DE2619674C2 - Halogen-Metalldampfentladungslampe - Google Patents
Halogen-MetalldampfentladungslampeInfo
- Publication number
- DE2619674C2 DE2619674C2 DE2619674A DE2619674A DE2619674C2 DE 2619674 C2 DE2619674 C2 DE 2619674C2 DE 2619674 A DE2619674 A DE 2619674A DE 2619674 A DE2619674 A DE 2619674A DE 2619674 C2 DE2619674 C2 DE 2619674C2
- Authority
- DE
- Germany
- Prior art keywords
- discharge vessel
- discharge
- metal halide
- discharge lamp
- matted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229910001507 metal halide Inorganic materials 0.000 title claims description 8
- 150000005309 metal halides Chemical class 0.000 title claims description 8
- 229910052761 rare earth metal Inorganic materials 0.000 claims description 5
- 229920006395 saturated elastomer Polymers 0.000 claims description 5
- 238000009877 rendering Methods 0.000 claims description 4
- -1 rare earth halide Chemical class 0.000 claims description 3
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 4
- 238000000576 coating method Methods 0.000 description 3
- 229910052753 mercury Inorganic materials 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical compound O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 230000004907 flux Effects 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 150000002910 rare earth metals Chemical class 0.000 description 2
- 229910052692 Dysprosium Inorganic materials 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000006004 Quartz sand Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- XQPRBTXUXXVTKB-UHFFFAOYSA-M caesium iodide Chemical compound [I-].[Cs+] XQPRBTXUXXVTKB-UHFFFAOYSA-M 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- KBQHZAAAGSGFKK-UHFFFAOYSA-N dysprosium atom Chemical compound [Dy] KBQHZAAAGSGFKK-UHFFFAOYSA-N 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910052716 thallium Inorganic materials 0.000 description 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 1
- CMJCEVKJYRZMIA-UHFFFAOYSA-M thallium(i) iodide Chemical compound [Tl]I CMJCEVKJYRZMIA-UHFFFAOYSA-M 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/30—Vessels; Containers
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/52—Cooling arrangements; Heating arrangements; Means for circulating gas or vapour within the discharge space
Landscapes
- Discharge Lamp (AREA)
- Vessels And Coating Films For Discharge Lamps (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2619674A DE2619674C2 (de) | 1976-05-04 | 1976-05-04 | Halogen-Metalldampfentladungslampe |
| CH394677A CH612038A5 (enExample) | 1976-05-04 | 1977-03-29 | |
| ES458101A ES458101A1 (es) | 1976-05-04 | 1977-04-22 | Perfeccionamientos en lamparas de descarga de vapor haloge- no-metalico. |
| SE7705082A SE422639B (sv) | 1976-05-04 | 1977-05-02 | Metallhalogenlampa |
| FR7713424A FR2350691A1 (fr) | 1976-05-04 | 1977-05-03 | Lampe a decharge aux halogenures |
| IT67987/77A IT1083241B (it) | 1976-05-04 | 1977-05-03 | Lampada alogena a scarica elettrica nei vapori metallici |
| GB18703/77A GB1579187A (en) | 1976-05-04 | 1977-05-04 | Halogen metal vapour discharge lamp |
| US05/956,343 US4249102A (en) | 1976-05-04 | 1978-10-31 | Halogen-metal vapor discharge lamp |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2619674A DE2619674C2 (de) | 1976-05-04 | 1976-05-04 | Halogen-Metalldampfentladungslampe |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2619674A1 DE2619674A1 (de) | 1977-11-24 |
| DE2619674C2 true DE2619674C2 (de) | 1986-05-07 |
Family
ID=5977041
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2619674A Expired DE2619674C2 (de) | 1976-05-04 | 1976-05-04 | Halogen-Metalldampfentladungslampe |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4249102A (enExample) |
| CH (1) | CH612038A5 (enExample) |
| DE (1) | DE2619674C2 (enExample) |
| ES (1) | ES458101A1 (enExample) |
| FR (1) | FR2350691A1 (enExample) |
| GB (1) | GB1579187A (enExample) |
| IT (1) | IT1083241B (enExample) |
| SE (1) | SE422639B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL178107C (nl) * | 1977-12-23 | 1986-01-16 | Philips Nv | Hogedrukontladingslamp. |
| DE2840771A1 (de) * | 1978-09-19 | 1980-03-27 | Patra Patent Treuhand | Hochdruckentladungslampe mit metallhalogeniden |
| GB2120006B (en) * | 1982-05-07 | 1985-10-09 | Gen Electric Plc | Diversion of heat and light from ribbon seals in high-power electric lamps |
| JPH0517799Y2 (enExample) * | 1986-03-14 | 1993-05-12 | ||
| US5003214A (en) * | 1986-12-19 | 1991-03-26 | Gte Products Corporation | Metal halide lamp having reflective coating on the arc tube |
| DE8807104U1 (de) * | 1988-05-31 | 1988-07-14 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Natriumhochdruckentladungslampe |
| US5220237A (en) * | 1990-05-31 | 1993-06-15 | Iwasaki Electric Co., Ltd. | Metal halide lamp apparatus |
| KR100268722B1 (ko) * | 1993-08-21 | 2000-10-16 | 김순택 | 고압 방전등 |
| DE9401436U1 (de) * | 1994-01-28 | 1994-03-31 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 81543 München | Metallhalogenidentladungslampe für Projektionszwecke |
| US20060255741A1 (en) * | 1997-06-06 | 2006-11-16 | Harison Toshiba Lighting Corporation | Lightening device for metal halide discharge lamp |
| DE19910709A1 (de) * | 1999-03-10 | 2000-09-14 | Audi Ag | Gasentladungslampe für einen Kraftfahrzeugscheinwerfer |
| US6844676B2 (en) * | 2001-10-01 | 2005-01-18 | Koninklijke Philips Electronics N.V. | Ceramic HID lamp with special frame wire for stabilizing the arc |
| JP2005108685A (ja) * | 2003-09-30 | 2005-04-21 | Harison Toshiba Lighting Corp | 管球 |
| DE102004005903A1 (de) * | 2004-02-05 | 2005-08-25 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH | Hochdruckentladungslampe und Herstellungsverfahren für eine Hochdruckentladungslampe |
| JP4978738B1 (ja) * | 2011-01-06 | 2012-07-18 | 岩崎電気株式会社 | メタルハライドランプ |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2213245A (en) * | 1935-12-23 | 1940-09-03 | Germer Edmund | Electrical discharge device |
| DE950224C (de) * | 1952-09-21 | 1956-10-04 | Quarzlampen Gmbh | Elektrische Ultraviolett-Bestrahlungslampe |
| NL245727A (enExample) * | 1958-11-25 | 1900-01-01 | ||
| US3234421A (en) * | 1961-01-23 | 1966-02-08 | Gen Electric | Metallic halide electric discharge lamps |
| US3384771A (en) * | 1965-02-08 | 1968-05-21 | Gen Electric | Reflector discharge lamp having frosted envelope and arc tube |
| DE2106447C2 (de) * | 1971-02-11 | 1983-02-17 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Quecksilberdampf-Hochdruckentladungslampe mit einem Zusatz von Metallhalogeniden |
| NL7206559A (enExample) * | 1972-05-16 | 1973-11-20 | ||
| US3900750A (en) * | 1974-06-03 | 1975-08-19 | Gte Sylvania Inc | Metal halide discharge lamp having heat absorbing coating |
| US4041344A (en) * | 1976-08-30 | 1977-08-09 | General Electric Company | Ellipsoidal reflector lamp |
-
1976
- 1976-05-04 DE DE2619674A patent/DE2619674C2/de not_active Expired
-
1977
- 1977-03-29 CH CH394677A patent/CH612038A5/xx not_active IP Right Cessation
- 1977-04-22 ES ES458101A patent/ES458101A1/es not_active Expired
- 1977-05-02 SE SE7705082A patent/SE422639B/xx unknown
- 1977-05-03 FR FR7713424A patent/FR2350691A1/fr active Granted
- 1977-05-03 IT IT67987/77A patent/IT1083241B/it active
- 1977-05-04 GB GB18703/77A patent/GB1579187A/en not_active Expired
-
1978
- 1978-10-31 US US05/956,343 patent/US4249102A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| CH612038A5 (enExample) | 1979-06-29 |
| US4249102A (en) | 1981-02-03 |
| FR2350691A1 (fr) | 1977-12-02 |
| SE7705082L (sv) | 1977-11-05 |
| IT1083241B (it) | 1985-05-21 |
| ES458101A1 (es) | 1978-03-16 |
| SE422639B (sv) | 1982-03-15 |
| DE2619674A1 (de) | 1977-11-24 |
| GB1579187A (en) | 1980-11-12 |
| FR2350691B1 (enExample) | 1982-05-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2619674C2 (de) | Halogen-Metalldampfentladungslampe | |
| DE2655167C2 (de) | Hochdruckentladungslampe mit Metallhalogeniden | |
| DE2624897A1 (de) | Aluminiumoxyd-ueberzuege fuer quecksilberdampf-lampen | |
| DE3322390A1 (de) | Niederdruckquecksilberdampfentladungslampe | |
| DE2854223C2 (de) | Hochdruckentladungslampe | |
| DE2530195A1 (de) | Hochleistungs-bogenentladungslampe | |
| DE2906383A1 (de) | Hochdrucknatriumdampfentladungslampe | |
| DE2519377A1 (de) | Quecksilberdampf-hochdruckentladungslampe | |
| DE1764979A1 (de) | Quecksilber-Metallhalogenid-Dampflampe mit Regeneration | |
| DE2644977A1 (de) | Elektrische reflektorlampe | |
| DE2840771C2 (enExample) | ||
| DE2616893A1 (de) | Bestrahlungslampe | |
| DE2725412A1 (de) | Niederdruckgasentladungslampe | |
| WO2011057903A1 (de) | Quecksilberfreie hochdruckentladungslampe mit reduziertem zinkhalogenidanteil | |
| DE1489527B2 (de) | Quecksilberdampfhochdrucklampe | |
| DE1489445B1 (de) | Elektrode fuer eine Quecksilberdampfhochdrucklampe mit Halogenidfuellung | |
| DE2711733C2 (de) | Natriumdampf-Hochdruckentladungslampe | |
| DE2106447A1 (de) | Quecksilberdampf-Hochdruckentladungslampe mit einem Zusatz von Metallhalogeniden | |
| DE1489406C3 (de) | Hochdruck-Quecksilberdampf entladungslampe | |
| DE69104866T2 (de) | Metalldampfentladungslampe. | |
| DE2846816A1 (de) | Niederdruckquecksilberdampfentladungslampe | |
| DE2265321C3 (de) | Ultraviolettlicht aussendende Quecksilberdampflampe | |
| DE2709221A1 (de) | Spiegelkondensorlampe | |
| DE2134133B2 (de) | Halogen-Glühlampe | |
| DE2457815A1 (de) | Hochdruckentladungslampe mit metallhalogenid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |