DE2614242C3 - Verfahren zur Herstellung von Acylcyaniden - Google Patents
Verfahren zur Herstellung von AcylcyanidenInfo
- Publication number
- DE2614242C3 DE2614242C3 DE2614242A DE2614242A DE2614242C3 DE 2614242 C3 DE2614242 C3 DE 2614242C3 DE 2614242 A DE2614242 A DE 2614242A DE 2614242 A DE2614242 A DE 2614242A DE 2614242 C3 DE2614242 C3 DE 2614242C3
- Authority
- DE
- Germany
- Prior art keywords
- cyanide
- mol
- carbon atoms
- acid
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 24
- 150000001264 acyl cyanides Chemical class 0.000 title claims description 12
- -1 alkyl radical Chemical class 0.000 claims description 28
- 125000004432 carbon atom Chemical group C* 0.000 claims description 16
- 150000002825 nitriles Chemical class 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 13
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 150000002367 halogens Chemical class 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims description 3
- 125000005842 heteroatom Chemical group 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000003107 substituted aryl group Chemical group 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims 1
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 28
- 238000006243 chemical reaction Methods 0.000 description 24
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 17
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- 150000004820 halides Chemical class 0.000 description 10
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 9
- 229910052783 alkali metal Inorganic materials 0.000 description 8
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 8
- 238000004508 fractional distillation Methods 0.000 description 7
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 125000003545 alkoxy group Chemical group 0.000 description 6
- 230000003197 catalytic effect Effects 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- GTLDTDOJJJZVBW-UHFFFAOYSA-N zinc cyanide Chemical compound [Zn+2].N#[C-].N#[C-] GTLDTDOJJJZVBW-UHFFFAOYSA-N 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 5
- 239000003513 alkali Substances 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 238000004821 distillation Methods 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 229910052731 fluorine Inorganic materials 0.000 description 5
- 239000011737 fluorine Substances 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- GJQBHOAJJGIPRH-UHFFFAOYSA-N benzoyl cyanide Chemical compound N#CC(=O)C1=CC=CC=C1 GJQBHOAJJGIPRH-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 229910001385 heavy metal Inorganic materials 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 238000010626 work up procedure Methods 0.000 description 4
- WHIHIKVIWVIIER-UHFFFAOYSA-N 3-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC(Cl)=C1 WHIHIKVIWVIIER-UHFFFAOYSA-N 0.000 description 3
- 150000001266 acyl halides Chemical class 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- LEKPFOXEZRZPGW-UHFFFAOYSA-N copper;dicyanide Chemical compound [Cu+2].N#[C-].N#[C-] LEKPFOXEZRZPGW-UHFFFAOYSA-N 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- LGRKVHGBNVCVHV-UHFFFAOYSA-N 3-chlorobenzoyl cyanide Chemical compound ClC1=CC=CC(C(=O)C#N)=C1 LGRKVHGBNVCVHV-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- FDQSRULYDNDXQB-UHFFFAOYSA-N benzene-1,3-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC(C(Cl)=O)=C1 FDQSRULYDNDXQB-UHFFFAOYSA-N 0.000 description 2
- DSEYQDSKEUBYSA-UHFFFAOYSA-N benzene-1,4-dicarbonyl cyanide Chemical compound N#CC(=O)C1=CC=C(C(=O)C#N)C=C1 DSEYQDSKEUBYSA-UHFFFAOYSA-N 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- MNWBNISUBARLIT-UHFFFAOYSA-N sodium cyanide Chemical compound [Na+].N#[C-] MNWBNISUBARLIT-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- LXEJRKJRKIFVNY-UHFFFAOYSA-N terephthaloyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)=O)C=C1 LXEJRKJRKIFVNY-UHFFFAOYSA-N 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 125000001399 1,2,3-triazolyl group Chemical group N1N=NC(=C1)* 0.000 description 1
- 125000003626 1,2,4-triazol-1-yl group Chemical group [*]N1N=C([H])N=C1[H] 0.000 description 1
- 125000001401 1,2,4-triazol-4-yl group Chemical group N=1N=C([H])N([*])C=1[H] 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- GGHLXLVPNZMBQR-UHFFFAOYSA-N 3,5-dichlorobenzoyl chloride Chemical compound ClC(=O)C1=CC(Cl)=CC(Cl)=C1 GGHLXLVPNZMBQR-UHFFFAOYSA-N 0.000 description 1
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 1
- UDBBCXDMJVNFLI-UHFFFAOYSA-N 4-chlorobenzoyl cyanide Chemical compound ClC1=CC=C(C(=O)C#N)C=C1 UDBBCXDMJVNFLI-UHFFFAOYSA-N 0.000 description 1
- XLWQUESMILVIPR-UHFFFAOYSA-N 4-ethoxybenzoyl chloride Chemical compound CCOC1=CC=C(C(Cl)=O)C=C1 XLWQUESMILVIPR-UHFFFAOYSA-N 0.000 description 1
- JIMIZSCETMDNEU-UHFFFAOYSA-N 4-methoxybenzoyl cyanide Chemical compound COC1=CC=C(C(=O)C#N)C=C1 JIMIZSCETMDNEU-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- MXMOTZIXVICDSD-UHFFFAOYSA-N anisoyl chloride Chemical compound COC1=CC=C(C(Cl)=O)C=C1 MXMOTZIXVICDSD-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- NMFMOYLXOPIJHU-UHFFFAOYSA-N benzene-1,3-dicarbonyl cyanide Chemical compound N#CC(=O)C1=CC=CC(C(=O)C#N)=C1 NMFMOYLXOPIJHU-UHFFFAOYSA-N 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- AQIHMSVIAGNIDM-UHFFFAOYSA-N benzoyl bromide Chemical compound BrC(=O)C1=CC=CC=C1 AQIHMSVIAGNIDM-UHFFFAOYSA-N 0.000 description 1
- HPMLGNIUXVXALD-UHFFFAOYSA-N benzoyl fluoride Chemical compound FC(=O)C1=CC=CC=C1 HPMLGNIUXVXALD-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- RVOJTCZRIKWHDX-UHFFFAOYSA-N cyclohexanecarbonyl chloride Chemical compound ClC(=O)C1CCCCC1 RVOJTCZRIKWHDX-UHFFFAOYSA-N 0.000 description 1
- WEPUZBYKXNKSDH-UHFFFAOYSA-N cyclopentanecarbonyl chloride Chemical compound ClC(=O)C1CCCC1 WEPUZBYKXNKSDH-UHFFFAOYSA-N 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- NSNPSJGHTQIXDO-UHFFFAOYSA-N naphthalene-1-carbonyl chloride Chemical compound C1=CC=C2C(C(=O)Cl)=CC=CC2=C1 NSNPSJGHTQIXDO-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000003839 salts Chemical group 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 235000015096 spirit Nutrition 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C253/00—Preparation of carboxylic acid nitriles
- C07C253/14—Preparation of carboxylic acid nitriles by reaction of cyanides with halogen-containing compounds with replacement of halogen atoms by cyano groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Toxicology (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Furan Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Priority Applications (13)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2614242A DE2614242C3 (de) | 1976-04-02 | 1976-04-02 | Verfahren zur Herstellung von Acylcyaniden |
| US05/777,288 US4143068A (en) | 1976-04-02 | 1977-03-11 | Process for the preparation of acyl cyanide compounds |
| GB13152/77A GB1527845A (en) | 1976-04-02 | 1977-03-29 | Process for the preparation of acyl cyanides |
| CH394777A CH629183A5 (de) | 1976-04-02 | 1977-03-29 | Verfahren zur herstellung von acylcyaniden. |
| IL51783A IL51783A (en) | 1976-04-02 | 1977-03-30 | Preparation of acyl cyanides |
| IT21942/77A IT1075381B (it) | 1976-04-02 | 1977-03-31 | Processo per la produzione di acilcianuri |
| JP3624777A JPS52122305A (en) | 1976-04-02 | 1977-04-01 | Process for preparing acylcyanide |
| FR7709938A FR2346323A1 (fr) | 1976-04-02 | 1977-04-01 | Procede de production de cyanures d'acyle utilises comme matieres premieres pour la synthese d'herbicides |
| DK144177A DK149446C (da) | 1976-04-02 | 1977-04-01 | Fremgangsmaade til fremstilling af acylcyanider |
| BR7702091A BR7702091A (pt) | 1976-04-02 | 1977-04-01 | Processo para a preparacao de acilcianetos |
| NLAANVRAGE7703596,A NL189129C (nl) | 1976-04-02 | 1977-04-01 | Werkwijze voor de bereiding van acylcyaniden. |
| AT230077A AT348995B (de) | 1976-04-02 | 1977-04-01 | Verfahren zur herstellung von acylcyaniden |
| BE176349A BE853158A (fr) | 1976-04-02 | 1977-04-01 | Procede de production de cyanure d'acyle |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2614242A DE2614242C3 (de) | 1976-04-02 | 1976-04-02 | Verfahren zur Herstellung von Acylcyaniden |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2614242A1 DE2614242A1 (de) | 1977-10-06 |
| DE2614242B2 DE2614242B2 (de) | 1979-11-29 |
| DE2614242C3 true DE2614242C3 (de) | 1986-11-13 |
Family
ID=5974271
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2614242A Expired DE2614242C3 (de) | 1976-04-02 | 1976-04-02 | Verfahren zur Herstellung von Acylcyaniden |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4143068A (enExample) |
| JP (1) | JPS52122305A (enExample) |
| AT (1) | AT348995B (enExample) |
| BE (1) | BE853158A (enExample) |
| BR (1) | BR7702091A (enExample) |
| CH (1) | CH629183A5 (enExample) |
| DE (1) | DE2614242C3 (enExample) |
| DK (1) | DK149446C (enExample) |
| FR (1) | FR2346323A1 (enExample) |
| GB (1) | GB1527845A (enExample) |
| IL (1) | IL51783A (enExample) |
| IT (1) | IT1075381B (enExample) |
| NL (1) | NL189129C (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2624891C2 (de) * | 1976-06-03 | 1982-11-18 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von Benzoylcyanid |
| DE2753656C2 (de) * | 1977-12-02 | 1982-11-25 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von Benzoylcyanid |
| DE2753657C2 (de) * | 1977-12-02 | 1982-11-25 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von Benzoylcyanid |
| DE2820575C3 (de) * | 1978-05-11 | 1981-09-24 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Acylcyaniden |
| US4209462A (en) * | 1978-12-18 | 1980-06-24 | Stauffer Chemical Company | Method for preparing acyl cyanides |
| DE3011305A1 (de) | 1980-03-24 | 1981-10-15 | Degussa Ag, 6000 Frankfurt | Verfahren zur herstellung von carbonsaeurecyaniden |
| DE3015587A1 (de) * | 1980-04-23 | 1981-10-29 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von acylcyaniden |
| DE3226425A1 (de) * | 1981-11-11 | 1983-05-19 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von acylcyaniden |
| US4786914A (en) * | 1985-01-25 | 1988-11-22 | E-Systems, Inc. | Meanderline polarization twister |
| FR2647109B1 (fr) * | 1989-05-19 | 1991-07-26 | Atochem | Procede de preparation de cyanures d'acyle en milieu anhydre |
| US5352826A (en) * | 1989-05-19 | 1994-10-04 | Atochem | Synthesis of acyl cyanides in an anhydrous reaction medium |
| FR2647110B1 (fr) * | 1989-05-19 | 1991-07-26 | Atochem | Procede de synthese de cyanures d'acyle |
| US5352827A (en) * | 1989-05-19 | 1994-10-04 | Atochem | Synthesis of acyl cyanides in a hydrous reaction medium |
| CN109651193A (zh) * | 2019-01-22 | 2019-04-19 | 江苏佳麦化工有限公司 | 一种苯甲酰氰的合成方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE835141C (de) * | 1948-10-26 | 1952-03-27 | Schering Ag | Verfahren zur Herstellung von ª‡-Ketocarbonsaeurenitrilen |
| CH410517A (de) * | 1958-08-04 | 1966-03-31 | Velsicol Chemical Corp | Verfahren und Mittel zur Bekämpfung von Unkraut |
| FR1563737A (enExample) * | 1967-12-08 | 1969-04-18 |
-
1976
- 1976-04-02 DE DE2614242A patent/DE2614242C3/de not_active Expired
-
1977
- 1977-03-11 US US05/777,288 patent/US4143068A/en not_active Expired - Lifetime
- 1977-03-29 CH CH394777A patent/CH629183A5/de not_active IP Right Cessation
- 1977-03-29 GB GB13152/77A patent/GB1527845A/en not_active Expired
- 1977-03-30 IL IL51783A patent/IL51783A/xx unknown
- 1977-03-31 IT IT21942/77A patent/IT1075381B/it active
- 1977-04-01 NL NLAANVRAGE7703596,A patent/NL189129C/xx not_active IP Right Cessation
- 1977-04-01 AT AT230077A patent/AT348995B/de not_active IP Right Cessation
- 1977-04-01 DK DK144177A patent/DK149446C/da not_active IP Right Cessation
- 1977-04-01 BE BE176349A patent/BE853158A/xx not_active IP Right Cessation
- 1977-04-01 JP JP3624777A patent/JPS52122305A/ja active Granted
- 1977-04-01 BR BR7702091A patent/BR7702091A/pt unknown
- 1977-04-01 FR FR7709938A patent/FR2346323A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| AT348995B (de) | 1979-03-12 |
| GB1527845A (en) | 1978-10-11 |
| US4143068A (en) | 1979-03-06 |
| DK149446C (da) | 1986-11-17 |
| DE2614242B2 (de) | 1979-11-29 |
| NL189129B (nl) | 1992-08-17 |
| NL189129C (nl) | 1993-01-18 |
| IL51783A0 (en) | 1977-05-31 |
| DE2614242A1 (de) | 1977-10-06 |
| IL51783A (en) | 1980-06-30 |
| BR7702091A (pt) | 1978-01-24 |
| IT1075381B (it) | 1985-04-22 |
| DK144177A (da) | 1977-10-03 |
| NL7703596A (nl) | 1977-10-04 |
| ATA230077A (de) | 1978-08-15 |
| CH629183A5 (de) | 1982-04-15 |
| FR2346323A1 (fr) | 1977-10-28 |
| JPS616813B2 (enExample) | 1986-03-01 |
| DK149446B (da) | 1986-06-16 |
| BE853158A (fr) | 1977-10-03 |
| FR2346323B1 (enExample) | 1981-02-13 |
| JPS52122305A (en) | 1977-10-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0038987B1 (de) | Verfahren zur Herstellung von Acylcyaniden | |
| DE2614242C3 (de) | Verfahren zur Herstellung von Acylcyaniden | |
| DE2528211C3 (de) | Verfahren zur Herstellung von Acylcyaniden | |
| DE2614240C3 (de) | Verfahren zur Herstellung von Acylcyaniden | |
| DE3006685C2 (de) | 3-Brom-4-fluorbenzonitril und Verfahren zur Herstellung eines substituierten 3-Brom-4-fluorbenzols | |
| EP0780384A2 (de) | Verfahren zur Herstellung von 2-Chlor-5-chlormethylthiazol | |
| DE2614241C3 (de) | Verfahren zur Herstellung von Acylcyaniden | |
| DE3315147A1 (de) | Verfahren zur herstellung von aromatischen verbindungen, die ueber ein heteroatom gebundene perfluorierte seitenketten enthalten | |
| EP0076985B1 (de) | Verfahren zur Herstellung von Alpha-Dicyano-trimethyl-silyloxy-Verbindungen (I) | |
| EP0079005B1 (de) | Verfahren zur Herstellung von Carbonsäureanhydriden | |
| EP0005484B1 (de) | Verfahren zur Herstellung von Acylcyaniden | |
| CH626332A5 (enExample) | ||
| EP0043490B1 (de) | Verfahren zur Herstellung von Acylcyaniden | |
| EP0581147B1 (de) | Chlorthiazolderivate | |
| DE2660213C2 (de) | Verfahren zur Herstellung von Acylcyaniden | |
| EP0663390B1 (de) | Verfahren zur Herstellung von aromatischen Carbonsäurenamiden aus aromatischen Carbonsäuren und Harnstoff | |
| EP0145907B1 (de) | Verfahren zur Herstellung von alpha-Ketonitrilen | |
| EP0731094B1 (de) | Verfahren zur Herstellung von Pyrazolen | |
| EP0036441B1 (de) | Verfahren zur Herstellung von Carbonsäurecyaniden | |
| WO2022069554A1 (de) | Verfahren zur herstellung von 4-bromfuran-2-carboxylaten | |
| EP0002477A1 (de) | Verfahren zur Herstellung von 1,1-Dihalogen-4-methyl-1,3-pentadienen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8281 | Inventor (new situation) |
Free format text: FINDEISEN, KURT, DR., 5074 ODENTHAL, DE |
|
| C3 | Grant after two publication steps (3rd publication) |