DE2716000C2 - Verfahren zur Herstellung von 1,4- Diacyloxybuten-(2) - Google Patents
Verfahren zur Herstellung von 1,4- Diacyloxybuten-(2)Info
- Publication number
- DE2716000C2 DE2716000C2 DE2716000A DE2716000A DE2716000C2 DE 2716000 C2 DE2716000 C2 DE 2716000C2 DE 2716000 A DE2716000 A DE 2716000A DE 2716000 A DE2716000 A DE 2716000A DE 2716000 C2 DE2716000 C2 DE 2716000C2
- Authority
- DE
- Germany
- Prior art keywords
- catalyst
- iodine
- iodide
- palladium
- metallic palladium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 23
- 238000002360 preparation method Methods 0.000 title claims description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 54
- 239000003054 catalyst Substances 0.000 claims description 49
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 28
- 229910052740 iodine Inorganic materials 0.000 claims description 28
- 239000011630 iodine Substances 0.000 claims description 28
- 238000006243 chemical reaction Methods 0.000 claims description 18
- 239000000126 substance Substances 0.000 claims description 17
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 16
- 229910001882 dioxygen Inorganic materials 0.000 claims description 13
- ICIWUVCWSCSTAQ-UHFFFAOYSA-N iodic acid Chemical class OI(=O)=O ICIWUVCWSCSTAQ-UHFFFAOYSA-N 0.000 claims description 9
- 150000004694 iodide salts Chemical class 0.000 claims description 9
- QFWPJPIVLCBXFJ-UHFFFAOYSA-N glymidine Chemical compound N1=CC(OCCOC)=CN=C1NS(=O)(=O)C1=CC=CC=C1 QFWPJPIVLCBXFJ-UHFFFAOYSA-N 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 4
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 2
- 150000001735 carboxylic acids Chemical class 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 30
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 24
- 230000000052 comparative effect Effects 0.000 description 22
- 238000002474 experimental method Methods 0.000 description 19
- 239000000243 solution Substances 0.000 description 16
- 239000007789 gas Substances 0.000 description 15
- 239000000047 product Substances 0.000 description 12
- 229910052763 palladium Inorganic materials 0.000 description 11
- 239000000725 suspension Substances 0.000 description 10
- -1 vinyl compound Chemical class 0.000 description 9
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 125000004429 atom Chemical group 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 229910052736 halogen Inorganic materials 0.000 description 6
- 150000002367 halogens Chemical class 0.000 description 6
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 6
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 6
- JLKDVMWYMMLWTI-UHFFFAOYSA-M potassium iodate Chemical compound [K+].[O-]I(=O)=O JLKDVMWYMMLWTI-UHFFFAOYSA-M 0.000 description 6
- 239000001230 potassium iodate Substances 0.000 description 6
- 235000006666 potassium iodate Nutrition 0.000 description 6
- 229940093930 potassium iodate Drugs 0.000 description 6
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 5
- XQPRBTXUXXVTKB-UHFFFAOYSA-M caesium iodide Chemical compound [I-].[Cs+] XQPRBTXUXXVTKB-UHFFFAOYSA-M 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- XZXYQEHISUMZAT-UHFFFAOYSA-N 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol Chemical compound CC1=CC=C(O)C(CC=2C(=CC=C(C)C=2)O)=C1 XZXYQEHISUMZAT-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 229940107816 ammonium iodide Drugs 0.000 description 4
- 229910052792 caesium Inorganic materials 0.000 description 4
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 4
- 238000004817 gas chromatography Methods 0.000 description 4
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000007791 liquid phase Substances 0.000 description 4
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- LYQFWZFBNBDLEO-UHFFFAOYSA-M caesium bromide Chemical compound [Br-].[Cs+] LYQFWZFBNBDLEO-UHFFFAOYSA-M 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- ICIWUVCWSCSTAQ-UHFFFAOYSA-M iodate Chemical compound [O-]I(=O)=O ICIWUVCWSCSTAQ-UHFFFAOYSA-M 0.000 description 3
- 238000006317 isomerization reaction Methods 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- DPKBAXPHAYBPRL-UHFFFAOYSA-M tetrabutylazanium;iodide Chemical compound [I-].CCCC[N+](CCCC)(CCCC)CCCC DPKBAXPHAYBPRL-UHFFFAOYSA-M 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 150000005840 aryl radicals Chemical class 0.000 description 2
- ZRDJERPXCFOFCP-UHFFFAOYSA-N azane;iodic acid Chemical compound [NH4+].[O-]I(=O)=O ZRDJERPXCFOFCP-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 150000002941 palladium compounds Chemical class 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 239000001103 potassium chloride Substances 0.000 description 2
- 235000011164 potassium chloride Nutrition 0.000 description 2
- BJDYCCHRZIFCGN-UHFFFAOYSA-N pyridin-1-ium;iodide Chemical compound I.C1=CC=NC=C1 BJDYCCHRZIFCGN-UHFFFAOYSA-N 0.000 description 2
- 125000001453 quaternary ammonium group Chemical group 0.000 description 2
- 229910052701 rubidium Inorganic materials 0.000 description 2
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 235000009518 sodium iodide Nutrition 0.000 description 2
- UZPGPVQCDJXSNM-UHFFFAOYSA-M tetrabutylazanium;iodate Chemical compound [O-]I(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC UZPGPVQCDJXSNM-UHFFFAOYSA-M 0.000 description 2
- ANCWWFAROKLXRF-UHFFFAOYSA-M tetraethylazanium;iodate Chemical compound [O-]I(=O)=O.CC[N+](CC)(CC)CC ANCWWFAROKLXRF-UHFFFAOYSA-M 0.000 description 2
- KKLAORVGAKUOPZ-UHFFFAOYSA-M trimethyl(phenyl)azanium;iodide Chemical compound [I-].C[N+](C)(C)C1=CC=CC=C1 KKLAORVGAKUOPZ-UHFFFAOYSA-M 0.000 description 2
- JTXMVXSTHSMVQF-UHFFFAOYSA-N 2-acetyloxyethyl acetate Chemical compound CC(=O)OCCOC(C)=O JTXMVXSTHSMVQF-UHFFFAOYSA-N 0.000 description 1
- WBPWDGRYHFQTRC-UHFFFAOYSA-N 2-ethoxycyclohexan-1-one Chemical compound CCOC1CCCCC1=O WBPWDGRYHFQTRC-UHFFFAOYSA-N 0.000 description 1
- XWNSFEAWWGGSKJ-UHFFFAOYSA-N 4-acetyl-4-methylheptanedinitrile Chemical compound N#CCCC(C)(C(=O)C)CCC#N XWNSFEAWWGGSKJ-UHFFFAOYSA-N 0.000 description 1
- 206010067484 Adverse reaction Diseases 0.000 description 1
- 244000144725 Amygdalus communis Species 0.000 description 1
- 235000011437 Amygdalus communis Nutrition 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 239000004153 Potassium bromate Substances 0.000 description 1
- 241000589614 Pseudomonas stutzeri Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- HHUIAYDQMNHELC-UHFFFAOYSA-N [O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O Chemical compound [O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O HHUIAYDQMNHELC-UHFFFAOYSA-N 0.000 description 1
- 230000006838 adverse reaction Effects 0.000 description 1
- 235000020224 almond Nutrition 0.000 description 1
- KFQARYBEAKAXIC-UHFFFAOYSA-N aniline;hydroiodide Chemical compound [I-].[NH3+]C1=CC=CC=C1 KFQARYBEAKAXIC-UHFFFAOYSA-N 0.000 description 1
- JWLJBISFJGEYMT-UHFFFAOYSA-M benzyl(triethyl)azanium;iodide Chemical compound [I-].CC[N+](CC)(CC)CC1=CC=CC=C1 JWLJBISFJGEYMT-UHFFFAOYSA-M 0.000 description 1
- LDZOLAWKYDGFCT-UHFFFAOYSA-M benzyl(trimethyl)azanium;iodate Chemical compound [O-]I(=O)=O.C[N+](C)(C)CC1=CC=CC=C1 LDZOLAWKYDGFCT-UHFFFAOYSA-M 0.000 description 1
- LRRJQNMXIDXNIM-UHFFFAOYSA-M benzyl(trimethyl)azanium;iodide Chemical compound [I-].C[N+](C)(C)CC1=CC=CC=C1 LRRJQNMXIDXNIM-UHFFFAOYSA-M 0.000 description 1
- SXDBWCPKPHAZSM-UHFFFAOYSA-N bromic acid Chemical compound OBr(=O)=O SXDBWCPKPHAZSM-UHFFFAOYSA-N 0.000 description 1
- CALQKRVFTWDYDG-UHFFFAOYSA-N butan-1-amine;hydroiodide Chemical compound [I-].CCCC[NH3+] CALQKRVFTWDYDG-UHFFFAOYSA-N 0.000 description 1
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 1
- FJBGREZEDFYYND-UHFFFAOYSA-N butylazanium;iodate Chemical compound [O-]I(=O)=O.CCCC[NH3+] FJBGREZEDFYYND-UHFFFAOYSA-N 0.000 description 1
- AIYUHDOJVYHVIT-UHFFFAOYSA-M caesium chloride Chemical compound [Cl-].[Cs+] AIYUHDOJVYHVIT-UHFFFAOYSA-M 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 239000012159 carrier gas Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- PWTKVYZOHUKOTQ-UHFFFAOYSA-L cesium rubidium(1+) diiodide Chemical compound [Rb+].[I-].[I-].[Cs+] PWTKVYZOHUKOTQ-UHFFFAOYSA-L 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- TXNFFBUJDPCRJM-UHFFFAOYSA-N dimethylazanium;iodate Chemical compound C[NH2+]C.[O-]I(=O)=O TXNFFBUJDPCRJM-UHFFFAOYSA-N 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- SHZQUVJYXDBXTN-UHFFFAOYSA-M dodecyl(trimethyl)azanium iodate Chemical compound [O-]I(=O)=O.CCCCCCCCCCCC[N+](C)(C)C SHZQUVJYXDBXTN-UHFFFAOYSA-M 0.000 description 1
- YIFWXQBNRQNUON-UHFFFAOYSA-M dodecyl(trimethyl)azanium;iodide Chemical compound [I-].CCCCCCCCCCCC[N+](C)(C)C YIFWXQBNRQNUON-UHFFFAOYSA-M 0.000 description 1
- VYJOHKGAZLBXNR-UHFFFAOYSA-N ethylazanium;iodate Chemical compound CC[NH3+].[O-]I(=O)=O VYJOHKGAZLBXNR-UHFFFAOYSA-N 0.000 description 1
- XFYICZOIWSBQSK-UHFFFAOYSA-N ethylazanium;iodide Chemical compound [I-].CC[NH3+] XFYICZOIWSBQSK-UHFFFAOYSA-N 0.000 description 1
- 238000010574 gas phase reaction Methods 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- IVUHDTWRNCXVCD-UHFFFAOYSA-N methylazanium;iodate Chemical compound [NH3+]C.[O-]I(=O)=O IVUHDTWRNCXVCD-UHFFFAOYSA-N 0.000 description 1
- LLWRXQXPJMPHLR-UHFFFAOYSA-N methylazanium;iodide Chemical compound [I-].[NH3+]C LLWRXQXPJMPHLR-UHFFFAOYSA-N 0.000 description 1
- JMXLWMIFDJCGBV-UHFFFAOYSA-N n-methylmethanamine;hydroiodide Chemical compound [I-].C[NH2+]C JMXLWMIFDJCGBV-UHFFFAOYSA-N 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- GPNDARIEYHPYAY-UHFFFAOYSA-N palladium(ii) nitrate Chemical compound [Pd+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O GPNDARIEYHPYAY-UHFFFAOYSA-N 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-O phenylazanium Chemical compound [NH3+]C1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-O 0.000 description 1
- 229940094037 potassium bromate Drugs 0.000 description 1
- 235000019396 potassium bromate Nutrition 0.000 description 1
- VKJKEPKFPUWCAS-UHFFFAOYSA-M potassium chlorate Chemical compound [K+].[O-]Cl(=O)=O VKJKEPKFPUWCAS-UHFFFAOYSA-M 0.000 description 1
- MXXRJZJYTALZLW-UHFFFAOYSA-M potassium iodite Chemical compound [K+].[O-]I=O MXXRJZJYTALZLW-UHFFFAOYSA-M 0.000 description 1
- XCXHVVWAGKXDTH-UHFFFAOYSA-N pyridin-1-ium;iodate Chemical compound [O-]I(=O)=O.C1=CC=[NH+]C=C1 XCXHVVWAGKXDTH-UHFFFAOYSA-N 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- WFUBYPSJBBQSOU-UHFFFAOYSA-M rubidium iodide Inorganic materials [Rb+].[I-] WFUBYPSJBBQSOU-UHFFFAOYSA-M 0.000 description 1
- CIOUAZZDKTZOPK-UHFFFAOYSA-M rubidium(1+);iodate Chemical compound [Rb+].[O-]I(=O)=O CIOUAZZDKTZOPK-UHFFFAOYSA-M 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- YUISSJZXEJELPR-UHFFFAOYSA-L tetrabutylazanium tetraethylazanium diiodide Chemical compound C(C)[N+](CC)(CC)CC.C(CCC)[N+](CCCC)(CCCC)CCCC.[I-].[I-] YUISSJZXEJELPR-UHFFFAOYSA-L 0.000 description 1
- HWCKGOZZJDHMNC-UHFFFAOYSA-M tetraethylammonium bromide Chemical compound [Br-].CC[N+](CC)(CC)CC HWCKGOZZJDHMNC-UHFFFAOYSA-M 0.000 description 1
- UQFSVBXCNGCBBW-UHFFFAOYSA-M tetraethylammonium iodide Chemical compound [I-].CC[N+](CC)(CC)CC UQFSVBXCNGCBBW-UHFFFAOYSA-M 0.000 description 1
- ZRVXFJFFJZFRLQ-UHFFFAOYSA-M tetramethylazanium;iodate Chemical compound [O-]I(=O)=O.C[N+](C)(C)C ZRVXFJFFJZFRLQ-UHFFFAOYSA-M 0.000 description 1
- RXMRGBVLCSYIBO-UHFFFAOYSA-M tetramethylazanium;iodide Chemical compound [I-].C[N+](C)(C)C RXMRGBVLCSYIBO-UHFFFAOYSA-M 0.000 description 1
- OMOVEABCHCGWHU-UHFFFAOYSA-N trimethylazanium;iodate Chemical compound C[NH+](C)C.[O-]I(=O)=O OMOVEABCHCGWHU-UHFFFAOYSA-N 0.000 description 1
- CURCMGVZNYCRNY-UHFFFAOYSA-N trimethylazanium;iodide Chemical compound I.CN(C)C CURCMGVZNYCRNY-UHFFFAOYSA-N 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/62—Halogen-containing esters
- C07C69/63—Halogen-containing esters of saturated acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/04—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds
- C07C67/05—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds with oxidation
- C07C67/055—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds with oxidation in the presence of platinum group metals or their compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4142176A JPS52125107A (en) | 1976-04-14 | 1976-04-14 | Production of 1,4-diacyloxybutene-2 |
| JP4776976A JPS52131518A (en) | 1976-04-28 | 1976-04-28 | Preparation of 1,4-diacyloxybutene-2 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2716000A1 DE2716000A1 (de) | 1977-10-27 |
| DE2716000C2 true DE2716000C2 (de) | 1982-07-08 |
Family
ID=26381032
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2716000A Expired DE2716000C2 (de) | 1976-04-14 | 1977-04-09 | Verfahren zur Herstellung von 1,4- Diacyloxybuten-(2) |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4113970A (enExample) |
| DE (1) | DE2716000C2 (enExample) |
| FR (1) | FR2348186A1 (enExample) |
| GB (1) | GB1515264A (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3022722A1 (de) * | 1980-06-18 | 1982-01-07 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von 1-buten-3,4-diolmonoestern und neue 1-buten-3-alkyl-3,4-diolmonester |
| DE3309168A1 (de) * | 1983-03-15 | 1984-09-20 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von diacyloxibutenen |
| FR2635471A1 (fr) * | 1988-08-22 | 1990-02-23 | Solvay | Compositions catalytiques, procede pour leur obtention et procede d'hydrogenation de 1,1,2-trichloro-1,2,2-trifluorethane au moyen de ces compositions |
| US6096933A (en) * | 1996-02-01 | 2000-08-01 | Phillips Petroleum Company | Hydrocarbon hydrogenation and catalyst therefor |
| AU692723B2 (en) * | 1996-02-01 | 1998-06-11 | Phillips Petroleum Company | Catalyst composition and process for selecting hydrogenation of diolefins |
| US6127588A (en) | 1998-10-21 | 2000-10-03 | Phillips Petroleum Company | Hydrocarbon hydrogenation catalyst and process |
| DE10009187A1 (de) * | 2000-02-26 | 2001-08-30 | Degussa | Verfahren zur Herstellung von Wasserstoffperoxid durch Direktsynthese und Edelmetallkatalysator hierfür |
| MY137042A (en) * | 2002-06-14 | 2008-12-31 | Chevron Phillips Chemical Co | Hydrogenation palladium-silver catalyst and methods |
| US7199076B2 (en) * | 2003-12-19 | 2007-04-03 | Chevron Phillips Chemical Company Lp | Methods of making and using a selective hydrogenation catalyst |
| DE602006011469D1 (de) | 2005-07-27 | 2010-02-11 | Chevron Phillips Chemical Co | Verfahren zur herstellung und verwendung eines selektiven hydrierungkatalysators |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1138366A (en) * | 1965-05-13 | 1969-01-01 | Ici Ltd | Improvements in and relating to the production of unsaturated compounds |
| FR1490400A (fr) * | 1966-03-07 | 1967-07-28 | Mitsui Petrochemical Ind | Procédé de préparation d'esters d'acides carboxyliques et d'alcools non saturés |
| JPS4827290B1 (enExample) * | 1969-03-18 | 1973-08-21 |
-
1977
- 1977-04-09 DE DE2716000A patent/DE2716000C2/de not_active Expired
- 1977-04-11 US US05/786,325 patent/US4113970A/en not_active Expired - Lifetime
- 1977-04-13 FR FR7711118A patent/FR2348186A1/fr active Granted
- 1977-04-14 GB GB15526/77A patent/GB1515264A/en not_active Expired
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT |
Also Published As
| Publication number | Publication date |
|---|---|
| US4113970A (en) | 1978-09-12 |
| FR2348186B1 (enExample) | 1979-06-22 |
| DE2716000A1 (de) | 1977-10-27 |
| GB1515264A (en) | 1978-06-21 |
| FR2348186A1 (fr) | 1977-11-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2716000C2 (de) | Verfahren zur Herstellung von 1,4- Diacyloxybuten-(2) | |
| DE1768909A1 (de) | Verfahren zur Herstellung von ungesaettigten Acylhalogeniden | |
| DE69012061T2 (de) | Verfahren zur herstellung von kohlenstoffsäureestern und katalysator dazu. | |
| EP0844994B1 (de) | Verfahren zur herstellung von butyrolactonen | |
| DE69008628T2 (de) | Verfahren zur Dimerisierung von aromatischen Halogenverbindungen. | |
| EP0081152A1 (de) | Verfahren zur Herstellung von Essigsäureanhydrid und/oder Essigsäure und/oder Ethylidendiacetat | |
| DE2722741A1 (de) | Verfahren zur stereoselektiven hydrierung von alpha-pinen | |
| DE2415742B2 (de) | Verfahren zur Herstellung von Carbonsäureestern | |
| DE3432015A1 (de) | Verfahren zur herstellung von aminen | |
| DE69418768T2 (de) | Verfahren zur Herstellung von N-acylierten Aminophenolen | |
| DE3104310A1 (de) | Verfahren zur herstellung von 5-chlor-2-nitroanilin | |
| DE2502092A1 (de) | Verfahren zur herstellung von aromatischen trifluormethylverbindungen der benzolreihe | |
| DE69114145T2 (de) | Katalytische hydrogenolyse. | |
| EP0090977B2 (de) | Verfahren zur Herstellung von Kohlensäureestern | |
| DE69704836T2 (de) | Verfahren zur Herstellung von Benzoylchloriden | |
| DE2538158B2 (de) | Verfahren zur herstellung von monochlorbenzoylchlorid | |
| DE2645844A1 (de) | Verfahren zur herstellung von oxalsaeureestern | |
| EP0226942A2 (de) | Verfahren zur Herstellung von ungesättigten aliphatischen Carbonsäureanhydriden | |
| DE947304C (de) | Verfahren zur Herstellung von 1, 3, 5-Trichlorbenzol durch Isomerisierung anderer Trichlorbenzole | |
| DE69313166T2 (de) | Verfahren zur Herstellung eines Diesters der Kohlensäure | |
| DE19903925B4 (de) | Verfahren zur Herstellung eines Styrolderivates | |
| DE2234249A1 (de) | Verfahren zur herstellung ungesaettigter aldehyde | |
| DE820303C (de) | Verfahren zur Herstellung organischer Saeuren sowie deren Ester | |
| DE3151543A1 (de) | Verfahren zur herstellung von ameisensaeureestern | |
| DE2165738A1 (de) | Verfahren zur Herstellung von Allylacetat |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8125 | Change of the main classification |
Ipc: C07C 69/007 |
|
| 8126 | Change of the secondary classification |
Ipc: C07C 69/16 |
|
| D2 | Grant after examination | ||
| 8339 | Ceased/non-payment of the annual fee |