DE2452494C2 - Ventilanordnung für Gasfeuerzeuge - Google Patents
Ventilanordnung für GasfeuerzeugeInfo
- Publication number
- DE2452494C2 DE2452494C2 DE2452494A DE2452494A DE2452494C2 DE 2452494 C2 DE2452494 C2 DE 2452494C2 DE 2452494 A DE2452494 A DE 2452494A DE 2452494 A DE2452494 A DE 2452494A DE 2452494 C2 DE2452494 C2 DE 2452494C2
- Authority
- DE
- Germany
- Prior art keywords
- valve
- section
- valve body
- arrangement according
- facing
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 claims description 10
- 239000012530 fluid Substances 0.000 claims description 8
- 238000011144 upstream manufacturing Methods 0.000 claims description 6
- 239000007788 liquid Substances 0.000 description 18
- 230000006835 compression Effects 0.000 description 7
- 238000007906 compression Methods 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 5
- 239000000446 fuel Substances 0.000 description 4
- 238000002485 combustion reaction Methods 0.000 description 3
- 230000000994 depressogenic effect Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000002309 gasification Methods 0.000 description 2
- 238000009434 installation Methods 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 238000005192 partition Methods 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 239000011148 porous material Substances 0.000 description 2
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 230000005489 elastic deformation Effects 0.000 description 1
- 239000013013 elastic material Substances 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 230000036316 preload Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F23—COMBUSTION APPARATUS; COMBUSTION PROCESSES
- F23Q—IGNITION; EXTINGUISHING-DEVICES
- F23Q2/00—Lighters containing fuel, e.g. for cigarettes
- F23Q2/16—Lighters with gaseous fuel, e.g. the gas being stored in liquid phase
- F23Q2/162—Lighters with gaseous fuel, e.g. the gas being stored in liquid phase with non-adjustable gas flame
- F23Q2/163—Burners (gas valves)
Landscapes
- Engineering & Computer Science (AREA)
- Chemical & Material Sciences (AREA)
- Combustion & Propulsion (AREA)
- Mechanical Engineering (AREA)
- General Engineering & Computer Science (AREA)
- Lighters Containing Fuel (AREA)
- Lift Valve (AREA)
- Hydraulic Motors (AREA)
- Pipeline Systems (AREA)
- Lubricants (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7341913A FR2251763B1 (enExample) | 1973-11-20 | 1973-11-20 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2452494A1 DE2452494A1 (de) | 1975-05-28 |
| DE2452494C2 true DE2452494C2 (de) | 1984-08-02 |
Family
ID=9128209
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2452494A Expired DE2452494C2 (de) | 1973-11-20 | 1974-11-05 | Ventilanordnung für Gasfeuerzeuge |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4008992A (enExample) |
| JP (1) | JPS5435812B2 (enExample) |
| AT (1) | AT342347B (enExample) |
| BE (1) | BE820372A (enExample) |
| BR (1) | BR7409644A (enExample) |
| CA (1) | CA1009862A (enExample) |
| CH (1) | CH581794A5 (enExample) |
| DE (1) | DE2452494C2 (enExample) |
| DK (1) | DK136739B (enExample) |
| ES (1) | ES207395Y (enExample) |
| FR (1) | FR2251763B1 (enExample) |
| GB (1) | GB1485489A (enExample) |
| IT (1) | IT1022482B (enExample) |
| NL (1) | NL168609C (enExample) |
| NO (1) | NO744148L (enExample) |
| SE (1) | SE7413799L (enExample) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS52164072U (enExample) * | 1976-06-05 | 1977-12-12 | ||
| FR2371633A1 (fr) * | 1976-11-19 | 1978-06-16 | Dupont S T | Appareil a gaz liquefie, notamment briquet a gaz pour fumeurs |
| FR2410221A1 (fr) * | 1977-11-29 | 1979-06-22 | Allumoirs Sa Cie | Briquet a gaz |
| ES232677Y (es) * | 1977-12-13 | 1978-07-16 | Dispositivo de gasificacion y reglaje perfeccionado para en-cendedores a gas. | |
| FR2514866B1 (fr) * | 1981-10-16 | 1986-04-25 | Dupont S T | Briquet a gaz liquefie |
| US4603834A (en) * | 1984-03-19 | 1986-08-05 | Smith International, Inc. | Mounting of disk in a disk valve |
| US4680007A (en) * | 1985-04-29 | 1987-07-14 | Schaechter Friedrich | Lighter with adjustable flame |
| US5215458A (en) * | 1988-03-04 | 1993-06-01 | Bic Corporation | Child-resistant lighter with spring-biased, rotatable safety release |
| US5456598A (en) * | 1988-09-02 | 1995-10-10 | Bic Corporation | Selectively actuatable lighter |
| US5125829A (en) * | 1988-09-02 | 1992-06-30 | Bic Corporation | Bidirectional selectively actuatable lighter |
| US5002482B1 (en) * | 1988-09-02 | 2000-02-29 | Bic Corp | Selectively actuatable lighter |
| US5584682A (en) * | 1988-09-02 | 1996-12-17 | Bic Corporation | Selectively actuatable lighter with anti-defeat latch |
| US5092764A (en) * | 1990-07-11 | 1992-03-03 | Bic Corporation | Selectively actuatable lighter with locking valve cap |
| CA2182123C (en) * | 1996-07-26 | 1999-10-05 | Graham F. Balderson | Method for the production of synthetic rutile |
| AU2002242313A1 (en) * | 2002-03-04 | 2003-09-29 | Sher, Tak Chi | Lighter with improved thermodynamics |
| US20060003280A1 (en) * | 2003-06-03 | 2006-01-05 | The Japan Smoking Articles Corporate Association | Hydrocarbon gas flow rate adjusting method and apparatus |
| CN102537384B (zh) * | 2010-12-20 | 2015-07-29 | 西安航天远征流体控制股份有限公司 | 内压橡胶密封块的非金属基体阀芯 |
| CN102829192B (zh) * | 2012-08-06 | 2013-12-11 | 宁波新海电气股份有限公司 | 一种泄气阀及打火机 |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1035035A (fr) * | 1951-04-03 | 1953-08-12 | Georges Lemoine Ets | Perfectionnements apportés aux appareils obturateurs du genre des robinets |
| US3092988A (en) * | 1962-01-09 | 1963-06-11 | Meyers Frederick Charles | Disposable lighter construction |
| AT246472B (de) * | 1962-06-19 | 1966-04-25 | Edmund Wycisk | Gasfeuerzeug |
| GB1050085A (enExample) * | 1963-02-04 | |||
| FR1360987A (fr) * | 1963-06-19 | 1964-05-15 | Briquet à gaz | |
| US3525497A (en) * | 1967-12-06 | 1970-08-25 | Eaton Yale & Towne | Lighter valve |
| JPS4428548Y1 (enExample) * | 1968-08-26 | 1969-11-26 | ||
| FR2036133A5 (enExample) * | 1969-03-05 | 1970-12-24 | Genoud & Cie Ets | |
| US3533721A (en) * | 1969-04-28 | 1970-10-13 | Francispam | Burner valve for gas-fueled pipe and cigarette lighters |
| US3695819A (en) * | 1970-02-02 | 1972-10-03 | Jean Gaston Tricot | Flame-adjuster of gas cigarette-lighter |
| FR2156495A1 (enExample) * | 1971-10-22 | 1973-06-01 | Allumoirs Sa Cie | |
| FR2209077B1 (enExample) * | 1972-07-10 | 1974-12-27 | Genoud & Cie Ets | |
| US3895905A (en) * | 1973-11-09 | 1975-07-22 | Gillette Co | Lighter |
-
1973
- 1973-11-20 FR FR7341913A patent/FR2251763B1/fr not_active Expired
-
1974
- 1974-09-26 BE BE148924A patent/BE820372A/xx not_active IP Right Cessation
- 1974-09-27 CA CA210,203A patent/CA1009862A/fr not_active Expired
- 1974-09-30 IT IT27919/74A patent/IT1022482B/it active
- 1974-10-01 CH CH1320974A patent/CH581794A5/xx not_active IP Right Cessation
- 1974-10-23 NL NLAANVRAGE7413853,A patent/NL168609C/xx not_active IP Right Cessation
- 1974-10-29 GB GB46730/74A patent/GB1485489A/en not_active Expired
- 1974-11-04 SE SE7413799A patent/SE7413799L/xx unknown
- 1974-11-05 DE DE2452494A patent/DE2452494C2/de not_active Expired
- 1974-11-07 AT AT893974A patent/AT342347B/de not_active IP Right Cessation
- 1974-11-12 ES ES1974207395U patent/ES207395Y/es not_active Expired
- 1974-11-13 DK DK589574AA patent/DK136739B/da not_active IP Right Cessation
- 1974-11-18 BR BR9644/74A patent/BR7409644A/pt unknown
- 1974-11-18 US US05/524,889 patent/US4008992A/en not_active Expired - Lifetime
- 1974-11-19 NO NO744148A patent/NO744148L/no unknown
- 1974-11-20 JP JP13283274A patent/JPS5435812B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DK136739B (da) | 1977-11-14 |
| DK589574A (enExample) | 1975-07-14 |
| FR2251763B1 (enExample) | 1976-10-01 |
| ATA893974A (de) | 1977-07-15 |
| US4008992A (en) | 1977-02-22 |
| FR2251763A1 (enExample) | 1975-06-13 |
| NO744148L (enExample) | 1975-06-16 |
| GB1485489A (en) | 1977-09-14 |
| IT1022482B (it) | 1978-03-20 |
| BE820372A (fr) | 1975-01-16 |
| AT342347B (de) | 1978-03-28 |
| DK136739C (enExample) | 1978-04-17 |
| BR7409644A (pt) | 1976-05-25 |
| CA1009862A (fr) | 1977-05-10 |
| NL168609C (nl) | 1982-04-16 |
| ES207395U (es) | 1976-03-16 |
| JPS5435812B2 (enExample) | 1979-11-06 |
| DE2452494A1 (de) | 1975-05-28 |
| CH581794A5 (enExample) | 1976-11-15 |
| NL7413853A (nl) | 1975-05-22 |
| ES207395Y (es) | 1976-07-16 |
| SE7413799L (enExample) | 1975-05-21 |
| JPS5084372A (enExample) | 1975-07-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2452494C2 (de) | Ventilanordnung für Gasfeuerzeuge | |
| DE2622097A1 (de) | Druckminderventil fuer ein gasfeuerzeug | |
| DE2249762B2 (de) | Doppelt spreizender duebel | |
| DE2942455A1 (de) | Laengenverstellbare gasfeder | |
| DE2750494C2 (de) | Durchflußregelventil | |
| DE2264055B2 (de) | Ventil fuer gasfeuerzeug | |
| DE3211208A1 (de) | Kraftstoffeinspritzventil | |
| DE2532249A1 (de) | Vereinfachte ventilvorrichtung fuer ein gasfeuerzeug | |
| DE2926499A1 (de) | Bremsdrucksteuereinheit fuer fahrzeugbremsanlagen | |
| AT519932B1 (de) | Ablassventil für hohe Drücke | |
| DE2710102C3 (de) | Durchflußventil für die Rückführung von Abgas in die Ansaugleitung einer Brennkraftmaschine | |
| EP0731315B1 (de) | Düsenabschlussventil sowie Druckzerstäuberdüse mit einem solchen Düsenabschlussventil | |
| DE69919318T2 (de) | Ampulle mit Startkraftstoff zum Zünden von Flüssigbrennstoffkomponenten bei Raketenmotoren | |
| DE2442010A1 (de) | Hydraulikkopf fuer eine einspritzpumpe und mit diesem hydraulikkopf ausgeruestete einspritzpumpe | |
| DE3005768A1 (de) | Ueberdruckventil | |
| EP0232449A2 (de) | Überdruckventil | |
| EP0806246B1 (de) | Düsenabschlussventil sowie Druckzerstäuberdüse mit einem solchen Düsenabschlussventil | |
| DE68913901T2 (de) | Hydraulisches Druckregelventil. | |
| DE2753264A1 (de) | Steuerscheibenventil, insbesondere fuer den sanitaerbereich | |
| DE1457657A1 (de) | Fluessiggas-Feuerzeug | |
| DE19633539C2 (de) | Druckabschaltventil | |
| DE1807918A1 (de) | Kleinfeuerzeug | |
| EP0914569B1 (de) | Einrichtung zur verstellung der länge einer stütze | |
| DE1757168C3 (de) | Ventil für ein Gasfeuerzeug | |
| DE1457648A1 (de) | Reguliervorrichtung fuer die Flamme eines Gasfeuerzeugs |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |