DE2504535A1 - Heiss vulkanisierbare silikonkautschukmassen - Google Patents
Heiss vulkanisierbare silikonkautschukmassenInfo
- Publication number
- DE2504535A1 DE2504535A1 DE19752504535 DE2504535A DE2504535A1 DE 2504535 A1 DE2504535 A1 DE 2504535A1 DE 19752504535 DE19752504535 DE 19752504535 DE 2504535 A DE2504535 A DE 2504535A DE 2504535 A1 DE2504535 A1 DE 2504535A1
- Authority
- DE
- Germany
- Prior art keywords
- parts
- mixtures
- silicon dioxide
- magnesium oxide
- present
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 229920002379 silicone rubber Polymers 0.000 title claims description 53
- 239000004945 silicone rubber Substances 0.000 title claims description 22
- 150000001875 compounds Chemical class 0.000 title claims description 11
- 239000000203 mixture Substances 0.000 claims description 181
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 114
- -1 polysiloxane Polymers 0.000 claims description 77
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 claims description 58
- 229920000642 polymer Polymers 0.000 claims description 53
- 229920001296 polysiloxane Polymers 0.000 claims description 51
- 235000012245 magnesium oxide Nutrition 0.000 claims description 49
- 239000000377 silicon dioxide Substances 0.000 claims description 49
- 239000003921 oil Substances 0.000 claims description 46
- 239000000395 magnesium oxide Substances 0.000 claims description 45
- 239000004215 Carbon black (E152) Substances 0.000 claims description 38
- 229930195733 hydrocarbon Natural products 0.000 claims description 38
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 claims description 36
- 239000000945 filler Substances 0.000 claims description 32
- 235000012239 silicon dioxide Nutrition 0.000 claims description 28
- 150000002430 hydrocarbons Chemical class 0.000 claims description 27
- 238000000034 method Methods 0.000 claims description 25
- 239000003054 catalyst Substances 0.000 claims description 24
- 239000006057 Non-nutritive feed additive Substances 0.000 claims description 22
- 239000004615 ingredient Substances 0.000 claims description 19
- 239000002245 particle Substances 0.000 claims description 18
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 17
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 claims description 15
- 239000003795 chemical substances by application Substances 0.000 claims description 15
- 239000011256 inorganic filler Substances 0.000 claims description 14
- 229910003475 inorganic filler Inorganic materials 0.000 claims description 14
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 13
- 239000005909 Kieselgur Substances 0.000 claims description 11
- 125000003545 alkoxy group Chemical group 0.000 claims description 11
- 125000004122 cyclic group Chemical group 0.000 claims description 11
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 10
- 229920002554 vinyl polymer Polymers 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 230000015556 catabolic process Effects 0.000 claims description 9
- 238000006731 degradation reaction Methods 0.000 claims description 9
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 8
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims description 8
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 claims description 8
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 claims description 8
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 6
- 239000002657 fibrous material Substances 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 229910052710 silicon Inorganic materials 0.000 claims description 6
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 229920001343 polytetrafluoroethylene Polymers 0.000 claims description 5
- 239000004810 polytetrafluoroethylene Substances 0.000 claims description 5
- 229920000742 Cotton Polymers 0.000 claims description 4
- 229920004934 Dacron® Polymers 0.000 claims description 4
- 239000005083 Zinc sulfide Substances 0.000 claims description 4
- 239000012760 heat stabilizer Substances 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 4
- 150000001451 organic peroxides Chemical class 0.000 claims description 4
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 4
- 239000005020 polyethylene terephthalate Substances 0.000 claims description 4
- 239000010453 quartz Substances 0.000 claims description 4
- 239000011787 zinc oxide Substances 0.000 claims description 4
- 229910052984 zinc sulfide Inorganic materials 0.000 claims description 4
- DRDVZXDWVBGGMH-UHFFFAOYSA-N zinc;sulfide Chemical compound [S-2].[Zn+2] DRDVZXDWVBGGMH-UHFFFAOYSA-N 0.000 claims description 4
- 239000010425 asbestos Substances 0.000 claims description 3
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 3
- 229910052746 lanthanum Inorganic materials 0.000 claims description 3
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 claims description 3
- 229920000728 polyester Polymers 0.000 claims description 3
- 229920002959 polymer blend Polymers 0.000 claims description 3
- 229910052895 riebeckite Inorganic materials 0.000 claims description 3
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 claims description 3
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 claims description 3
- DMWVYCCGCQPJEA-UHFFFAOYSA-N 2,5-bis(tert-butylperoxy)-2,5-dimethylhexane Chemical group CC(C)(C)OOC(C)(C)CCC(C)(C)OOC(C)(C)C DMWVYCCGCQPJEA-UHFFFAOYSA-N 0.000 claims 2
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 claims 2
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical group C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 claims 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims 1
- 238000010894 electron beam technology Methods 0.000 claims 1
- 239000004848 polyfunctional curative Substances 0.000 claims 1
- 229920001971 elastomer Polymers 0.000 description 30
- 229920005645 diorganopolysiloxane polymer Polymers 0.000 description 25
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 20
- 239000000806 elastomer Substances 0.000 description 20
- 230000006835 compression Effects 0.000 description 16
- 238000007906 compression Methods 0.000 description 16
- 239000010721 machine oil Substances 0.000 description 16
- 238000012360 testing method Methods 0.000 description 15
- 239000000049 pigment Substances 0.000 description 13
- 230000003014 reinforcing effect Effects 0.000 description 12
- 125000001424 substituent group Chemical group 0.000 description 11
- 238000002156 mixing Methods 0.000 description 8
- 230000000704 physical effect Effects 0.000 description 8
- 239000007789 gas Substances 0.000 description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 7
- 239000012071 phase Substances 0.000 description 7
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000000654 additive Substances 0.000 description 6
- 239000004205 dimethyl polysiloxane Substances 0.000 description 6
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 6
- 230000007062 hydrolysis Effects 0.000 description 6
- 238000006460 hydrolysis reaction Methods 0.000 description 6
- 238000007654 immersion Methods 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000011261 inert gas Substances 0.000 description 5
- 150000002978 peroxides Chemical class 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 5
- 229920001187 thermosetting polymer Polymers 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 4
- 230000005484 gravity Effects 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- GJBRNHKUVLOCEB-UHFFFAOYSA-N tert-butyl benzenecarboperoxoate Chemical compound CC(C)(C)OOC(=O)C1=CC=CC=C1 GJBRNHKUVLOCEB-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 150000005840 aryl radicals Chemical class 0.000 description 3
- 230000005540 biological transmission Effects 0.000 description 3
- 239000000470 constituent Substances 0.000 description 3
- 125000005375 organosiloxane group Chemical group 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 238000010926 purge Methods 0.000 description 3
- 239000012763 reinforcing filler Substances 0.000 description 3
- 150000004756 silanes Chemical class 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- WRXCBRHBHGNNQA-UHFFFAOYSA-N (2,4-dichlorobenzoyl) 2,4-dichlorobenzenecarboperoxoate Chemical compound ClC1=CC(Cl)=CC=C1C(=O)OOC(=O)C1=CC=C(Cl)C=C1Cl WRXCBRHBHGNNQA-UHFFFAOYSA-N 0.000 description 2
- INZDTEICWPZYJM-UHFFFAOYSA-N 1-(chloromethyl)-4-[4-(chloromethyl)phenyl]benzene Chemical compound C1=CC(CCl)=CC=C1C1=CC=C(CCl)C=C1 INZDTEICWPZYJM-UHFFFAOYSA-N 0.000 description 2
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical class C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 235000019400 benzoyl peroxide Nutrition 0.000 description 2
- 238000005336 cracking Methods 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- FWDBOZPQNFPOLF-UHFFFAOYSA-N ethenyl(triethoxy)silane Chemical compound CCO[Si](OCC)(OCC)C=C FWDBOZPQNFPOLF-UHFFFAOYSA-N 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 229910052738 indium Inorganic materials 0.000 description 2
- 238000011835 investigation Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 150000001282 organosilanes Chemical class 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- WWNRKHUOXUIPKO-UHFFFAOYSA-N (1,4-dichlorocyclohexa-2,4-diene-1-carbonyl) 1,4-dichlorocyclohexa-2,4-diene-1-carboperoxoate Chemical compound C1=CC(Cl)=CCC1(Cl)C(=O)OOC(=O)C1(Cl)C=CC(Cl)=CC1 WWNRKHUOXUIPKO-UHFFFAOYSA-N 0.000 description 1
- OXYKVVLTXXXVRT-UHFFFAOYSA-N (4-chlorobenzoyl) 4-chlorobenzenecarboperoxoate Chemical compound C1=CC(Cl)=CC=C1C(=O)OOC(=O)C1=CC=C(Cl)C=C1 OXYKVVLTXXXVRT-UHFFFAOYSA-N 0.000 description 1
- PNJLSKTVCRNRBO-UHFFFAOYSA-N 1-tert-butylperoxy-2,5-dimethylhexane Chemical compound CC(C)CCC(C)COOC(C)(C)C PNJLSKTVCRNRBO-UHFFFAOYSA-N 0.000 description 1
- WFUGQJXVXHBTEM-UHFFFAOYSA-N 2-hydroperoxy-2-(2-hydroperoxybutan-2-ylperoxy)butane Chemical compound CCC(C)(OO)OOC(C)(CC)OO WFUGQJXVXHBTEM-UHFFFAOYSA-N 0.000 description 1
- NFPBWZOKGZKYRE-UHFFFAOYSA-N 2-propan-2-ylperoxypropane Chemical group CC(C)OOC(C)C NFPBWZOKGZKYRE-UHFFFAOYSA-N 0.000 description 1
- RNMGIGDVVSNURZ-UHFFFAOYSA-N 3-ethyl-3-(3-ethyl-4-methyloctan-3-yl)peroxy-4-methyloctane Chemical group CCCCC(C)C(CC)(CC)OOC(CC)(CC)C(C)CCCC RNMGIGDVVSNURZ-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- 150000000703 Cerium Chemical class 0.000 description 1
- 229910052684 Cerium Inorganic materials 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 239000004594 Masterbatch (MB) Substances 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- LZIADWJBEUXKRJ-UHFFFAOYSA-N [butylperoxy(diphenyl)methyl]benzene Chemical group C=1C=CC=CC=1C(C=1C=CC=CC=1)(OOCCCC)C1=CC=CC=C1 LZIADWJBEUXKRJ-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- FYBYQXQHBHTWLP-UHFFFAOYSA-N bis(silyloxysilyloxy)silane Chemical class [SiH3]O[SiH2]O[SiH2]O[SiH2]O[SiH3] FYBYQXQHBHTWLP-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 description 1
- 230000001055 chewing effect Effects 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229910000428 cobalt oxide Inorganic materials 0.000 description 1
- IVMYJDGYRUAWML-UHFFFAOYSA-N cobalt(ii) oxide Chemical compound [Co]=O IVMYJDGYRUAWML-UHFFFAOYSA-N 0.000 description 1
- 230000001427 coherent effect Effects 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 150000007973 cyanuric acids Chemical class 0.000 description 1
- 150000001923 cyclic compounds Chemical class 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- LSXWFXONGKSEMY-UHFFFAOYSA-N di-tert-butyl peroxide Chemical compound CC(C)(C)OOC(C)(C)C LSXWFXONGKSEMY-UHFFFAOYSA-N 0.000 description 1
- 239000012969 di-tertiary-butyl peroxide Substances 0.000 description 1
- MROCJMGDEKINLD-UHFFFAOYSA-N dichlorosilane Chemical class Cl[SiH2]Cl MROCJMGDEKINLD-UHFFFAOYSA-N 0.000 description 1
- OLLFKUHHDPMQFR-UHFFFAOYSA-N dihydroxy(diphenyl)silane Chemical compound C=1C=CC=CC=1[Si](O)(O)C1=CC=CC=C1 OLLFKUHHDPMQFR-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- SRXOCFMDUSFFAK-UHFFFAOYSA-N dimethyl peroxide Chemical class COOC SRXOCFMDUSFFAK-UHFFFAOYSA-N 0.000 description 1
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000011067 equilibration Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 229910021485 fumed silica Inorganic materials 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- 239000003550 marker Substances 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- HMMGMWAXVFQUOA-UHFFFAOYSA-N octamethylcyclotetrasiloxane Chemical compound C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 HMMGMWAXVFQUOA-UHFFFAOYSA-N 0.000 description 1
- NDLPOXTZKUMGOV-UHFFFAOYSA-N oxo(oxoferriooxy)iron hydrate Chemical compound O.O=[Fe]O[Fe]=O NDLPOXTZKUMGOV-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 101150101567 pat-2 gene Proteins 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229910052761 rare earth metal Inorganic materials 0.000 description 1
- 150000002910 rare earth metals Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 239000003566 sealing material Substances 0.000 description 1
- 125000004469 siloxy group Chemical group [SiH3]O* 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 125000000725 trifluoropropyl group Chemical group [H]C([H])(*)C([H])([H])C(F)(F)F 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 239000010913 used oil Substances 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 238000004073 vulcanization Methods 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/18—Oxygen-containing compounds, e.g. metal carbonyls
- C08K3/20—Oxides; Hydroxides
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/01—Use of inorganic substances as compounding ingredients characterized by their specific function
- C08K3/013—Fillers, pigments or reinforcing additives
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US440377A US3865778A (en) | 1974-02-07 | 1974-02-07 | Heat vulcanizable silicone rubber compositions resistant to oil degradation |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2504535A1 true DE2504535A1 (de) | 1975-08-14 |
Family
ID=23748517
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752504535 Withdrawn DE2504535A1 (de) | 1974-02-07 | 1975-02-04 | Heiss vulkanisierbare silikonkautschukmassen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3865778A (enExample) |
| JP (1) | JPS5930746B2 (enExample) |
| DE (1) | DE2504535A1 (enExample) |
| FR (1) | FR2260606B1 (enExample) |
| GB (1) | GB1493269A (enExample) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5388055A (en) * | 1977-01-13 | 1978-08-03 | Toray Silicone Co Ltd | Silicone rubber composition for shaft sealing |
| JPS54143463A (en) * | 1978-04-28 | 1979-11-08 | Shin Etsu Chem Co Ltd | Silicone rubber composition |
| JPS5566968A (en) * | 1978-11-13 | 1980-05-20 | Matsushita Electric Ind Co Ltd | Coating compound |
| JPS5643351A (en) * | 1979-09-14 | 1981-04-22 | Toray Silicone Co Ltd | Silicone rubber composition for sealing shaft |
| US4430461A (en) | 1980-06-06 | 1984-02-07 | General Electric Company | Method of removing volatiles in the preparation of silicone compositions |
| JPS5776055A (en) * | 1980-10-29 | 1982-05-12 | Toshiba Silicone Co Ltd | Sealing method |
| FR2497517B1 (fr) * | 1981-01-07 | 1985-08-09 | Rhone Poulenc Spec Chim | Compositions organopolysiloxaniques pateuses durcissant a chaud en elastomeres |
| US4559782A (en) * | 1983-03-25 | 1985-12-24 | Cummins Engine Company, Inc. | Turbocharger drain line with reinforced flexible conduit |
| US4504621A (en) * | 1983-12-28 | 1985-03-12 | Dow Corning Corporation | Clay filled silicone elastomeric emulsions |
| FR2581391B1 (fr) * | 1985-05-06 | 1987-06-05 | Rhone Poulenc Rech | Composition organo-polysilazane comportant des generateurs de radicaux libres et reticulable par apport d'energie |
| FR2592656B1 (fr) * | 1986-01-09 | 1988-05-20 | Rhone Poulenc Spec Chim | Composition organopolysiloxane elastomerique vulcanisable a chaud, a resistance a la reversion et a la tenue aux huiles ameliorees. |
| US4604424A (en) * | 1986-01-29 | 1986-08-05 | Dow Corning Corporation | Thermally conductive polyorganosiloxane elastomer composition |
| US5082886A (en) * | 1989-08-28 | 1992-01-21 | General Electric Company | Low compression set, oil and fuel resistant, liquid injection moldable, silicone rubber |
| JPH062838B2 (ja) * | 1989-09-19 | 1994-01-12 | 信越化学工業株式会社 | 発泡性シリコーンゴム組成物の発泡、硬化方法および発泡シリコーンゴム硬化物 |
| FR2664897B1 (fr) * | 1990-07-19 | 1994-07-29 | Rhone Poulenc Chimie | Compositions organopolysiloxanes vulcanisables a chaud, utilisables notamment pour le revetement de cables electriques. |
| JPH05132664A (ja) * | 1991-11-12 | 1993-05-28 | Shin Etsu Chem Co Ltd | シリコーンゴム・ガスケツト |
| GB2284609B (en) * | 1993-12-10 | 1998-04-15 | Gen Electric | High application rate extrudable polymers |
| DE19621304A1 (de) | 1996-05-28 | 1997-12-04 | Bayer Ag | Siliconelastomere mit insektizider Wirkung |
| DE19634971A1 (de) * | 1996-08-29 | 1998-03-05 | Wacker Chemie Gmbh | Flüssigsiliconkautschuk mit verbessertem Druckverformungsrest |
| DE19808117A1 (de) * | 1998-02-26 | 1999-09-09 | Wacker Chemie Gmbh | RTV-2 Siliconschäume mit niedrigem Druckverformungsrest |
| JP2001164111A (ja) * | 1999-12-10 | 2001-06-19 | Dow Corning Toray Silicone Co Ltd | シリコーンゴム組成物、およびキーパッド用シリコーンゴム組成物 |
| JP4047511B2 (ja) * | 2000-03-07 | 2008-02-13 | 三菱自動車工業株式会社 | ロッカカバーのシール方法 |
| FR2816312B1 (fr) * | 2000-11-09 | 2003-01-24 | Rhodia Chimie Sa | Composition silicone liquide reticulable comprenant une charge peu "viscosante" a base de zirconium, application de cette composition comme revetement textile ignifuge |
| ITMO20030117A1 (it) * | 2003-04-23 | 2004-10-24 | Ceramiche Gambarelli S R L | Procedimento per la realizzazione di manufatti ceramici particolarmente piastrelle e pezzi speciali in gres porcellanato dotati di proprieta'antinquinamento e antibatterico e manufatti cosi' ottenuti. |
| US7247667B2 (en) * | 2004-03-23 | 2007-07-24 | E. I. Du Pont De Nemours And Company | Particle containing solid surface material |
| US20090036588A1 (en) * | 2006-01-20 | 2009-02-05 | Easter Mark R | Silicone wire and cable insulations and jackets with improved abrasion resistance |
| US20080081879A1 (en) * | 2006-09-29 | 2008-04-03 | Kim Balfour | Crosslinked block copolymer composition and method |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3179546A (en) * | 1958-12-03 | 1965-04-20 | Dow Corning | Method of bonding silicone rubber to other materials |
| US3184427A (en) * | 1962-08-22 | 1965-05-18 | Dow Corning | Method for curing room-temperaturevulcanizing organopolysiloxane rubber |
| BE793729A (fr) * | 1972-01-07 | 1973-07-05 | Rhone Poulenc Sa | Compositions organopolysiloxaniques |
| BE795673A (fr) * | 1972-02-21 | 1973-08-20 | Rhone Poulenc Sa | Compositions organopolysiloxaniques transformables en elastomeres a tenue amelioree a la combustion |
-
1974
- 1974-02-07 US US440377A patent/US3865778A/en not_active Expired - Lifetime
- 1974-12-23 GB GB55517/74A patent/GB1493269A/en not_active Expired
-
1975
- 1975-02-04 DE DE19752504535 patent/DE2504535A1/de not_active Withdrawn
- 1975-02-07 FR FR7503830A patent/FR2260606B1/fr not_active Expired
- 1975-02-07 JP JP50015518A patent/JPS5930746B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2260606A1 (enExample) | 1975-09-05 |
| JPS50109953A (enExample) | 1975-08-29 |
| US3865778A (en) | 1975-02-11 |
| GB1493269A (en) | 1977-11-30 |
| FR2260606B1 (enExample) | 1981-07-24 |
| JPS5930746B2 (ja) | 1984-07-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2504535A1 (de) | Heiss vulkanisierbare silikonkautschukmassen | |
| DE2358784A1 (de) | Kalt haertende silikon-kautschukzusammensetzungen | |
| DE2535334A1 (de) | Verfahren zur homogenen verteilung hochdisperser aktiver fuellstoffe in polyorganosiloxanen | |
| DE2300504B2 (de) | Hitzehaertbare organopolysiloxanformmassen | |
| DD203064A5 (de) | Verfahren zur herstellung von silikonkautschuk | |
| EP0455078B1 (de) | Siliconelastomere mit vermindertem Druckverformungsrest sowie Verfahren zu deren Herstellung | |
| DE2000461A1 (de) | Verstaerkerfuellstoffe auf der Basis von Siliciumdioxyd | |
| DE10259613A1 (de) | Organopolysiloxanzusammensetzungen und deren Einsatz in bei Raumtemperatur vernetzbaren niedermoduligen Massen | |
| DE2644551A1 (de) | Loesungsmittelbestaendige kalthaertende silikonkautschuk-massen | |
| DE69702370T2 (de) | Härtbare Fluorosiloxanzusammensetzung und Verfahren zur Steuerung der Initiierung und der Dauer der Härtung | |
| DE2350369A1 (de) | Verfahren zur herstellung von diorganopolysiloxanen | |
| CH623843A5 (enExample) | ||
| EP0828794B1 (de) | Wässrige dispersionen von organopolysiloxanen | |
| DE10211314A1 (de) | Vernetzbare Massen auf der Basis von Organosiliciumverbindungen | |
| DE3213616A1 (de) | Hitzehaertbare silikonkautschukmasse | |
| DE2308595A1 (de) | In elastomere verbesserter bestaendigkeit gegen verbrennen ueberfuehrbare organopolysiloxanzusammensetzungen | |
| DE2308608C2 (de) | Hitzefärbbare Organopolysiloxanformmassen mit verbesserter Feuerbeständigkeit | |
| DE2900707A1 (de) | Hitzehaertbare silikonkautschukmassen | |
| DE2234790A1 (de) | Nichttoxische selbstloeschende einkomponenten-siliconelastomere | |
| DE2638452B2 (de) | Verfahren zur Herstellung von Formkorpern aus Organopolysiloxanolen | |
| DE3336135A1 (de) | Rtv-siliconpasten | |
| DE2653580A1 (de) | Lagerfaehige, vulkanisierbare organopolysiloxanmassen | |
| EP1215247A1 (de) | Härtbare Organopolysiloxanmassen | |
| DE2218101A1 (de) | Asbesthaltige, hitzehärtbare PoIysiloxan-Zusammensetzungen | |
| DE2229560A1 (de) | Entflammungshemmende Zusammensetzung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8130 | Withdrawal |