DE2701638A1 - Phosphorverbindungen enthaltende isoliermassen - Google Patents
Phosphorverbindungen enthaltende isoliermassenInfo
- Publication number
- DE2701638A1 DE2701638A1 DE19772701638 DE2701638A DE2701638A1 DE 2701638 A1 DE2701638 A1 DE 2701638A1 DE 19772701638 DE19772701638 DE 19772701638 DE 2701638 A DE2701638 A DE 2701638A DE 2701638 A1 DE2701638 A1 DE 2701638A1
- Authority
- DE
- Germany
- Prior art keywords
- compound
- group
- groups
- polymer
- phosphorus
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 150000001875 compounds Chemical class 0.000 title claims description 48
- 150000003018 phosphorus compounds Chemical class 0.000 title description 6
- -1 polysiloxane Polymers 0.000 claims description 63
- 229920000642 polymer Polymers 0.000 claims description 33
- 150000003254 radicals Chemical class 0.000 claims description 32
- 229910052698 phosphorus Inorganic materials 0.000 claims description 31
- 239000011574 phosphorus Substances 0.000 claims description 27
- 239000000654 additive Substances 0.000 claims description 22
- 239000000203 mixture Substances 0.000 claims description 17
- 150000003839 salts Chemical class 0.000 claims description 14
- 230000000996 additive effect Effects 0.000 claims description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 11
- 229910052760 oxygen Inorganic materials 0.000 claims description 11
- 239000001301 oxygen Substances 0.000 claims description 11
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 10
- 230000003628 erosive effect Effects 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- 229910052717 sulfur Inorganic materials 0.000 claims description 9
- 239000011593 sulfur Substances 0.000 claims description 9
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 8
- 239000007983 Tris buffer Substances 0.000 claims description 8
- 230000015572 biosynthetic process Effects 0.000 claims description 8
- 229920001577 copolymer Polymers 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 125000001424 substituent group Chemical group 0.000 claims description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 6
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 claims description 6
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- WMWXXXSCZVGQAR-UHFFFAOYSA-N dialuminum;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3] WMWXXXSCZVGQAR-UHFFFAOYSA-N 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 125000004437 phosphorous atom Chemical group 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 5
- 229910019142 PO4 Inorganic materials 0.000 claims description 5
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 claims description 5
- 125000004429 atom Chemical group 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 229940126214 compound 3 Drugs 0.000 claims description 5
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- 239000011737 fluorine Substances 0.000 claims description 5
- 239000007788 liquid Substances 0.000 claims description 5
- 125000003107 substituted aryl group Chemical group 0.000 claims description 5
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 4
- 150000001336 alkenes Chemical class 0.000 claims description 4
- 229910052782 aluminium Inorganic materials 0.000 claims description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 4
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 4
- 230000002401 inhibitory effect Effects 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 229910052759 nickel Inorganic materials 0.000 claims description 4
- 150000002894 organic compounds Chemical class 0.000 claims description 4
- 239000010452 phosphate Substances 0.000 claims description 4
- 229910052710 silicon Inorganic materials 0.000 claims description 4
- 239000010703 silicon Substances 0.000 claims description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 4
- 229920002554 vinyl polymer Polymers 0.000 claims description 4
- 229910052725 zinc Inorganic materials 0.000 claims description 4
- 239000011701 zinc Substances 0.000 claims description 4
- DREPONDJUKIQLX-UHFFFAOYSA-N 1-[ethenyl(ethoxy)phosphoryl]oxyethane Chemical compound CCOP(=O)(C=C)OCC DREPONDJUKIQLX-UHFFFAOYSA-N 0.000 claims description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 3
- RKJGHINMWRVRJW-UHFFFAOYSA-N 3-[bis(2-ethylhexyl)phosphorylmethyl]heptane Chemical compound CCCCC(CC)CP(=O)(CC(CC)CCCC)CC(CC)CCCC RKJGHINMWRVRJW-UHFFFAOYSA-N 0.000 claims description 3
- 239000004698 Polyethylene Substances 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 3
- SSTALXWJLKACQG-UHFFFAOYSA-L calcium;dioxido-oxo-phenyl-$l^{5}-phosphane Chemical compound [Ca+2].[O-]P([O-])(=O)C1=CC=CC=C1 SSTALXWJLKACQG-UHFFFAOYSA-L 0.000 claims description 3
- 150000001768 cations Chemical class 0.000 claims description 3
- 229910017052 cobalt Inorganic materials 0.000 claims description 3
- 239000010941 cobalt Substances 0.000 claims description 3
- 238000009413 insulation Methods 0.000 claims description 3
- 239000002245 particle Substances 0.000 claims description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 3
- 229910000073 phosphorus hydride Inorganic materials 0.000 claims description 3
- 229920000573 polyethylene Polymers 0.000 claims description 3
- 229920001296 polysiloxane Polymers 0.000 claims description 3
- 239000002243 precursor Substances 0.000 claims description 3
- CNUJLMSKURPSHE-UHFFFAOYSA-N trioctadecyl phosphite Chemical compound CCCCCCCCCCCCCCCCCCOP(OCCCCCCCCCCCCCCCCCC)OCCCCCCCCCCCCCCCCCC CNUJLMSKURPSHE-UHFFFAOYSA-N 0.000 claims description 3
- VYXPIEPOZNGSJX-UHFFFAOYSA-L zinc;dioxido-oxo-phenyl-$l^{5}-phosphane Chemical compound [Zn+2].[O-]P([O-])(=O)C1=CC=CC=C1 VYXPIEPOZNGSJX-UHFFFAOYSA-L 0.000 claims description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 2
- 239000005977 Ethylene Substances 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 238000009835 boiling Methods 0.000 claims description 2
- 150000001993 dienes Chemical class 0.000 claims description 2
- 239000003822 epoxy resin Substances 0.000 claims description 2
- HQQADJVZYDDRJT-UHFFFAOYSA-N ethene;prop-1-ene Chemical group C=C.CC=C HQQADJVZYDDRJT-UHFFFAOYSA-N 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 239000012774 insulation material Substances 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 229910021645 metal ion Inorganic materials 0.000 claims description 2
- 125000000962 organic group Chemical group 0.000 claims description 2
- ACVYVLVWPXVTIT-UHFFFAOYSA-N phosphinic acid Chemical compound O[PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-N 0.000 claims description 2
- 150000003009 phosphonic acids Chemical class 0.000 claims description 2
- 229920000647 polyepoxide Polymers 0.000 claims description 2
- 229920001897 terpolymer Polymers 0.000 claims description 2
- MDDUHVRJJAFRAU-YZNNVMRBSA-N tert-butyl-[(1r,3s,5z)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2-diphenylphosphorylethylidene)-4-methylidenecyclohexyl]oxy-dimethylsilane Chemical compound C1[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)C(=C)\C1=C/CP(=O)(C=1C=CC=CC=1)C1=CC=CC=C1 MDDUHVRJJAFRAU-YZNNVMRBSA-N 0.000 claims description 2
- 229910052723 transition metal Inorganic materials 0.000 claims description 2
- 150000003624 transition metals Chemical class 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims 3
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims 2
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical group [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 claims 2
- 239000004743 Polypropylene Substances 0.000 claims 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims 1
- RMRFFCXPLWYOOY-UHFFFAOYSA-N allyl radical Chemical group [CH2]C=C RMRFFCXPLWYOOY-UHFFFAOYSA-N 0.000 claims 1
- 159000000007 calcium salts Chemical class 0.000 claims 1
- 229940125898 compound 5 Drugs 0.000 claims 1
- CGPRUXZTHGTMKW-UHFFFAOYSA-N ethene;ethyl prop-2-enoate Chemical compound C=C.CCOC(=O)C=C CGPRUXZTHGTMKW-UHFFFAOYSA-N 0.000 claims 1
- CMPQUABWPXYYSH-UHFFFAOYSA-N phenyl phosphate Chemical compound OP(O)(=O)OC1=CC=CC=C1 CMPQUABWPXYYSH-UHFFFAOYSA-N 0.000 claims 1
- ACVYVLVWPXVTIT-UHFFFAOYSA-M phosphinate Chemical compound [O-][PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-M 0.000 claims 1
- XRBCRPZXSCBRTK-UHFFFAOYSA-N phosphonous acid Chemical compound OPO XRBCRPZXSCBRTK-UHFFFAOYSA-N 0.000 claims 1
- 229920001155 polypropylene Polymers 0.000 claims 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims 1
- 239000007787 solid Substances 0.000 claims 1
- OKQKDCXVLPGWPO-UHFFFAOYSA-N sulfanylidenephosphane Chemical compound S=P OKQKDCXVLPGWPO-UHFFFAOYSA-N 0.000 claims 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 6
- 125000003342 alkenyl group Chemical group 0.000 description 4
- 239000000395 magnesium oxide Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- GBBSRAPFLXBZEO-UHFFFAOYSA-J C(C)C(C1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C)P([O-])([O-])=O.C(C)C(C1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C)P([O-])([O-])=O.[Ni+4] Chemical compound C(C)C(C1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C)P([O-])([O-])=O.C(C)C(C1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C)P([O-])([O-])=O.[Ni+4] GBBSRAPFLXBZEO-UHFFFAOYSA-J 0.000 description 3
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- SSVSHJXHXYNILI-UHFFFAOYSA-L dioxido-oxo-phenyl-$l^{5}-phosphane;nickel(2+) Chemical compound [Ni+2].[O-]P([O-])(=O)C1=CC=CC=C1 SSVSHJXHXYNILI-UHFFFAOYSA-L 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 3
- 235000021317 phosphate Nutrition 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- FIDRAVVQGKNYQK-UHFFFAOYSA-N 1,2,3,4-tetrahydrotriazine Chemical compound C1NNNC=C1 FIDRAVVQGKNYQK-UHFFFAOYSA-N 0.000 description 2
- AATNZNJRDOVKDD-UHFFFAOYSA-N 1-[ethoxy(ethyl)phosphoryl]oxyethane Chemical compound CCOP(=O)(CC)OCC AATNZNJRDOVKDD-UHFFFAOYSA-N 0.000 description 2
- QMOMLBXAJYQNCP-UHFFFAOYSA-N 1-[pentoxy(pentyl)phosphoryl]oxypentane Chemical compound CCCCCOP(=O)(CCCCC)OCCCCC QMOMLBXAJYQNCP-UHFFFAOYSA-N 0.000 description 2
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 2
- 239000004114 Ammonium polyphosphate Substances 0.000 description 2
- QLZHNIAADXEJJP-UHFFFAOYSA-N Phenylphosphonic acid Chemical compound OP(O)(=O)C1=CC=CC=C1 QLZHNIAADXEJJP-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 235000019826 ammonium polyphosphate Nutrition 0.000 description 2
- 229920001276 ammonium polyphosphate Polymers 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- YSRMRWIQPVDQBV-UHFFFAOYSA-N bis(prop-2-enoxy)phosphorylbenzene Chemical compound C=CCOP(=O)(OCC=C)C1=CC=CC=C1 YSRMRWIQPVDQBV-UHFFFAOYSA-N 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- UOCIZHQMWNPGEN-UHFFFAOYSA-N dialuminum;oxygen(2-);trihydrate Chemical compound O.O.O.[O-2].[O-2].[O-2].[Al+3].[Al+3] UOCIZHQMWNPGEN-UHFFFAOYSA-N 0.000 description 2
- AIPRAPZUGUTQKX-UHFFFAOYSA-N diethoxyphosphorylmethylbenzene Chemical compound CCOP(=O)(OCC)CC1=CC=CC=C1 AIPRAPZUGUTQKX-UHFFFAOYSA-N 0.000 description 2
- BEQVQKJCLJBTKZ-UHFFFAOYSA-N diphenylphosphinic acid Chemical compound C=1C=CC=CC=1P(=O)(O)C1=CC=CC=C1 BEQVQKJCLJBTKZ-UHFFFAOYSA-N 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 229910000159 nickel phosphate Inorganic materials 0.000 description 2
- JOCJYBPHESYFOK-UHFFFAOYSA-K nickel(3+);phosphate Chemical compound [Ni+3].[O-]P([O-])([O-])=O JOCJYBPHESYFOK-UHFFFAOYSA-K 0.000 description 2
- UPDNYUVJHQABBS-UHFFFAOYSA-N phenoxy(diphenyl)phosphane Chemical compound C=1C=CC=CC=1OP(C=1C=CC=CC=1)C1=CC=CC=C1 UPDNYUVJHQABBS-UHFFFAOYSA-N 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical group CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 239000004071 soot Substances 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 230000000087 stabilizing effect Effects 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- IVIIAEVMQHEPAY-UHFFFAOYSA-N tridodecyl phosphite Chemical compound CCCCCCCCCCCCOP(OCCCCCCCCCCCC)OCCCCCCCCCCCC IVIIAEVMQHEPAY-UHFFFAOYSA-N 0.000 description 2
- 150000004684 trihydrates Chemical class 0.000 description 2
- IKXFIBBKEARMLL-UHFFFAOYSA-N triphenoxy(sulfanylidene)-$l^{5}-phosphane Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=S)OC1=CC=CC=C1 IKXFIBBKEARMLL-UHFFFAOYSA-N 0.000 description 2
- XZZNDPSIHUTMOC-UHFFFAOYSA-N triphenyl phosphate Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=O)OC1=CC=CC=C1 XZZNDPSIHUTMOC-UHFFFAOYSA-N 0.000 description 2
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 2
- LUVCTYHBTXSAMX-UHFFFAOYSA-N tris(2-chloroethyl) phosphite Chemical compound ClCCOP(OCCCl)OCCCl LUVCTYHBTXSAMX-UHFFFAOYSA-N 0.000 description 2
- 208000016261 weight loss Diseases 0.000 description 2
- 230000004580 weight loss Effects 0.000 description 2
- 125000005940 1,4-dioxanyl group Chemical group 0.000 description 1
- WPBIPDCUDVLEON-UHFFFAOYSA-N 2,4,6-tris(diethoxyphosphoryl)-1,3,5-triazine Chemical compound CCOP(=O)(OCC)C1=NC(P(=O)(OCC)OCC)=NC(P(=O)(OCC)OCC)=N1 WPBIPDCUDVLEON-UHFFFAOYSA-N 0.000 description 1
- PWBRLMKOCGLZAH-UHFFFAOYSA-N 2-(4-ethylphenyl)acetaldehyde Chemical compound CCC1=CC=C(CC=O)C=C1 PWBRLMKOCGLZAH-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- KKZUMAMOMRDVKA-UHFFFAOYSA-N 2-chloropropane Chemical group [CH2]C(C)Cl KKZUMAMOMRDVKA-UHFFFAOYSA-N 0.000 description 1
- HTQOTCWTIXZYJP-UHFFFAOYSA-N 4-[bis(3-cyanopropyl)phosphanyl]butanenitrile Chemical compound N#CCCCP(CCCC#N)CCCC#N HTQOTCWTIXZYJP-UHFFFAOYSA-N 0.000 description 1
- 125000003143 4-hydroxybenzyl group Chemical group [H]C([*])([H])C1=C([H])C([H])=C(O[H])C([H])=C1[H] 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- JJFKJXHONVWDKF-UHFFFAOYSA-H C(C)C(C1=CC=CC=C1)P([O-])([O-])=O.C(C)C(C1=CC=CC=C1)P([O-])([O-])=O.C(C)C(C1=CC=CC=C1)P([O-])([O-])=O.[Al+3].[Al+3] Chemical compound C(C)C(C1=CC=CC=C1)P([O-])([O-])=O.C(C)C(C1=CC=CC=C1)P([O-])([O-])=O.C(C)C(C1=CC=CC=C1)P([O-])([O-])=O.[Al+3].[Al+3] JJFKJXHONVWDKF-UHFFFAOYSA-H 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- NTGBJJWAZVLKLW-UHFFFAOYSA-N O[Si]CCC(F)(F)F Chemical class O[Si]CCC(F)(F)F NTGBJJWAZVLKLW-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 229920003182 Surlyn® Polymers 0.000 description 1
- GTVWRXDRKAHEAD-UHFFFAOYSA-N Tris(2-ethylhexyl) phosphate Chemical compound CCCCC(CC)COP(=O)(OCC(CC)CCCC)OCC(CC)CCCC GTVWRXDRKAHEAD-UHFFFAOYSA-N 0.000 description 1
- JRTGUGKMYJIOBM-UHFFFAOYSA-N [4-[4-[phenoxy-(2-phenylphenoxy)phosphoryl]oxyphenoxy]phenyl] phenyl (2-phenylphenyl) phosphate Chemical compound C=1C=C(OC=2C=CC(OP(=O)(OC=3C=CC=CC=3)OC=3C(=CC=CC=3)C=3C=CC=CC=3)=CC=2)C=CC=1OP(OC=1C(=CC=CC=1)C=1C=CC=CC=1)(=O)OC1=CC=CC=C1 JRTGUGKMYJIOBM-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910052768 actinide Inorganic materials 0.000 description 1
- 150000001255 actinides Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- XQZSFIJLZMTXFD-UHFFFAOYSA-N azanium;diphenylphosphinate Chemical compound [NH4+].C=1C=CC=CC=1P(=O)([O-])C1=CC=CC=C1 XQZSFIJLZMTXFD-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 150000008366 benzophenones Chemical class 0.000 description 1
- 125000003354 benzotriazolyl group Chemical class N1N=NC2=C1C=CC=C2* 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- WSOJYRTVHMMFST-UHFFFAOYSA-N benzyl(ethoxy)phosphinic acid Chemical compound CCOP(O)(=O)CC1=CC=CC=C1 WSOJYRTVHMMFST-UHFFFAOYSA-N 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229920005549 butyl rubber Polymers 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- GKXZRMYDEMWOSP-UHFFFAOYSA-L cobalt(2+);dicyclohexyl-sulfanylidene-sulfido-$l^{5}-phosphane Chemical compound [Co+2].C1CCCCC1P(=S)([S-])C1CCCCC1.C1CCCCC1P(=S)([S-])C1CCCCC1 GKXZRMYDEMWOSP-UHFFFAOYSA-L 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 125000004802 cyanophenyl group Chemical group 0.000 description 1
- 239000011353 cycloaliphatic epoxy resin Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- TYWAKIKWTGMYJY-UHFFFAOYSA-N dicyclohexyl-sulfanyl-sulfanylidene-$l^{5}-phosphane Chemical compound C1CCCCC1P(=S)(S)C1CCCCC1 TYWAKIKWTGMYJY-UHFFFAOYSA-N 0.000 description 1
- RVDJLKVICMLVJQ-UHFFFAOYSA-N diethoxy(phenyl)phosphane Chemical compound CCOP(OCC)C1=CC=CC=C1 RVDJLKVICMLVJQ-UHFFFAOYSA-N 0.000 description 1
- VZEGPPPCKHRYGO-UHFFFAOYSA-N diethoxyphosphorylbenzene Chemical compound CCOP(=O)(OCC)C1=CC=CC=C1 VZEGPPPCKHRYGO-UHFFFAOYSA-N 0.000 description 1
- BEQVQKJCLJBTKZ-UHFFFAOYSA-M diphenylphosphinate Chemical compound C=1C=CC=CC=1P(=O)([O-])C1=CC=CC=C1 BEQVQKJCLJBTKZ-UHFFFAOYSA-M 0.000 description 1
- BXXYQIADDPAMGV-UHFFFAOYSA-N diphenylphosphorylimino(triphenyl)-$l^{5}-phosphane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)N=P(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 BXXYQIADDPAMGV-UHFFFAOYSA-N 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- PYGSKMBEVAICCR-UHFFFAOYSA-N hexa-1,5-diene Chemical group C=CCCC=C PYGSKMBEVAICCR-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000011810 insulating material Substances 0.000 description 1
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 1
- 229910052747 lanthanoid Inorganic materials 0.000 description 1
- 150000002602 lanthanoids Chemical class 0.000 description 1
- 229920001684 low density polyethylene Polymers 0.000 description 1
- 239000004702 low-density polyethylene Substances 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 230000008774 maternal effect Effects 0.000 description 1
- BNQHMZUZDKANKC-UHFFFAOYSA-N methoxy(phenoxy)phosphane Chemical compound COPOC1=CC=CC=C1 BNQHMZUZDKANKC-UHFFFAOYSA-N 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 230000006855 networking Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 125000006501 nitrophenyl group Chemical group 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical class [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- ABTNKPAZMOYEAS-UHFFFAOYSA-N oxo-bis(prop-2-enoxy)phosphanium Chemical compound C=CCO[P+](=O)OCC=C ABTNKPAZMOYEAS-UHFFFAOYSA-N 0.000 description 1
- AUONHKJOIZSQGR-UHFFFAOYSA-N oxophosphane Chemical compound P=O AUONHKJOIZSQGR-UHFFFAOYSA-N 0.000 description 1
- 125000005702 oxyalkylene group Chemical group 0.000 description 1
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- DXCSBPNCZRYVDN-UHFFFAOYSA-N phenoxyphosphinous acid Chemical compound OPOC1=CC=CC=C1 DXCSBPNCZRYVDN-UHFFFAOYSA-N 0.000 description 1
- 150000003003 phosphines Chemical class 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920001083 polybutene Polymers 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 239000012763 reinforcing filler Substances 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- HHJJPFYGIRKQOM-UHFFFAOYSA-N sodium;oxido-oxo-phenylphosphanium Chemical compound [Na+].[O-][P+](=O)C1=CC=CC=C1 HHJJPFYGIRKQOM-UHFFFAOYSA-N 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 150000004763 sulfides Chemical class 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- ZMBHCYHQLYEYDV-UHFFFAOYSA-N trioctylphosphine oxide Chemical compound CCCCCCCCP(=O)(CCCCCCCC)CCCCCCCC ZMBHCYHQLYEYDV-UHFFFAOYSA-N 0.000 description 1
- FIQMHBFVRAXMOP-UHFFFAOYSA-N triphenylphosphane oxide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)C1=CC=CC=C1 FIQMHBFVRAXMOP-UHFFFAOYSA-N 0.000 description 1
- VYNGFCUGSYEOOZ-UHFFFAOYSA-N triphenylphosphine sulfide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=S)C1=CC=CC=C1 VYNGFCUGSYEOOZ-UHFFFAOYSA-N 0.000 description 1
- XHGIFBQQEGRTPB-UHFFFAOYSA-N tris(prop-2-enyl) phosphate Chemical compound C=CCOP(=O)(OCC=C)OCC=C XHGIFBQQEGRTPB-UHFFFAOYSA-N 0.000 description 1
- KJWHEZXBZQXVSA-UHFFFAOYSA-N tris(prop-2-enyl) phosphite Chemical compound C=CCOP(OCC=C)OCC=C KJWHEZXBZQXVSA-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01B—CABLES; CONDUCTORS; INSULATORS; SELECTION OF MATERIALS FOR THEIR CONDUCTIVE, INSULATING OR DIELECTRIC PROPERTIES
- H01B7/00—Insulated conductors or cables characterised by their form
- H01B7/17—Protection against damage caused by external factors, e.g. sheaths or armouring
- H01B7/28—Protection against damage caused by moisture, corrosion, chemical attack or weather
- H01B7/2813—Protection against damage caused by electrical, chemical or water tree deterioration
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01B—CABLES; CONDUCTORS; INSULATORS; SELECTION OF MATERIALS FOR THEIR CONDUCTIVE, INSULATING OR DIELECTRIC PROPERTIES
- H01B3/00—Insulators or insulating bodies characterised by the insulating materials; Selection of materials for their insulating or dielectric properties
- H01B3/18—Insulators or insulating bodies characterised by the insulating materials; Selection of materials for their insulating or dielectric properties mainly consisting of organic substances
Landscapes
- Physics & Mathematics (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Organic Insulating Materials (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/649,797 US4100089A (en) | 1976-01-16 | 1976-01-16 | High-voltage insulating material comprising anti-tracking and erosion inhibiting compounds with insulating polymers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2701638A1 true DE2701638A1 (de) | 1977-07-21 |
Family
ID=24606275
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772701638 Ceased DE2701638A1 (de) | 1976-01-16 | 1977-01-17 | Phosphorverbindungen enthaltende isoliermassen |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4100089A (OSRAM) |
| JP (1) | JPS6033853B2 (OSRAM) |
| CA (1) | CA1089216A (OSRAM) |
| DE (1) | DE2701638A1 (OSRAM) |
| FR (1) | FR2338555A1 (OSRAM) |
| GB (1) | GB1575465A (OSRAM) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2834871A1 (de) * | 1977-08-19 | 1979-03-08 | Sandoz Ag | Arylphosphonite und arylthiophosphonite, deren herstellung und verwendung als antioxydantien |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1590723A (en) * | 1976-08-03 | 1981-06-10 | Raychem Ltd | Hv insulation materials |
| US4219607A (en) * | 1978-01-13 | 1980-08-26 | Raychem Corporation | High voltage insulating compositions containing phosphorus compounds |
| US4223071A (en) * | 1978-01-13 | 1980-09-16 | Raychem Corporation | High voltage insulating compositions containing phosphorus compounds |
| CA1161589A (en) * | 1979-07-19 | 1984-01-31 | Melvin F. Maringer | Electrical tree and water tree resistant polymer compositions |
| DK169628B1 (da) * | 1979-11-03 | 1994-12-27 | Raychem Ltd | Mod vand stabiliseret polymert materiale samt elektrisk udstyr |
| US4560716A (en) * | 1983-08-30 | 1985-12-24 | Kabushiki Kaisha Toyota Chuo Kenkyusho | Rust preventing epoxy resin compositions |
| US4514535A (en) * | 1984-02-01 | 1985-04-30 | National Distillers And Chemical Corporation | Electrical tree and water tree resistant compounds and polymer compositions containing the same |
| DE3511299A1 (de) * | 1985-03-28 | 1986-10-09 | kabelmetal electro GmbH, 3000 Hannover | Kriechstromfester schrumpfschlauch fuer endenabschluesse |
| ZA867242B (en) * | 1985-09-27 | 1987-05-27 | Dsg Schrumpfschlauch Gmbh | Heat shring tubing |
| US5641827A (en) * | 1996-03-20 | 1997-06-24 | Raychem Corporation | Tracking and erosion resistant composition |
| DE19614424A1 (de) | 1996-04-12 | 1997-10-16 | Hoechst Ag | Synergistische Flammschutzmittel-Kombination für Polymere |
| EP1113465A3 (en) * | 1996-05-28 | 2001-08-01 | Hitachi, Ltd. | Soft-magnetic powder composite core having particles with insulating layers |
| DE19903707C2 (de) * | 1999-01-30 | 2003-05-28 | Clariant Gmbh | Flammwidrige duroplastische Massen |
| JP4591662B2 (ja) * | 2004-06-25 | 2010-12-01 | 東洋インキ製造株式会社 | 抗菌剤および抗菌性樹脂組成物 |
| DE102006016753A1 (de) * | 2006-04-10 | 2007-10-11 | Wacker Chemie Ag | Vernetzbare Massen auf der Basis von Organosiliciumverbindungen |
| JP6812345B2 (ja) * | 2014-11-04 | 2021-01-13 | シエル・インターナシヨネイル・リサーチ・マーチヤツピイ・ベー・ウイＳｈｅｌｌ Ｉｎｔｅｒｎａｔｉｏｎａｌｅ Ｒｅｓｅａｒｃｈ Ｍａａｔｓｃｈａｐｐｉｊ Ｂｅｓｌｏｔｅｎ Ｖｅｎｎｏｏｔｓｈａｐ | 潤滑用組成物 |
| US9774174B1 (en) | 2016-03-23 | 2017-09-26 | Eaton Corporation | Dielectric heat transfer windows, and systems and methods using the same |
| US10283945B2 (en) * | 2016-03-23 | 2019-05-07 | Eaton Intelligent Power Limited | Load center thermally conductive component |
| US10115657B2 (en) | 2016-03-23 | 2018-10-30 | Eaton Intelligent Power Limited | Dielectric heat path devices, and systems and methods using the same |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1037930A (en) * | 1963-09-17 | 1966-08-03 | Rostone Corp | Improvements in or relating to a moulding composition for forming into an arc exposure surface of a moulded electrical insulating element |
| US3420792A (en) * | 1967-01-18 | 1969-01-07 | Gen Electric | Stabilized polyphenylene ether |
| US3676393A (en) * | 1968-10-14 | 1972-07-11 | Goodyear Tire & Rubber | Polyesters stabilized by phosphorus compounds |
| US3793473A (en) * | 1970-12-01 | 1974-02-19 | Ici Ltd | Insulated conductor with organometallic stabilizer |
| US3875264A (en) * | 1971-11-24 | 1975-04-01 | Sandoz Ag | Phosphonous acid esters |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2768264A (en) * | 1953-04-28 | 1956-10-23 | Rostone Corp | Arc-suppressing device |
| US2997528A (en) * | 1957-01-09 | 1961-08-22 | Gen Electric | Electrical apparatus having insulation for eliminating creepage tracking |
| US2997526A (en) * | 1957-01-09 | 1961-08-22 | Gen Electric | Electrical apparatus having insulation for eliminating creepage tracking |
| US2997527A (en) * | 1957-01-09 | 1961-08-22 | Gen Electric | Electrical apparatus having insulation for eliminating creepage tracking |
| US3035209A (en) * | 1957-10-11 | 1962-05-15 | Gen Electric | Transformer cover |
| NL281553A (OSRAM) * | 1961-07-31 | |||
| US3192347A (en) * | 1962-01-10 | 1965-06-29 | Ite Circuit Breaker Ltd | Circuit interrupter having track resistant coating thereon |
| US3285954A (en) * | 1962-02-19 | 1966-11-15 | Stauffer Chemical Co | Thiomethylenephosphinic acids |
| US3339013A (en) * | 1963-06-07 | 1967-08-29 | Westinghouse Electric Corp | Arc and tracking resistant insulation |
| US3325444A (en) * | 1964-07-10 | 1967-06-13 | American Cyanamid Co | Stabilized methyl methacrylate monomer and polymer compositions containing a dithio phosphinic acid or a metal salt thereof |
| US3475546A (en) * | 1966-08-22 | 1969-10-28 | Mc Graw Edison Co | Insulating material for electrical apparatus |
| US3626083A (en) * | 1968-01-12 | 1971-12-07 | Westinghouse Electric Corp | High-voltage insulation and insulated high-voltage apparatus |
| JPS5428960B1 (OSRAM) * | 1968-01-22 | 1979-09-20 | ||
| US3645899A (en) * | 1968-08-19 | 1972-02-29 | Ohio Brass Co | Molded epoxy resin electrical insulating body containing alumina and silica |
| US3586802A (en) * | 1968-10-03 | 1971-06-22 | Gen Electric | Load break device with arc-extinguishing material |
| US3772455A (en) * | 1972-12-22 | 1973-11-13 | Gen Electric | Flame and moisture resisting impregnating composition for fibrous materials, and products thereof |
| DE2345799C3 (de) * | 1973-09-11 | 1981-10-08 | Bayer Ag, 5090 Leverkusen | Kriechstromfeste Polycarbonatmassen |
| US3898372A (en) * | 1974-02-11 | 1975-08-05 | Ohio Brass Co | Insulator with resin-bonded fiber rod and elastomeric weathersheds, and method of making same |
-
1976
- 1976-01-16 US US05/649,797 patent/US4100089A/en not_active Expired - Lifetime
-
1977
- 1977-01-13 GB GB1397/77A patent/GB1575465A/en not_active Expired
- 1977-01-14 CA CA269,745A patent/CA1089216A/en not_active Expired
- 1977-01-17 FR FR7701206A patent/FR2338555A1/fr active Granted
- 1977-01-17 DE DE19772701638 patent/DE2701638A1/de not_active Ceased
- 1977-01-17 JP JP52003876A patent/JPS6033853B2/ja not_active Expired
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1037930A (en) * | 1963-09-17 | 1966-08-03 | Rostone Corp | Improvements in or relating to a moulding composition for forming into an arc exposure surface of a moulded electrical insulating element |
| US3420792A (en) * | 1967-01-18 | 1969-01-07 | Gen Electric | Stabilized polyphenylene ether |
| US3676393A (en) * | 1968-10-14 | 1972-07-11 | Goodyear Tire & Rubber | Polyesters stabilized by phosphorus compounds |
| US3793473A (en) * | 1970-12-01 | 1974-02-19 | Ici Ltd | Insulated conductor with organometallic stabilizer |
| US3875264A (en) * | 1971-11-24 | 1975-04-01 | Sandoz Ag | Phosphonous acid esters |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2834871A1 (de) * | 1977-08-19 | 1979-03-08 | Sandoz Ag | Arylphosphonite und arylthiophosphonite, deren herstellung und verwendung als antioxydantien |
Also Published As
| Publication number | Publication date |
|---|---|
| CA1089216A (en) | 1980-11-11 |
| GB1575465A (en) | 1980-09-24 |
| FR2338555B1 (OSRAM) | 1982-10-29 |
| JPS6033853B2 (ja) | 1985-08-05 |
| FR2338555A1 (fr) | 1977-08-12 |
| JPS5288800A (en) | 1977-07-25 |
| US4100089A (en) | 1978-07-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2701638A1 (de) | Phosphorverbindungen enthaltende isoliermassen | |
| EP3083741B1 (de) | Flammgeschütztes thermoplastisches polyurethan | |
| EP1537173B1 (de) | Flammschutzmittel-stabilisator-kombination fur thermoplastische polymere | |
| EP0964886B1 (de) | Flammgeschützte polymerformmassen | |
| EP2825597B1 (de) | Flammgeschütztes thermoplastisches polyurethan enthaltend umhüllte metallhydroxide, phosphor-haltige flammschutzmittel und/oder hydrotalkit bzw. schichtsilikat | |
| EP2563877B1 (de) | Flammschutzmittel-stabilisator-kombination für thermoplastische und duroplastische polymere | |
| EP2864404B1 (de) | Flammgeschütztes thermoplastisches polyurethan auf der basis von polycarbonatdiolen | |
| EP2563876B1 (de) | Flammschutzmittel-stabilisator-kombination für thermoplastische und duroplastische polymere | |
| DE69013273T2 (de) | Polyolefine und Polyphenylenether enthaltende thermoplastische Zusammensetzungen und die daraus hergestellten Gegenstände. | |
| US4198310A (en) | High voltage insulating compositions containing organic polymerizable phosphorus compounds | |
| DE102019201824A1 (de) | Flammschutzmittelmischungen, flammhemmende Polymerzusammensetzungen, damit ausgerüstete Kabel und deren Verwendung | |
| DE102010026973A1 (de) | Flammschutzmittel-Stabilisator-Kombination für thermoplastische Polymere | |
| EP3665218B1 (de) | Flammhemmende polyamidzusammensetzungen und deren verwendung | |
| DE10320465A1 (de) | Flammschutzmittel-Nanocomposite-Kombination für thermoplastische Polymere | |
| EP0896023A1 (de) | Synergistiche Flammschutzmittel-Kombination für Polymere | |
| US4223071A (en) | High voltage insulating compositions containing phosphorus compounds | |
| EP3083734B1 (de) | Flammgeschütztes thermoplastisches polyurethan | |
| DE10226732A1 (de) | Mischungen aus einem Phosphonit und anderen Komponenten | |
| EP2297240A1 (de) | Kautschukmodifizierte flammgeschützte formmassen | |
| US4219607A (en) | High voltage insulating compositions containing phosphorus compounds | |
| EP3679093A1 (de) | Flammschutzmittelkombinationen für polymerzusammensetzungen und deren verwendung | |
| DE102004016125B3 (de) | Halogenfreie flammwidrige Polymermischung für Leitungssysteme und deren Herstellung | |
| WO2011039301A1 (de) | Funktionalisierte expandierbare graphiteinlagerungsverbindungen | |
| DE3812415A1 (de) | Entflammungshemmender zusatz fuer thermoplaste und masse damit | |
| DE3504646A1 (de) | Halogenfreie, selbstverloeschende thermoplastische formmasse |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8131 | Rejection |