438B2 (en) * | 2005-11-01 | 2010-03-23 | International Paper Company | Paper substrate having enhanced print density |
| US7622022B2 (en) | 2006-06-01 | 2009-11-24 | Benny J Skaggs | Surface treatment of substrate or paper/paperboard products using optical brightening agent |
| US7967948B2 (en) * | 2006-06-02 | 2011-06-28 | International Paper Company | Process for non-chlorine oxidative bleaching of mechanical pulp in the presence of optical brightening agents |
| US20070284425A1 (en) * | 2006-06-13 | 2007-12-13 | John Raymond Garvey | Blank and gable top carton thereof |
| RU2490388C2 (ru) * | 2007-04-05 | 2013-08-20 | Акцо Нобель Н.В. | Способ улучшения оптических свойств бумаги |
| EP2152522A1 (en) * | 2007-05-21 | 2010-02-17 | International Paper Company | Recording sheet with improved image waterfastness, surface strength, and runnability |
| US8057637B2 (en) | 2007-12-26 | 2011-11-15 | International Paper Company | Paper substrate containing a wetting agent and having improved print mottle |
| CA2738923C (en) * | 2008-10-01 | 2016-06-21 | International Paper Company | A paper substrate containing a wetting agent and having improved printability |
| US20130189457A1 (en) | 2012-01-23 | 2013-07-25 | International Paper Company | SEPARATED TREATMENT OF PAPER SUBSTRATE WITH MULTIVALENT METAL SALTS AND OBAs |
| CN108138447A (zh) | 2015-08-14 | 2018-06-08 | 巴斯夫欧洲公司 | 用于纸和纸板的含水表面处理组合物 |
| CN109208098B (zh) * | 2017-07-06 | 2021-09-10 | 中国石化仪征化纤有限责任公司 | 一种荧光增白剂、母粒及钛系增白涤纶短纤维的制备方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3260715A (en) * | 1962-12-17 | 1966-07-12 | Eastman Kodak Co | Fluorescent bis-benzoxazolyl stilbenes |
| FR1440678A (fr) * | 1964-06-30 | 1966-06-03 | Nippon Kayaku Kk | Agent d'avivage optique |
| US3595801A (en) * | 1967-12-29 | 1971-07-27 | Hoechst Ag | Aqueous dispersions of mixtures of benzoxazole derivatives and their use as optical brighteners |
| US3711474A (en) * | 1969-07-31 | 1973-01-16 | Procter & Gamble | Heterocyclic nitrogen-and sulfur-containing optical brightener compounds and detergents and bleach compositions containing same |
| US4105399A (en) * | 1973-09-05 | 1978-08-08 | Ciba-Geigy Corporation | Optically brightening with a synergistic mixture |
| JPS5652065B2 (enExample) * | 1974-01-17 | 1981-12-09 | ||
| DE2629703C3 (de) * | 1976-07-02 | 1981-07-23 | Hoechst Ag, 6000 Frankfurt | Aufhellermischungen und deren Verwendung |
-
1977
- 1977-05-11 DE DE2721084A patent/DE2721084C3/de not_active Expired
-
1978
- 1978-05-08 CH CH498978A patent/CH647912GA3/de unknown
- 1978-05-08 US US05/903,606 patent/US4169810A/en not_active Expired - Lifetime
- 1978-05-09 IT IT23196/78A patent/IT1094602B/it active
- 1978-05-09 GB GB18452/78A patent/GB1588687A/en not_active Expired
- 1978-05-10 PH PH21123A patent/PH15034A/en unknown
- 1978-05-10 NL NL7805039A patent/NL7805039A/xx not_active Application Discontinuation
- 1978-05-10 JP JP5455578A patent/JPS53139635A/ja active Pending
- 1978-05-10 CA CA303,000A patent/CA1107913A/en not_active Expired
- 1978-05-10 BR BR7802937A patent/BR7802937A/pt unknown
- 1978-05-11 BE BE187609A patent/BE866964A/xx not_active IP Right Cessation
- 1978-05-11 SE SE7805451A patent/SE7805451L/xx unknown
- 1978-05-11 FR FR7813972A patent/FR2390537A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| SE7805451L (sv) | 1978-11-12 |
| JPS53139635A (en) | 1978-12-06 |
| GB1588687A (en) | 1981-04-29 |
| BE866964A (fr) | 1978-11-13 |
| FR2390537B1 (enExample) | 1983-05-20 |
| NL7805039A (nl) | 1978-11-14 |
| DE2721084B2 (de) | 1980-06-26 |
| BR7802937A (pt) | 1979-01-02 |
| FR2390537A1 (fr) | 1978-12-08 |
| DE2721084A1 (de) | 1978-11-23 |
| IT7823196A0 (it) | 1978-05-09 |
| CA1107913A (en) | 1981-09-01 |
| IT1094602B (it) | 1985-08-02 |
| CH647912GA3 (enExample) | 1985-02-28 |
| US4169810A (en) | 1979-10-02 |
| PH15034A (en) | 1982-05-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2721084C3 (de) | Mischungen von optischen Aufhellern | |
| EP0475905A1 (de) | Verfahren zum photochemischen Stabilisieren von Wolle | |
| DE2207979A1 (de) | Trockene chlorfreie Bleichmittel | |
| DE2629703C3 (de) | Aufhellermischungen und deren Verwendung | |
| DE2704825B2 (de) | Fluoreszenzfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung zum Weißtönen organischer Materialien | |
| EP2160489B1 (de) | Verfahren zur vergilbungsinhibierung | |
| DE3027479A1 (de) | Mischungen von optischen aufhellern und deren verwendung | |
| DE2759217C3 (de) | Mischungen von optischen Aufhellern | |
| DE2839936C2 (de) | Mischungen von optischen Aufhellern und deren Verwendung zum optischen Aufhellen | |
| CH477501A (de) | Verfahren zur Aufhellung von nichttextilem Polymermaterial mittels Dibenzazolylstilbenverbindungen | |
| DE3104992A1 (de) | "mischungen von optischen aufhellern" | |
| DE2124617A1 (de) | Verfahren zur Erzeugung von Mehrton-Effekten auf Fasermaterial aus Polyacrylnitril oder Polyacrylnitrilcopolymeren | |
| EP0011824A1 (de) | Benzofuranyl-benzimidazole, Verfahren zu ihrer Herstellung sowie ihre Verwendung zum optischen Aufhellen von organischen Materialien | |
| DE2148867C3 (de) | Verfahren zur kontinuierlichen Fixierung von Dispersionsfarbstoffen auf Polyester, Cellulosetriacetat, Cellulose-2 l/2-acetat und deren Mischungen | |
| DE1293719B (de) | Optische Aufheller | |
| DE2146761C3 (de) | Verfahren zur Herstellung ichtechter Färbungen auf synthetischen Fasern | |
| DE1545895B2 (de) | Pyrazolinverbindungen | |
| CH427364A (de) | Gerät zur graphischen Darstellung von Sachverhalten, insbesondere Planungsgerät, und Verwendung desselben | |
| DE1695103C3 (de) | Neue Pyrazolinsulfonsäureester zur Verwendung als optische Aufheller und Verfahren zu ihrer Herstellung | |
| DE2217284A1 (de) | Neue Pyrazolinverbindungen als optische Aufheller | |
| DE1594858C3 (de) | Verfahren zum kontinuierlichen opti sehen Aufhellen von Fasermatenal aus unvollständig acyherter Cellulose | |
| DE1469223C (de) | Optische Aufhellungsmittel | |
| DE1953068C3 (de) | Hilfsmittel für das Färben von Cellulosefasern, stickstoffhaltigen Fasern, synthetischen Fasern und deren Fasermischungen und dessen Verwendung | |
| DE2052151B2 (de) | Verfahren zur Färbung von säuremodifizierten synthetischen Textilfasern | |
| DE2512462B1 (de) | Verfahren zum bedrucken oder klotzfaerben von polyester, cellulose-triacetat, cellulose 2 1/2 acetat und deren mischungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OAP | Request for examination filed | ||
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |