DE2529005C3 - Niederdruck-Gasentladungslampe - Google Patents
Niederdruck-GasentladungslampeInfo
- Publication number
- DE2529005C3 DE2529005C3 DE2529005A DE2529005A DE2529005C3 DE 2529005 C3 DE2529005 C3 DE 2529005C3 DE 2529005 A DE2529005 A DE 2529005A DE 2529005 A DE2529005 A DE 2529005A DE 2529005 C3 DE2529005 C3 DE 2529005C3
- Authority
- DE
- Germany
- Prior art keywords
- low
- gas discharge
- pressure gas
- discharge lamp
- lamp according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000011491 glass wool Substances 0.000 claims description 20
- 230000005855 radiation Effects 0.000 claims description 11
- 210000002268 wool Anatomy 0.000 claims description 10
- 229910001678 gehlenite Inorganic materials 0.000 claims description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 4
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 229910052721 tungsten Inorganic materials 0.000 claims description 3
- 239000010937 tungsten Substances 0.000 claims description 3
- 238000010521 absorption reaction Methods 0.000 claims description 2
- 239000012777 electrically insulating material Substances 0.000 claims description 2
- 239000007787 solid Substances 0.000 claims description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 17
- 229910052708 sodium Inorganic materials 0.000 description 10
- 239000011734 sodium Substances 0.000 description 10
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 9
- 230000000087 stabilizing effect Effects 0.000 description 8
- 229910052753 mercury Inorganic materials 0.000 description 7
- 239000012494 Quartz wool Substances 0.000 description 5
- 238000005259 measurement Methods 0.000 description 5
- 238000012856 packing Methods 0.000 description 5
- 238000009826 distribution Methods 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 3
- 230000002349 favourable effect Effects 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 229910052754 neon Inorganic materials 0.000 description 3
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 229910052734 helium Inorganic materials 0.000 description 2
- 239000001307 helium Substances 0.000 description 2
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 2
- 229910052756 noble gas Inorganic materials 0.000 description 2
- 230000006641 stabilisation Effects 0.000 description 2
- 238000011105 stabilization Methods 0.000 description 2
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 241000270295 Serpentes Species 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- WIGAYVXYNSVZAV-UHFFFAOYSA-N ac1lavbc Chemical compound [W].[W] WIGAYVXYNSVZAV-UHFFFAOYSA-N 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000003306 harvesting Methods 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 150000002835 noble gases Chemical class 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000009827 uniform distribution Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/04—Electrodes; Screens; Shields
- H01J61/10—Shields, screens, or guides for influencing the discharge
Landscapes
- Discharge Lamps And Accessories Thereof (AREA)
- Vessels And Coating Films For Discharge Lamps (AREA)
- Discharge Lamp (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL7409366.A NL163669C (nl) | 1974-07-11 | 1974-07-11 | Lagedrukgasontladingslamp. |
| NL7506654A NL7506654A (en) | 1975-06-05 | 1975-06-05 | Low pressure gas discharge lamp - has gas discharge permeable solid element at specified point between electrodes |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2529005A1 DE2529005A1 (de) | 1976-01-29 |
| DE2529005B2 DE2529005B2 (de) | 1979-04-12 |
| DE2529005C3 true DE2529005C3 (de) | 1979-12-06 |
Family
ID=26645017
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2529005A Expired DE2529005C3 (de) | 1974-07-11 | 1975-06-28 | Niederdruck-Gasentladungslampe |
Country Status (16)
| Country | Link |
|---|---|
| JP (1) | JPS5837663B2 (enExample) |
| AR (1) | AR203929A1 (enExample) |
| AT (1) | AT352217B (enExample) |
| AU (1) | AU501410B2 (enExample) |
| BE (1) | BE831176A (enExample) |
| BR (1) | BR7504412A (enExample) |
| CA (1) | CA1038922A (enExample) |
| CH (1) | CH600732A5 (enExample) |
| DD (1) | DD120971A5 (enExample) |
| DE (1) | DE2529005C3 (enExample) |
| ES (1) | ES439264A1 (enExample) |
| FR (1) | FR2278158A1 (enExample) |
| GB (1) | GB1464063A (enExample) |
| HU (1) | HU171653B (enExample) |
| IT (1) | IT1039816B (enExample) |
| SE (1) | SE419489B (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7603285A (nl) * | 1976-03-30 | 1977-10-04 | Philips Nv | Werkwijze voor het vervaardigen van een lagedruk- gasontladingslamp. |
| NL179771C (nl) * | 1976-06-17 | 1986-11-03 | Philips Nv | Lagedrukgasontladingslamp. |
| JPS5937231B2 (ja) * | 1976-06-23 | 1984-09-08 | エプソン株式会社 | インクリボン反転装置 |
| JPS5818236Y2 (ja) * | 1976-06-28 | 1983-04-13 | 日本電気ホームエレクトロニクス株式会社 | 放電灯点灯装置 |
| JPS5310343A (en) * | 1976-07-16 | 1978-01-30 | Mitsubishi Electric Corp | Apparatus for electrolytic processing |
| NL7701910A (nl) * | 1977-02-23 | 1978-08-25 | Philips Nv | Lagedrukgasontladingslamp. |
| NL174104C (nl) * | 1977-08-23 | 1984-04-16 | Philips Nv | Lampeenheid. |
| JPS55144651A (en) * | 1979-04-28 | 1980-11-11 | Matsushita Electric Works Ltd | Fluorescent lamp |
| JPS5667657U (enExample) * | 1979-10-30 | 1981-06-05 | ||
| JPS5674510A (en) * | 1979-11-21 | 1981-06-20 | Toshiba Corp | Liquid fuel combustion device |
| NL7908924A (nl) * | 1979-12-12 | 1981-07-16 | Philips Nv | Lagedrukkwikdampontladingslamp. |
| GB2169440B (en) * | 1984-12-14 | 1989-08-16 | Matsushita Electric Works Ltd | High pressure discharge lamp |
| JPS62163251A (ja) * | 1986-01-14 | 1987-07-20 | Matsushita Electric Works Ltd | 放電ランプ |
| US9318311B2 (en) * | 2011-10-11 | 2016-04-19 | Kla-Tencor Corporation | Plasma cell for laser-sustained plasma light source |
-
1975
- 1975-06-28 DE DE2529005A patent/DE2529005C3/de not_active Expired
- 1975-07-08 GB GB2868275A patent/GB1464063A/en not_active Expired
- 1975-07-08 CH CH893175A patent/CH600732A5/xx not_active IP Right Cessation
- 1975-07-08 IT IT7525202A patent/IT1039816B/it active
- 1975-07-08 SE SE7507777A patent/SE419489B/xx unknown
- 1975-07-08 HU HU75PI00000479A patent/HU171653B/hu unknown
- 1975-07-08 AT AT525175A patent/AT352217B/de not_active IP Right Cessation
- 1975-07-08 DD DD187165A patent/DD120971A5/xx unknown
- 1975-07-09 CA CA231,152A patent/CA1038922A/en not_active Expired
- 1975-07-09 ES ES439264A patent/ES439264A1/es not_active Expired
- 1975-07-09 BE BE158134A patent/BE831176A/xx unknown
- 1975-07-09 AU AU82860/75A patent/AU501410B2/en not_active Expired
- 1975-07-10 JP JP50084046A patent/JPS5837663B2/ja not_active Expired
- 1975-07-10 FR FR7521724A patent/FR2278158A1/fr active Granted
- 1975-07-11 BR BR7504412*A patent/BR7504412A/pt unknown
- 1975-07-11 AR AR259545A patent/AR203929A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| AT352217B (de) | 1979-09-10 |
| SE419489B (sv) | 1981-08-03 |
| JPS5837663B2 (ja) | 1983-08-17 |
| GB1464063A (en) | 1977-02-09 |
| CA1038922A (en) | 1978-09-19 |
| DE2529005A1 (de) | 1976-01-29 |
| DD120971A5 (enExample) | 1976-07-05 |
| JPS5131082A (enExample) | 1976-03-16 |
| BR7504412A (pt) | 1976-07-06 |
| FR2278158A1 (fr) | 1976-02-06 |
| AU501410B2 (en) | 1979-06-21 |
| ATA525175A (de) | 1979-02-15 |
| AR203929A1 (es) | 1975-10-31 |
| HU171653B (hu) | 1978-02-28 |
| SE7507777L (sv) | 1976-01-12 |
| AU8286075A (en) | 1977-01-13 |
| BE831176A (fr) | 1976-01-09 |
| IT1039816B (it) | 1979-12-10 |
| CH600732A5 (enExample) | 1978-06-30 |
| ES439264A1 (es) | 1977-03-01 |
| FR2278158B1 (enExample) | 1979-06-22 |
| DE2529005B2 (de) | 1979-04-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2529005C3 (de) | Niederdruck-Gasentladungslampe | |
| DE19636965B4 (de) | Elektrische Strahlungsquelle und Bestrahlungssystem mit dieser Strahlungsquelle | |
| DE2624897A1 (de) | Aluminiumoxyd-ueberzuege fuer quecksilberdampf-lampen | |
| DE2718642C2 (de) | Elektrode für eine Hochdruck-Metallhalogenidlampe | |
| DE2031449C3 (de) | Hochdruck-Metalldampf lampe mit einer in ausgewählten Spektralbereichen konzentrierten Strahlung | |
| DE2225308C3 (de) | Hochdruckgasentladungslampe | |
| DE3038993A1 (de) | Metalldampfentladungslampe | |
| DE10245228B4 (de) | Quecksilberfreie Bogenentladungsröhre für Entladungsleuchteneinheit | |
| DE905414C (de) | Entladungslampe mit langgestreckter Glashuelle und je einer Elektrode an beiden Enden dieser Huelle | |
| DE1489527B2 (de) | Quecksilberdampfhochdrucklampe | |
| DE2106447C2 (de) | Quecksilberdampf-Hochdruckentladungslampe mit einem Zusatz von Metallhalogeniden | |
| DE2028781A1 (de) | Hochdruck-Quecksilberdampf Jodid-Entladungslampe | |
| DE1199882B (de) | Gasentladungslampe | |
| DE1286637B (de) | Elektrische Hochdruck-Metalldampf-Entladungslampe | |
| DE2456757A1 (de) | Metallhalogenid-hochdruckgasentladungslampe | |
| DE69214631T2 (de) | Negativglimmentladungslampe mit drahtanode | |
| DE2402760A1 (de) | Metallhalogenid-hochdruckentladungslampe | |
| DE1807439A1 (de) | Gluehlampe mit verbesserter Lichtausbeute | |
| DE620831C (de) | Elektrische, Dampf schwerfluechtiger Metalle enthaltende Entladungsroehre, insbesondere zur Lichtausstrahlung | |
| DE69507821T2 (de) | Niederdruckentladungslampe | |
| DE2722694A1 (de) | Quecksilberdampf-niederdruckentladungslampe | |
| DE1539498C3 (de) | Gasentladungslampe mit positiver Strom-Spannungs-Kennlinie | |
| DE2009684A1 (de) | Bogenentladungslampe | |
| DE2718527A1 (de) | Spektrallampe zur erzeugung des eisenlinienspektrums | |
| DE1788106U (de) | Elektrische niederdruck-entladungslampe. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |