DE2716898B5 - - Google Patents
Info
- Publication number
- DE2716898B5 DE2716898B5 DE2716898B5 DE 2716898 B5 DE2716898 B5 DE 2716898B5 DE 2716898 B5 DE2716898 B5 DE 2716898B5
- Authority
- DE
- Germany
- Prior art keywords
- cis
- trans
- isomer
- ppm
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 238000000034 method Methods 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 7
- 238000000926 separation method Methods 0.000 claims description 6
- 150000007513 acids Chemical class 0.000 claims description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 2
- 238000004821 distillation Methods 0.000 description 13
- 239000000203 mixture Substances 0.000 description 9
- VGKZBAMIYUHSMU-UHFFFAOYSA-N 4-[[2-chloroethyl(nitroso)carbamoyl]amino]cyclohexane-1-carboxylic acid Chemical compound OC(=O)C1CCC(NC(=O)N(CCCl)N=O)CC1 VGKZBAMIYUHSMU-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 239000002904 solvent Substances 0.000 description 5
- PDOBSLHNWIVQJX-UHFFFAOYSA-N 1-ethenylcyclopropane-1-carboxylic acid Chemical class OC(=O)C1(C=C)CC1 PDOBSLHNWIVQJX-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butanoic acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atoms Chemical group C* 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000005712 crystallization Effects 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- -1 2-methylbutene-1-yl Chemical group 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N Carbon tetrachloride Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 230000035507 absorption Effects 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- YACLCMMBHTUQON-UHFFFAOYSA-N 1-chloro-1-fluoroethane Chemical compound CC(F)Cl YACLCMMBHTUQON-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical class OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 235000019441 ethanol Nutrition 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000008079 hexane Substances 0.000 description 1
- 235000015243 ice cream Nutrition 0.000 description 1
- 230000000749 insecticidal Effects 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2427608C3 (de) | Verfahren zur Herstellung von Undecatrienen | |
| DE2432235C2 (de) | Verfahren zur Herstellung von Lavandulol, seinen Estern und von 3,5,5-Trimethyl-hepta-1,6-dien-3-ol | |
| DE2713538A1 (de) | Verfahren zur trennung stereoisomerer cyclischer carbonsaeuren | |
| DE2213865A1 (de) | Chlorthiazole und ein verfahren zu ihrer herstellung | |
| EP0022972B1 (de) | Neue Menthylester, Verfahren zu ihrer Herstellung und ihre Verwendung zur Enantiomerentrennung chiraler Carbonsäuren | |
| DE2716898B2 (de) | Verfahren zur Trennung von cis- und trans-Vinylcyclopropancarbonsäuren | |
| DE4439836C1 (de) | cis-4-(2,2,3,3-Tetrafluorpropoxy)-zimtsäurenitril und trans-4-(2,2,3,3-Tetrafluorpropoxy)- zimtsäurenitril und ein Verfahren zu ihrer Herstellung | |
| DE2716898B5 (es) | ||
| WO2007082847A1 (de) | Verfahren zur herstellung von farnesol-freiem oder farnesol-armem bisabolol | |
| EP0057844A1 (de) | Verfahren zur Herstellung von Polychlorbenzoylchloriden | |
| EP0119546B1 (de) | Neues Verfahren zur Herstellung von Verbindungen der 4-Oxodamascon-Reihe sowie neue Riechstoffe aus dieser Verbindungsklasse | |
| EP0046193B1 (de) | 1-Hydroxypyrazol und Verfahren zu seiner Herstellung | |
| DE707426C (de) | Herstellung von ungesaettigten Aldehyden | |
| EP0673945B1 (de) | Herstellung eines Wittigestersalzes | |
| DE2424128C3 (de) | Verfahren zum Herstellen von cis, cis-2,4,6-Triisopropyl-1,3,5-trioxan | |
| DE2729974B2 (de) | Verfahren zur Herstellung von wäßrigen Lösungen bzw. feinteiligen wäßrigen Dispersionen von Polyenyltriarylphosphoniumsalzen | |
| DE3037086A1 (de) | 3-(m-chloranilino-)acrylsaeureaethylester und ein verfahren zu dessen herstellung | |
| EP0024588A1 (de) | Verfahren zur Herstellung von substituierten Cyclopropyl-carbonsäure-(alpha-cyano-3-phenoxy-benzyl)-estern | |
| DE3785652T2 (de) | Zwischenprodukte und deren verwendung fuer die synthese von organischen verbindungen. | |
| DE2108926C3 (de) | Verfahren zur Herstellung von 3-Acyl-4-hydroxy-buten-(2)-saurelactonen | |
| DE2352054C3 (de) | Verfahren zur Reinigung von 2-Methyl-2-hydroxy-heptanon-6 | |
| EP0046950A1 (de) | Optisch aktive Isomere von trans-3-(2-Chlor-2-(4-chlor-phenyl)-vinyl)-2,2-dimethyl-cyclopropan-1-carbonsäure-(alpha-cyano-4-fluor-3-phenoxy-benzyl)-ester, Verfahren zu deren Herstellung und deren Verwendung als Ektoparasitizide | |
| EP0075237A2 (de) | Verfahren zur Herstellung von Derivaten des 1-Formyl-2,6,6-trimethyl-cyclohex-1-ens | |
| DE3836159A1 (de) | Neue fluor enthaltende und an der ch(pfeil abwaerts)3(pfeil abwaerts)-gruppe gegebenenfalls halogenierte acetophenone und deren herstellung aus neuen fluor enthaltenden benzonitrilen | |
| DE118351C (es) |