DE2459640A1 - Magnetischer speicher - Google Patents
Magnetischer speicherInfo
- Publication number
- DE2459640A1 DE2459640A1 DE19742459640 DE2459640A DE2459640A1 DE 2459640 A1 DE2459640 A1 DE 2459640A1 DE 19742459640 DE19742459640 DE 19742459640 DE 2459640 A DE2459640 A DE 2459640A DE 2459640 A1 DE2459640 A1 DE 2459640A1
- Authority
- DE
- Germany
- Prior art keywords
- magnetic
- memory according
- loops
- main loop
- secondary loops
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 230000005291 magnetic effect Effects 0.000 title claims description 35
- 230000005540 biological transmission Effects 0.000 claims description 35
- 238000012546 transfer Methods 0.000 claims description 22
- 230000005381 magnetic domain Effects 0.000 claims description 15
- 239000000696 magnetic material Substances 0.000 claims description 15
- 239000002223 garnet Substances 0.000 claims description 8
- 229910000889 permalloy Inorganic materials 0.000 claims description 6
- 239000000758 substrate Substances 0.000 claims description 4
- 239000013078 crystal Substances 0.000 claims description 3
- 229910017052 cobalt Inorganic materials 0.000 claims 1
- 239000010941 cobalt Substances 0.000 claims 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims 1
- 239000010408 film Substances 0.000 claims 1
- 239000010409 thin film Substances 0.000 claims 1
- 230000008520 organization Effects 0.000 description 26
- 230000033001 locomotion Effects 0.000 description 7
- 230000006870 function Effects 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 230000005415 magnetization Effects 0.000 description 4
- 230000008901 benefit Effects 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical group [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical group [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000004020 conductor Substances 0.000 description 2
- 229910052733 gallium Chemical group 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 230000010287 polarization Effects 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- IOMKFXWXDFZXQH-UHFFFAOYSA-N (6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl) 3-chloro-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyloxy]benzoate Chemical compound C1=C(Cl)C(OC(=O)CCNC(=O)OC(C)(C)C)=CC=C1C(=O)OC1=CC=C(C2=C(CCCC2)C(=O)O2)C2=C1 IOMKFXWXDFZXQH-UHFFFAOYSA-N 0.000 description 1
- 206010035148 Plague Diseases 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000006399 behavior Effects 0.000 description 1
- 230000002457 bidirectional effect Effects 0.000 description 1
- VAUNMJNZQZLHJE-UHFFFAOYSA-N cobalt gadolinium Chemical compound [Co].[Gd] VAUNMJNZQZLHJE-UHFFFAOYSA-N 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000005294 ferromagnetic effect Effects 0.000 description 1
- 150000002505 iron Chemical class 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000002688 persistence Effects 0.000 description 1
- 229910052761 rare earth metal Inorganic materials 0.000 description 1
- 150000002910 rare earth metals Chemical class 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000001360 synchronised effect Effects 0.000 description 1
- 229910000859 α-Fe Inorganic materials 0.000 description 1
Classifications
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11C—STATIC STORES
- G11C19/00—Digital stores in which the information is moved stepwise, e.g. shift registers
- G11C19/02—Digital stores in which the information is moved stepwise, e.g. shift registers using magnetic elements
- G11C19/08—Digital stores in which the information is moved stepwise, e.g. shift registers using magnetic elements using thin films in plane structure
- G11C19/0875—Organisation of a plurality of magnetic shift registers
Landscapes
- Thin Magnetic Films (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00429260A US3838407A (en) | 1973-12-28 | 1973-12-28 | Bubble memory organization with two port major/minor loop transfer |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2459640A1 true DE2459640A1 (de) | 1975-07-10 |
Family
ID=23702498
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742459640 Withdrawn DE2459640A1 (de) | 1973-12-28 | 1974-12-17 | Magnetischer speicher |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3838407A (enExample) |
| JP (1) | JPS561713B2 (enExample) |
| CA (1) | CA1035864A (enExample) |
| DE (1) | DE2459640A1 (enExample) |
| FR (1) | FR2256505B1 (enExample) |
| GB (1) | GB1486819A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2722203A1 (de) * | 1976-05-24 | 1977-12-01 | Rockwell International Corp | Magnetischer domaenenspeicher nach der major-minor-anordnung |
| EP0019391A1 (en) * | 1979-05-12 | 1980-11-26 | Fujitsu Limited | Improvement in method of manufacturing electronic device having multilayer wiring structure |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3967263A (en) * | 1974-05-14 | 1976-06-29 | International Business Machines Corporation | Text editing system |
| US3999172A (en) * | 1974-11-29 | 1976-12-21 | Texas Instruments Incorporated | Magnetic domain memory |
| JPS5182532A (enExample) * | 1975-01-16 | 1976-07-20 | Nippon Telegraph & Telephone | |
| US3971005A (en) * | 1975-01-17 | 1976-07-20 | Gte Laboratories Incorporated | Dual access magnetic domain memory |
| US4081861A (en) * | 1975-02-10 | 1978-03-28 | Texas Instruments Incorporated | Matrixed magnetic bubble memories |
| JPS566069B2 (enExample) * | 1975-02-25 | 1981-02-09 | ||
| JPS566070B2 (enExample) * | 1975-02-27 | 1981-02-09 | ||
| US4007453A (en) * | 1975-03-31 | 1977-02-08 | Bell Telephone Laboratories, Incorporated | Magnetic bubble memory organization |
| US4058799A (en) * | 1975-05-19 | 1977-11-15 | Rockwell International Corporation | Block oriented random access bubble memory |
| US4075611A (en) * | 1975-11-19 | 1978-02-21 | Rockwell International Corporation | Consecutive bit access of magnetic bubble domain memory devices |
| JPS5369545A (en) * | 1976-12-03 | 1978-06-21 | Hitachi Ltd | Shift-register-type memory unit |
| US4168535A (en) * | 1977-08-22 | 1979-09-18 | International Business Machines Corporation | Non-volatile bubble domain memory system |
| JPS5812670B2 (ja) * | 1977-12-12 | 1983-03-09 | 株式会社日立製作所 | 磁気バブルメモリ装置 |
| US4238836A (en) * | 1979-03-07 | 1980-12-09 | Bell Telephone Laboratories, Incorporated | Fail safe magnetic bubble memory |
| USRE30732E (en) * | 1979-07-25 | 1981-09-01 | Consecutive bit access of magnetic bubble domain memory devices | |
| US4249249A (en) * | 1979-12-03 | 1981-02-03 | Bell Telephone Laboratories, Incorporated | Ion-implanted bubble memory |
| US4386417A (en) * | 1981-06-30 | 1983-05-31 | International Business Machines Corporation | High performance bubble chip architecture |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3613056A (en) * | 1970-04-20 | 1971-10-12 | Bell Telephone Labor Inc | Magnetic devices utilizing garnet compositions |
| US3680067A (en) * | 1970-11-16 | 1972-07-25 | Bell Telephone Labor Inc | Domain propagation circuit |
| JPS511535B1 (enExample) * | 1971-02-06 | 1976-01-19 | ||
| US3731109A (en) * | 1971-06-17 | 1973-05-01 | Bell Telephone Labor Inc | Magnetic domain logic apparatus |
| US3751597A (en) * | 1971-12-30 | 1973-08-07 | Bell Telephone Labor Inc | Time division multiplex network switching unit |
| JPS5430263B2 (enExample) * | 1972-03-31 | 1979-09-29 | ||
| US3760386A (en) * | 1972-07-27 | 1973-09-18 | Gte Automatic Electric Lab Inc | Magnetic domain logic decoder |
-
1973
- 1973-12-28 US US00429260A patent/US3838407A/en not_active Expired - Lifetime
-
1974
- 1974-07-31 CA CA206,030A patent/CA1035864A/en not_active Expired
- 1974-09-25 JP JP11039874A patent/JPS561713B2/ja not_active Expired
- 1974-12-17 DE DE19742459640 patent/DE2459640A1/de not_active Withdrawn
- 1974-12-18 GB GB54736/74A patent/GB1486819A/en not_active Expired
- 1974-12-19 FR FR7441978A patent/FR2256505B1/fr not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2722203A1 (de) * | 1976-05-24 | 1977-12-01 | Rockwell International Corp | Magnetischer domaenenspeicher nach der major-minor-anordnung |
| EP0019391A1 (en) * | 1979-05-12 | 1980-11-26 | Fujitsu Limited | Improvement in method of manufacturing electronic device having multilayer wiring structure |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5099233A (enExample) | 1975-08-06 |
| GB1486819A (en) | 1977-09-28 |
| JPS561713B2 (enExample) | 1981-01-14 |
| CA1035864A (en) | 1978-08-01 |
| FR2256505A1 (enExample) | 1975-07-25 |
| FR2256505B1 (enExample) | 1978-04-28 |
| US3838407A (en) | 1974-09-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2459640A1 (de) | Magnetischer speicher | |
| DE1549136B2 (de) | Magnetischer speicher | |
| DE2232922C3 (de) | Magnetische Domänen-Übertragungsanordnung | |
| DE2508087A1 (de) | Magnetblasenspeicher | |
| DE2758623C3 (de) | Datenübertrager und -speicher mit isotropem ferromagnetischem Nickeleisenfilm in einer Dicke von 350 Angström | |
| DE2411731A1 (de) | Magnetischer datenspeicher | |
| DE2613489B2 (enExample) | ||
| DE2804695A1 (de) | Magnetblasenspeicheranordnung | |
| DE2901130A1 (de) | Magnetblasenspeicheranordnung | |
| DE2412879A1 (de) | Einrichtung zur weiterleitung, speicherung und vernichtung magnetischer einzelwanddomaenen | |
| DE2527916A1 (de) | Magnetisches einzelwanddomaenensystem | |
| DE2259042A1 (de) | Magnetische speicheranordnung | |
| DE2732536B2 (de) | Einteiliger lamellierter Körper zum Transport von Blasendomänen | |
| DE1816340A1 (de) | Magnetschichtspeicherelement | |
| DE2908930A1 (de) | Magnetblasenspeicheranordnung | |
| DE2436991A1 (de) | Weiche fuer magnetische zylinderdomaenen | |
| DE2820491A1 (de) | Magnetblasenspeicheranordnung | |
| DE2638420C3 (de) | Digitaler Schiebespeicher aus einem ferromagnetischen Film von uniaxialer Anisotropie in einer Dicke von 100 bis 300 Angstrom mit einer Querschwellenwand | |
| DE2758622C3 (enExample) | ||
| DE2344983A1 (de) | Magnetischer duennschichtspeicher | |
| DE2159062A1 (de) | Informationsübertragung bei Bläschendomänen-Speicher- und Schaltvorrichtungen | |
| DE2529150A1 (de) | Bitorganisierter blasenspeicher mit duennen, ferromagnetischen filmen | |
| DE2231877C3 (de) | Magnetische Speichereinrichtung mit bewegtem magnetischem Aufzeichnungsträger und einem Schreibkopf | |
| DE1574757C (de) | Speichervorrichtung mit einem magne tischen Dünnschicht Speicherelement | |
| DE1549136C (de) | Magnetischer Speicher |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8141 | Disposal/no request for examination |