DE2647420C2 - Modifiziertes Polysaccarid und Verfahren zu seiner Herstellung - Google Patents
Modifiziertes Polysaccarid und Verfahren zu seiner HerstellungInfo
- Publication number
- DE2647420C2 DE2647420C2 DE2647420A DE2647420A DE2647420C2 DE 2647420 C2 DE2647420 C2 DE 2647420C2 DE 2647420 A DE2647420 A DE 2647420A DE 2647420 A DE2647420 A DE 2647420A DE 2647420 C2 DE2647420 C2 DE 2647420C2
- Authority
- DE
- Germany
- Prior art keywords
- water
- sec
- product
- acrylamide
- polysaccharide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000004676 glycans Chemical class 0.000 title claims description 44
- 229920001282 polysaccharide Polymers 0.000 title claims description 44
- 239000005017 polysaccharide Substances 0.000 title claims description 44
- 238000000034 method Methods 0.000 title claims description 33
- 238000002360 preparation method Methods 0.000 title description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 94
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 54
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 52
- 238000010521 absorption reaction Methods 0.000 claims description 49
- 239000000178 monomer Substances 0.000 claims description 49
- 239000007788 liquid Substances 0.000 claims description 46
- 229920002554 vinyl polymer Polymers 0.000 claims description 38
- 238000006243 chemical reaction Methods 0.000 claims description 33
- 239000000463 material Substances 0.000 claims description 27
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 20
- 229920002678 cellulose Polymers 0.000 claims description 18
- 239000001913 cellulose Substances 0.000 claims description 18
- 229920001059 synthetic polymer Polymers 0.000 claims description 15
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 claims description 14
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical group C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 10
- 238000004519 manufacturing process Methods 0.000 claims description 8
- PQUXFUBNSYCQAL-UHFFFAOYSA-N 1-(2,3-difluorophenyl)ethanone Chemical compound CC(=O)C1=CC=CC(F)=C1F PQUXFUBNSYCQAL-UHFFFAOYSA-N 0.000 claims description 6
- 239000012429 reaction media Substances 0.000 claims description 6
- 229940047670 sodium acrylate Drugs 0.000 claims description 6
- 238000012546 transfer Methods 0.000 claims description 6
- 238000009835 boiling Methods 0.000 claims description 5
- 239000000376 reactant Substances 0.000 claims description 5
- 229920002201 Oxidized cellulose Polymers 0.000 claims description 4
- 229940107304 oxidized cellulose Drugs 0.000 claims description 4
- 239000003701 inert diluent Substances 0.000 claims description 2
- 229920003169 water-soluble polymer Polymers 0.000 claims description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims 1
- 125000002066 L-histidyl group Chemical group [H]N1C([H])=NC(C([H])([H])[C@](C(=O)[*])([H])N([H])[H])=C1[H] 0.000 claims 1
- 229940048053 acrylate Drugs 0.000 claims 1
- 239000011953 free-radical catalyst Substances 0.000 claims 1
- 239000012266 salt solution Substances 0.000 claims 1
- 239000000047 product Substances 0.000 description 113
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 64
- 239000000243 solution Substances 0.000 description 48
- 239000011780 sodium chloride Substances 0.000 description 32
- 229920000742 Cotton Polymers 0.000 description 19
- 235000010980 cellulose Nutrition 0.000 description 17
- 239000003795 chemical substances by application Substances 0.000 description 16
- 229920001577 copolymer Polymers 0.000 description 14
- 239000000203 mixture Substances 0.000 description 14
- 238000012360 testing method Methods 0.000 description 14
- 239000002250 absorbent Substances 0.000 description 13
- 230000002745 absorbent Effects 0.000 description 13
- 239000000499 gel Substances 0.000 description 13
- ZIUHHBKFKCYYJD-UHFFFAOYSA-N n,n'-methylenebisacrylamide Chemical group C=CC(=O)NCNC(=O)C=C ZIUHHBKFKCYYJD-UHFFFAOYSA-N 0.000 description 11
- 229920000642 polymer Polymers 0.000 description 11
- 239000007787 solid Substances 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000012190 activator Substances 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- 239000002002 slurry Substances 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 229920002785 Croscarmellose sodium Polymers 0.000 description 8
- -1 divinyl compound Chemical class 0.000 description 8
- 239000000835 fiber Substances 0.000 description 8
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 7
- 239000001768 carboxy methyl cellulose Substances 0.000 description 7
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 7
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 7
- 239000003085 diluting agent Substances 0.000 description 7
- 229920001519 homopolymer Polymers 0.000 description 7
- 229910052783 alkali metal Inorganic materials 0.000 description 6
- 238000001879 gelation Methods 0.000 description 6
- 238000007792 addition Methods 0.000 description 5
- 238000004132 cross linking Methods 0.000 description 5
- 239000002198 insoluble material Substances 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- 238000006116 polymerization reaction Methods 0.000 description 5
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 229920002472 Starch Polymers 0.000 description 4
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 4
- 239000008186 active pharmaceutical agent Substances 0.000 description 4
- 239000003638 chemical reducing agent Substances 0.000 description 4
- 239000003431 cross linking reagent Substances 0.000 description 4
- 230000002349 favourable effect Effects 0.000 description 4
- 230000036571 hydration Effects 0.000 description 4
- 238000006703 hydration reaction Methods 0.000 description 4
- 239000003999 initiator Substances 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000007800 oxidant agent Substances 0.000 description 4
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- 229920001131 Pulp (paper) Polymers 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 239000012530 fluid Substances 0.000 description 3
- 229920000578 graft copolymer Polymers 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 239000006228 supernatant Substances 0.000 description 3
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- 239000004971 Cross linker Substances 0.000 description 2
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 2
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 2
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- SXLIFQSDMYZOBA-UHFFFAOYSA-N 2,5-bis(ethenyl)pyridine Chemical compound C=CC1=CC=C(C=C)N=C1 SXLIFQSDMYZOBA-UHFFFAOYSA-N 0.000 description 1
- TURITJIWSQEMDB-UHFFFAOYSA-N 2-methyl-n-[(2-methylprop-2-enoylamino)methyl]prop-2-enamide Chemical compound CC(=C)C(=O)NCNC(=O)C(C)=C TURITJIWSQEMDB-UHFFFAOYSA-N 0.000 description 1
- HIWGDJVTAWTBNH-UHFFFAOYSA-N 2-methylidene-5-sulfopentanoic acid Chemical compound OC(=O)C(=C)CCCS(O)(=O)=O HIWGDJVTAWTBNH-UHFFFAOYSA-N 0.000 description 1
- XKIGDOOFWYHZDA-UHFFFAOYSA-M 5-ethenyl-1,2-dimethylpyridin-1-ium;methyl sulfate Chemical compound COS([O-])(=O)=O.CC1=CC=C(C=C)C=[N+]1C XKIGDOOFWYHZDA-UHFFFAOYSA-M 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical class [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 1
- GUTLYIVDDKVIGB-OUBTZVSYSA-N Cobalt-60 Chemical compound [60Co] GUTLYIVDDKVIGB-OUBTZVSYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 244000303965 Cyamopsis psoralioides Species 0.000 description 1
- PQUCIEFHOVEZAU-UHFFFAOYSA-N Diammonium sulfite Chemical compound [NH4+].[NH4+].[O-]S([O-])=O PQUCIEFHOVEZAU-UHFFFAOYSA-N 0.000 description 1
- 101150086776 FAM3C gene Proteins 0.000 description 1
- 125000002842 L-seryl group Chemical group O=C([*])[C@](N([H])[H])([H])C([H])([H])O[H] 0.000 description 1
- 240000006240 Linum usitatissimum Species 0.000 description 1
- 235000019759 Maize starch Nutrition 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- MKYBYDHXWVHEJW-UHFFFAOYSA-N N-[1-oxo-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propan-2-yl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(C(C)NC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 MKYBYDHXWVHEJW-UHFFFAOYSA-N 0.000 description 1
- GLVPUAWFPNGKHO-UHFFFAOYSA-L N.[Fe+2].[O-]S([O-])(=O)=O Chemical compound N.[Fe+2].[O-]S([O-])(=O)=O GLVPUAWFPNGKHO-UHFFFAOYSA-L 0.000 description 1
- 239000004159 Potassium persulphate Substances 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- WWAZUUULUNZNFE-UHFFFAOYSA-N [Na].NC(=O)C=C Chemical compound [Na].NC(=O)C=C WWAZUUULUNZNFE-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium peroxydisulfate Substances [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 1
- VAZSKTXWXKYQJF-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)OOS([O-])=O VAZSKTXWXKYQJF-UHFFFAOYSA-N 0.000 description 1
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- ZETCGWYACBNPIH-UHFFFAOYSA-N azane;sulfurous acid Chemical compound N.OS(O)=O ZETCGWYACBNPIH-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000004364 calculation method Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 238000010894 electron beam technology Methods 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000013529 heat transfer fluid Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 235000015243 ice cream Nutrition 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- IHBKAGRPNRKYAO-UHFFFAOYSA-M methyl sulfate;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium Chemical compound COS([O-])(=O)=O.CC(=C)C(=O)OCC[N+](C)(C)C IHBKAGRPNRKYAO-UHFFFAOYSA-M 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 238000007747 plating Methods 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 150000004804 polysaccharides Polymers 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 235000019394 potassium persulphate Nutrition 0.000 description 1
- 229910052939 potassium sulfate Inorganic materials 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000002203 pretreatment Methods 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000010526 radical polymerization reaction Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 239000004289 sodium hydrogen sulphite Substances 0.000 description 1
- CHQMHPLRPQMAMX-UHFFFAOYSA-L sodium persulfate Substances [Na+].[Na+].[O-]S(=O)(=O)OOS([O-])(=O)=O CHQMHPLRPQMAMX-UHFFFAOYSA-L 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical group [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- SKMHHHHLLBKNKR-UHFFFAOYSA-M sodium;prop-2-enamide;prop-2-enoate Chemical compound [Na+].NC(=O)C=C.[O-]C(=O)C=C SKMHHHHLLBKNKR-UHFFFAOYSA-M 0.000 description 1
- LPXFITACVAQQAL-UHFFFAOYSA-M sodium;prop-2-enoylazanide Chemical compound [Na+].[NH-]C(=O)C=C LPXFITACVAQQAL-UHFFFAOYSA-M 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 239000008399 tap water Substances 0.000 description 1
- 235000020679 tap water Nutrition 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 239000012085 test solution Substances 0.000 description 1
- 238000012549 training Methods 0.000 description 1
- 238000003828 vacuum filtration Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 229940100445 wheat starch Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F251/00—Macromolecular compounds obtained by polymerising monomers on to polysaccharides or derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Graft Or Block Polymers (AREA)
- Polymerisation Methods In General (AREA)
- Absorbent Articles And Supports Therefor (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/625,332 US4028290A (en) | 1975-10-23 | 1975-10-23 | Highly absorbent modified polysaccharides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2647420A1 DE2647420A1 (de) | 1977-04-28 |
| DE2647420C2 true DE2647420C2 (de) | 1982-12-02 |
Family
ID=24505572
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2647420A Expired DE2647420C2 (de) | 1975-10-23 | 1976-10-20 | Modifiziertes Polysaccarid und Verfahren zu seiner Herstellung |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4028290A (Direct) |
| JP (1) | JPS6021164B2 (Direct) |
| AU (1) | AU507842B2 (Direct) |
| BE (1) | BE846610A (Direct) |
| BR (1) | BR7607083A (Direct) |
| CA (1) | CA1075233A (Direct) |
| DE (1) | DE2647420C2 (Direct) |
| ES (1) | ES451462A1 (Direct) |
| FR (1) | FR2328719A1 (Direct) |
| GB (1) | GB1535574A (Direct) |
| IT (1) | IT1069013B (Direct) |
| MX (1) | MX144321A (Direct) |
| NL (1) | NL174149C (Direct) |
| SE (1) | SE433222B (Direct) |
Families Citing this family (91)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4200557A (en) * | 1973-12-07 | 1980-04-29 | Personal Products Company | Absorbent product including grafted insolubilized cellulose ether |
| US4194998A (en) * | 1976-12-06 | 1980-03-25 | The United States Of America As Represented By The Secretary Of Agriculture | Highly absorbent polyhydroxy polymer graft copolymers without saponification |
| US4134863A (en) * | 1976-12-06 | 1979-01-16 | The United States Of America As Represented By The Secretary Of Agriculture | Highly absorbent graft copolymers of polyhydroxy polymers, acrylonitrile, and acrylic comonomers |
| GB1594389A (en) * | 1977-06-03 | 1981-07-30 | Max Planck Gesellschaft | Dressing material for wounds |
| US4242242A (en) * | 1977-06-10 | 1980-12-30 | Akzona Incorporated | Highly absorbent fibers of rayon with sulfonic acid polymer incorporated |
| US4131576A (en) * | 1977-12-15 | 1978-12-26 | National Starch And Chemical Corporation | Process for the preparation of graft copolymers of a water soluble monomer and polysaccharide employing a two-phase reaction system |
| US4153585A (en) * | 1978-05-08 | 1979-05-08 | National Starch And Chemical Corporation | Starch ether derivatives and process for the preparation thereof |
| US4267103A (en) * | 1978-12-07 | 1981-05-12 | The B. F. Goodrich Company | Solvent polymerization of carboxyl containing monomers |
| DE2900110A1 (de) * | 1979-01-03 | 1980-07-10 | Wolff Walsrode Ag | Loesliche makromolekularsubstanzen mit hohem dispergier-, suspendier- und fluessigkeitsrueckhaltevermoegen, verfahren zu ihrer herstellung und verwendung |
| US4204983A (en) * | 1979-05-07 | 1980-05-27 | Illinois Cereal Mills | Absorbent polymeric compositions derived from amylaceous material-formaldehyde substrates |
| US4394930A (en) * | 1981-03-27 | 1983-07-26 | Johnson & Johnson | Absorbent foam products |
| US4341215A (en) * | 1980-09-04 | 1982-07-27 | Tampax Incorporated | Absorbent device |
| US4517351A (en) * | 1982-08-11 | 1985-05-14 | National Starch And Chemical Corporation | Process for reacting quaternary ammonium monomer in the presence of anionic polymers |
| US4663163A (en) * | 1983-02-14 | 1987-05-05 | Hou Kenneth C | Modified polysaccharide supports |
| SE8301955D0 (sv) * | 1983-04-08 | 1983-04-08 | Bengt Gustav Ranby | Hogabsorberande ympsampolymerisat av sterkelse och akrylnitril |
| DE3339860A1 (de) * | 1983-11-04 | 1985-05-15 | Wolff Walsrode Ag, 3030 Walsrode | Wasserloesliche, mit polymeren modifizierte hydroxyalkylmethylcellulose und deren verwendung als zusatzmittel fuer asbestfreie fliesenkleber-formulierungen |
| US4587284A (en) * | 1985-06-14 | 1986-05-06 | Ed. Geistlich Sohne Ag Fur Chemische Industrie | Absorbent polymer material and its preparation |
| US4690996A (en) * | 1985-08-28 | 1987-09-01 | National Starch And Chemical Corporation | Inverse emulsions |
| DE3801633A1 (de) * | 1988-01-21 | 1989-07-27 | Starchem Gmbh | Verfahren zur herstellung von wasserabsorbierenden und wasserquellbaren polysaccharid-pfropfpolymeren |
| FR2628764B1 (fr) * | 1988-03-16 | 1990-10-12 | Du Pin Cellulose | Procede de fabrication de produits fibreux a base de cellulose modifiee presentant des proprietes absorbantes ameliorees et produits obtenus |
| AU645512B2 (en) * | 1989-08-08 | 1994-01-20 | Macdonald Johnston Engineering Company Pty Limited | Improvements relating to rubbish compactor paddles |
| MX213505B (Direct) * | 1993-02-24 | 2003-04-03 | ||
| US5580910A (en) * | 1993-04-12 | 1996-12-03 | Kimberly-Clark Corporation | Self sealing film |
| US5466518A (en) * | 1993-08-17 | 1995-11-14 | Kimberly-Clark Corporation | Binder compositions and web materials formed thereby |
| US5496874A (en) * | 1994-11-02 | 1996-03-05 | Kimberly-Clark Corporation | Moldable hydrodisintegratable material and products formed thereby |
| US5700553A (en) * | 1995-11-16 | 1997-12-23 | Kimberly-Clark Corporation | Multilayer hydrodisintegratable film |
| US5868991A (en) * | 1996-07-26 | 1999-02-09 | Kimberly-Clark Worldwide, Inc. | Method for low temperature injection molding of hydrodisintegratable compositions |
| DE19905947B4 (de) * | 1999-02-12 | 2004-05-27 | Fraunhofer-Gesellschaft zur Förderung der angewandten Forschung e.V. | Verfahren zur Herstellung von Superabsorbern und mittels eines solchen Verfahrens hergestellte Superabsorber und deren Verwendung |
| US7087556B2 (en) | 2001-04-16 | 2006-08-08 | Wsp Chemicals & Technology, L.L.C. | Compositions for treating subterranean zones penetrated by well bores |
| FI113375B (fi) * | 2001-05-16 | 2004-04-15 | Cerefi Oy | Menetelmä absorboivien aineiden valmistamiseksi lignoselluloosamateriaalista |
| CA2382419A1 (en) * | 2002-04-24 | 2003-10-24 | Le Groupe Lysac Inc. | Synergistic blends of polysaccharides as biodegradable absorbent materials or superabsorbents |
| US20030220632A1 (en) * | 2002-05-23 | 2003-11-27 | Wolfgang Strasser | Method of using gel sheets for laser treatment |
| DE10308753A1 (de) * | 2003-02-28 | 2004-09-09 | Bayer Ag | Kationische Stärke-Pfropfcopolymere und neues Verfahren zur Herstellung von kationischen Stärke-Pfropfcopolymeren |
| SE0302509D0 (sv) * | 2003-09-19 | 2003-09-19 | Amersham Biosciences Ab | Matrix for separation of polyethers and method of separation |
| US8173171B2 (en) * | 2003-11-17 | 2012-05-08 | Taiwan Textile Research Institute | Hydrogel microparticle composition, application thereof and method for preparing the same |
| TW200517128A (en) * | 2003-11-17 | 2005-06-01 | China Testile Inst | Micro-particles of hydrogel containing polysaccharide or its derivatives composition and method for preparing the same |
| US8217219B2 (en) * | 2003-12-29 | 2012-07-10 | Kimberly-Clark Worldwide, Inc. | Anatomically conforming vaginal insert |
| US7842382B2 (en) * | 2004-03-11 | 2010-11-30 | Knauf Insulation Gmbh | Binder compositions and associated methods |
| WO2006044302A1 (en) * | 2004-10-13 | 2006-04-27 | Knauf Insulation Gmbh | Polyester binding compositions |
| ITTO20040918A1 (it) * | 2004-12-29 | 2005-03-29 | Luigi Ambrosio | Idrogel polimerici superassorbenti biodegradabili e procedimento per la loro preparazione |
| US7888445B2 (en) * | 2005-07-26 | 2011-02-15 | Knauf Insulation Gmbh | Fibrous products and methods for producing the same |
| US7645806B2 (en) * | 2006-10-02 | 2010-01-12 | Weyerhaeuser Nr Company | Methods for the preparation of superabsorbent particles containing carboxyalkyl cellulose |
| US20080081165A1 (en) * | 2006-10-02 | 2008-04-03 | Weyerhaeuser Co. | Fibrous superabsorbent composite containing cellulose |
| US7785710B2 (en) | 2006-10-02 | 2010-08-31 | Weyerhaeuser Nr Company | Superabsorbent particles containing carboxyalkyl cellulose and temporary metal crosslinks |
| US20080078514A1 (en) * | 2006-10-02 | 2008-04-03 | Weyerhaeuser Co. | Methods for the preparation of cellulose fibers having superabsorbent particles adhered thereto |
| US7625463B2 (en) | 2006-10-02 | 2009-12-01 | Weyerhaeuser Nr Company | Methods for the preparation of fibrous superabsorbent composite containing cellulose |
| US20080082065A1 (en) * | 2006-10-02 | 2008-04-03 | Weyerhaeuser Co. | Mixed polymer superabsorbent fibers containing cellulose |
| US20080079188A1 (en) * | 2006-10-02 | 2008-04-03 | Weyerhaeuser Co. | Methods for the preparation of mixed polymer superabsorbent fibers |
| US7717995B2 (en) * | 2006-10-02 | 2010-05-18 | Weyerhaeuser Nr Company | Methods for the preparation of mixed polymer superabsorbent fibers containing cellulose |
| ES2526345T3 (es) * | 2007-01-25 | 2015-01-09 | Knauf Insulation | Producto de aislamiento de fibras minerales que no contienen formaldehído |
| WO2008089848A1 (en) * | 2007-01-25 | 2008-07-31 | Knauf Insulation Limited | Mineral fibre insulation |
| SI2108006T1 (sl) | 2007-01-25 | 2021-02-26 | Knauf Insulation Gmbh | Veziva in s tem narejeni materiali |
| US8082609B2 (en) * | 2007-01-25 | 2011-12-27 | Best Bath Systems, Inc. | Walk-in bathtub having a flip-up seat portion over a rearward foot well recess |
| US8501838B2 (en) | 2007-01-25 | 2013-08-06 | Knauf Insulation Sprl | Composite wood board |
| DK2125650T3 (da) | 2007-01-25 | 2024-08-05 | Knauf Insulation | Mineralfiberplade |
| EP2137223B1 (en) | 2007-04-13 | 2019-02-27 | Knauf Insulation GmbH | Composite maillard-resole binders |
| US7749317B2 (en) | 2007-06-25 | 2010-07-06 | Weyerhaeuser Nr Company | Fibrous blend and method of making |
| US20080318772A1 (en) * | 2007-06-25 | 2008-12-25 | Weyerhaeuser Co. | Mixed polymer composite fiber and cellulose fiber |
| US7591891B2 (en) * | 2007-06-25 | 2009-09-22 | Weyerhaeuser Nr Company | Fibrous blend and methods of preparation |
| BRPI0814014A2 (pt) * | 2007-07-05 | 2015-02-03 | Knauf Insulation Gmbh | Material colante de maillard de base ácido hidróxi-monocarboxílico |
| GB0715100D0 (en) | 2007-08-03 | 2007-09-12 | Knauf Insulation Ltd | Binders |
| US7833384B2 (en) * | 2008-06-30 | 2010-11-16 | Weyerhaeuser Nr Company | Method for making fiber having biodegradable superabsorbent particles attached thereto |
| US8101543B2 (en) * | 2008-06-30 | 2012-01-24 | Weyerhaeuser Nr Company | Biodegradable superabsorbent particles |
| US8084391B2 (en) * | 2008-06-30 | 2011-12-27 | Weyerhaeuser Nr Company | Fibers having biodegradable superabsorbent particles attached thereto |
| US8641869B2 (en) * | 2008-06-30 | 2014-02-04 | Weyerhaeuser Nr Company | Method for making biodegradable superabsorbent particles |
| US20090325797A1 (en) * | 2008-06-30 | 2009-12-31 | Weyerhaeuser Co. | Biodegradable Superabsorbent Particles |
| US7959762B2 (en) * | 2008-06-30 | 2011-06-14 | Weyerhaeuser Nr Company | Method for making biodegradable superabsorbent particles |
| US20090326180A1 (en) * | 2008-06-30 | 2009-12-31 | Weyerhaeuser Co. | Biodegradable Superabsorbent Particles Containing Cellulose Fiber |
| WO2011015946A2 (en) | 2009-08-07 | 2011-02-10 | Knauf Insulation | Molasses binder |
| US8399590B2 (en) | 2009-10-07 | 2013-03-19 | Akzo Nobel Chemicals International B.V. | Superhydrophilic amphiphilic copolymers and processes for making the same |
| US11173106B2 (en) * | 2009-10-07 | 2021-11-16 | Johnson & Johnson Consumer Inc. | Compositions comprising a superhydrophilic amphiphilic copolymer and a micellar thickener |
| US8258250B2 (en) | 2009-10-07 | 2012-09-04 | Johnson & Johnson Consumer Companies, Inc. | Compositions comprising superhydrophilic amphiphilic copolymers and methods of use thereof |
| EP2368924A1 (en) * | 2010-03-22 | 2011-09-28 | Kemira Germany GmbH | Composition for improving dry strength |
| KR101835899B1 (ko) | 2010-05-07 | 2018-03-07 | 크나우프 인설레이션, 인크. | 탄수화물 결합제 및 이를 이용하여 제조된 물질 |
| US20130059075A1 (en) | 2010-05-07 | 2013-03-07 | Knauf Insulation | Carbohydrate polyamine binders and materials made therewith |
| WO2011154368A1 (en) | 2010-06-07 | 2011-12-15 | Knauf Insulation | Fiber products having temperature control additives |
| WO2012152731A1 (en) | 2011-05-07 | 2012-11-15 | Knauf Insulation | Liquid high solids binder composition |
| GB201206193D0 (en) | 2012-04-05 | 2012-05-23 | Knauf Insulation Ltd | Binders and associated products |
| GB201214734D0 (en) | 2012-08-17 | 2012-10-03 | Knauf Insulation Ltd | Wood board and process for its production |
| EP2928936B1 (en) | 2012-12-05 | 2022-04-13 | Knauf Insulation SPRL | Binder |
| WO2015120252A1 (en) | 2014-02-07 | 2015-08-13 | Knauf Insulation, Llc | Uncured articles with improved shelf-life |
| GB201408909D0 (en) | 2014-05-20 | 2014-07-02 | Knauf Insulation Ltd | Binders |
| GB201412709D0 (en) | 2014-07-17 | 2014-09-03 | Knauf Insulation And Knauf Insulation Ltd | Improved binder compositions and uses thereof |
| GB201517867D0 (en) | 2015-10-09 | 2015-11-25 | Knauf Insulation Ltd | Wood particle boards |
| CN105692847B (zh) * | 2016-01-29 | 2018-04-20 | 浙江赛维环保科技有限公司 | 一种在合成纤维素基絮凝材料过程中循环利用未反应单体的方法 |
| CN105777994A (zh) * | 2016-03-16 | 2016-07-20 | 张学健 | 一种硅藻土基复合材料及其制备方法 |
| GB201610063D0 (en) | 2016-06-09 | 2016-07-27 | Knauf Insulation Ltd | Binders |
| GB201701569D0 (en) | 2017-01-31 | 2017-03-15 | Knauf Insulation Ltd | Improved binder compositions and uses thereof |
| GB201804907D0 (en) | 2018-03-27 | 2018-05-09 | Knauf Insulation Ltd | Composite products |
| GB201804908D0 (en) | 2018-03-27 | 2018-05-09 | Knauf Insulation Ltd | Binder compositions and uses thereof |
| CN113826887A (zh) * | 2021-09-22 | 2021-12-24 | 湖州草本连生物科技有限公司 | 降压降脂降血糖营养粉、植物提取物及其应用 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2922768A (en) * | 1956-04-12 | 1960-01-26 | Mino Guido | Process for polymerization of a vinylidene monomer in the presence of a ceric salt and an organic reducing agent |
| US3065041A (en) * | 1958-04-23 | 1962-11-20 | American Cyanamid Co | Method of graft-polymerizing acrylate monomers onto paper in presence of ethylene dimethacrylate, and resulting product |
| US3125406A (en) * | 1961-02-28 | 1964-03-17 | Process for making them | |
| US3184421A (en) * | 1961-05-24 | 1965-05-18 | Eastman Kodak Co | Polymeric composition prepared from cellulose sulfate and alkyl acrylate and textilematerial coated therewith |
| US3297786A (en) * | 1961-10-03 | 1967-01-10 | Yardney International Corp | Method of graft polymerizing onto hydrophobic substrates |
| US3455853A (en) * | 1964-03-09 | 1969-07-15 | Union Oil Co | Method for preparing polysaccharide graft copolymers |
| NL125103C (Direct) * | 1965-08-20 | |||
| US3809664A (en) * | 1973-08-16 | 1974-05-07 | Us Agriculture | Method of preparing starch graft polymers |
-
1975
- 1975-10-23 US US05/625,332 patent/US4028290A/en not_active Expired - Lifetime
-
1976
- 1976-07-22 CA CA257,545A patent/CA1075233A/en not_active Expired
- 1976-09-11 ES ES451462A patent/ES451462A1/es not_active Expired
- 1976-09-21 FR FR7628254A patent/FR2328719A1/fr active Granted
- 1976-09-24 BE BE170963A patent/BE846610A/xx not_active IP Right Cessation
- 1976-09-27 JP JP51115731A patent/JPS6021164B2/ja not_active Expired
- 1976-09-30 MX MX166507A patent/MX144321A/es unknown
- 1976-10-20 DE DE2647420A patent/DE2647420C2/de not_active Expired
- 1976-10-21 NL NLAANVRAGE7611635,A patent/NL174149C/xx not_active IP Right Cessation
- 1976-10-22 IT IT28629/76A patent/IT1069013B/it active
- 1976-10-22 AU AU18909/76A patent/AU507842B2/en not_active Expired
- 1976-10-22 SE SE7611761A patent/SE433222B/xx unknown
- 1976-10-23 BR BR7607083A patent/BR7607083A/pt unknown
- 1976-10-25 GB GB44238/76A patent/GB1535574A/en not_active Expired
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT |
Also Published As
| Publication number | Publication date |
|---|---|
| SE433222B (sv) | 1984-05-14 |
| IT1069013B (it) | 1985-03-21 |
| FR2328719A1 (fr) | 1977-05-20 |
| NL174149C (nl) | 1984-05-01 |
| GB1535574A (en) | 1978-12-13 |
| NL174149B (nl) | 1983-12-01 |
| ES451462A1 (es) | 1977-12-16 |
| BR7607083A (pt) | 1977-09-06 |
| US4028290A (en) | 1977-06-07 |
| FR2328719B1 (Direct) | 1980-10-31 |
| MX144321A (es) | 1981-09-29 |
| AU507842B2 (en) | 1980-02-28 |
| CA1075233A (en) | 1980-04-08 |
| AU1890976A (en) | 1978-04-27 |
| NL7611635A (nl) | 1977-04-26 |
| JPS5251482A (en) | 1977-04-25 |
| JPS6021164B2 (ja) | 1985-05-25 |
| SE7611761L (sv) | 1977-04-24 |
| DE2647420A1 (de) | 1977-04-28 |
| BE846610A (fr) | 1977-01-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2647420C2 (de) | Modifiziertes Polysaccarid und Verfahren zu seiner Herstellung | |
| DE2840010C3 (de) | Pfropfmischpolymerisate | |
| DE3782092T2 (de) | Verfahren zur herstellung von wasserabsorbierenden materialien. | |
| DE60026206T2 (de) | Aus mit Aldehyden modifizierter Zellstoffpulpe hergestelltes Papier | |
| DE69124903T2 (de) | Absorbierendes Polymer | |
| DE2653135C2 (Direct) | ||
| DE69415651T2 (de) | Superabsobierende polymere und diese enthaltende produkte | |
| DE19983287B4 (de) | Bruchfeste superabsorbierende Polymere | |
| DE3031304C2 (Direct) | ||
| EP1165638B1 (de) | Vernetzte, hydrophile, hochquellfähige hydrogele, verfahren zu ihrer herstellung und ihre verwendung | |
| DE69434574T2 (de) | Modifizierte polysaccharide mit absorptionseigenschaften und verfahren zu deren herstellung | |
| DE69212025T2 (de) | Reduzierung von Restmonomeren in superabsorbierenden Polymeren | |
| EP0014258B1 (de) | Wasserlösliche Makromolekularsubstanzen mit hohem Dispergier-, Suspendier- und Flüssigkeitsrückhaltevermögen und ihre Verwendung als Additiv | |
| DE2753214A1 (de) | Sehr absorptionsfaehige polymere zusammensetzungen aus polyhydroxypolymer- pfropfcopolymeren | |
| DE3147953A1 (de) | Verfahren zur herstellung von hydrogelen | |
| DE3331644A1 (de) | Verfahren zur herstellung eines stark wasserabsorbierenden polymerisats | |
| DE3784280T2 (de) | Verfahren zur herstellung von wasserabsorbierendem faserigem material. | |
| DE2712043A1 (de) | Verfahren zur erhoehung der absorptionsrate von acrylamidpolymerisaten fuer wasser oder salzloesung und mittel zu seiner durchfuehrung | |
| DE2730249A1 (de) | Waessrige, fluessigkeitsabsorbierende zusammensetzung und verfahren zu ihrer herstellung | |
| DE69017846T2 (de) | Verfahren zur herstellung von harzen mit hoher wasserabsorption. | |
| AT402932B (de) | Celluloseschwamm und verfahren zu dessen herstellung | |
| DE3628482A1 (de) | Verfahren zur herstellung eines harzes mit hohem absorptionsvermoegen | |
| DE69503459T2 (de) | Wasserlösliche Polymere aus (Meth)acrylamid, äthylenisch ungesättigte alifatische Carbonsäure oder Salz, und Polyvinylmonomer und deren Verwendung als Trockenfestigkeitszusatz für Papier | |
| DE2528555A1 (de) | Verfahren zur herstellung eines modifizierten cellulosematerials | |
| DE4015085C2 (de) | Vernetztes, wasserabsorbierendes Polymer und Verwendung zur Herstellung von Hygieneartikeln, zur Bodenverbesserung und in Kabelummantelungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: LEDERER, F., DIPL.-CHEM. DR., PAT.-ANW., 8000 MUENCHEN |
|
| 8339 | Ceased/non-payment of the annual fee |