DE2840771C2 - - Google Patents
Info
- Publication number
- DE2840771C2 DE2840771C2 DE2840771A DE2840771A DE2840771C2 DE 2840771 C2 DE2840771 C2 DE 2840771C2 DE 2840771 A DE2840771 A DE 2840771A DE 2840771 A DE2840771 A DE 2840771A DE 2840771 C2 DE2840771 C2 DE 2840771C2
- Authority
- DE
- Germany
- Prior art keywords
- discharge vessel
- discharge
- lamp
- outer bulb
- iodine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000009825 accumulation Methods 0.000 claims description 9
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 6
- 229910052740 iodine Inorganic materials 0.000 claims description 6
- 239000011630 iodine Substances 0.000 claims description 6
- 229910052708 sodium Inorganic materials 0.000 claims description 5
- 239000011734 sodium Substances 0.000 claims description 5
- 150000004694 iodide salts Chemical class 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 229910001507 metal halide Inorganic materials 0.000 claims description 3
- 150000005309 metal halides Chemical class 0.000 claims description 3
- 238000009877 rendering Methods 0.000 claims description 3
- -1 Sodium halide Chemical class 0.000 claims description 2
- 238000007792 addition Methods 0.000 claims description 2
- 150000001649 bromium compounds Chemical class 0.000 claims description 2
- 150000004820 halides Chemical class 0.000 claims description 2
- 238000005338 heat storage Methods 0.000 claims description 2
- 239000000463 material Substances 0.000 claims description 2
- 239000012858 resilient material Substances 0.000 claims description 2
- 230000035508 accumulation Effects 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 238000005530 etching Methods 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000010453 quartz Substances 0.000 description 2
- 239000005341 toughened glass Substances 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 229910010413 TiO 2 Inorganic materials 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 239000000289 melt material Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Inorganic materials [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 229910052716 thallium Inorganic materials 0.000 description 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/04—Electrodes; Screens; Shields
- H01J61/10—Shields, screens, or guides for influencing the discharge
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
- H01J61/125—Selection of substances for gas fillings; Specified operating pressure or temperature having an halogenide as principal component
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
- Discharge Lamp (AREA)
- Discharge Lamps And Accessories Thereof (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782840771 DE2840771A1 (de) | 1978-09-19 | 1978-09-19 | Hochdruckentladungslampe mit metallhalogeniden |
| FR7922188A FR2437063A2 (fr) | 1978-09-19 | 1979-09-05 | Lampe a decharge a haute pression et a halogenures |
| GB7932259A GB2035679A (en) | 1978-09-19 | 1979-09-18 | High pressure metal vapour discharge lamps |
| IT68831/79A IT1165228B (it) | 1978-09-19 | 1979-09-18 | Lampada a scarica ad alta pressione con alogenuri metallici |
| JP11887479A JPS5543794A (en) | 1978-09-19 | 1979-09-18 | High voltage discharge lamp |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782840771 DE2840771A1 (de) | 1978-09-19 | 1978-09-19 | Hochdruckentladungslampe mit metallhalogeniden |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2840771A1 DE2840771A1 (de) | 1980-03-27 |
| DE2840771C2 true DE2840771C2 (enExample) | 1988-03-24 |
Family
ID=6049862
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782840771 Granted DE2840771A1 (de) | 1978-09-19 | 1978-09-19 | Hochdruckentladungslampe mit metallhalogeniden |
Country Status (5)
| Country | Link |
|---|---|
| JP (1) | JPS5543794A (enExample) |
| DE (1) | DE2840771A1 (enExample) |
| FR (1) | FR2437063A2 (enExample) |
| GB (1) | GB2035679A (enExample) |
| IT (1) | IT1165228B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4467238A (en) * | 1981-09-03 | 1984-08-21 | General Electric Company | High-pressure sodium lamp with improved IR reflector |
| DE3232632A1 (de) * | 1981-09-03 | 1983-03-10 | General Electric Co., Schenectady, N.Y. | Hochdruck-alkalimetalldampflampe mit verbesserter wirksamkeit |
| DD203430A1 (de) * | 1982-01-19 | 1983-10-19 | Kloss | Elektrodenstabilisierte hochdruckentladungslampe mit leuchtzusaetzen |
| US4629929A (en) * | 1982-02-10 | 1986-12-16 | Mitsubishi Denki Kabushiki Kaisha | Metal vapor discharge lamp |
| US4580989A (en) * | 1982-08-18 | 1986-04-08 | Gte Products Corporation | Metal halide arc discharge lamp with means for suppressing convection currents within the outer envelope and methods of operating and constructing same |
| US4499396A (en) * | 1982-08-18 | 1985-02-12 | Gte Products Corporation | Metal halide arc discharge lamp with means for suppressing convection currents within the outer envelope and methods of operating same |
| DE3321479A1 (de) * | 1983-06-14 | 1984-12-20 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Hochdruckentladungslampe |
| JPS60221949A (ja) * | 1985-04-01 | 1985-11-06 | Hitachi Ltd | メタルハライドランプ |
| US4791334A (en) * | 1987-05-07 | 1988-12-13 | Gte Products Corporation | Metal-halide lamp having heat redistribution means |
| DE8803881U1 (de) * | 1988-03-22 | 1988-05-11 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Kompakte Reflektorlampe |
| US5136208A (en) * | 1989-02-07 | 1992-08-04 | Toshiba Lighting & Technology Corporation | Metal halide lamp maintaining a high lumen maintenance factor over an extended operation period |
| EP0492726A1 (en) * | 1990-12-27 | 1992-07-01 | Koninklijke Philips Electronics N.V. | High pressure sodium reflector lamp |
| DE682356T1 (de) * | 1994-05-12 | 1996-05-02 | Iwasaki Electric Co Ltd | Metallhalogenid Lampe. |
| US20060202598A1 (en) * | 2003-07-22 | 2006-09-14 | Koninklijke Philips Electronics N.V. | High-pressure discharge lamp |
| CN105240712B (zh) * | 2015-11-06 | 2017-05-24 | 武汉九鼎光电子科技有限公司 | 一种泛光聚光可调式组合配光照明灯泡及其制造方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2116720A (en) * | 1935-05-14 | 1938-05-10 | Gen Electric | Electric discharge device |
| BE623133A (enExample) * | 1961-10-04 | |||
| GB1541437A (en) * | 1975-02-13 | 1979-02-28 | Thorn Electrical Ind Ltd | Electrical discharge lamp |
| DE2619674C2 (de) * | 1976-05-04 | 1986-05-07 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Halogen-Metalldampfentladungslampe |
| DE2655167C2 (de) * | 1976-12-06 | 1986-12-18 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Hochdruckentladungslampe mit Metallhalogeniden |
-
1978
- 1978-09-19 DE DE19782840771 patent/DE2840771A1/de active Granted
-
1979
- 1979-09-05 FR FR7922188A patent/FR2437063A2/fr active Granted
- 1979-09-18 GB GB7932259A patent/GB2035679A/en not_active Withdrawn
- 1979-09-18 IT IT68831/79A patent/IT1165228B/it active
- 1979-09-18 JP JP11887479A patent/JPS5543794A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| IT1165228B (it) | 1987-04-22 |
| JPS5543794A (en) | 1980-03-27 |
| FR2437063A2 (fr) | 1980-04-18 |
| IT7968831A0 (it) | 1979-09-18 |
| DE2840771A1 (de) | 1980-03-27 |
| GB2035679A (en) | 1980-06-18 |
| FR2437063B2 (enExample) | 1983-04-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2840771C2 (enExample) | ||
| DE2655167C2 (de) | Hochdruckentladungslampe mit Metallhalogeniden | |
| EP0535311B1 (de) | Hochdruckentladungslampe kleiner Leistung | |
| DE1464181A1 (de) | Elektrische Gasentladungslampe | |
| DE2854223C2 (de) | Hochdruckentladungslampe | |
| DE1940539A1 (de) | Quecksilberdampf-Hochdruckentladungslampe mit Metallhalogenidzusatz | |
| DE2624897A1 (de) | Aluminiumoxyd-ueberzuege fuer quecksilberdampf-lampen | |
| DE3813421A1 (de) | Hochdruck-quecksilberdampfentladungslampe | |
| DE69703079T2 (de) | Hochdruck Quecksilber-Ultravioletlampe | |
| DE2619674C2 (de) | Halogen-Metalldampfentladungslampe | |
| DE1076814B (de) | Entladungslampe | |
| DE2408572A1 (de) | Hochdruckquecksilberdampfentladungslampe | |
| DE2725412A1 (de) | Niederdruckgasentladungslampe | |
| DE1489445B1 (de) | Elektrode fuer eine Quecksilberdampfhochdrucklampe mit Halogenidfuellung | |
| DE2102112C3 (de) | Hochdruck-Entladungslampe | |
| DE611962C (de) | Elektrische Entladungslampe mit Dampffuellung schwer verdampfbarer Metalle | |
| DE1489406C3 (de) | Hochdruck-Quecksilberdampf entladungslampe | |
| DE2134133C3 (de) | Halogen-Glühlampe | |
| DE655156C (de) | Insbesondere zur Lichtausstrahlung dienende elektrische Entladungsroehre | |
| DE3327302A1 (de) | Niederdruck-quecksilberdampf-entladungslampe | |
| DE3731134C2 (de) | Hochdruck-Metallhalogenidentladungslampe mit niedriger Farbtemperatur und guter Farbwiedergabe | |
| DE7827876U1 (de) | Hochdruckentladungslampe mit metallhalogeniden | |
| DE2535922A1 (de) | Quecksilberdampf-hochdruckentladungslampe fuer horizontale brennlage | |
| DE1957978A1 (de) | Hochdruckentladungslampe | |
| DE3232632A1 (de) | Hochdruck-alkalimetalldampflampe mit verbesserter wirksamkeit |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| AF | Is addition to no. |
Ref country code: DE Ref document number: 2655167 Format of ref document f/p: P |
|
| AF | Is addition to no. |
Ref country code: DE Ref document number: 2655167 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |