DE2641685C2 - - Google Patents
Info
- Publication number
- DE2641685C2 DE2641685C2 DE2641685A DE2641685A DE2641685C2 DE 2641685 C2 DE2641685 C2 DE 2641685C2 DE 2641685 A DE2641685 A DE 2641685A DE 2641685 A DE2641685 A DE 2641685A DE 2641685 C2 DE2641685 C2 DE 2641685C2
- Authority
- DE
- Germany
- Prior art keywords
- fuel
- fuel nozzle
- hollow body
- sleeve
- nozzle according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000446 fuel Substances 0.000 claims description 89
- 238000002347 injection Methods 0.000 claims description 15
- 239000007924 injection Substances 0.000 claims description 15
- 238000001816 cooling Methods 0.000 claims description 9
- 238000011144 upstream manufacturing Methods 0.000 claims description 8
- 239000007788 liquid Substances 0.000 claims description 5
- 238000002485 combustion reaction Methods 0.000 description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 7
- 229910052799 carbon Inorganic materials 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- 238000000889 atomisation Methods 0.000 description 6
- 230000001681 protective effect Effects 0.000 description 6
- 238000007664 blowing Methods 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 238000009413 insulation Methods 0.000 description 2
- 125000006850 spacer group Chemical group 0.000 description 2
- 235000010678 Paulownia tomentosa Nutrition 0.000 description 1
- 240000002834 Paulownia tomentosa Species 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- SQMCFUSVGSBKFK-UHFFFAOYSA-M sodium;5-(cyclohexen-1-yl)-1,5-dimethylpyrimidin-3-ide-2,4,6-trione Chemical compound [Na+].O=C1N(C)C(=O)[N-]C(=O)C1(C)C1=CCCCC1 SQMCFUSVGSBKFK-UHFFFAOYSA-M 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 238000003466 welding Methods 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F23—COMBUSTION APPARATUS; COMBUSTION PROCESSES
- F23R—GENERATING COMBUSTION PRODUCTS OF HIGH PRESSURE OR HIGH VELOCITY, e.g. GAS-TURBINE COMBUSTION CHAMBERS
- F23R3/00—Continuous combustion chambers using liquid or gaseous fuel
- F23R3/02—Continuous combustion chambers using liquid or gaseous fuel characterised by the air-flow or gas-flow configuration
- F23R3/04—Air inlet arrangements
- F23R3/10—Air inlet arrangements for primary air
- F23R3/12—Air inlet arrangements for primary air inducing a vortex
- F23R3/14—Air inlet arrangements for primary air inducing a vortex by using swirl vanes
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F02—COMBUSTION ENGINES; HOT-GAS OR COMBUSTION-PRODUCT ENGINE PLANTS
- F02C—GAS-TURBINE PLANTS; AIR INTAKES FOR JET-PROPULSION PLANTS; CONTROLLING FUEL SUPPLY IN AIR-BREATHING JET-PROPULSION PLANTS
- F02C7/00—Features, components parts, details or accessories, not provided for in, or of interest apart form groups F02C1/00 - F02C6/00; Air intakes for jet-propulsion plants
- F02C7/22—Fuel supply systems
- F02C7/222—Fuel flow conduits, e.g. manifolds
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F23—COMBUSTION APPARATUS; COMBUSTION PROCESSES
- F23D—BURNERS
- F23D11/00—Burners using a direct spraying action of liquid droplets or vaporised liquid into the combustion space
- F23D11/10—Burners using a direct spraying action of liquid droplets or vaporised liquid into the combustion space the spraying being induced by a gaseous medium, e.g. water vapour
- F23D11/106—Burners using a direct spraying action of liquid droplets or vaporised liquid into the combustion space the spraying being induced by a gaseous medium, e.g. water vapour medium and fuel meeting at the burner outlet
Landscapes
- Engineering & Computer Science (AREA)
- Chemical & Material Sciences (AREA)
- Combustion & Propulsion (AREA)
- Mechanical Engineering (AREA)
- General Engineering & Computer Science (AREA)
- Spray-Type Burners (AREA)
- Fuel-Injection Apparatus (AREA)
- Nozzles For Spraying Of Liquid Fuel (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/644,040 US4070826A (en) | 1975-12-24 | 1975-12-24 | Low pressure fuel injection system |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2641685A1 DE2641685A1 (de) | 1977-07-07 |
| DE2641685C2 true DE2641685C2 (enExample) | 1987-08-27 |
Family
ID=24583204
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762641685 Granted DE2641685A1 (de) | 1975-12-24 | 1976-09-16 | Niederdruck-brennstoff-injektionszerstaeubersystem |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4070826A (enExample) |
| JP (1) | JPS5279113A (enExample) |
| DE (1) | DE2641685A1 (enExample) |
| FR (1) | FR2336556A1 (enExample) |
| GB (1) | GB1563125A (enExample) |
| IT (1) | IT1072558B (enExample) |
Families Citing this family (69)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2710618C2 (de) * | 1977-03-11 | 1982-11-11 | MTU Motoren- und Turbinen-Union München GmbH, 8000 München | Brennstoffeinspritzdüse für Gasturbinentriebwerke |
| US4111369A (en) * | 1977-07-05 | 1978-09-05 | General Motors Corporation | Fuel nozzle |
| US4180974A (en) * | 1977-10-31 | 1980-01-01 | General Electric Company | Combustor dome sleeve |
| US4311277A (en) * | 1979-06-20 | 1982-01-19 | Lucas Industries Limited | Fuel injector |
| FR2461816A1 (fr) * | 1979-07-16 | 1981-02-06 | Lucas Industries Ltd | Injecteur de combustible |
| FR2471480A1 (fr) * | 1979-12-13 | 1981-06-19 | Snecma | Dispositif d'injection pour chambre a combustion de moteur a turbine |
| GB2085146B (en) * | 1980-10-01 | 1985-06-12 | Gen Electric | Flow modifying device |
| US4735044A (en) * | 1980-11-25 | 1988-04-05 | General Electric Company | Dual fuel path stem for a gas turbine engine |
| GB2097112B (en) * | 1981-04-16 | 1984-12-12 | Rolls Royce | Fuel burners and combustion equipment for use in gas turbine engines |
| US4584834A (en) * | 1982-07-06 | 1986-04-29 | General Electric Company | Gas turbine engine carburetor |
| US4497170A (en) * | 1982-07-22 | 1985-02-05 | The Garrett Corporation | Actuation system for a variable geometry combustor |
| US4532762A (en) * | 1982-07-22 | 1985-08-06 | The Garrett Corporation | Gas turbine engine variable geometry combustor apparatus |
| US5020329A (en) * | 1984-12-20 | 1991-06-04 | General Electric Company | Fuel delivery system |
| FR2575223B1 (fr) * | 1984-12-20 | 1991-10-25 | Gen Electric | Systeme de fourniture de combustible |
| US4653278A (en) * | 1985-08-23 | 1987-03-31 | General Electric Company | Gas turbine engine carburetor |
| US5146741A (en) * | 1990-09-14 | 1992-09-15 | Solar Turbines Incorporated | Gaseous fuel injector |
| US5231833A (en) * | 1991-01-18 | 1993-08-03 | General Electric Company | Gas turbine engine fuel manifold |
| CA2056480C (en) * | 1991-01-18 | 2000-01-04 | Thomas Maclean | Gas turbine engine fuel manifold |
| US5167122A (en) * | 1991-04-30 | 1992-12-01 | Sundstrand Corporation | Fuel system for a turbo machine |
| US5265425A (en) * | 1991-09-23 | 1993-11-30 | General Electric Company | Aero-slinger combustor |
| US5345906A (en) * | 1993-07-20 | 1994-09-13 | Luczak John R | Fuel injection apparatus |
| US5453255A (en) * | 1994-06-24 | 1995-09-26 | Exxon Research & Engineering Co. | High temperature hanging system for fluid solid cyclone/plenum systems |
| US5598696A (en) * | 1994-09-20 | 1997-02-04 | Parker-Hannifin Corporation | Clip attached heat shield |
| US5623827A (en) * | 1995-01-26 | 1997-04-29 | General Electric Company | Regenerative cooled dome assembly for a gas turbine engine combustor |
| CA2248736C (en) | 1996-03-13 | 2007-03-27 | Parker-Hannifin Corporation | Internally heatshielded nozzle |
| US6076356A (en) * | 1996-03-13 | 2000-06-20 | Parker-Hannifin Corporation | Internally heatshielded nozzle |
| US5970716A (en) | 1997-10-02 | 1999-10-26 | General Electric Company | Apparatus for retaining centerbody between adjacent domes of multiple annular combustor employing interference and clamping fits |
| US6711898B2 (en) | 1999-04-01 | 2004-03-30 | Parker-Hannifin Corporation | Fuel manifold block and ring with macrolaminate layers |
| US6321541B1 (en) * | 1999-04-01 | 2001-11-27 | Parker-Hannifin Corporation | Multi-circuit multi-injection point atomizer |
| US6761035B1 (en) * | 1999-10-15 | 2004-07-13 | General Electric Company | Thermally free fuel nozzle |
| FR2817017B1 (fr) * | 2000-11-21 | 2003-03-07 | Snecma Moteurs | Refroidissement integral des injecteurs de decollage d'une chambre de combustion a deux tetes |
| US6718770B2 (en) * | 2002-06-04 | 2004-04-13 | General Electric Company | Fuel injector laminated fuel strip |
| US6863228B2 (en) * | 2002-09-30 | 2005-03-08 | Delavan Inc. | Discrete jet atomizer |
| US7451602B2 (en) * | 2005-11-07 | 2008-11-18 | General Electric Company | Methods and apparatus for injecting fluids into turbine engines |
| DE102006004840A1 (de) * | 2006-02-02 | 2007-08-23 | Rolls-Royce Deutschland Ltd & Co Kg | Gasturbinenbrennkammer mit Kraftstoffeinspritzung über den gesamten Brennkammerring |
| US20070193272A1 (en) * | 2006-02-21 | 2007-08-23 | Woodward Fst, Inc. | Gas turbine engine fuel injector |
| US7854120B2 (en) * | 2006-03-03 | 2010-12-21 | Pratt & Whitney Canada Corp. | Fuel manifold with reduced losses |
| US7762070B2 (en) * | 2006-05-11 | 2010-07-27 | Siemens Energy, Inc. | Pilot nozzle heat shield having internal turbulators |
| US7603863B2 (en) * | 2006-06-05 | 2009-10-20 | General Electric Company | Secondary fuel injection from stage one nozzle |
| EP1892469B1 (en) * | 2006-08-16 | 2011-10-05 | Siemens Aktiengesellschaft | Swirler passage and burner for a gas turbine engine |
| US20090320483A1 (en) * | 2008-06-26 | 2009-12-31 | General Electric Company | Variable Orifice Plug for Turbine Fuel Nozzle |
| US20100078506A1 (en) * | 2008-09-30 | 2010-04-01 | General Electric Company | Circumferential fuel circuit divider |
| EP2312215A1 (de) * | 2008-10-01 | 2011-04-20 | Siemens Aktiengesellschaft | Brenner und Verfahren zum Betrieb eines Brenners |
| US8413446B2 (en) * | 2008-12-10 | 2013-04-09 | Caterpillar Inc. | Fuel injector arrangement having porous premixing chamber |
| EP2196734A1 (de) * | 2008-12-12 | 2010-06-16 | Siemens Aktiengesellschaft | Brennstofflanze für einen Brenner |
| US8079218B2 (en) * | 2009-05-21 | 2011-12-20 | General Electric Company | Method and apparatus for combustor nozzle with flameholding protection |
| KR101470774B1 (ko) * | 2011-03-30 | 2014-12-08 | 미츠비시 쥬고교 가부시키가이샤 | 노즐 및 가스 터빈 연소기, 가스 터빈 |
| US20120317992A1 (en) * | 2011-06-17 | 2012-12-20 | General Electric Company | Feed injector for gasification system |
| US8966908B2 (en) | 2011-06-23 | 2015-03-03 | Solar Turbines Incorporated | Phase and amplitude matched fuel injector |
| US9638422B2 (en) * | 2012-06-22 | 2017-05-02 | Delavan Inc. | Active purge mechanism with backflow preventer for gas turbine fuel injectors |
| DE102013201232A1 (de) * | 2013-01-25 | 2014-07-31 | Siemens Aktiengesellschaft | Brenner mit einer zentralen Brennstoffzufuhranordnung |
| US10288291B2 (en) * | 2014-08-15 | 2019-05-14 | General Electric Company | Air-shielded fuel injection assembly to facilitate reduced NOx emissions in a combustor system |
| US9939155B2 (en) * | 2015-01-26 | 2018-04-10 | Delavan Inc. | Flexible swirlers |
| GB201511841D0 (en) * | 2015-07-07 | 2015-08-19 | Rolls Royce Plc | Fuel spray nozel for a gas turbine engine |
| US10196983B2 (en) | 2015-11-04 | 2019-02-05 | General Electric Company | Fuel nozzle for gas turbine engine |
| GB201700459D0 (en) * | 2017-01-11 | 2017-02-22 | Rolls Royce Plc | Fuel injector |
| GB201700465D0 (en) * | 2017-01-11 | 2017-02-22 | Rolls Royce Plc | Fuel injector |
| US10954859B2 (en) * | 2017-07-25 | 2021-03-23 | Raytheon Technologies Corporation | Low emissions combustor assembly for gas turbine engine |
| US11175045B2 (en) | 2018-01-04 | 2021-11-16 | General Electric Company | Fuel nozzle for gas turbine engine combustor |
| US11305142B2 (en) * | 2018-01-12 | 2022-04-19 | Carrier Corporation | End cap agent nozzle |
| US10982856B2 (en) | 2019-02-01 | 2021-04-20 | Pratt & Whitney Canada Corp. | Fuel nozzle with sleeves for thermal protection |
| US11226100B2 (en) * | 2019-07-22 | 2022-01-18 | Delavan Inc. | Fuel manifolds |
| US11378275B2 (en) | 2019-12-06 | 2022-07-05 | Raytheon Technologies Corporation | High shear swirler with recessed fuel filmer for a gas turbine engine |
| KR102720500B1 (ko) * | 2020-06-26 | 2024-10-21 | 미츠비시 파워 가부시키가이샤 | 연료 분사기 및 이 연료 분사기를 구비하는 연소기 및 이 연소기를 구비하는 가스 터빈 |
| GB2611115B (en) * | 2021-09-23 | 2024-10-09 | Gen Electric | Floating primary vane swirler |
| EP4317784A1 (en) * | 2022-08-04 | 2024-02-07 | RTX Corporation | Swirler with recessed fuel filmer and air assist fuel nozzle |
| DE102022004896A1 (de) * | 2022-12-23 | 2024-07-04 | Deutz Aktiengesellschaft | Zylinderkopf für eine Brennkraftmaschine und eine Brennkraftmaschine mit einem solchen Zylinderkopf |
| US12111056B2 (en) * | 2023-02-02 | 2024-10-08 | Pratt & Whitney Canada Corp. | Combustor with central fuel injection and downstream air mixing |
| CN119802667B (zh) * | 2024-12-30 | 2025-10-31 | 沈阳航空航天大学 | 一种基于等离子体激励耦合气动辅助雾化的高扰动喷杆结构 |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL67338C (enExample) * | 1944-11-28 | |||
| US2483951A (en) * | 1944-12-13 | 1949-10-04 | Lucas Ltd Joseph | Liquid fuel nozzle |
| GB584820A (en) * | 1944-12-22 | 1947-01-23 | Lucas Ltd Joseph | Improvements relating to internal combustion prime movers |
| US2551538A (en) * | 1948-01-08 | 1951-05-01 | Walter E Hensel | Multiple jet spray nozzle |
| US2982099A (en) * | 1956-10-09 | 1961-05-02 | Rolls Royce | Fuel injection arrangement in combustion equipment for gas turbine engines |
| FR1207869A (fr) * | 1957-07-23 | 1960-02-19 | Le Ministre De La Defense Nati | Appareil de combustion à brûleur de sortie pour turbo-réacteur à gaz comportant une tuyère d'échappement et un cône de queue dans celle-ci |
| US3028102A (en) * | 1957-08-14 | 1962-04-03 | Parker Hannifin Corp | Liquid fuel spray nozzle |
| FR1460927A (fr) * | 1965-10-05 | 1966-12-10 | Comm Materiel Et D Outil S Soc | Perfectionnements aux pistolets à peinture |
| GB1165163A (en) * | 1966-04-30 | 1969-09-24 | Nat Res Dev | Improvements in and relating to Fuel Burning Equipment |
| JPS4931059Y1 (enExample) * | 1970-11-30 | 1974-08-22 | ||
| GB1377184A (en) * | 1971-02-02 | 1974-12-11 | Secr Defence | Gas turbine engine combustion apparatus |
| US3724207A (en) * | 1971-08-05 | 1973-04-03 | Gen Motors Corp | Combustion apparatus |
| FR2189630B1 (enExample) * | 1972-06-23 | 1980-03-14 | Snecma | |
| GB1435083A (en) * | 1972-08-10 | 1976-05-12 | Rolls Royce | Gas turbine engine combustion equipment |
| US3972182A (en) * | 1973-09-10 | 1976-08-03 | General Electric Company | Fuel injection apparatus |
| US3915626A (en) * | 1974-04-22 | 1975-10-28 | Air Prod & Chem | Oxy-oil burner |
| US3938324A (en) * | 1974-12-12 | 1976-02-17 | General Motors Corporation | Premix combustor with flow constricting baffle between combustion and dilution zones |
| JPH041804U (enExample) * | 1990-04-17 | 1992-01-09 |
-
1975
- 1975-12-24 US US05/644,040 patent/US4070826A/en not_active Expired - Lifetime
-
1976
- 1976-09-16 DE DE19762641685 patent/DE2641685A1/de active Granted
- 1976-09-16 GB GB38410/76A patent/GB1563125A/en not_active Expired
- 1976-09-22 FR FR7628438A patent/FR2336556A1/fr active Granted
- 1976-09-22 JP JP51113171A patent/JPS5279113A/ja active Granted
- 1976-09-24 IT IT27618/76A patent/IT1072558B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6214722B2 (enExample) | 1987-04-03 |
| FR2336556A1 (fr) | 1977-07-22 |
| US4070826A (en) | 1978-01-31 |
| JPS5279113A (en) | 1977-07-04 |
| IT1072558B (it) | 1985-04-10 |
| FR2336556B1 (enExample) | 1982-11-19 |
| GB1563125A (en) | 1980-03-19 |
| DE2641685A1 (de) | 1977-07-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2641685C2 (enExample) | ||
| EP0933593B1 (de) | Zweistoffbrenner | |
| DE69410424T2 (de) | Brennstoff-Einspritzvorrichtung | |
| EP0769655B1 (de) | Airblast-Zerstäuberdüse | |
| EP0902233B1 (de) | Kombinierte Druckzerstäuberdüse | |
| DE69210715T2 (de) | Brenner mit geringer NOx-Produktion | |
| DE69718253T2 (de) | Vorrichtung zur Einspritzung von mit Luft zerstäubten Einzelstrahlen aus flüssigem Brennstoff | |
| DE2935290C2 (de) | Steinstrahlbrenner | |
| DE69519849T2 (de) | Brennstoffdüse mit tangentialer einspritzung | |
| EP1802915B1 (de) | Brenner für gasturbine | |
| DE3830185A1 (de) | Verwirbelungs- und brennstoffeinspritzvorrichtung fuer eine gasturbinenbrennkammer | |
| DE2446398A1 (de) | Axialwirbelvergaser mit zentraleinspritzung | |
| DE2131490A1 (de) | Luftmischduese | |
| DE4326802A1 (de) | Brennstofflanze für flüssige und/oder gasförmige Brennstoffe sowie Verfahren zu deren Betrieb | |
| DE2443007A1 (de) | Brennstoffinjektionsvorrichtung | |
| DE2300217C3 (de) | Einspritzvorrichtung zur Einspritzung flüssigen Brennstoffs in Hochöfen | |
| DE10304386A1 (de) | Doppelfluid-Verwirbelungsdüse mit selbstreinigendem Zapfen | |
| EP1359376B1 (de) | Gasturbinenbrennkammer mit gezielter Kraftstoffeinbringung zur Verbesserung der Homogenität des Kraftstoff-Luft-Gemisches | |
| DE4424599A1 (de) | Verfahren und Vorrichtung zum Betreiben eines kombinierten Brenners für flüssige und gasförmige Brennstoffe | |
| DE10205573B4 (de) | Zerstäuberdüse für einen Brenner | |
| EP0710799A2 (de) | Verfahren zur thermischen Oxidation von flüssigen Abfallstoffen | |
| DE19532264C2 (de) | Einrichtung zur Aufbereitung eines Gemisches aus Brennstoff und Luft an Brennkammern für Gasturbinentriebwerke | |
| DE2641605C2 (de) | Vorrichtung zur Zufuhr von Luft und Brennstoff | |
| DE1198130B (de) | Brenner fuer ringfoermige Brennkammern | |
| DE69423900T2 (de) | V-jet atomisateur |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8125 | Change of the main classification |
Ipc: F23D 11/10 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |