DE2607681A1 - Thenyl- und tetrazolylmethylcephalosporine - Google Patents
Thenyl- und tetrazolylmethylcephalosporineInfo
- Publication number
- DE2607681A1 DE2607681A1 DE19762607681 DE2607681A DE2607681A1 DE 2607681 A1 DE2607681 A1 DE 2607681A1 DE 19762607681 DE19762607681 DE 19762607681 DE 2607681 A DE2607681 A DE 2607681A DE 2607681 A1 DE2607681 A1 DE 2607681A1
- Authority
- DE
- Germany
- Prior art keywords
- cephem
- general formula
- carboxylic acid
- group
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 150000001875 compounds Chemical class 0.000 claims description 82
- -1 2-Thienylacetamido Chemical group 0.000 claims description 56
- 238000000034 method Methods 0.000 claims description 30
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 17
- 238000006243 chemical reaction Methods 0.000 claims description 15
- 125000000143 2-carboxyethyl group Chemical group [H]OC(=O)C([H])([H])C([H])([H])* 0.000 claims description 13
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 9
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical class S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 claims description 8
- 150000002148 esters Chemical group 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 125000003282 alkyl amino group Chemical group 0.000 claims description 6
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- 125000001544 thienyl group Chemical group 0.000 claims description 5
- 125000006239 protecting group Chemical group 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 3
- 125000001425 triazolyl group Chemical group 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 2
- 230000002378 acidificating effect Effects 0.000 claims 1
- 230000003115 biocidal effect Effects 0.000 claims 1
- 229940079593 drug Drugs 0.000 claims 1
- 239000003814 drug Substances 0.000 claims 1
- 150000007529 inorganic bases Chemical class 0.000 claims 1
- 150000007530 organic bases Chemical class 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 84
- 239000000243 solution Substances 0.000 description 50
- 239000000203 mixture Substances 0.000 description 41
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 38
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 34
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 34
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 32
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 31
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 29
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 27
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 25
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- 239000011541 reaction mixture Substances 0.000 description 24
- 159000000000 sodium salts Chemical class 0.000 description 24
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 18
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 18
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 17
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 16
- 235000017557 sodium bicarbonate Nutrition 0.000 description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 229910052757 nitrogen Inorganic materials 0.000 description 13
- JAAIPIWKKXCNOC-UHFFFAOYSA-N 1h-tetrazol-1-ium-5-thiolate Chemical compound SC1=NN=NN1 JAAIPIWKKXCNOC-UHFFFAOYSA-N 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- 239000008346 aqueous phase Substances 0.000 description 12
- 239000002253 acid Substances 0.000 description 11
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 10
- 239000002024 ethyl acetate extract Substances 0.000 description 10
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 8
- 235000019341 magnesium sulphate Nutrition 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- LLCOQBODWBFTDD-UHFFFAOYSA-N 1h-triazol-1-ium-4-thiolate Chemical compound SC1=CNN=N1 LLCOQBODWBFTDD-UHFFFAOYSA-N 0.000 description 7
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 7
- 239000007864 aqueous solution Substances 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 239000000284 extract Substances 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- AJYXPNIENRLELY-UHFFFAOYSA-N 2-thiophen-2-ylacetyl chloride Chemical compound ClC(=O)CC1=CC=CS1 AJYXPNIENRLELY-UHFFFAOYSA-N 0.000 description 5
- 229930186147 Cephalosporin Natural products 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 5
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 5
- 229940124587 cephalosporin Drugs 0.000 description 5
- 150000001780 cephalosporins Chemical class 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- UOTQEHLQKASWQO-UHFFFAOYSA-N 2-(5-sulfanylidene-2h-tetrazol-1-yl)acetic acid Chemical compound OC(=O)CN1N=NN=C1S UOTQEHLQKASWQO-UHFFFAOYSA-N 0.000 description 4
- BKZLVXLDRQUFHT-UHFFFAOYSA-N 3-(5-sulfanylidene-2h-tetrazol-1-yl)propanoic acid Chemical compound OC(=O)CCN1N=NN=C1S BKZLVXLDRQUFHT-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 4
- XIURVHNZVLADCM-IUODEOHRSA-N cefalotin Chemical compound N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C(O)=O)C(=O)CC1=CC=CS1 XIURVHNZVLADCM-IUODEOHRSA-N 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 3
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000003292 glue Substances 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 239000003456 ion exchange resin Substances 0.000 description 3
- 229920003303 ion-exchange polymer Polymers 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000000575 pesticide Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- HNRQWFXWCSGIQR-UHFFFAOYSA-N 11-(methylsulfanylcarbothioylamino)undecanoic acid Chemical compound CSC(=S)NCCCCCCCCCCC(O)=O HNRQWFXWCSGIQR-UHFFFAOYSA-N 0.000 description 2
- AFBBKYQYNPNMAT-UHFFFAOYSA-N 1h-1,2,4-triazol-1-ium-3-thiolate Chemical compound SC=1N=CNN=1 AFBBKYQYNPNMAT-UHFFFAOYSA-N 0.000 description 2
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 2
- SYOANZBNGDEJFH-UHFFFAOYSA-N 2,5-dihydro-1h-triazole Chemical compound C1NNN=C1 SYOANZBNGDEJFH-UHFFFAOYSA-N 0.000 description 2
- OYLWNIRWHSRRDC-UHFFFAOYSA-N 2-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)acetic acid Chemical compound OC(=O)CC1=NN=C(S)N1 OYLWNIRWHSRRDC-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- PBBKFUOGKZPENI-UHFFFAOYSA-N 3-(methylsulfanylcarbothioylamino)propanoic acid Chemical compound CSC(=S)NCCC(O)=O PBBKFUOGKZPENI-UHFFFAOYSA-N 0.000 description 2
- OQEBBZSWEGYTPG-UHFFFAOYSA-N 3-aminobutanoic acid Chemical compound CC(N)CC(O)=O OQEBBZSWEGYTPG-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- BQIWJFVLKNPOGK-UHFFFAOYSA-N 6-(5-sulfanylidene-2h-tetrazol-1-yl)hexanoic acid Chemical compound OC(=O)CCCCCN1N=NN=C1S BQIWJFVLKNPOGK-UHFFFAOYSA-N 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical class OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- QWCKQJZIFLGMSD-UHFFFAOYSA-N alpha-aminobutyric acid Chemical compound CCC(N)C(O)=O QWCKQJZIFLGMSD-UHFFFAOYSA-N 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- UCMIRNVEIXFBKS-UHFFFAOYSA-N beta-alanine Chemical compound NCCC(O)=O UCMIRNVEIXFBKS-UHFFFAOYSA-N 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000001782 cephems Chemical class 0.000 description 2
- 229920001429 chelating resin Polymers 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 210000002966 serum Anatomy 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- IAIJXUHASIZJOZ-WPZCJLIBSA-N (6r)-3-[[1-(carboxymethyl)tetrazol-5-yl]sulfanylmethyl]-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)CC=3SC=CC=3)[C@H]2SC1 IAIJXUHASIZJOZ-WPZCJLIBSA-N 0.000 description 1
- MDGYFLVHPNJXOI-IOJJLOCKSA-N (6r)-7-amino-3-[[1-(2-amino-2-oxoethyl)tetrazol-5-yl]sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)N)CC=1CSC1=NN=NN1CC(N)=O MDGYFLVHPNJXOI-IOJJLOCKSA-N 0.000 description 1
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical class NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 1
- YIQVJZMYQCYZKP-UHFFFAOYSA-N 1-o,1-o-diethyl 2-o-methyl 2-ethylbutane-1,1,2-tricarboxylate Chemical compound CCOC(=O)C(C(=O)OCC)C(CC)(CC)C(=O)OC YIQVJZMYQCYZKP-UHFFFAOYSA-N 0.000 description 1
- UDBSWPKISUZCAT-UHFFFAOYSA-N 1-o,1-o-diethyl 3-o-methyl 3-methylbutane-1,1,3-tricarboxylate Chemical compound CCOC(=O)C(C(=O)OCC)CC(C)(C)C(=O)OC UDBSWPKISUZCAT-UHFFFAOYSA-N 0.000 description 1
- HRDIKQFHFOTXDL-UHFFFAOYSA-N 1-o,1-o-diethyl 3-o-methyl propane-1,1,3-tricarboxylate Chemical compound CCOC(=O)C(C(=O)OCC)CCC(=O)OC HRDIKQFHFOTXDL-UHFFFAOYSA-N 0.000 description 1
- BAKUBDCJRCCYJT-UHFFFAOYSA-N 1-o,1-o-diethyl 5-o-methyl hexane-1,1,5-tricarboxylate Chemical compound CCOC(=O)C(C(=O)OCC)CCCC(C)C(=O)OC BAKUBDCJRCCYJT-UHFFFAOYSA-N 0.000 description 1
- AXKPLOXWGRGZDU-UHFFFAOYSA-N 11-(5-sulfanylidene-2h-tetrazol-1-yl)undecanamide Chemical compound NC(=O)CCCCCCCCCCN1NN=NC1=S AXKPLOXWGRGZDU-UHFFFAOYSA-N 0.000 description 1
- MWJYRAUQODYNLH-UHFFFAOYSA-N 11-(5-sulfanylidene-2h-tetrazol-1-yl)undecanoic acid Chemical compound OC(=O)CCCCCCCCCCN1NN=NC1=S MWJYRAUQODYNLH-UHFFFAOYSA-N 0.000 description 1
- PBLZLIFKVPJDCO-UHFFFAOYSA-N 12-aminododecanoic acid Chemical compound NCCCCCCCCCCCC(O)=O PBLZLIFKVPJDCO-UHFFFAOYSA-N 0.000 description 1
- RHJDIDBHTPSUBU-UHFFFAOYSA-N 2-(5-sulfanylidene-1,2-dihydrotriazol-4-yl)acetic acid Chemical compound OC(=O)CC=1N=NNC=1S RHJDIDBHTPSUBU-UHFFFAOYSA-N 0.000 description 1
- TWGICHSXPKQMRR-UHFFFAOYSA-N 2-(5-sulfanylidene-2h-tetrazol-1-yl)propanoic acid Chemical compound OC(=O)C(C)N1N=NN=C1S TWGICHSXPKQMRR-UHFFFAOYSA-N 0.000 description 1
- CVYLWKKBVGCWBQ-UHFFFAOYSA-N 2-(methylsulfanylcarbothioylamino)acetic acid Chemical compound CSC(=S)NCC(O)=O CVYLWKKBVGCWBQ-UHFFFAOYSA-N 0.000 description 1
- GRWAIJBHBCCLGS-UHFFFAOYSA-N 2-(tetrazol-1-yl)acetic acid Chemical compound OC(=O)CN1C=NN=N1 GRWAIJBHBCCLGS-UHFFFAOYSA-N 0.000 description 1
- SNDPXSYFESPGGJ-UHFFFAOYSA-N 2-aminopentanoic acid Chemical compound CCCC(N)C(O)=O SNDPXSYFESPGGJ-UHFFFAOYSA-N 0.000 description 1
- KARGJECDNYFOQH-UHFFFAOYSA-N 2-isothiocyanatoacetic acid Chemical compound OC(=O)CN=C=S KARGJECDNYFOQH-UHFFFAOYSA-N 0.000 description 1
- YLZOPXRUQYQQID-UHFFFAOYSA-N 3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]propan-1-one Chemical compound N1N=NC=2CN(CCC=21)CCC(=O)N1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F YLZOPXRUQYQQID-UHFFFAOYSA-N 0.000 description 1
- HDCRPLDQSLGQQA-UHFFFAOYSA-N 3-(5-sulfanylidene-2h-tetrazol-1-yl)butanoic acid Chemical compound OC(=O)CC(C)N1N=NN=C1S HDCRPLDQSLGQQA-UHFFFAOYSA-N 0.000 description 1
- XSHRIGOGVGDZIX-UHFFFAOYSA-N 3-(5-sulfanylidene-2h-tetrazol-1-yl)propanamide Chemical compound NC(=O)CCN1N=NN=C1S XSHRIGOGVGDZIX-UHFFFAOYSA-N 0.000 description 1
- FUENJGFCFZKXBX-UHFFFAOYSA-N 3-azaniumylheptanoate Chemical compound CCCCC(N)CC(O)=O FUENJGFCFZKXBX-UHFFFAOYSA-N 0.000 description 1
- WHNOEVOISMYRDZ-UHFFFAOYSA-N 4-(5-sulfanylidene-2h-tetrazol-1-yl)butanamide Chemical compound NC(=O)CCCN1N=NN=C1S WHNOEVOISMYRDZ-UHFFFAOYSA-N 0.000 description 1
- MORHPNKHDKWZHZ-UHFFFAOYSA-N 4-(5-sulfanylidene-2h-tetrazol-1-yl)butanoic acid Chemical compound OC(=O)CCCN1N=NN=C1S MORHPNKHDKWZHZ-UHFFFAOYSA-N 0.000 description 1
- JQATYBMVAFRQNM-UHFFFAOYSA-N 4-(methylsulfanylcarbothioylamino)butanoic acid Chemical compound CSC(=S)NCCCC(O)=O JQATYBMVAFRQNM-UHFFFAOYSA-N 0.000 description 1
- HFGHRUCCKVYFKL-UHFFFAOYSA-N 4-ethoxy-2-piperazin-1-yl-7-pyridin-4-yl-5h-pyrimido[5,4-b]indole Chemical compound C1=C2NC=3C(OCC)=NC(N4CCNCC4)=NC=3C2=CC=C1C1=CC=NC=C1 HFGHRUCCKVYFKL-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- AZMSMQZKBRVUHB-UHFFFAOYSA-N 5-sulfanylidene-1,2-dihydrotriazole-4-carboxamide Chemical compound NC(=O)C1=NNNC1=S AZMSMQZKBRVUHB-UHFFFAOYSA-N 0.000 description 1
- GNCPNAQCXHPXOX-UHFFFAOYSA-N 5-sulfanylidene-1,2-dihydrotriazole-4-carboxylic acid Chemical compound OC(=O)C1=NNNC1=S GNCPNAQCXHPXOX-UHFFFAOYSA-N 0.000 description 1
- CDAOOUIBHCVUSV-UHFFFAOYSA-N 6-(5-sulfanylidene-2h-tetrazol-1-yl)hexanamide Chemical compound NC(=O)CCCCCN1N=NN=C1S CDAOOUIBHCVUSV-UHFFFAOYSA-N 0.000 description 1
- OJIOPDXKHZOIIZ-UHFFFAOYSA-N 6-(methylsulfanylcarbothioylamino)hexanoic acid Chemical compound CSC(=S)NCCCCCC(O)=O OJIOPDXKHZOIIZ-UHFFFAOYSA-N 0.000 description 1
- SLXKOJJOQWFEFD-UHFFFAOYSA-N 6-aminohexanoic acid Chemical compound NCCCCCC(O)=O SLXKOJJOQWFEFD-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- IKKSMKVTNYLVHA-FIKRSJQMSA-N CC(C1=C(N2[C@@H](C(C2=O)NC(=O)CC3=CC=CS3)SC1)C(=O)O)SC4=NN=NN4C(=O)O Chemical compound CC(C1=C(N2[C@@H](C(C2=O)NC(=O)CC3=CC=CS3)SC1)C(=O)O)SC4=NN=NN4C(=O)O IKKSMKVTNYLVHA-FIKRSJQMSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- 241000588772 Morganella morganii Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- MKYBYDHXWVHEJW-UHFFFAOYSA-N N-[1-oxo-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propan-2-yl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(C(C)NC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 MKYBYDHXWVHEJW-UHFFFAOYSA-N 0.000 description 1
- 206010035148 Plague Diseases 0.000 description 1
- 241000405965 Scomberomorus brasiliensis Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical class [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- FHKPLLOSJHHKNU-INIZCTEOSA-N [(3S)-3-[8-(1-ethyl-5-methylpyrazol-4-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]-(oxan-4-yl)methanone Chemical compound C(C)N1N=CC(=C1C)C=1N(C2=NC=NC(=C2N=1)O[C@@H]1CN(CC1)C(=O)C1CCOCC1)C FHKPLLOSJHHKNU-INIZCTEOSA-N 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 235000004279 alanine Nutrition 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229960002684 aminocaproic acid Drugs 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- UDLLFLQFQMACJB-UHFFFAOYSA-N azidomethylbenzene Chemical compound [N-]=[N+]=NCC1=CC=CC=C1 UDLLFLQFQMACJB-UHFFFAOYSA-N 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 229940000635 beta-alanine Drugs 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 238000006264 debenzylation reaction Methods 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- IBDMRHDXAQZJAP-UHFFFAOYSA-N dichlorophosphorylbenzene Chemical compound ClP(Cl)(=O)C1=CC=CC=C1 IBDMRHDXAQZJAP-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- 150000004659 dithiocarbamates Chemical class 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- IOLQWGVDEFWYNP-UHFFFAOYSA-N ethyl 2-bromo-2-methylpropanoate Chemical compound CCOC(=O)C(C)(C)Br IOLQWGVDEFWYNP-UHFFFAOYSA-N 0.000 description 1
- IYPSSPPKMLXXRN-UHFFFAOYSA-N ethyl 2-isothiocyanatoacetate Chemical compound CCOC(=O)CN=C=S IYPSSPPKMLXXRN-UHFFFAOYSA-N 0.000 description 1
- ORPRVDCFUJMTEZ-UHFFFAOYSA-N ethyl 3-(1-benzyl-5-chlorotriazol-4-yl)propanoate Chemical compound ClC1=C(CCC(=O)OCC)N=NN1CC1=CC=CC=C1 ORPRVDCFUJMTEZ-UHFFFAOYSA-N 0.000 description 1
- ZUGOHJWUTNKRMG-UHFFFAOYSA-N ethyl 5-aminothiadiazole-4-carboxylate Chemical compound CCOC(=O)C=1N=NSC=1N ZUGOHJWUTNKRMG-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229910052730 francium Inorganic materials 0.000 description 1
- 229960003692 gamma aminobutyric acid Drugs 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- JBFYUZGYRGXSFL-UHFFFAOYSA-N imidazolide Chemical compound C1=C[N-]C=N1 JBFYUZGYRGXSFL-UHFFFAOYSA-N 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- GYXGJKGWKZTXMX-UHFFFAOYSA-N methyl 2-bromo-2-ethylbutanoate Chemical compound CCC(Br)(CC)C(=O)OC GYXGJKGWKZTXMX-UHFFFAOYSA-N 0.000 description 1
- NFWYCLOPRIAQFJ-UHFFFAOYSA-N methyl 5-bromo-2-methylpentanoate Chemical compound COC(=O)C(C)CCCBr NFWYCLOPRIAQFJ-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- UORVCLMRJXCDCP-UHFFFAOYSA-N propynoic acid Chemical compound OC(=O)C#C UORVCLMRJXCDCP-UHFFFAOYSA-N 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000006000 trichloroethyl group Chemical group 0.000 description 1
- FHDFMQBXVDYVGQ-UHFFFAOYSA-N triethyl 2-methylpropane-1,1,2-tricarboxylate Chemical compound CCOC(=O)C(C(=O)OCC)C(C)(C)C(=O)OCC FHDFMQBXVDYVGQ-UHFFFAOYSA-N 0.000 description 1
- ILKYNBSNODHAAI-UHFFFAOYSA-N triethyl butane-1,1,3-tricarboxylate Chemical compound CCOC(=O)C(C)CC(C(=O)OCC)C(=O)OCC ILKYNBSNODHAAI-UHFFFAOYSA-N 0.000 description 1
- TVWZLLYAJDSSCJ-UHFFFAOYSA-N triethyl ethane-1,1,2-tricarboxylate Chemical compound CCOC(=O)CC(C(=O)OCC)C(=O)OCC TVWZLLYAJDSSCJ-UHFFFAOYSA-N 0.000 description 1
- HRXKRNGNAMMEHJ-UHFFFAOYSA-K trisodium citrate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O HRXKRNGNAMMEHJ-UHFFFAOYSA-K 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/36—Methylene radicals, substituted by sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US55372275A | 1975-02-27 | 1975-02-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2607681A1 true DE2607681A1 (de) | 1976-09-09 |
Family
ID=24210475
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762607681 Withdrawn DE2607681A1 (de) | 1975-02-27 | 1976-02-25 | Thenyl- und tetrazolylmethylcephalosporine |
Country Status (13)
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4112086A (en) * | 1976-11-02 | 1978-09-05 | Smithkline Corporation | 7β-Acylamino-3-(phosphonoalkyl and esterified phosphonoalkyl substituted tetrazolylthiomethyl)cephalosporins |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2068419A1 (en) * | 1969-10-27 | 1971-08-27 | Fujisawa Pharmaceutical Co | Antibacterial cephalosporin compsns |
| BE793037A (fr) * | 1971-12-23 | 1973-06-20 | Fujisawa Pharmaceutical Co | Procede de preparation de derives d'acide 7-acylamino-3-substitue-3-cephem-4-carboxylique et nouveaux produits ainsi obtenus |
| JPS612674B2 (enrdf_load_stackoverflow) * | 1974-06-20 | 1986-01-27 | Meiji Seika Co |
-
1976
- 1976-01-27 ZA ZA451A patent/ZA76451B/xx unknown
- 1976-02-16 CA CA245,853A patent/CA1072543A/en not_active Expired
- 1976-02-18 GB GB6367/76A patent/GB1544703A/en not_active Expired
- 1976-02-19 IL IL49066A patent/IL49066A/xx unknown
- 1976-02-20 BE BE164478A patent/BE838760A/xx not_active IP Right Cessation
- 1976-02-23 IT IT20483/76A patent/IT1055451B/it active
- 1976-02-24 JP JP51019818A patent/JPS51110595A/ja active Pending
- 1976-02-25 LU LU74427A patent/LU74427A1/xx unknown
- 1976-02-25 DE DE19762607681 patent/DE2607681A1/de not_active Withdrawn
- 1976-02-25 AU AU11406/76A patent/AU499565B2/en not_active Expired
- 1976-02-25 NL NL7601935A patent/NL7601935A/xx not_active Application Discontinuation
- 1976-02-27 FR FR7605506A patent/FR2302098A1/fr active Granted
- 1976-02-27 IE IE406/76A patent/IE42961B1/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL7601935A (nl) | 1976-08-31 |
| IE42961B1 (en) | 1980-11-19 |
| IE42961L (en) | 1976-08-27 |
| IT1055451B (it) | 1981-12-21 |
| GB1544703A (en) | 1979-04-25 |
| IL49066A0 (en) | 1976-04-30 |
| CA1072543A (en) | 1980-02-26 |
| AU499565B2 (en) | 1979-04-26 |
| BE838760A (fr) | 1976-08-20 |
| LU74427A1 (enrdf_load_stackoverflow) | 1976-08-13 |
| FR2302098B1 (enrdf_load_stackoverflow) | 1979-09-21 |
| FR2302098A1 (fr) | 1976-09-24 |
| AU1140676A (en) | 1977-09-01 |
| JPS51110595A (enrdf_load_stackoverflow) | 1976-09-30 |
| ZA76451B (en) | 1977-01-26 |
| IL49066A (en) | 1982-07-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2462736C2 (de) | 7-Aminothiazolylacetamido-3-cephem-4-carbonsäuren und Verfahren zur Herstellung derselben | |
| DE2512670C2 (de) | Verfahren zur Herstellung von 7-Methoxycephalosporinverbindungen | |
| DE2539664C2 (enrdf_load_stackoverflow) | ||
| DE2434340A1 (de) | 7-acylamido-3-cephem-4-carbonsaeurederivate, verfahren zu ihrer herstellung und ihre verwendung in pharmazeutischen zubereitungen | |
| DE2512284A1 (de) | Cephalosporansaeurederivate, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische mittel | |
| DE2312997A1 (de) | Verfahren zur herstellung von 7-(alphahydroxy-alpha-phenyl)-acetamido-3-(1-methyl1h-tetrazol-5-ylthiomethyl)-3-cephem-4carbonsaeure und derivaten davon | |
| CH622523A5 (enrdf_load_stackoverflow) | ||
| DE2611270C2 (de) | Cephalosporin-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2451931C2 (de) | 7β-Acylamido-7α-methoxycephalosporine, Verfahren zu ihrer Herstellung und sie enthaltendes antibiotisches Mittel | |
| DE2607681A1 (de) | Thenyl- und tetrazolylmethylcephalosporine | |
| DE2640488A1 (de) | 3-triazolylthiomethyl-7-alpha-ureidoacylamido-7alpha-methoxy- und -desmethoxycephalosporansaeure-derivate | |
| DE2521063A1 (de) | Phenylacetamidocephalosporin- derivate | |
| DE2203653A1 (de) | Cephalosporincarbamate und Verfahren zu deren Herstellung | |
| DE2710490A1 (de) | 7-acylamino-3-(5-sulfoalkyl-1,3,4- oxadiazol-2-ylthiomethyl)-3-cephem-4- carbonsaeuren, ihre salze, verfahren zu ihrer herstellung, zwischenprodukte und arzneimittel | |
| DE2532723A1 (de) | Verfahren zur herstellung von 7-aminocephalosporansaeure und ihrer derivate | |
| DE2215039A1 (de) | Neue Acyloxyalkylesterderivate von Penicillin und Cephalosporin | |
| DD201303A5 (de) | Verfahren zur herstellung von bistetrazolmethylthiolen | |
| CH666037A5 (de) | Verfahren zur herstellung von cephalosporin-syn-isomeren. | |
| CH631988A5 (de) | Verfahren zur herstellung von 3-(alkylsulfonamidoalkyltetrazolylthiomethyl)-cephalosporin-derivaten. | |
| DE2639380A1 (de) | 3- eckige klammer auf 1-(2-hydroxyalkyl)-tetrazol-5-ylthiomethyl eckige klammer zu -3-cephem-4-carbonsaeuren, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2552861A1 (de) | Verfahren zur herstellung von 7-methoxycephalosporinverbindungen | |
| CH630634A5 (de) | Verfahren zur herstellung von 7-beta-(2-oxyimino-2-arylacetamido)-cephalosporine. | |
| DD201142A5 (de) | Verfahren zur herstellung von bistetrazolyl-methylsubstituierten cephalosporiantibiotika | |
| DE2818025A1 (de) | Verfahren zur herstellung von cephemverbindungen | |
| DE2619243A1 (de) | Neue 3-acyloxymethyl-cephem-verbindung und verfahren zu ihrer herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8141 | Disposal/no request for examination |