DE2502894B2 - - Google Patents
Info
- Publication number
- DE2502894B2 DE2502894B2 DE2502894A DE2502894A DE2502894B2 DE 2502894 B2 DE2502894 B2 DE 2502894B2 DE 2502894 A DE2502894 A DE 2502894A DE 2502894 A DE2502894 A DE 2502894A DE 2502894 B2 DE2502894 B2 DE 2502894B2
- Authority
- DE
- Germany
- Prior art keywords
- catalyst
- ruthenium
- hydrogenation
- manganese
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000003054 catalyst Substances 0.000 claims description 105
- 229910052707 ruthenium Inorganic materials 0.000 claims description 35
- 238000005984 hydrogenation reaction Methods 0.000 claims description 34
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 33
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 33
- 239000011651 chromium Substances 0.000 claims description 27
- 238000000034 method Methods 0.000 claims description 24
- 239000011572 manganese Substances 0.000 claims description 21
- 229910052804 chromium Inorganic materials 0.000 claims description 17
- 229910052748 manganese Inorganic materials 0.000 claims description 15
- 239000000203 mixture Substances 0.000 claims description 9
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 8
- 238000001035 drying Methods 0.000 claims description 8
- 150000004982 aromatic amines Chemical class 0.000 claims description 7
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 claims description 6
- 150000002696 manganese Chemical class 0.000 claims description 5
- 238000001556 precipitation Methods 0.000 claims description 5
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 claims description 4
- 239000001099 ammonium carbonate Substances 0.000 claims description 4
- 239000007900 aqueous suspension Substances 0.000 claims description 3
- 230000018044 dehydration Effects 0.000 claims description 3
- 238000006297 dehydration reaction Methods 0.000 claims description 3
- 150000004679 hydroxides Chemical class 0.000 claims description 3
- 239000011656 manganese carbonate Substances 0.000 claims description 3
- 229940093474 manganese carbonate Drugs 0.000 claims description 3
- 235000006748 manganese carbonate Nutrition 0.000 claims description 3
- 229910000016 manganese(II) carbonate Inorganic materials 0.000 claims description 3
- XMWCXZJXESXBBY-UHFFFAOYSA-L manganese(ii) carbonate Chemical compound [Mn+2].[O-]C([O-])=O XMWCXZJXESXBBY-UHFFFAOYSA-L 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 238000005406 washing Methods 0.000 claims description 3
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 2
- LYEMDGROXHJJOF-UHFFFAOYSA-I chromium(3+) manganese(2+) pentahydroxide Chemical compound [OH-].[Cr+3].[Mn+2].[OH-].[OH-].[OH-].[OH-] LYEMDGROXHJJOF-UHFFFAOYSA-I 0.000 claims description 2
- 229910000013 Ammonium bicarbonate Inorganic materials 0.000 claims 1
- 235000012538 ammonium bicarbonate Nutrition 0.000 claims 1
- 239000000969 carrier Substances 0.000 claims 1
- 150000004677 hydrates Chemical class 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 27
- 239000001257 hydrogen Substances 0.000 description 27
- 229910052739 hydrogen Inorganic materials 0.000 description 27
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 24
- -1 basic metal carbonates Chemical class 0.000 description 24
- 239000000243 solution Substances 0.000 description 24
- 238000004458 analytical method Methods 0.000 description 16
- 229910052757 nitrogen Inorganic materials 0.000 description 14
- 239000000843 powder Substances 0.000 description 14
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 13
- 238000003756 stirring Methods 0.000 description 12
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 8
- 238000009835 boiling Methods 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 7
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical compound C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- 229910052782 aluminium Inorganic materials 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 238000007710 freezing Methods 0.000 description 5
- 230000008014 freezing Effects 0.000 description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 4
- AMWRITDGCCNYAT-UHFFFAOYSA-L hydroxy(oxo)manganese;manganese Chemical compound [Mn].O[Mn]=O.O[Mn]=O AMWRITDGCCNYAT-UHFFFAOYSA-L 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- BIXNGBXQRRXPLM-UHFFFAOYSA-K ruthenium(3+);trichloride;hydrate Chemical compound O.Cl[Ru](Cl)Cl BIXNGBXQRRXPLM-UHFFFAOYSA-K 0.000 description 4
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 3
- 229910002651 NO3 Inorganic materials 0.000 description 3
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- 235000012501 ammonium carbonate Nutrition 0.000 description 3
- 150000001448 anilines Chemical class 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 3
- 150000004985 diamines Chemical class 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000012266 salt solution Substances 0.000 description 3
- 238000007086 side reaction Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- VOZKAJLKRJDJLL-UHFFFAOYSA-N 2,4-diaminotoluene Chemical compound CC1=CC=C(N)C=C1N VOZKAJLKRJDJLL-UHFFFAOYSA-N 0.000 description 2
- FEUISMYEFPANSS-UHFFFAOYSA-N 2-methylcyclohexan-1-amine Chemical compound CC1CCCCC1N FEUISMYEFPANSS-UHFFFAOYSA-N 0.000 description 2
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 2
- KXEPRLUGFAULQX-UHFFFAOYSA-N 4-[2,5-di(propan-2-yl)phenyl]aniline Chemical compound CC(C)C1=CC=C(C(C)C)C(C=2C=CC(N)=CC=2)=C1 KXEPRLUGFAULQX-UHFFFAOYSA-N 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical compound CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- JOSWYUNQBRPBDN-UHFFFAOYSA-P ammonium dichromate Chemical compound [NH4+].[NH4+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O JOSWYUNQBRPBDN-UHFFFAOYSA-P 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 239000012876 carrier material Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229910000423 chromium oxide Inorganic materials 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 2
- 238000006356 dehydrogenation reaction Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 2
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 229920002635 polyurethane Polymers 0.000 description 2
- 239000004814 polyurethane Substances 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000002791 soaking Methods 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- CDULGHZNHURECF-UHFFFAOYSA-N 2,3-dimethylaniline 2,4-dimethylaniline 2,5-dimethylaniline 2,6-dimethylaniline 3,4-dimethylaniline 3,5-dimethylaniline Chemical class CC1=CC=C(N)C(C)=C1.CC1=CC=C(C)C(N)=C1.CC1=CC(C)=CC(N)=C1.CC1=CC=C(N)C=C1C.CC1=CC=CC(N)=C1C.CC1=CC=CC(C)=C1N CDULGHZNHURECF-UHFFFAOYSA-N 0.000 description 1
- DNKCZIYEBRERBA-UHFFFAOYSA-N 3-hexylaniline Chemical class CCCCCCC1=CC=CC(N)=C1 DNKCZIYEBRERBA-UHFFFAOYSA-N 0.000 description 1
- BHMDNHIWCXQHCM-UHFFFAOYSA-N 4-(cyclohexylmethyl)cyclohexan-1-amine Chemical compound C1CC(N)CCC1CC1CCCCC1 BHMDNHIWCXQHCM-UHFFFAOYSA-N 0.000 description 1
- DZIHTWJGPDVSGE-UHFFFAOYSA-N 4-[(4-aminocyclohexyl)methyl]cyclohexan-1-amine Chemical compound C1CC(N)CCC1CC1CCC(N)CC1 DZIHTWJGPDVSGE-UHFFFAOYSA-N 0.000 description 1
- ZSQIQUAKDNTQOI-UHFFFAOYSA-N 4-[1-(4-aminophenyl)cyclohexyl]aniline Chemical compound C1=CC(N)=CC=C1C1(C=2C=CC(N)=CC=2)CCCCC1 ZSQIQUAKDNTQOI-UHFFFAOYSA-N 0.000 description 1
- ZWPIVPCBQJHQKP-UHFFFAOYSA-N 4-[2,5-di(propan-2-yl)phenyl]cyclohexan-1-amine Chemical compound CC(C)C1=CC=C(C(C)C)C(C2CCC(N)CC2)=C1 ZWPIVPCBQJHQKP-UHFFFAOYSA-N 0.000 description 1
- ZYEDGEXYGKWJPB-UHFFFAOYSA-N 4-[2-(4-aminophenyl)propan-2-yl]aniline Chemical compound C=1C=C(N)C=CC=1C(C)(C)C1=CC=C(N)C=C1 ZYEDGEXYGKWJPB-UHFFFAOYSA-N 0.000 description 1
- QTKDDPSHNLZGRO-UHFFFAOYSA-N 4-methylcyclohexane-1,3-diamine Chemical compound CC1CCC(N)CC1N QTKDDPSHNLZGRO-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 101100513612 Microdochium nivale MnCO gene Proteins 0.000 description 1
- 239000004642 Polyimide Substances 0.000 description 1
- 229920002396 Polyurea Polymers 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 238000005899 aromatization reaction Methods 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 229910052728 basic metal Inorganic materials 0.000 description 1
- HFACYLZERDEVSX-UHFFFAOYSA-N benzidine Chemical group C1=CC(N)=CC=C1C1=CC=C(N)C=C1 HFACYLZERDEVSX-UHFFFAOYSA-N 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- JOPOVCBBYLSVDA-UHFFFAOYSA-N chromium(6+) Chemical class [Cr+6] JOPOVCBBYLSVDA-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 230000036461 convulsion Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 150000001923 cyclic compounds Chemical class 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- SOCTUWSJJQCPFX-UHFFFAOYSA-N dichromate(2-) Chemical compound [O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O SOCTUWSJJQCPFX-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- FGEKTVAHFDQHBU-UHFFFAOYSA-N dioxoruthenium;hydrate Chemical compound O.O=[Ru]=O FGEKTVAHFDQHBU-UHFFFAOYSA-N 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- CZZYITDELCSZES-UHFFFAOYSA-N diphenylmethane Chemical compound C=1C=CC=CC=1CC1=CC=CC=C1 CZZYITDELCSZES-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 description 1
- FRCFWPVMFJMNDP-UHFFFAOYSA-N n-propan-2-ylaniline Chemical compound CC(C)NC1=CC=CC=C1 FRCFWPVMFJMNDP-UHFFFAOYSA-N 0.000 description 1
- CDZOGLJOFWFVOZ-UHFFFAOYSA-N n-propylaniline Chemical compound CCCNC1=CC=CC=C1 CDZOGLJOFWFVOZ-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 229920001721 polyimide Polymers 0.000 description 1
- 150000003112 potassium compounds Chemical class 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000003303 ruthenium Chemical class 0.000 description 1
- 150000003304 ruthenium compounds Chemical class 0.000 description 1
- YBCAZPLXEGKKFM-UHFFFAOYSA-K ruthenium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Ru+3] YBCAZPLXEGKKFM-UHFFFAOYSA-K 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 238000004383 yellowing Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J23/00—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00
- B01J23/38—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00 of noble metals
- B01J23/54—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00 of noble metals combined with metals, oxides or hydroxides provided for in groups B01J23/02 - B01J23/36
- B01J23/56—Platinum group metals
- B01J23/64—Platinum group metals with arsenic, antimony, bismuth, vanadium, niobium, tantalum, polonium, chromium, molybdenum, tungsten, manganese, technetium or rhenium
- B01J23/656—Manganese, technetium or rhenium
- B01J23/6562—Manganese
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2502894A DE2502894C3 (de) | 1975-01-24 | 1975-01-24 | Ruthenium-Trägerkatalysator |
| US05/646,827 US4049584A (en) | 1975-01-24 | 1976-01-06 | Supported ruthenium catalyst and process for preparing it |
| CH65976A CH619379A5 (enExample) | 1975-01-24 | 1976-01-20 | |
| NL7600609A NL7600609A (nl) | 1975-01-24 | 1976-01-21 | Ruthenium-dragerkatalysator. |
| JP51005505A JPS596699B2 (ja) | 1975-01-24 | 1976-01-22 | 担持ルテニウム触媒 |
| IT47749/76A IT1053416B (it) | 1975-01-24 | 1976-01-22 | Catalizzatore supportato al rutenio e procedimento per la sua produzione ed applicazione |
| GB2662/76A GB1536025A (en) | 1975-01-24 | 1976-01-23 | Supported ruthenium catalyst |
| BE163753A BE837853A (fr) | 1975-01-24 | 1976-01-23 | Catalyseur au ruthenium supporte |
| FR7601864A FR2298366A1 (fr) | 1975-01-24 | 1976-01-23 | Catalyseur au ruthenium |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2502894A DE2502894C3 (de) | 1975-01-24 | 1975-01-24 | Ruthenium-Trägerkatalysator |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2502894A1 DE2502894A1 (de) | 1976-07-29 |
| DE2502894B2 true DE2502894B2 (enExample) | 1981-01-15 |
| DE2502894C3 DE2502894C3 (de) | 1981-12-03 |
Family
ID=5937234
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2502894A Expired DE2502894C3 (de) | 1975-01-24 | 1975-01-24 | Ruthenium-Trägerkatalysator |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4049584A (enExample) |
| JP (1) | JPS596699B2 (enExample) |
| BE (1) | BE837853A (enExample) |
| CH (1) | CH619379A5 (enExample) |
| DE (1) | DE2502894C3 (enExample) |
| FR (1) | FR2298366A1 (enExample) |
| GB (1) | GB1536025A (enExample) |
| IT (1) | IT1053416B (enExample) |
| NL (1) | NL7600609A (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS52133905A (en) * | 1976-04-30 | 1977-11-09 | Sumitomo Chem Co Ltd | Preparation of enamides |
| DE2745172A1 (de) * | 1977-10-07 | 1979-04-12 | Bayer Ag | Ruthenium-traegerkatalysator |
| US4214970A (en) * | 1979-01-15 | 1980-07-29 | Diamond Shamrock Technologies, S.A. | Novel electrocatalytic electrodes |
| US4222961A (en) * | 1979-02-01 | 1980-09-16 | Suntech, Inc. | Process for hydrogenating aromatic dinitriles |
| DE3801756A1 (de) * | 1988-01-22 | 1989-08-03 | Bayer Ag | Ruthenium-katalysator, verfahren zu seiner herstellung und verfahren zur herstellung eines gemisches aus cyclohexylamin und dicyclohexylamin unter einsatz des ruthenium-katalysators |
| DE3801755A1 (de) * | 1988-01-22 | 1989-07-27 | Bayer Ag | Ruthenium-traegerkatalysator, seine herstellung und sein einsatz bei der herstellung von gegebenenfalls substituiertem cyclohexylamin und gegebenenfalls substituiertem dicyclohexylamin |
| DE19641688A1 (de) * | 1996-10-10 | 1998-04-16 | Bayer Ag | Katalysatoren und Verfahren zur Herstellung von cycloaliphatischen Aminen |
| DE19824906A1 (de) * | 1998-06-04 | 1999-12-09 | Bayer Ag | Verfahren zur Herstellung von variablen Gemischen aus Cyclohexylamin und Dicyclohexylamin |
| DE19827282A1 (de) * | 1998-06-19 | 1999-12-23 | Bayer Ag | Verfahren zur Herstellung von cycloaliphatischen Aminen |
| US6750172B2 (en) | 2001-03-14 | 2004-06-15 | Micron Technology, Inc. | Nanometer engineering of metal-support catalysts |
| EP1493486B1 (en) * | 2002-04-08 | 2008-02-20 | Sued-Chemie Catalysts Japan, Inc. | Treating agent for exhaust gas containing metal hydride compound and method for treating exhaust gas containing metal hydride compound |
| DE102004061608A1 (de) * | 2004-12-17 | 2006-07-06 | Basf Ag | Verfahren zur Herstellung von 1,2-Diamino-3-methylcyclohexan und/oder 1,2-Diamino-4-methylcyclohexan |
| JP2006257046A (ja) * | 2005-03-18 | 2006-09-28 | Arakawa Chem Ind Co Ltd | 新規な脂環式ジアミン化合物および脂環式ジアミン化合物の製造方法 |
| WO2011074444A1 (ja) * | 2009-12-18 | 2011-06-23 | コスモ石油株式会社 | 炭化水素類の製造用触媒組成物及び炭化水素類の製造方法 |
| CN117339590A (zh) * | 2022-06-28 | 2024-01-05 | 中国石油化工股份有限公司 | 加氢催化剂及其制备方法和应用和环己烷二甲酸酯合成的方法 |
| EP4658405A1 (en) | 2023-01-30 | 2025-12-10 | Gaznat SA | Supported ru catalysts highly efficient for carbon dioxide methanation, methods of preparation and uses thereof |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3636108A (en) * | 1965-12-23 | 1972-01-18 | Du Pont | Catalytic hydrogenation of aromatic nitrogen containing compounds over alkali moderated ruthenium |
| GB1415155A (en) * | 1971-10-28 | 1975-11-26 | Johnson Matthey Co Ltd | Catalysis |
| CA979180A (en) * | 1972-04-12 | 1975-12-09 | Janice L. Stiles | Process for depositing noble metal catalysts |
-
1975
- 1975-01-24 DE DE2502894A patent/DE2502894C3/de not_active Expired
-
1976
- 1976-01-06 US US05/646,827 patent/US4049584A/en not_active Expired - Lifetime
- 1976-01-20 CH CH65976A patent/CH619379A5/de not_active IP Right Cessation
- 1976-01-21 NL NL7600609A patent/NL7600609A/xx not_active Application Discontinuation
- 1976-01-22 IT IT47749/76A patent/IT1053416B/it active
- 1976-01-22 JP JP51005505A patent/JPS596699B2/ja not_active Expired
- 1976-01-23 BE BE163753A patent/BE837853A/xx not_active IP Right Cessation
- 1976-01-23 FR FR7601864A patent/FR2298366A1/fr active Granted
- 1976-01-23 GB GB2662/76A patent/GB1536025A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2298366A1 (fr) | 1976-08-20 |
| CH619379A5 (enExample) | 1980-09-30 |
| IT1053416B (it) | 1981-08-31 |
| GB1536025A (en) | 1978-12-13 |
| US4049584A (en) | 1977-09-20 |
| JPS596699B2 (ja) | 1984-02-14 |
| FR2298366B1 (enExample) | 1979-06-01 |
| NL7600609A (nl) | 1976-07-27 |
| DE2502894A1 (de) | 1976-07-29 |
| DE2502894C3 (de) | 1981-12-03 |
| BE837853A (fr) | 1976-07-23 |
| JPS5197591A (enExample) | 1976-08-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2502894C3 (de) | Ruthenium-Trägerkatalysator | |
| EP0053818B1 (de) | Verfahren zur Herstellung von Cyclohexylaminen durch Hydrierung von aromatischen Aminen | |
| EP0070397B1 (de) | Verfahren und Katalysator zur Herstellung von cyclischen Iminen | |
| EP0324983B1 (de) | Ruthenium-Trägerkatalysator, seine Herstellung und sein Einsatz bei der Herstellung von gegebenenfalls substituiertem Cyclohexylamin und gegebenenfalls substituiertem Dicyclohexylamin | |
| EP0351661B1 (de) | Ruthenium-Trägerkatalysator, seine Herstellung und sein Einsatz bei der Herstellung von gegebenenfalls substituiertem Cyclohexylamin und gegebenenfalls substituiertem Dicyclohexylamin | |
| DE2502893C2 (de) | Cycloaliphatische Amine | |
| EP0001425B1 (de) | Ruthenium-Trägerkatalysator, Verfahren zu seiner Herstellung und seine Verwendung als Hydrierkatalysator | |
| DE2909650C2 (enExample) | ||
| DE2520893A1 (de) | Verfahren zur herstellung von diphenylamin | |
| EP0494455B1 (de) | Verfahren zur Herstellung von Diphenylaminen | |
| EP0668101B1 (de) | Ruthenium-Katalysatoren, deren Herstellung und ein Verfahren zur Herstellung von cycloaliphatischen Polyaminen unter Verwendung dieser Katalysatoren | |
| DD298088A5 (de) | Verfahren zur herstellung von chlorsubstituierten aromatischen aminen | |
| EP0503347B1 (de) | Verfahren zur Herstellung eines Gemisches von, gegebenenfalls substituiertem, Cyclohexylamin und gegebenenfalls substituiertem Dicyclohexylamin unter Ver- wendung eines Palladium/Al2O3 Katalysators. | |
| DE2506348B2 (enExample) | ||
| DE2061709A1 (en) | N-methylaniline production | |
| CH629180A5 (de) | Verfahren zur herstellung von hydrazobenzol. | |
| EP0369420B1 (de) | Verfahren zur Herstellung von 4,4'-Dinitrodiphenylamin | |
| DE2308014A1 (de) | Verfahren zur herstellung von diaminodiarylmethanen | |
| EP0054809B1 (de) | Verfahren zur Herstellung von 5-Amino-2,4-dimethyl-acetanilid | |
| EP0322761B1 (de) | Verfahren zur Herstellung von Dialkylaminoethylaminen | |
| DE2632437A1 (de) | 2-chlor-n-isopropyl-2',3'-dimethylacetanilid, verfahren zu seiner herstellung und seine verwendung | |
| EP0104531A1 (de) | Gegebenenfalls Isomerengemische darstellende cycloaliphatische Diisocyanate, ein Verfahren zu ihrer Herstellung, sowie ihre Verwendung als Ausgangsmaterialien bei der Herstellung von Polyurethankunststoffen | |
| EP0645356A1 (de) | Verfahren zur Herstellung von Cyclohexen durch partielle Hydrierung von Benzol | |
| DE3338681A1 (de) | Verfahren zur herstellung von n-methylhomoveratrylamin | |
| DE2214056C3 (de) | Katalysator und Verfahren zur Reduktion von Nitroverbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8326 | Change of the secondary classification | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |