DE2435509A1 - Stabilisierte polyacrylsaeureester und verfahren zu ihrer herstellung - Google Patents
Stabilisierte polyacrylsaeureester und verfahren zu ihrer herstellungInfo
- Publication number
- DE2435509A1 DE2435509A1 DE2435509A DE2435509A DE2435509A1 DE 2435509 A1 DE2435509 A1 DE 2435509A1 DE 2435509 A DE2435509 A DE 2435509A DE 2435509 A DE2435509 A DE 2435509A DE 2435509 A1 DE2435509 A1 DE 2435509A1
- Authority
- DE
- Germany
- Prior art keywords
- compounds
- esterification
- allyl
- acid esters
- polyacrylic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 229920002125 Sokalan® Polymers 0.000 title claims description 19
- 239000004584 polyacrylic acid Substances 0.000 title claims description 19
- 238000000034 method Methods 0.000 title claims description 18
- 238000004519 manufacturing process Methods 0.000 title description 8
- 238000005886 esterification reaction Methods 0.000 claims description 38
- 230000032050 esterification Effects 0.000 claims description 37
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 27
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 26
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 25
- 150000001875 compounds Chemical class 0.000 claims description 21
- 239000000203 mixture Substances 0.000 claims description 21
- 150000002148 esters Chemical class 0.000 claims description 19
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 claims description 18
- 238000006116 polymerization reaction Methods 0.000 claims description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 15
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 14
- 239000003112 inhibitor Substances 0.000 claims description 14
- 230000002378 acidificating effect Effects 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 238000009835 boiling Methods 0.000 claims description 11
- 239000003054 catalyst Substances 0.000 claims description 10
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 239000003381 stabilizer Substances 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 23
- 229930195733 hydrocarbon Natural products 0.000 description 14
- 150000002430 hydrocarbons Chemical class 0.000 description 14
- 239000004215 Carbon black (E152) Substances 0.000 description 13
- -1 hydroquinone Chemical compound 0.000 description 10
- 150000002500 ions Chemical class 0.000 description 9
- 239000003208 petroleum Substances 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 125000005396 acrylic acid ester group Chemical group 0.000 description 6
- 150000001298 alcohols Chemical class 0.000 description 6
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 6
- 150000002989 phenols Chemical class 0.000 description 6
- 150000005846 sugar alcohols Polymers 0.000 description 6
- 229940113165 trimethylolpropane Drugs 0.000 description 6
- 125000001931 aliphatic group Chemical group 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 230000009257 reactivity Effects 0.000 description 5
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 4
- DAKWPKUUDNSNPN-UHFFFAOYSA-N Trimethylolpropane triacrylate Chemical compound C=CC(=O)OCC(CC)(COC(=O)C=C)COC(=O)C=C DAKWPKUUDNSNPN-UHFFFAOYSA-N 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- WJFKNYWRSNBZNX-UHFFFAOYSA-N 10H-phenothiazine Chemical compound C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 description 3
- ATVJXMYDOSMEPO-UHFFFAOYSA-N 3-prop-2-enoxyprop-1-ene Chemical compound C=CCOCC=C ATVJXMYDOSMEPO-UHFFFAOYSA-N 0.000 description 3
- 239000005749 Copper compound Substances 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 150000001880 copper compounds Chemical class 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 3
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 3
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 3
- 230000006641 stabilisation Effects 0.000 description 3
- 238000011105 stabilization Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- JHWGFJBTMHEZME-UHFFFAOYSA-N 4-prop-2-enoyloxybutyl prop-2-enoate Chemical compound C=CC(=O)OCCCCOC(=O)C=C JHWGFJBTMHEZME-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 2
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 238000003848 UV Light-Curing Methods 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 101150038956 cup-4 gene Proteins 0.000 description 2
- 125000004386 diacrylate group Chemical group 0.000 description 2
- 238000010894 electron beam technology Methods 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000000976 ink Substances 0.000 description 2
- 239000003456 ion exchange resin Substances 0.000 description 2
- 229920003303 ion-exchange polymer Polymers 0.000 description 2
- HVAMZGADVCBITI-UHFFFAOYSA-M pent-4-enoate Chemical compound [O-]C(=O)CCC=C HVAMZGADVCBITI-UHFFFAOYSA-M 0.000 description 2
- 229950000688 phenothiazine Drugs 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 229920005862 polyol Polymers 0.000 description 2
- 150000003077 polyols Chemical class 0.000 description 2
- 230000002028 premature Effects 0.000 description 2
- POSICDHOUBKJKP-UHFFFAOYSA-N prop-2-enoxybenzene Chemical compound C=CCOC1=CC=CC=C1 POSICDHOUBKJKP-UHFFFAOYSA-N 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 230000000087 stabilizing effect Effects 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 125000000542 sulfonic acid group Chemical group 0.000 description 2
- 238000004448 titration Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- MYWOJODOMFBVCB-UHFFFAOYSA-N 1,2,6-trimethylphenanthrene Chemical compound CC1=CC=C2C3=CC(C)=CC=C3C=CC2=C1C MYWOJODOMFBVCB-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- IBTLFDCPAJLATQ-UHFFFAOYSA-N 1-prop-2-enoxybutane Chemical compound CCCCOCC=C IBTLFDCPAJLATQ-UHFFFAOYSA-N 0.000 description 1
- NSRJCKNAJOEJMR-UHFFFAOYSA-N 1-prop-2-enoxydodecane Chemical compound CCCCCCCCCCCCOCC=C NSRJCKNAJOEJMR-UHFFFAOYSA-N 0.000 description 1
- KXZLHMICGMACLR-UHFFFAOYSA-N 2-(hydroxymethyl)-2-pentylpropane-1,3-diol Chemical compound CCCCCC(CO)(CO)CO KXZLHMICGMACLR-UHFFFAOYSA-N 0.000 description 1
- PTJWCLYPVFJWMP-UHFFFAOYSA-N 2-[[3-hydroxy-2-[[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]methyl]-2-(hydroxymethyl)propoxy]methyl]-2-(hydroxymethyl)propane-1,3-diol Chemical compound OCC(CO)(CO)COCC(CO)(CO)COCC(CO)(CO)CO PTJWCLYPVFJWMP-UHFFFAOYSA-N 0.000 description 1
- BYDRTKVGBRTTIT-UHFFFAOYSA-N 2-methylprop-2-en-1-ol Chemical compound CC(=C)CO BYDRTKVGBRTTIT-UHFFFAOYSA-N 0.000 description 1
- LECDNXOCIPRJNJ-UHFFFAOYSA-N 2-methylprop-2-enoxybenzene Chemical compound CC(=C)COC1=CC=CC=C1 LECDNXOCIPRJNJ-UHFFFAOYSA-N 0.000 description 1
- IVKYUXHYUAMPMT-UHFFFAOYSA-N 2-methylprop-2-enyl acetate Chemical compound CC(=C)COC(C)=O IVKYUXHYUAMPMT-UHFFFAOYSA-N 0.000 description 1
- JSDZSLGMRRSAHD-UHFFFAOYSA-N 3-methylbutan-2-ylcyclopropane Chemical compound CC(C)C(C)C1CC1 JSDZSLGMRRSAHD-UHFFFAOYSA-N 0.000 description 1
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- DOYTVCMYDUKCJY-UHFFFAOYSA-N CCCCO.OC(=O)C=C.OC(=O)C=C Chemical compound CCCCO.OC(=O)C=C.OC(=O)C=C DOYTVCMYDUKCJY-UHFFFAOYSA-N 0.000 description 1
- 239000004971 Cross linker Substances 0.000 description 1
- 241001448862 Croton Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 239000004641 Diallyl-phthalate Substances 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 1
- USBQRZMRUABNHR-NSCUHMNNSA-N [(e)-but-2-enoxy]benzene Chemical compound C\C=C\COC1=CC=CC=C1 USBQRZMRUABNHR-NSCUHMNNSA-N 0.000 description 1
- WNHXJHGRIHUOTG-ONEGZZNKSA-N [(e)-but-2-enyl] acetate Chemical compound C\C=C\COC(C)=O WNHXJHGRIHUOTG-ONEGZZNKSA-N 0.000 description 1
- ORLQHILJRHBSAY-UHFFFAOYSA-N [1-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1(CO)CCCCC1 ORLQHILJRHBSAY-UHFFFAOYSA-N 0.000 description 1
- TUOBEAZXHLTYLF-UHFFFAOYSA-N [2-(hydroxymethyl)-2-(prop-2-enoyloxymethyl)butyl] prop-2-enoate Chemical compound C=CC(=O)OCC(CO)(CC)COC(=O)C=C TUOBEAZXHLTYLF-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- JQRRFDWXQOQICD-UHFFFAOYSA-N biphenylen-1-ylboronic acid Chemical compound C12=CC=CC=C2C2=C1C=CC=C2B(O)O JQRRFDWXQOQICD-UHFFFAOYSA-N 0.000 description 1
- QUDWYFHPNIMBFC-UHFFFAOYSA-N bis(prop-2-enyl) benzene-1,2-dicarboxylate Chemical compound C=CCOC(=O)C1=CC=CC=C1C(=O)OCC=C QUDWYFHPNIMBFC-UHFFFAOYSA-N 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- ZTIOYMICVOVVHM-UHFFFAOYSA-N butane-1,1-diol;2-ethyl-2-(hydroxymethyl)propane-1,3-diol Chemical compound CCCC(O)O.CCC(CO)(CO)CO ZTIOYMICVOVVHM-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000001723 curing Methods 0.000 description 1
- MIHINWMALJZIBX-UHFFFAOYSA-N cyclohexa-2,4-dien-1-ol Chemical class OC1CC=CC=C1 MIHINWMALJZIBX-UHFFFAOYSA-N 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000001227 electron beam curing Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- PYGSKMBEVAICCR-UHFFFAOYSA-N hexa-1,5-diene Chemical group C=CCCC=C PYGSKMBEVAICCR-UHFFFAOYSA-N 0.000 description 1
- ACCCMOQWYVYDOT-UHFFFAOYSA-N hexane-1,1-diol Chemical compound CCCCCC(O)O ACCCMOQWYVYDOT-UHFFFAOYSA-N 0.000 description 1
- 229940051250 hexylene glycol Drugs 0.000 description 1
- SVTBMSDMJJWYQN-UHFFFAOYSA-N hexylene glycol Natural products CC(O)CC(C)(C)O SVTBMSDMJJWYQN-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 125000005397 methacrylic acid ester group Chemical group 0.000 description 1
- 125000005394 methallyl group Chemical group 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical class OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- CDXZRBLOGJXGTN-UHFFFAOYSA-N prop-2-enoxycyclohexane Chemical compound C=CCOC1CCCCC1 CDXZRBLOGJXGTN-UHFFFAOYSA-N 0.000 description 1
- HUGHWHMUUQNACD-UHFFFAOYSA-N prop-2-enoxymethylbenzene Chemical compound C=CCOCC1=CC=CC=C1 HUGHWHMUUQNACD-UHFFFAOYSA-N 0.000 description 1
- QTECDUFMBMSHKR-UHFFFAOYSA-N prop-2-enyl prop-2-enoate Chemical compound C=CCOC(=O)C=C QTECDUFMBMSHKR-UHFFFAOYSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 1
- QXJQHYBHAIHNGG-UHFFFAOYSA-N trimethylolethane Chemical compound OCC(C)(CO)CO QXJQHYBHAIHNGG-UHFFFAOYSA-N 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/52—Esters of acyclic unsaturated carboxylic acids having the esterified carboxyl group bound to an acyclic carbon atom
- C07C69/533—Monocarboxylic acid esters having only one carbon-to-carbon double bond
- C07C69/54—Acrylic acid esters; Methacrylic acid esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/48—Separation; Purification; Stabilisation; Use of additives
- C07C67/62—Use of additives, e.g. for stabilisation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2435509A DE2435509A1 (de) | 1974-07-24 | 1974-07-24 | Stabilisierte polyacrylsaeureester und verfahren zu ihrer herstellung |
| US05/597,168 US4059721A (en) | 1974-07-24 | 1975-07-18 | Stabilized acrylic acid esters of polyhydric alcohols and a process for their preparation |
| NL7508686A NL7508686A (nl) | 1974-07-24 | 1975-07-21 | Gestabiliseerde acrylzuuresters van meerwaardige alcoholen en een werkwijze voor de bereiding er- van. |
| JP50088917A JPS5136414A (en) | 1974-07-24 | 1975-07-22 | Anteikasareta akurirusanesuteru |
| AT565075A AT340377B (de) | 1974-07-24 | 1975-07-22 | Stabilisierte acrylsaureester mehrwertiger alkohole und verfahren zu ihrer herstellung |
| IT50607/75A IT1036932B (it) | 1974-07-24 | 1975-07-22 | Esteri acrilici di alcoli poliva lenti stabilizzati e procedimento per produrli |
| BE158476A BE831583A (fr) | 1974-07-24 | 1975-07-22 | Esters stabilises d'acide acrylique et d'alcools polyfonctionnels |
| GB3080475A GB1466552A (en) | 1974-07-24 | 1975-07-23 | Stabilised acrylic acid esters of polyhydric alcohols and a process for their preparation |
| CH962775A CH601168A5 (cg-RX-API-DMAC7.html) | 1974-07-24 | 1975-07-23 | |
| FR7523202A FR2279715A1 (fr) | 1974-07-24 | 1975-07-24 | Esters stabilises d'acide acrylique et d'alcools polyfonctionnels, et leur procede de preparation |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2435509A DE2435509A1 (de) | 1974-07-24 | 1974-07-24 | Stabilisierte polyacrylsaeureester und verfahren zu ihrer herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2435509A1 true DE2435509A1 (de) | 1976-02-05 |
Family
ID=5921341
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2435509A Withdrawn DE2435509A1 (de) | 1974-07-24 | 1974-07-24 | Stabilisierte polyacrylsaeureester und verfahren zu ihrer herstellung |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4059721A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5136414A (cg-RX-API-DMAC7.html) |
| AT (1) | AT340377B (cg-RX-API-DMAC7.html) |
| BE (1) | BE831583A (cg-RX-API-DMAC7.html) |
| CH (1) | CH601168A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2435509A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2279715A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1466552A (cg-RX-API-DMAC7.html) |
| IT (1) | IT1036932B (cg-RX-API-DMAC7.html) |
| NL (1) | NL7508686A (cg-RX-API-DMAC7.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10118232A1 (de) * | 2001-04-11 | 2002-10-24 | Roehm Gmbh | Herstellung von dihydroxyfunktionellen ((Meth)acrylsäureestern |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5847198B2 (ja) * | 1976-07-03 | 1983-10-20 | ジューキ株式会社 | 自動縫製機の制御装置 |
| JPS5453059A (en) * | 1977-10-04 | 1979-04-26 | Yaskawa Denki Seisakusho Kk | Sewing machine capable of automatically making pattern |
| JPS54115947A (en) * | 1978-02-28 | 1979-09-08 | Yaskawa Denki Seisakusho Kk | Sewing machine capable of automatically making combined pattern |
| DE2753087A1 (de) * | 1977-11-29 | 1979-05-31 | Zangs Ag Maschf | Einrichtung zur steuerung der rahmenbewegungen an stick- oder naehautomaten |
| JPS5854838B2 (ja) * | 1978-06-28 | 1983-12-06 | 蛇の目ミシン工業株式会社 | ししゆう装置付ミシンテ−ブル |
| DE2931553A1 (de) * | 1979-08-03 | 1981-02-26 | Basf Ag | Verfahren zur stabilisierung monomerer acrylsaeureester gegen vorzeitige polymerisation |
| JPS5975262U (ja) * | 1982-11-12 | 1984-05-22 | 三菱電機株式会社 | ミシンの布押え装置 |
| US4738870A (en) * | 1986-03-27 | 1988-04-19 | The Dow Chemical Company | Adherent photopolymerizable compositions |
| JPS6365893A (ja) * | 1987-04-17 | 1988-03-24 | 株式会社日立製作所 | 電動ミシンの制御方法 |
| US5130471A (en) * | 1991-09-06 | 1992-07-14 | Heiman John C | Stabilized acrylic monomer compositions |
| EP1042410A1 (en) | 1997-11-06 | 2000-10-11 | The Edgington Company | Coating composition |
| US10807063B1 (en) | 2019-12-31 | 2020-10-20 | Industrial Technology Research Institute | Device and method for continuously manufacturing acrylate compound |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3227628A (en) * | 1963-05-16 | 1966-01-04 | Union Carbide Corp | Stabilization of acrylic monomers |
-
1974
- 1974-07-24 DE DE2435509A patent/DE2435509A1/de not_active Withdrawn
-
1975
- 1975-07-18 US US05/597,168 patent/US4059721A/en not_active Expired - Lifetime
- 1975-07-21 NL NL7508686A patent/NL7508686A/xx not_active Application Discontinuation
- 1975-07-22 JP JP50088917A patent/JPS5136414A/ja active Pending
- 1975-07-22 BE BE158476A patent/BE831583A/xx unknown
- 1975-07-22 AT AT565075A patent/AT340377B/de not_active IP Right Cessation
- 1975-07-22 IT IT50607/75A patent/IT1036932B/it active
- 1975-07-23 CH CH962775A patent/CH601168A5/xx not_active IP Right Cessation
- 1975-07-23 GB GB3080475A patent/GB1466552A/en not_active Expired
- 1975-07-24 FR FR7523202A patent/FR2279715A1/fr active Granted
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10118232A1 (de) * | 2001-04-11 | 2002-10-24 | Roehm Gmbh | Herstellung von dihydroxyfunktionellen ((Meth)acrylsäureestern |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5136414A (en) | 1976-03-27 |
| FR2279715A1 (fr) | 1976-02-20 |
| ATA565075A (de) | 1977-04-15 |
| US4059721A (en) | 1977-11-22 |
| FR2279715B1 (cg-RX-API-DMAC7.html) | 1979-01-05 |
| IT1036932B (it) | 1979-10-30 |
| GB1466552A (en) | 1977-03-09 |
| NL7508686A (nl) | 1976-01-27 |
| CH601168A5 (cg-RX-API-DMAC7.html) | 1978-06-30 |
| AT340377B (de) | 1977-12-12 |
| BE831583A (fr) | 1976-01-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69434318T2 (de) | Organozinn katalysierte Transesterifizierung | |
| DE2435509A1 (de) | Stabilisierte polyacrylsaeureester und verfahren zu ihrer herstellung | |
| DE2432563A1 (de) | Verfahren zur herstellung von aryldialkoxymethylketonen | |
| DE2527005A1 (de) | Stabilisierte acrylsaeureester mehrwertiger alkohole und verfahren zu ihrer herstellung | |
| DE3225431C2 (de) | Verfahren zur Herstellung von makrocyclischen Esterverbindungen | |
| EP0376090A1 (de) | Verfahren zur verbesserten Herstellung von (Meth)acrylsäureestern mehrwertiger Alkohole (II) | |
| DE19940622C1 (de) | Verfahren zur Herstellung von Di(meth)acrylsäureestern | |
| EP0755949A1 (de) | Strahlungshärtbare Massen mit kovalent gebundenen Photoinitiatoren | |
| WO1997026293A1 (de) | Verfahren zur herstellung von polyglycol(meth)acrylaten | |
| WO2003042151A1 (de) | Verfahren zur herstellung von (meth) acrylsäureestern mehrwertiger alkohole | |
| DE1645379B2 (de) | Anaerob haertbare massen | |
| DE2913218A1 (de) | Verfahren zur herstellung von (meth)acrylsaeureestern | |
| WO1990007486A1 (de) | Verfahren zur verbesserten herstellung von (meth)acrylsäureestern mehrwertiger alkohole (i) | |
| DE2731085A1 (de) | Verfahren zur herstellung von olefinisch-ungesaettigten estern | |
| EP1063225A2 (de) | Verfahren zur Herstellung von (Meth)acrylsäureestern | |
| DE2559857C2 (de) | Quervernetzbares, wärmehärtbares Copolymer und Verfahren zu dessen Herstellung | |
| DE1745919C3 (de) | Verfahren zur Herstellung von Polyurethanen | |
| DE19543464A1 (de) | Verfahren zur Herstellung von (Meth)acrylsäureestern | |
| EP0874014A1 (de) | Verfahren zur Herstellung von Estern mit geringem Restsäuregehalt aus Alpha, Bêta-ethylenisch ungesättigten Carbonsäuren und Hydroxylgrupen-haltigen Polymerisaten | |
| DE19941136A1 (de) | Verfahren zur Herstellung von (Meth)acrylsäureestern | |
| DE2521859B2 (de) | Verfahren zur Herstellung von Aziridincarbonsäureestern | |
| DE2511807C3 (de) | Verfahren zur Herstellung von Estern mehrwertiger Alkohole und Monocarbonf ettsäuren mit 5 bis 9 Kohlenstoffatomen | |
| DE852302C (de) | Verfahren zur Herstellung von Polyalkoholen vom Allyltypus | |
| EP0317913A2 (de) | Neue Di(meth)acrylate, Verfahren zu deren Herstellung und deren Verwendung | |
| EP2054399A1 (de) | Verfahren zur herstellung oxetangruppenhaltiger (meth)acrylate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8130 | Withdrawal |