DE2647094C3 - - Google Patents
Info
- Publication number
- DE2647094C3 DE2647094C3 DE2647094C3 DE 2647094 C3 DE2647094 C3 DE 2647094C3 DE 2647094 C3 DE2647094 C3 DE 2647094C3
- Authority
- DE
- Germany
- Prior art keywords
- cysteine
- acid
- reaction
- cystine
- chloroacetic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 16
- 238000006243 chemical reaction Methods 0.000 claims description 16
- LEVWYRKDKASIDU-IMJSIDKUSA-N L-cystine Chemical compound [O-]C(=O)[C@@H]([NH3+])CSSC[C@H]([NH3+])C([O-])=O LEVWYRKDKASIDU-IMJSIDKUSA-N 0.000 claims description 13
- GBFLZEXEOZUWRN-VKHMYHEASA-M S-carboxylatomethyl-L-cysteine(1-) Chemical compound [O-]C(=O)[C@@H]([NH3+])CSCC([O-])=O GBFLZEXEOZUWRN-VKHMYHEASA-M 0.000 claims description 13
- 229960003067 cystine Drugs 0.000 claims description 13
- XUJNEKJLAYXESH-REOHCLBHSA-N L-Cysteine Chemical compound SC[C@H](N)C(O)=O XUJNEKJLAYXESH-REOHCLBHSA-N 0.000 claims description 12
- 239000004158 L-cystine Substances 0.000 claims description 12
- 235000019393 L-cystine Nutrition 0.000 claims description 12
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 claims description 12
- 229940106681 chloroacetic acid Drugs 0.000 claims description 12
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 9
- 239000011734 sodium Substances 0.000 claims description 9
- 229910052708 sodium Inorganic materials 0.000 claims description 9
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 8
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 claims description 7
- 239000007864 aqueous solution Substances 0.000 claims description 7
- 239000004201 L-cysteine Substances 0.000 claims description 6
- 235000013878 L-cysteine Nutrition 0.000 claims description 6
- 229910021529 ammonia Inorganic materials 0.000 claims description 5
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 4
- 150000001447 alkali salts Chemical class 0.000 claims description 4
- 235000019253 formic acid Nutrition 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 3
- 230000003647 oxidation Effects 0.000 claims description 3
- 238000007254 oxidation reaction Methods 0.000 claims description 3
- 239000011541 reaction mixture Substances 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- PWKSKIMOESPYIA-UHFFFAOYSA-N 2-acetamido-3-sulfanylpropanoic acid Chemical compound CC(=O)NC(CS)C(O)=O PWKSKIMOESPYIA-UHFFFAOYSA-N 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 238000001704 evaporation Methods 0.000 claims description 2
- 230000008020 evaporation Effects 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 238000001556 precipitation Methods 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims 1
- 238000002360 preparation method Methods 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 238000001816 cooling Methods 0.000 description 5
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- SAEXFNRQXFBCIC-NVKWYWNSSA-L disodium;(2r)-2-amino-3-sulfanylpropanoate Chemical compound [Na+].[Na+].SC[C@H](N)C([O-])=O.SC[C@H](N)C([O-])=O SAEXFNRQXFBCIC-NVKWYWNSSA-L 0.000 description 2
- 230000007717 exclusion Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 206010006451 bronchitis Diseases 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- HRKQOINLCJTGBK-UHFFFAOYSA-N dihydroxidosulfur Chemical class OSO HRKQOINLCJTGBK-UHFFFAOYSA-N 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003172 expectorant agent Substances 0.000 description 1
- 230000003419 expectorant effect Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 150000004715 keto acids Chemical class 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 210000003097 mucus Anatomy 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 229940127557 pharmaceutical product Drugs 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 208000008128 pulmonary tuberculosis Diseases 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH631956A5 (de) | Verfahren zur herstellung von 2,5-dichlorphenol. | |
| EP0417604B1 (de) | Verfahren zur Herstellung von Riboflavin-5'-phosphat bzw. dessen Natriumsalz | |
| DE2647094B1 (de) | Verfahren zur Herstellung von hochreinem S-Carboxymethyl-L-cystein | |
| DE2647094C3 (enExample) | ||
| DE19909200C1 (de) | Verfahren zur Herstellung von N-Phosphonomethyliminodiessigsäure | |
| EP0897910B1 (de) | Verfahren zur Herstellung von 2-Carboxyy-5-nitro-benzolsulfonsäure und deren Salzen durch Oxidation | |
| DE3538746C2 (enExample) | ||
| DE3638364A1 (de) | Verfahren zur herstellung von 5-aminosalicylsaeure | |
| EP0519246B1 (de) | Verfahren zur Herstellung von N,N'-bis-[7-(4-hydroxy-2-sulfo)naphthyl]-harnstoff | |
| EP1690855B1 (de) | Mischung umfassend Phenylen-bis-benzimidazol-tetrasulfonsäure-dinatriumsalz | |
| DE2535337C2 (de) | Verfahren zur Herstellung von 1-Amino-naphthalin-7-sulfonsäure | |
| EP0066770B1 (de) | Verfahren zur Herstellung von 3-Hydroxybenzoesäure | |
| EP0027658A1 (de) | Verfahren zur Herstellung von 3-Nitro-4-aminotoluol | |
| DE2244652C3 (de) | Verfahren zur Herstellung von 2,3-Dicyan-1,4-dithiaanthrahydrochinon und -anthrachinon | |
| EP0098541B1 (de) | Verfahren zur Herstellung von Thioethern | |
| EP0028730B1 (de) | Verfahren zur Herstellung von 1,6-Diaminonaphthalin-4,8-disulfonsäure | |
| DE1593878C (de) | Verfahren zur Herstellung von Chlorthiophenolen | |
| EP0039812B1 (de) | Verfahren zur Herstellung von 3-Hydroxybenzoesäure | |
| DE2502411C2 (de) | Verfahren zur herstellung von bis-n-chloramiden gesaettigter aliphatischer dicarbonsaeuren | |
| DE921626C (de) | Verfahren zur Herstellung von Xanthen-9-carbonsaeure | |
| AT239243B (de) | Verfahren zur Herstellung von 2, 3-Dicyan-1, 4-dithia-anthrahydrochinon und -anthrachinon | |
| DE1543960C (de) | Verfahren zur Herstellung von Naphthol mit überwiegendem alpha Naphthol Gehalt durch alkalische Hydrolyse von Monochlor naphthalin | |
| EP0064633B1 (de) | Verfahren zur Herstellung von 3,3-Dimethylglutarsäure | |
| CH507920A (de) | Verfahren zur Herstellung von Chlorthiophenolen | |
| EP0033829A1 (de) | Verfahren zur Herstellung von 1-Nitro-benzol-2-carbonsäurealkylester-5-carbonsäuren |