DE2611690A1 - Cyclische sulfonyloxyimide - Google Patents
Cyclische sulfonyloxyimideInfo
- Publication number
- DE2611690A1 DE2611690A1 DE19762611690 DE2611690A DE2611690A1 DE 2611690 A1 DE2611690 A1 DE 2611690A1 DE 19762611690 DE19762611690 DE 19762611690 DE 2611690 A DE2611690 A DE 2611690A DE 2611690 A1 DE2611690 A1 DE 2611690A1
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- acid
- compounds
- radical
- numbers
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 150000001875 compounds Chemical class 0.000 claims description 29
- -1 aliphatic radical Chemical class 0.000 claims description 21
- 239000002253 acid Substances 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 125000004122 cyclic group Chemical group 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 239000011230 binding agent Substances 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- 125000003107 substituted aryl group Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- DSSYKIVIOFKYAU-XCBNKYQSSA-N (R)-camphor Chemical group C1C[C@@]2(C)C(=O)C[C@@H]1C2(C)C DSSYKIVIOFKYAU-XCBNKYQSSA-N 0.000 claims 1
- 125000004799 bromophenyl group Chemical group 0.000 claims 1
- 125000000068 chlorophenyl group Chemical group 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 125000006501 nitrophenyl group Chemical group 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 238000006731 degradation reaction Methods 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 7
- 150000001413 amino acids Chemical class 0.000 description 7
- 230000015556 catabolic process Effects 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 229940077388 benzenesulfonate Drugs 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- KMBMIFAMYKVGMQ-UHFFFAOYSA-N 2-[1-[2-(hydroxyamino)-2-oxoethyl]cyclohexyl]acetic acid Chemical compound ON=C(O)CC1(CC(O)=O)CCCCC1 KMBMIFAMYKVGMQ-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 3
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 150000003949 imides Chemical class 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- XBUDZAQEMFGLEU-UHFFFAOYSA-N 2-[1-(aminomethyl)cyclohexyl]acetic acid;hydron;chloride Chemical compound Cl.OC(=O)CC1(CN)CCCCC1 XBUDZAQEMFGLEU-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- UGJMXCAKCUNAIE-UHFFFAOYSA-N Gabapentin Chemical compound OC(=O)CC1(CN)CCCCC1 UGJMXCAKCUNAIE-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 150000003951 lactams Chemical class 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- XTEGVFVZDVNBPF-UHFFFAOYSA-N naphthalene-1,5-disulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1S(O)(=O)=O XTEGVFVZDVNBPF-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 1
- XFLACBVNBXGJKW-UHFFFAOYSA-N 2-[1-(carboxymethyl)cycloheptyl]acetic acid Chemical compound OC(=O)CC1(CC(O)=O)CCCCCC1 XFLACBVNBXGJKW-UHFFFAOYSA-N 0.000 description 1
- QDZCKNUOXQRHGY-UHFFFAOYSA-N 2-[1-[2-(hydroxyamino)-2-oxoethyl]cycloheptyl]acetic acid Chemical compound ON=C(O)CC1(CC(O)=O)CCCCCC1 QDZCKNUOXQRHGY-UHFFFAOYSA-N 0.000 description 1
- XNDSIASQMRYFSW-UHFFFAOYSA-N 3-oxaspiro[5.5]undecane-2,4-dione Chemical compound C1C(=O)OC(=O)CC11CCCCC1 XNDSIASQMRYFSW-UHFFFAOYSA-N 0.000 description 1
- CGSIJCLRVFEHNY-UHFFFAOYSA-N 3-oxaspiro[5.6]dodecane-2,4-dione Chemical compound C1C(=O)OC(=O)CC21CCCCCC2 CGSIJCLRVFEHNY-UHFFFAOYSA-N 0.000 description 1
- PXACTUVBBMDKRW-UHFFFAOYSA-N 4-bromobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Br)C=C1 PXACTUVBBMDKRW-UHFFFAOYSA-N 0.000 description 1
- RJWBTWIBUIGANW-UHFFFAOYSA-N 4-chlorobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Cl)C=C1 RJWBTWIBUIGANW-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- IXKVYKPPJAWZLH-UHFFFAOYSA-N 7-thiabicyclo[4.1.0]hepta-2,4-diene Chemical compound C1=CC=CC2SC21 IXKVYKPPJAWZLH-UHFFFAOYSA-N 0.000 description 1
- GFWLMILMVMCJDI-UHFFFAOYSA-N 8-oxaspiro[4.5]decane-7,9-dione Chemical compound C1C(=O)OC(=O)CC11CCCC1 GFWLMILMVMCJDI-UHFFFAOYSA-N 0.000 description 1
- HWTDMFJYBAURQR-UHFFFAOYSA-N 80-82-0 Chemical compound OS(=O)(=O)C1=CC=CC=C1[N+]([O-])=O HWTDMFJYBAURQR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 206010010904 Convulsion Diseases 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 238000000023 Kugelrohr distillation Methods 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 230000006179 O-acylation Effects 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- CVBYVUQVPQRITK-UHFFFAOYSA-N acetic acid;benzenesulfonic acid Chemical compound CC(O)=O.OS(=O)(=O)C1=CC=CC=C1 CVBYVUQVPQRITK-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical compound C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000036461 convulsion Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-N ethanesulfonic acid Chemical compound CCS(O)(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000002631 hypothermal effect Effects 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- XBCUTKBYIBLQDE-UHFFFAOYSA-N methyl 2-[1-[(methoxycarbonylamino)methyl]cyclohexyl]acetate Chemical compound COC(=O)NCC1(CC(=O)OC)CCCCC1 XBCUTKBYIBLQDE-UHFFFAOYSA-N 0.000 description 1
- YZMHQCWXYHARLS-UHFFFAOYSA-N naphthalene-1,2-disulfonic acid Chemical class C1=CC=CC2=C(S(O)(=O)=O)C(S(=O)(=O)O)=CC=C21 YZMHQCWXYHARLS-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical class OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D221/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00
- C07D221/02—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00 condensed with carbocyclic rings or ring systems
- C07D221/20—Spiro-condensed ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/54—Spiro-condensed
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Indole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pyrrole Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
Priority Applications (17)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762611690 DE2611690A1 (de) | 1976-03-19 | 1976-03-19 | Cyclische sulfonyloxyimide |
| US05/775,336 US4152326A (en) | 1976-03-19 | 1977-03-07 | Cyclic sulphonyloxyimides |
| IE520/77A IE44641B1 (en) | 1976-03-19 | 1977-03-09 | 1,1-cycloalkyldiacetic acid imide derivatives and their use for preparing 1-aminomethyl-1-cycloalkylacetic acids |
| GB11097/77A GB1575709A (en) | 1976-03-19 | 1977-03-16 | 1,1-cycloalkyldiacetic acid imide derivatives and their use for preparing 1-aminomethyl-1-cycloalkylacetic acids |
| BE6045936A BE852591A (fr) | 1976-03-19 | 1977-03-17 | Sulfonyloxyimides cycliques |
| SE7703018A SE442013B (sv) | 1976-03-19 | 1977-03-17 | Cykliska sulfonyloxiimider for anvendning vid framstellning av cykliska aminosyror |
| FR7707961A FR2344540A1 (fr) | 1976-03-19 | 1977-03-17 | Sulfonyloximides cycliques, leur procede de preparation et hydroxyimides cycliques convenant a cette fin |
| NLAANVRAGE7703014,A NL186634C (nl) | 1976-03-19 | 1977-03-18 | Werkwijze ter bereiding van cyclische aminozuren en ter bereiding van bij toepassing van deze werkwijze geschikte sulfonyloxyimiden. |
| CH343777A CH635066A5 (de) | 1976-03-19 | 1977-03-18 | Verfahren zur herstellung cyclischer aminosaeuren. |
| AU23414/77A AU513892B2 (en) | 1976-03-19 | 1977-03-18 | Cyclic amino acid derivatives |
| LU76974A LU76974A1 (https=) | 1976-03-19 | 1977-03-18 | |
| DK120077A DK156826C (da) | 1976-03-19 | 1977-03-18 | Fremgangsmaade til fremstilling af cycliske aminosyrer |
| JP2934577A JPS52113977A (en) | 1976-03-19 | 1977-03-18 | Cyclohydroxyimide |
| ES457050A ES457050A1 (es) | 1976-03-19 | 1977-03-21 | Un procedimiento para la preparacion de aminoacidos cicli- cos. |
| DK087282A DK156770C (da) | 1976-03-19 | 1982-02-26 | Cycliske sulfonyloxyimider til anvendelse som mellemprodukter ved fremstilling af cycliske aminosyrer |
| SE8205469A SE454273B (sv) | 1976-03-19 | 1982-09-24 | Cykliska hydroxiimider till anvendning vid framstellning av cykliska aminosyror samt forfaranden for deras framstellning |
| DK214688A DK159680C (da) | 1976-03-19 | 1988-04-20 | Cycliske imider til anvendelse ved fremstilling af cycliske aminosyrer |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762611690 DE2611690A1 (de) | 1976-03-19 | 1976-03-19 | Cyclische sulfonyloxyimide |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2611690A1 true DE2611690A1 (de) | 1977-09-22 |
| DE2611690C2 DE2611690C2 (https=) | 1992-01-16 |
Family
ID=5972938
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762611690 Granted DE2611690A1 (de) | 1976-03-19 | 1976-03-19 | Cyclische sulfonyloxyimide |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4152326A (https=) |
| JP (1) | JPS52113977A (https=) |
| AU (1) | AU513892B2 (https=) |
| BE (1) | BE852591A (https=) |
| CH (1) | CH635066A5 (https=) |
| DE (1) | DE2611690A1 (https=) |
| DK (2) | DK156826C (https=) |
| ES (1) | ES457050A1 (https=) |
| FR (1) | FR2344540A1 (https=) |
| GB (1) | GB1575709A (https=) |
| IE (1) | IE44641B1 (https=) |
| LU (1) | LU76974A1 (https=) |
| NL (1) | NL186634C (https=) |
| SE (2) | SE442013B (https=) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0358092A1 (de) * | 1988-09-01 | 1990-03-14 | Lonza A.G. | 2-Aza-4-(alkoxycarbonyl)spiro-[4,5]decan-3-on |
| EP1468985A1 (en) * | 2003-04-18 | 2004-10-20 | FARCHEMIA S.r.l. | A process for the preparation of gabapentin free from inorganic acids anions |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3928183A1 (de) * | 1989-08-25 | 1991-02-28 | Goedecke Ag | Lactamfreie cyclische aminosaeuren |
| DE3928182A1 (de) | 1989-08-25 | 1991-02-28 | Goedecke Ag | Verfahren zur herstellung von gabapentin |
| AU633612B2 (en) * | 1989-08-25 | 1993-02-04 | Warner-Lambert Company | Improved process for cyclic amino acid anticonvulsant compounds |
| US5319135A (en) * | 1989-08-25 | 1994-06-07 | Warner-Lambert Company | Process for cyclic amino acid anticonvulsant compounds |
| US5132451A (en) * | 1989-08-25 | 1992-07-21 | Warner-Lambert Company | Process for cyclic amino acid anticonvulsant compounds |
| US5149870A (en) * | 1989-11-16 | 1992-09-22 | Lonza Ltd. | Process for the production of 1-(aminomethyl)cyclohexane acetic acid |
| FI905584L (fi) * | 1989-11-16 | 1991-05-17 | Lonza Ag | Foerfarande foer framstaellning av 1-(aminometyl)cyklohexanaettikssyra. |
| US5136091A (en) * | 1989-11-16 | 1992-08-04 | Lonza Ltd. | Process for the production of 1-(aminomethyl) cyclohexane acetic acid |
| HU224720B1 (en) * | 1996-03-14 | 2006-01-30 | Warner Lambert Co | Novel substituted cyclic amino acid derivatives use as pharmaceutical agents |
| WO1999018063A2 (en) | 1997-10-07 | 1999-04-15 | Warner-Lambert Company | Process for preparing a cyclic amino acid anticonvulsant compound |
| ATE323067T1 (de) * | 1997-10-27 | 2006-04-15 | Warner Lambert Co | Zyklische aminosäuren und deren derivate als arzneimittel |
| GB2362646A (en) * | 2000-05-26 | 2001-11-28 | Warner Lambert Co | Cyclic amino acid derivatives useful as pharmaceutical agents |
| PL363155A1 (en) * | 2000-06-16 | 2004-11-15 | Teva Pharmaceutical Industries, Ltd. | Stable gabapentin having ph within a controlled range |
| DE60101476T2 (de) | 2000-06-16 | 2004-05-27 | Teva Pharmaceutical Industries Ltd. | Stabiles gabapentin, das mehr als 20 ppm chlor enthält |
| US7186855B2 (en) * | 2001-06-11 | 2007-03-06 | Xenoport, Inc. | Prodrugs of GABA analogs, compositions and uses thereof |
| US8048917B2 (en) | 2005-04-06 | 2011-11-01 | Xenoport, Inc. | Prodrugs of GABA analogs, compositions and uses thereof |
| US6818787B2 (en) * | 2001-06-11 | 2004-11-16 | Xenoport, Inc. | Prodrugs of GABA analogs, compositions and uses thereof |
| CN1264607C (zh) * | 2001-09-28 | 2006-07-19 | 大赛璐化学工业株式会社 | 含有n-取代的环酰亚胺化合物的催化剂和使用该催化剂生产有机化合物的方法 |
| US7612112B2 (en) * | 2001-10-25 | 2009-11-03 | Depomed, Inc. | Methods of treatment using a gastric retained gabapentin dosage |
| US20070184104A1 (en) * | 2001-10-25 | 2007-08-09 | Depomed, Inc. | Gastric retentive gabapentin dosage forms and methods for using same |
| US20060159743A1 (en) * | 2001-10-25 | 2006-07-20 | Depomed, Inc. | Methods of treating non-nociceptive pain states with gastric retentive gabapentin |
| TWI312285B (en) | 2001-10-25 | 2009-07-21 | Depomed Inc | Methods of treatment using a gastric retained gabapentin dosage |
| ITMI20012750A1 (it) | 2001-12-21 | 2003-06-21 | Procos Spa | Processo per la produzione dell'acido 1-(amminometil)-cicloesil-acetico in forma pura |
| ITMI20022071A1 (it) * | 2002-10-01 | 2004-04-02 | Erregierre Spa | Processo di sintesi dell'acido 1-(aminometil)cicloesanacetico cloridato. |
| EP1727784B1 (en) | 2002-11-18 | 2008-12-24 | Nicholas Piramal India Limited | Improved process for preparation of gabapentin |
| US20050187295A1 (en) * | 2004-02-19 | 2005-08-25 | Surendra Kalyan | Processes for the preparation of gabapentin |
| US20090176882A1 (en) * | 2008-12-09 | 2009-07-09 | Depomed, Inc. | Gastric retentive gabapentin dosage forms and methods for using same |
| US8431739B2 (en) | 2010-06-14 | 2013-04-30 | Divi's Laboratories, Ltd. | Process for the preparation of gabapentin |
| RU2678991C1 (ru) * | 2017-12-21 | 2019-02-05 | Закрытое акционерное общество "Институт новых углеродных материалов и технологий" (ЗАО "ИНУМиТ") | Латентный катализатор ускорения отверждения смесей фенолформальдегидных и эпоксидных смол и способ его изготовления |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3238217A (en) * | 1961-09-07 | 1966-03-01 | Geschickter Fund Med Res | Azaspiranes |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3256277A (en) * | 1966-06-14 | Azaspiro alkanes | ||
| US3256276A (en) * | 1961-02-17 | 1966-06-14 | Geschickter Fund Med Res | Substituted spiroimides |
| US3432499A (en) * | 1965-04-02 | 1969-03-11 | Geschickter Fund Med Res | Trifluoromethylazaspiranes and azaspirane diones |
| DE2460891C2 (de) * | 1974-12-21 | 1982-09-23 | Gödecke AG, 1000 Berlin | 1-Aminomethyl-1-cycloalkanessigsäuren und deren Ester, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Arzneimittel |
-
1976
- 1976-03-19 DE DE19762611690 patent/DE2611690A1/de active Granted
-
1977
- 1977-03-07 US US05/775,336 patent/US4152326A/en not_active Expired - Lifetime
- 1977-03-09 IE IE520/77A patent/IE44641B1/en not_active IP Right Cessation
- 1977-03-16 GB GB11097/77A patent/GB1575709A/en not_active Expired
- 1977-03-17 SE SE7703018A patent/SE442013B/xx not_active IP Right Cessation
- 1977-03-17 BE BE6045936A patent/BE852591A/xx not_active IP Right Cessation
- 1977-03-17 FR FR7707961A patent/FR2344540A1/fr active Granted
- 1977-03-18 JP JP2934577A patent/JPS52113977A/ja active Pending
- 1977-03-18 LU LU76974A patent/LU76974A1/xx unknown
- 1977-03-18 NL NLAANVRAGE7703014,A patent/NL186634C/xx not_active IP Right Cessation
- 1977-03-18 CH CH343777A patent/CH635066A5/de not_active IP Right Cessation
- 1977-03-18 DK DK120077A patent/DK156826C/da not_active IP Right Cessation
- 1977-03-18 AU AU23414/77A patent/AU513892B2/en not_active Expired
- 1977-03-21 ES ES457050A patent/ES457050A1/es not_active Expired
-
1982
- 1982-09-24 SE SE8205469A patent/SE454273B/sv not_active IP Right Cessation
-
1988
- 1988-04-20 DK DK214688A patent/DK159680C/da active
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3238217A (en) * | 1961-09-07 | 1966-03-01 | Geschickter Fund Med Res | Azaspiranes |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0358092A1 (de) * | 1988-09-01 | 1990-03-14 | Lonza A.G. | 2-Aza-4-(alkoxycarbonyl)spiro-[4,5]decan-3-on |
| EP1468985A1 (en) * | 2003-04-18 | 2004-10-20 | FARCHEMIA S.r.l. | A process for the preparation of gabapentin free from inorganic acids anions |
Also Published As
| Publication number | Publication date |
|---|---|
| DK159680C (da) | 1991-04-22 |
| DK214688D0 (da) | 1988-04-20 |
| FR2344540B1 (https=) | 1981-02-27 |
| ES457050A1 (es) | 1978-08-16 |
| FR2344540A1 (fr) | 1977-10-14 |
| DK120077A (da) | 1977-09-20 |
| SE7703018L (sv) | 1977-09-20 |
| AU2341477A (en) | 1978-09-21 |
| IE44641B1 (en) | 1982-02-10 |
| DK156826C (da) | 1990-03-12 |
| JPS52113977A (en) | 1977-09-24 |
| SE454273B (sv) | 1988-04-18 |
| DK156826B (da) | 1989-10-09 |
| GB1575709A (en) | 1980-09-24 |
| DE2611690C2 (https=) | 1992-01-16 |
| SE442013B (sv) | 1985-11-25 |
| DK214688A (da) | 1988-04-20 |
| AU513892B2 (en) | 1981-01-15 |
| NL186634C (nl) | 1991-01-16 |
| SE8205469L (sv) | 1982-09-24 |
| LU76974A1 (https=) | 1977-07-22 |
| SE8205469D0 (sv) | 1982-09-24 |
| DK159680B (da) | 1990-11-19 |
| BE852591A (fr) | 1977-09-19 |
| US4152326A (en) | 1979-05-01 |
| CH635066A5 (de) | 1983-03-15 |
| IE44641L (en) | 1977-09-19 |
| NL7703014A (nl) | 1977-09-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2611690A1 (de) | Cyclische sulfonyloxyimide | |
| DE69426520T2 (de) | Neues verfahren zur herstellung von ergothionein | |
| EP0253257A2 (de) | Substituierte Amino -5,6,7,8-tetrahydronaphtyl-oxyessigsäuren, Verfahren zu deren Herstellung sowie die Verwendung als Arzneimittel | |
| DE69605746T2 (de) | Naphtholderivate und ein verfahren zu ihrer herstellung | |
| DE2858737C2 (https=) | ||
| DE2830469A1 (de) | Herstellung von l-desoxy-nojirimycin und n-substituierten derivaten | |
| DE2316377B2 (de) | Verfahren zur Herstellung von 2-Phenyl-amino-2-imidazolin-Derivaten und von deren Salzen | |
| DE69429224T2 (de) | Zwischenprodukte für die Synthese von Cephalosporinen | |
| CH660483A5 (de) | Verfahren zur herstellung von cimetidin und seiner n-benzylderivate. | |
| EP0270929A2 (de) | Substituierte Aminomethyl-5,6,7,8-tetrahydronaphtyl-oxy-essigsäuren, neue Zwischenprodukte, Verfahren zu ihrer Herstellung sowie ihre Verwendungin Arzneimitteln | |
| EP0179408A2 (de) | Neue Amidoalkylmelamine und Aminoalkylmelamine und Verfahren zu ihrer Herstellung | |
| DE887816C (de) | Verfahren zur Herstellung von 1-Nitrophenyl-2-amino-propan-1, 3-diolderivaten | |
| DE2936240A1 (de) | Verfahren zur herstellung bekannter und neuer 6-amino-6-desoxy-2,3-0-isopropyliden-(alpha)-l-sorbofuranose-derivate sowie neue zwischenprodukte des verfahrens | |
| EP0088252B1 (de) | Verfahren zur Herstellung von 1-(4-Chlorbenzoyl)-5-methoxy-2-methyl-3-indolacetoxyessigsäure | |
| DE2409675A1 (de) | Alpha-alkyl(oder -aryl)-thio-5-hydroxytryptophan-derivat und verfahren zu seiner herstellung | |
| DE2436897C2 (de) | Verfahren zur Herstellung von Trisaminopyridinen | |
| DE69528770T2 (de) | Derivate des benzopyrans und des benzothiopyrans, deren herstellung und deren verwendung als agonisten von dopamin rezeptoren | |
| DE3314167C2 (https=) | ||
| DE862602C (de) | Verfahren zur Herstellung von Halogendiamidinen und ihren Salzen | |
| DE2225482C3 (de) | Pyrindin-2,6-bis(dithiocarbamat)-Derivate, Verfahren zur Herstellung derselben und Mittel mit einem Gehalt derselben | |
| EP0087656B1 (de) | Verfahren zur Herstellung von 1-(4-Chlorbenzoyl)-5-methoxy-2-methyl-3-indolacetoxyessigsäure | |
| DE2637580C2 (de) | Verfahren zur herstellung von n-substituierten oxazolidinen | |
| DE2759137A1 (de) | Tetrathio- und tetraselenopentalen- verbindungen | |
| DE2051871A1 (en) | Beta-amino-alpha-aryloxymethylacrylonitrile - and 2,4-diamino-5-benzylpyrimidine derivs. useful as antibacterial agents | |
| DE2362687A1 (de) | Verfahren zur razematspaltung von d,l-penicillamin |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OI | Miscellaneous see part 1 | ||
| AF | Is addition to no. |
Ref country code: DE Ref document number: 2460891 Format of ref document f/p: P |
|
| 8110 | Request for examination paragraph 44 | ||
| AF | Is addition to no. |
Ref country code: DE Ref document number: 2460891 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |