DE2459374A1 - Fluessigkristalline verbindungen - Google Patents
Fluessigkristalline verbindungenInfo
- Publication number
- DE2459374A1 DE2459374A1 DE19742459374 DE2459374A DE2459374A1 DE 2459374 A1 DE2459374 A1 DE 2459374A1 DE 19742459374 DE19742459374 DE 19742459374 DE 2459374 A DE2459374 A DE 2459374A DE 2459374 A1 DE2459374 A1 DE 2459374A1
- Authority
- DE
- Germany
- Prior art keywords
- acid
- cyanophenyl ester
- ester
- cinnamic acid
- hydroxybenzonitrile
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 title claims description 57
- 239000007788 liquid Substances 0.000 title description 4
- -1 phenyl ester Chemical class 0.000 claims description 26
- CVNOWLNNPYYEOH-UHFFFAOYSA-N 4-cyanophenol Chemical compound OC1=CC=C(C#N)C=C1 CVNOWLNNPYYEOH-UHFFFAOYSA-N 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 18
- 125000004432 carbon atom Chemical group C* 0.000 claims description 17
- 239000002253 acid Substances 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 238000002360 preparation method Methods 0.000 claims description 9
- CQKKAIGLUZJBPG-UHFFFAOYSA-N 3-(4-heptylphenyl)prop-2-enoic acid Chemical compound CCCCCCCC1=CC=C(C=CC(O)=O)C=C1 CQKKAIGLUZJBPG-UHFFFAOYSA-N 0.000 claims description 8
- ZVQOOHYFBIDMTQ-UHFFFAOYSA-N [methyl(oxido){1-[6-(trifluoromethyl)pyridin-3-yl]ethyl}-lambda(6)-sulfanylidene]cyanamide Chemical compound N#CN=S(C)(=O)C(C)C1=CC=C(C(F)(F)F)N=C1 ZVQOOHYFBIDMTQ-UHFFFAOYSA-N 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- GOIIVCHICYNWSG-UHFFFAOYSA-N 3-(4-ethylphenyl)prop-2-enoic acid Chemical compound CCC1=CC=C(C=CC(O)=O)C=C1 GOIIVCHICYNWSG-UHFFFAOYSA-N 0.000 claims description 3
- RURHILYUWQEGOS-VOTSOKGWSA-N 4-Methylcinnamic acid Chemical compound CC1=CC=C(\C=C\C(O)=O)C=C1 RURHILYUWQEGOS-VOTSOKGWSA-N 0.000 claims description 3
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 claims description 3
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 claims description 3
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 claims description 3
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 claims description 3
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 3
- ARGVABDJPRRAQI-UHFFFAOYSA-N 3-(4-methylphenyl)prop-2-enoyl chloride Chemical compound CC1=CC=C(C=CC(Cl)=O)C=C1 ARGVABDJPRRAQI-UHFFFAOYSA-N 0.000 claims description 2
- BWEWPHKYGVJYHR-UHFFFAOYSA-N 3-(4-propylphenyl)prop-2-enoic acid Chemical compound CCCC1=CC=C(C=CC(O)=O)C=C1 BWEWPHKYGVJYHR-UHFFFAOYSA-N 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims 2
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 claims 1
- FWTAYRNCJHYNAZ-UHFFFAOYSA-N 2-benzylidenedecanoic acid Chemical compound CCCCCCCCC(C(O)=O)=CC1=CC=CC=C1 FWTAYRNCJHYNAZ-UHFFFAOYSA-N 0.000 claims 1
- DQEWREMUBNHXKH-UHFFFAOYSA-N 2-benzylideneheptanoic acid Chemical compound CCCCCC(C(O)=O)=CC1=CC=CC=C1 DQEWREMUBNHXKH-UHFFFAOYSA-N 0.000 claims 1
- XDSLRKTVZZEPEH-UHFFFAOYSA-N 2-benzylidenehexanoyl chloride Chemical compound CCCCC(C(Cl)=O)=CC1=CC=CC=C1 XDSLRKTVZZEPEH-UHFFFAOYSA-N 0.000 claims 1
- HILSQAAMFAHTMW-UHFFFAOYSA-N 2-benzylidenenonanoic acid Chemical compound CCCCCCCC(C(O)=O)=CC1=CC=CC=C1 HILSQAAMFAHTMW-UHFFFAOYSA-N 0.000 claims 1
- ONCYWMWZJKRKSB-UHFFFAOYSA-N 2-benzylideneoctanoic acid Chemical compound CCCCCCC(C(O)=O)=CC1=CC=CC=C1 ONCYWMWZJKRKSB-UHFFFAOYSA-N 0.000 claims 1
- AXGUJMXDTRGASZ-UHFFFAOYSA-N 3-(4-ethylphenyl)prop-2-enoyl chloride Chemical compound CCC1=CC=C(C=CC(Cl)=O)C=C1 AXGUJMXDTRGASZ-UHFFFAOYSA-N 0.000 claims 1
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical compound [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 claims 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 claims 1
- 229930016911 cinnamic acid Natural products 0.000 claims 1
- 235000013985 cinnamic acid Nutrition 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 66
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 32
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 29
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 26
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 26
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 22
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- 238000002844 melting Methods 0.000 description 21
- 230000008018 melting Effects 0.000 description 21
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 20
- 239000000203 mixture Substances 0.000 description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical group O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 19
- 239000011541 reaction mixture Substances 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 13
- 150000002148 esters Chemical class 0.000 description 13
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- 239000012043 crude product Substances 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 125000005910 alkyl carbonate group Chemical group 0.000 description 9
- 239000005457 ice water Substances 0.000 description 9
- 238000001953 recrystallisation Methods 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- 235000011121 sodium hydroxide Nutrition 0.000 description 8
- 239000013078 crystal Substances 0.000 description 7
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 125000003545 alkoxy group Chemical group 0.000 description 6
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 238000009835 boiling Methods 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000004973 liquid crystal related substance Substances 0.000 description 5
- RGHHSNMVTDWUBI-UHFFFAOYSA-N 4-hydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1 RGHHSNMVTDWUBI-UHFFFAOYSA-N 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000011230 binding agent Substances 0.000 description 4
- 239000003990 capacitor Substances 0.000 description 4
- 150000002367 halogens Chemical group 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 4
- YQIASAUDDDCAKU-UHFFFAOYSA-N 2-hexylbenzoic acid Chemical compound CCCCCCC1=CC=CC=C1C(O)=O YQIASAUDDDCAKU-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 239000005711 Benzoic acid Substances 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 125000004423 acyloxy group Chemical group 0.000 description 3
- 235000010233 benzoic acid Nutrition 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 2
- HIKJBZUXMYBAIL-UHFFFAOYSA-N 3-(4-hexylphenyl)prop-2-enoic acid Chemical compound CCCCCCC1=CC=C(C=CC(O)=O)C=C1 HIKJBZUXMYBAIL-UHFFFAOYSA-N 0.000 description 2
- PPAIOXAEVGTBTD-UHFFFAOYSA-N 3-(4-propylphenyl)prop-2-enoyl chloride Chemical compound CCCC1=CC=C(C=CC(Cl)=O)C=C1 PPAIOXAEVGTBTD-UHFFFAOYSA-N 0.000 description 2
- VSUKEWPHURLYTK-UHFFFAOYSA-N 4-heptylbenzoic acid Chemical compound CCCCCCCC1=CC=C(C(O)=O)C=C1 VSUKEWPHURLYTK-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- ATHHXGZTWNVVOU-UHFFFAOYSA-N N-methylformamide Chemical compound CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 2
- 238000000297 Sandmeyer reaction Methods 0.000 description 2
- 239000004990 Smectic liquid crystal Substances 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- SWIDWYDWKMYMLV-UHFFFAOYSA-N (4-aminophenyl) methyl carbonate Chemical compound COC(=O)OC1=CC=C(N)C=C1 SWIDWYDWKMYMLV-UHFFFAOYSA-N 0.000 description 1
- ZEKLCHCUARAYTN-UHFFFAOYSA-N (4-carbonochloridoylphenyl) ethyl carbonate Chemical compound CCOC(=O)OC1=CC=C(C(Cl)=O)C=C1 ZEKLCHCUARAYTN-UHFFFAOYSA-N 0.000 description 1
- GQYLKKWTYKNXIC-UHFFFAOYSA-N (4-formylphenyl) methyl carbonate Chemical compound COC(=O)OC1=CC=C(C=O)C=C1 GQYLKKWTYKNXIC-UHFFFAOYSA-N 0.000 description 1
- WOGITNXCNOTRLK-VOTSOKGWSA-N (e)-3-phenylprop-2-enoyl chloride Chemical compound ClC(=O)\C=C\C1=CC=CC=C1 WOGITNXCNOTRLK-VOTSOKGWSA-N 0.000 description 1
- HLCPWBZNUKCSBN-UHFFFAOYSA-N 2-aminobenzonitrile Chemical compound NC1=CC=CC=C1C#N HLCPWBZNUKCSBN-UHFFFAOYSA-N 0.000 description 1
- MCHAOCNRCCQOPT-UHFFFAOYSA-N 2-benzylidenepentanoic acid Chemical compound CCCC(C(O)=O)=CC1=CC=CC=C1 MCHAOCNRCCQOPT-UHFFFAOYSA-N 0.000 description 1
- SMNNDVUKAKPGDD-UHFFFAOYSA-N 2-butylbenzoic acid Chemical compound CCCCC1=CC=CC=C1C(O)=O SMNNDVUKAKPGDD-UHFFFAOYSA-N 0.000 description 1
- QVTPWONEVZJCCS-UHFFFAOYSA-N 2-formylbenzonitrile Chemical compound O=CC1=CC=CC=C1C#N QVTPWONEVZJCCS-UHFFFAOYSA-N 0.000 description 1
- YNFUGQHDAKFMGG-UHFFFAOYSA-N 2-heptylbenzoic acid Chemical compound CCCCCCCC1=CC=CC=C1C(O)=O YNFUGQHDAKFMGG-UHFFFAOYSA-N 0.000 description 1
- BVLVGYXYGXOSOG-UHFFFAOYSA-N 2-hexoxybenzoic acid Chemical compound CCCCCCOC1=CC=CC=C1C(O)=O BVLVGYXYGXOSOG-UHFFFAOYSA-N 0.000 description 1
- PNGABSLKIWVPMN-UHFFFAOYSA-N 3-(4-heptylphenyl)prop-2-enoyl chloride Chemical compound CCCCCCCC1=CC=C(C=CC(Cl)=O)C=C1 PNGABSLKIWVPMN-UHFFFAOYSA-N 0.000 description 1
- BHRKWWLBXDZCST-UHFFFAOYSA-N 3-(4-hexylphenyl)prop-2-enoyl chloride Chemical compound CCCCCCC1=CC=C(C=CC(Cl)=O)C=C1 BHRKWWLBXDZCST-UHFFFAOYSA-N 0.000 description 1
- RGUSGOMPDDPYTR-UHFFFAOYSA-N 3-(4-octylphenyl)prop-2-enoic acid Chemical compound CCCCCCCCC1=CC=C(C=CC(O)=O)C=C1 RGUSGOMPDDPYTR-UHFFFAOYSA-N 0.000 description 1
- BSDFMNIPTCDJFY-UHFFFAOYSA-N 3-(4-octylphenyl)prop-2-enoyl chloride Chemical compound CCCCCCCCC1=CC=C(C=CC(Cl)=O)C=C1 BSDFMNIPTCDJFY-UHFFFAOYSA-N 0.000 description 1
- ZGOWXOZNUNZPAV-UHFFFAOYSA-N 4-(4-heptylphenyl)benzonitrile Chemical group C1=CC(CCCCCCC)=CC=C1C1=CC=C(C#N)C=C1 ZGOWXOZNUNZPAV-UHFFFAOYSA-N 0.000 description 1
- ZRMIETZFPZGBEB-UHFFFAOYSA-N 4-(4-hydroxyphenyl)benzonitrile Chemical group C1=CC(O)=CC=C1C1=CC=C(C#N)C=C1 ZRMIETZFPZGBEB-UHFFFAOYSA-N 0.000 description 1
- BVTLIIQDQAUXOI-UHFFFAOYSA-N 4-(benzylideneamino)phenol Chemical compound C1=CC(O)=CC=C1N=CC1=CC=CC=C1 BVTLIIQDQAUXOI-UHFFFAOYSA-N 0.000 description 1
- YBAZINRZQSAIAY-UHFFFAOYSA-N 4-aminobenzonitrile Chemical compound NC1=CC=C(C#N)C=C1 YBAZINRZQSAIAY-UHFFFAOYSA-N 0.000 description 1
- GZFGOTFRPZRKDS-UHFFFAOYSA-N 4-bromophenol Chemical compound OC1=CC=C(Br)C=C1 GZFGOTFRPZRKDS-UHFFFAOYSA-N 0.000 description 1
- WZWIQYMTQZCSKI-UHFFFAOYSA-N 4-cyanobenzaldehyde Chemical compound O=CC1=CC=C(C#N)C=C1 WZWIQYMTQZCSKI-UHFFFAOYSA-N 0.000 description 1
- UXVMHSYMNTYLPO-UHFFFAOYSA-N 4-ethoxycarbonyloxybenzoic acid Chemical compound CCOC(=O)OC1=CC=C(C(O)=O)C=C1 UXVMHSYMNTYLPO-UHFFFAOYSA-N 0.000 description 1
- JRFVBFVDDUPPNQ-UHFFFAOYSA-N 4-heptylbenzaldehyde Chemical compound CCCCCCCC1=CC=C(C=O)C=C1 JRFVBFVDDUPPNQ-UHFFFAOYSA-N 0.000 description 1
- CPEPWESLFZVUEP-UHFFFAOYSA-N 4-hexylbenzoic acid Chemical compound CCCCCCC1=CC=C(C(O)=O)C=C1 CPEPWESLFZVUEP-UHFFFAOYSA-N 0.000 description 1
- ZQLDNJKHLQOJGE-UHFFFAOYSA-N 4-octylbenzoic acid Chemical compound CCCCCCCCC1=CC=C(C(O)=O)C=C1 ZQLDNJKHLQOJGE-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000723347 Cinnamomum Species 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- TYCFVGXFMHMJSQ-UHFFFAOYSA-N OC(=O)OCCCCCCc1ccccc1 Chemical compound OC(=O)OCCCCCCc1ccccc1 TYCFVGXFMHMJSQ-UHFFFAOYSA-N 0.000 description 1
- 235000014443 Pyrus communis Nutrition 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- YPNOVBAYFYHHJM-UHFFFAOYSA-N [4-(4-cyanophenyl)phenyl] butanoate Chemical compound C1=CC(OC(=O)CCC)=CC=C1C1=CC=C(C#N)C=C1 YPNOVBAYFYHHJM-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- TXHIDIHEXDFONW-UHFFFAOYSA-N benzene;propan-2-one Chemical compound CC(C)=O.C1=CC=CC=C1 TXHIDIHEXDFONW-UHFFFAOYSA-N 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 235000017803 cinnamon Nutrition 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000005684 electric field Effects 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- YCNSGSUGQPDYTK-UHFFFAOYSA-N ethyl phenyl carbonate Chemical compound CCOC(=O)OC1=CC=CC=C1 YCNSGSUGQPDYTK-UHFFFAOYSA-N 0.000 description 1
- 230000005496 eutectics Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- KDCIHNCMPUBDKT-UHFFFAOYSA-N hexane;propan-2-one Chemical compound CC(C)=O.CCCCCC KDCIHNCMPUBDKT-UHFFFAOYSA-N 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 150000002466 imines Chemical group 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000005905 mesyloxy group Chemical group 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003935 n-pentoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000004043 responsiveness Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/30—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing six-membered aromatic rings
- C07C57/42—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing six-membered aromatic rings having unsaturation outside the rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/64—Acyl halides
- C07C57/72—Acyl halides containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K19/00—Liquid crystal materials
- C09K19/04—Liquid crystal materials characterised by the chemical structure of the liquid crystal components, e.g. by a specific unit
- C09K19/06—Non-steroidal liquid crystal compounds
- C09K19/08—Non-steroidal liquid crystal compounds containing at least two non-condensed rings
- C09K19/10—Non-steroidal liquid crystal compounds containing at least two non-condensed rings containing at least two benzene rings
- C09K19/20—Non-steroidal liquid crystal compounds containing at least two non-condensed rings containing at least two benzene rings linked by a chain containing carbon and oxygen atoms as chain links, e.g. esters or ethers
- C09K19/2007—Non-steroidal liquid crystal compounds containing at least two non-condensed rings containing at least two benzene rings linked by a chain containing carbon and oxygen atoms as chain links, e.g. esters or ethers the chain containing -COO- or -OCO- groups
- C09K19/2014—Non-steroidal liquid crystal compounds containing at least two non-condensed rings containing at least two benzene rings linked by a chain containing carbon and oxygen atoms as chain links, e.g. esters or ethers the chain containing -COO- or -OCO- groups containing additionally a linking group other than -COO- or -OCO-, e.g. -CH2-CH2-, -CH=CH-, -C=C-; containing at least one additional carbon atom in the chain containing -COO- or -OCO- groups, e.g. -(CH2)m-COO-(CH2)n-
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Crystallography & Structural Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Liquid Crystal Substances (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1762673 | 1973-12-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2459374A1 true DE2459374A1 (de) | 1975-06-19 |
Family
ID=4426826
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742459374 Pending DE2459374A1 (de) | 1973-12-17 | 1974-12-16 | Fluessigkristalline verbindungen |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3927066A (enExample) |
| JP (1) | JPS5089342A (enExample) |
| DD (1) | DD117321A5 (enExample) |
| DE (1) | DE2459374A1 (enExample) |
| DK (1) | DK637774A (enExample) |
| FR (1) | FR2254559B1 (enExample) |
| GB (1) | GB1483498A (enExample) |
| IT (1) | IT1025415B (enExample) |
| NL (1) | NL7415610A (enExample) |
| SE (1) | SE7415643L (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4053431A (en) * | 1973-11-19 | 1977-10-11 | Hoffmann-La Roche Inc. | Liquid crystalline biphenyls |
| US4061587A (en) * | 1973-12-17 | 1977-12-06 | Hoffmann-La Roche Inc. | Liquid crystalline cinnamic acid esters |
| US4066570A (en) * | 1974-10-25 | 1978-01-03 | Hoffman-La Roche Inc. | Phenyl-pyrimidines |
| CA1055517A (en) * | 1975-06-05 | 1979-05-29 | Toshio Jinnai | Liquid crystalline cinnamic acid esters and liquid crystal compositions containing the same |
| US4138358A (en) * | 1976-02-09 | 1979-02-06 | Temple University | Liquid crystal compositions |
| NL7701750A (nl) * | 1976-02-26 | 1977-08-30 | Hoffmann La Roche | Mengsels van vloeibare kristallen. |
| US4490277A (en) * | 1981-05-29 | 1984-12-25 | Grebenkin Mikhail F | Mesomorphic material with low optical anisotropy and process for producing same |
| DE3225290A1 (de) * | 1982-07-07 | 1984-01-12 | Merck Patent Gmbh | Ringverbindungen |
| CN105316008A (zh) * | 2015-11-16 | 2016-02-10 | 深圳市华星光电技术有限公司 | 反应型垂直取向材料、液晶显示面板、及液晶配向方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3795436A (en) * | 1972-07-05 | 1974-03-05 | Hoffmann La Roche | Nematogenic material which exhibit the kerr effect at isotropic temperatures |
-
1974
- 1974-10-31 IT IT29082/74A patent/IT1025415B/it active
- 1974-11-29 NL NL7415610A patent/NL7415610A/xx unknown
- 1974-12-04 US US529436A patent/US3927066A/en not_active Expired - Lifetime
- 1974-12-06 DK DK637774A patent/DK637774A/da unknown
- 1974-12-12 SE SE7415643A patent/SE7415643L/xx not_active Application Discontinuation
- 1974-12-13 FR FR7441199A patent/FR2254559B1/fr not_active Expired
- 1974-12-13 JP JP49142641A patent/JPS5089342A/ja active Pending
- 1974-12-16 DD DD183070A patent/DD117321A5/xx unknown
- 1974-12-16 DE DE19742459374 patent/DE2459374A1/de active Pending
- 1974-12-16 GB GB54165/74A patent/GB1483498A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL7415610A (nl) | 1975-06-19 |
| US3927066A (en) | 1975-12-16 |
| FR2254559B1 (enExample) | 1978-08-18 |
| FR2254559A1 (enExample) | 1975-07-11 |
| GB1483498A (en) | 1977-08-17 |
| DK637774A (enExample) | 1975-09-01 |
| IT1025415B (it) | 1978-08-10 |
| JPS5089342A (enExample) | 1975-07-17 |
| DD117321A5 (enExample) | 1976-01-05 |
| SE7415643L (enExample) | 1975-06-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2701591C3 (de) | Hexahydroterphenylderivate und deren Verwendung in flüssigkristallinen Dielektrika | |
| EP0074608B1 (de) | Flüssigkristalline Halogenverbindungen, Verfahren zu ihrer Herstellung, diese enthaltende Dielektrika und elektrooptisches Anzeigeelement | |
| EP0064193B1 (de) | Fluorhaltige 4,4'-Bis-(cyclohexyl)-biphenylderivate, diese enthaltende Dielektrika und elektrooptisches Anzeigeelement | |
| EP0047817A2 (de) | Hydrierte Naphthaline, deren Herstellung und Verwendung sowie derartige Naphthaline enthaltende Gemische | |
| DE2547737A1 (de) | Phenylpyrimidine | |
| EP0471813B1 (de) | 4,4'-disubstituierte 2',3-difluorbiphenyle und flüssigkristallines medium | |
| DE2454570A1 (de) | Fluessigkristalline biphenyle | |
| EP0085335B1 (de) | Flüssigkristallines Dielektrikum, neue Farbstoffe, Verfahren zu ihrer Herstellung und elektrooptisches Anzeigeelement | |
| DE2948836A1 (de) | Partiell hydrierte oligo-1,4-phenylene, diese enthaltende dielektrika und elektrooptisches anzeigeelement | |
| WO1987005017A2 (en) | Optically active compounds | |
| EP0051738A1 (de) | Fluorhaltige Cyclohexylbiphenylderivate, diese enthaltende Dielektrika und elektrooptisches Anzeigeelement | |
| DE2702598A1 (de) | Cyclohexylcyclohexane | |
| CH645102A5 (de) | Disubstituierte pyrimidine. | |
| US4211666A (en) | Liquid crystal compounds | |
| EP0256097A1 (de) | Vinylen-Verbindungen und flüssigkristalline Phase. | |
| DE2459374A1 (de) | Fluessigkristalline verbindungen | |
| DE2306738A1 (de) | Fluessigkristalline schiff'sche basen | |
| DE4427766A1 (de) | Verfahren zur Herstellung flüssigkristalliner Mischungen | |
| DE69018065T2 (de) | Flüssigkristalline eigenschaften besitzende phenylnaphthalene. | |
| DE3872543T2 (de) | Optisch aktive 2-substituierte propylaether- und fluessigkristallzusammensetzung. | |
| DE3886692T2 (de) | Biphenylverbindung. | |
| DE2447098A1 (de) | Fluessigkristalline ester | |
| DD156258A5 (de) | Fluessigkristalline gemische | |
| DE2447099A1 (de) | Fluessigkristalline schiff'sche basen | |
| DE3300587A1 (de) | Fluessigkristallines dielektrikum |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHW | Rejection |