DE2424466A1 - Biaxial orientierte polyaethylen-2,6naphthalatfolien - Google Patents
Biaxial orientierte polyaethylen-2,6naphthalatfolienInfo
- Publication number
- DE2424466A1 DE2424466A1 DE2424466A DE2424466A DE2424466A1 DE 2424466 A1 DE2424466 A1 DE 2424466A1 DE 2424466 A DE2424466 A DE 2424466A DE 2424466 A DE2424466 A DE 2424466A DE 2424466 A1 DE2424466 A1 DE 2424466A1
- Authority
- DE
- Germany
- Prior art keywords
- longitudinal direction
- film
- young
- naphthalate
- modulus
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229920000642 polymer Polymers 0.000 claims description 33
- 238000000034 method Methods 0.000 claims description 12
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 claims description 11
- 239000011888 foil Substances 0.000 claims description 11
- 230000007704 transition Effects 0.000 claims description 9
- -1 polyethylene Polymers 0.000 claims description 7
- 230000015572 biosynthetic process Effects 0.000 claims description 6
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 3
- 239000005977 Ethylene Substances 0.000 claims description 3
- 239000004698 Polyethylene Substances 0.000 claims 3
- 229920000573 polyethylene Polymers 0.000 claims 3
- 125000005487 naphthalate group Chemical group 0.000 claims 2
- 238000010438 heat treatment Methods 0.000 description 5
- 230000000704 physical effect Effects 0.000 description 5
- 230000000052 comparative effect Effects 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 229920000139 polyethylene terephthalate Polymers 0.000 description 4
- 239000005020 polyethylene terephthalate Substances 0.000 description 4
- 238000006116 polymerization reaction Methods 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 238000001125 extrusion Methods 0.000 description 3
- 230000002349 favourable effect Effects 0.000 description 3
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 3
- 238000011282 treatment Methods 0.000 description 3
- GMOYUTKNPLBTMT-UHFFFAOYSA-N 2-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=CC=CC=C1OCC1=CC=CC=C1 GMOYUTKNPLBTMT-UHFFFAOYSA-N 0.000 description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 238000009998 heat setting Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000003607 modifier Substances 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- QLIQIXIBZLTPGQ-UHFFFAOYSA-N 4-(2-hydroxyethoxy)benzoic acid Chemical compound OCCOC1=CC=C(C(O)=O)C=C1 QLIQIXIBZLTPGQ-UHFFFAOYSA-N 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000002390 adhesive tape Substances 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910001570 bauxite Inorganic materials 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000007596 consolidation process Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 229920005684 linear copolymer Polymers 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- RXOHFPCZGPKIRD-UHFFFAOYSA-N naphthalene-2,6-dicarboxylic acid Chemical compound C1=C(C(O)=O)C=CC2=CC(C(=O)O)=CC=C21 RXOHFPCZGPKIRD-UHFFFAOYSA-N 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B5/00—Recording by magnetisation or demagnetisation of a record carrier; Reproducing by magnetic means; Record carriers therefor
- G11B5/62—Record carriers characterised by the selection of the material
- G11B5/73—Base layers, i.e. all non-magnetic layers lying under a lowermost magnetic recording layer, e.g. including any non-magnetic layer in between a first magnetic recording layer and either an underlying substrate or a soft magnetic underlayer
- G11B5/739—Magnetic recording media substrates
- G11B5/73923—Organic polymer substrates
- G11B5/73927—Polyester substrates, e.g. polyethylene terephthalate
- G11B5/73929—Polyester substrates, e.g. polyethylene terephthalate comprising naphthalene ring compounds, e.g. polyethylene naphthalate substrates
Landscapes
- Manufacture Of Macromolecular Shaped Articles (AREA)
- Magnetic Record Carriers (AREA)
- Shaping By String And By Release Of Stress In Plastics And The Like (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP49006016A JPS50102303A (enrdf_load_stackoverflow) | 1974-01-11 | 1974-01-11 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2424466A1 true DE2424466A1 (de) | 1975-07-31 |
Family
ID=11626892
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2424466A Pending DE2424466A1 (de) | 1974-01-11 | 1974-05-20 | Biaxial orientierte polyaethylen-2,6naphthalatfolien |
Country Status (5)
| Country | Link |
|---|---|
| JP (1) | JPS50102303A (enrdf_load_stackoverflow) |
| BE (1) | BE815395A (enrdf_load_stackoverflow) |
| DE (1) | DE2424466A1 (enrdf_load_stackoverflow) |
| FR (1) | FR2257403A1 (enrdf_load_stackoverflow) |
| NL (1) | NL7406918A (enrdf_load_stackoverflow) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3401625A1 (de) * | 1983-01-18 | 1984-10-04 | Diafoil Co. Ltd., Tokio/Tokyo | Polyesterfolie fuer magnetische aufzeichnungsmedien und verfahren zu ihrer herstellung |
| DE3525170A1 (de) * | 1984-07-17 | 1986-02-20 | TDK Corporation, Tokio/Tokyo | Magnetischer aufzeichnungstraeger |
| EP0226162A1 (en) * | 1985-12-09 | 1987-06-24 | Diafoil Company, Limited | Polyethylene-2,6-naphthalate film for magnetic recording tapes |
| EP0381213A3 (en) * | 1989-02-01 | 1992-11-04 | Teijin Limited | Biaxially oriented film of polyethylene-2,6-naphthalate |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH0628098B2 (ja) * | 1985-07-23 | 1994-04-13 | 帝人株式会社 | 磁気記録用テ−プ |
| JPS62113529A (ja) * | 1985-11-13 | 1987-05-25 | Diafoil Co Ltd | ポリエチレンナフタレ−トフイルム |
| JPS62219317A (ja) * | 1986-03-20 | 1987-09-26 | Sony Corp | 金属薄膜型磁気記録媒体 |
| US4835214A (en) * | 1987-11-23 | 1989-05-30 | Eastman Kodak Company | Polymer blends useful for hot fillable containers having improved gas barrier properties |
| JPH0677472U (ja) * | 1991-07-08 | 1994-10-28 | ジェコー株式会社 | ブラシホルダの保持構造 |
-
1974
- 1974-01-11 JP JP49006016A patent/JPS50102303A/ja active Pending
- 1974-05-20 DE DE2424466A patent/DE2424466A1/de active Pending
- 1974-05-22 BE BE144622A patent/BE815395A/xx unknown
- 1974-05-22 NL NL7406918A patent/NL7406918A/xx unknown
- 1974-05-22 FR FR7417818A patent/FR2257403A1/fr active Granted
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3401625A1 (de) * | 1983-01-18 | 1984-10-04 | Diafoil Co. Ltd., Tokio/Tokyo | Polyesterfolie fuer magnetische aufzeichnungsmedien und verfahren zu ihrer herstellung |
| DE3525170A1 (de) * | 1984-07-17 | 1986-02-20 | TDK Corporation, Tokio/Tokyo | Magnetischer aufzeichnungstraeger |
| EP0226162A1 (en) * | 1985-12-09 | 1987-06-24 | Diafoil Company, Limited | Polyethylene-2,6-naphthalate film for magnetic recording tapes |
| EP0381213A3 (en) * | 1989-02-01 | 1992-11-04 | Teijin Limited | Biaxially oriented film of polyethylene-2,6-naphthalate |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2257403B1 (enrdf_load_stackoverflow) | 1976-12-24 |
| JPS50102303A (enrdf_load_stackoverflow) | 1975-08-13 |
| BE815395A (fr) | 1974-09-16 |
| NL7406918A (nl) | 1975-07-15 |
| FR2257403A1 (en) | 1975-08-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69022499T2 (de) | Heissiegelbarer laminierter Polyesterfilm. | |
| DE60007789T2 (de) | Folie aus Polymilchsäure | |
| EP0849075B1 (de) | Siegelfähige biaxial orientierte Polyesterfolie, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE69522546T3 (de) | Biaxial-orientierte Polyamidfolie | |
| EP1344790A1 (de) | Biaxial orientierte Folie mit verbesserter Oberflächenqualität auf Basis von kristallisierbaren Polyestern und Verfahren zur Herstellung der Folie | |
| EP1385700B1 (de) | Pla-folie mit guten antistatischen eigenschaften | |
| DE2424466A1 (de) | Biaxial orientierte polyaethylen-2,6naphthalatfolien | |
| DE60219512T2 (de) | Wärmeschrumfbare polyesterfolie | |
| DE2320118C3 (de) | Verfahren zum Herstellen einer biaxial orientierten Folie aus Polyäthylenterephthalat | |
| EP1421142B1 (de) | Biologisch abbaubare biaxial verstreckte folie mit kontrolliertem weiterreissverhalten | |
| EP0193844A2 (de) | Biaxial orientierte Folie mit hoher Kratz- und Abriebfestigkeit | |
| DE102008046780A1 (de) | Siegelfähige Polyesterfolie | |
| DE2416712C3 (de) | Biaxial gereckte Polyester-Folie | |
| DE3146358C2 (de) | Blockcopolyester-Formmasse | |
| DE2350637A1 (de) | Polyesterfilme mit ueberlegener witterungsbestaendigkeit und waermebestaendigkeit sowie verfahren zu deren herstellung | |
| DE69321777T2 (de) | Verfahren zur Herstellung einer Polyesterfolie | |
| EP0000386B1 (de) | Biaxial gestreckte Polyesterfolie. | |
| DE2350159A1 (de) | Einachsig gereckte filme bzw. folien und verfahren zu ihrer herstellung | |
| DE2336228A1 (de) | Biaxial orientierte polyaethylenterephthalatfolie und verfahren zu ihrer herstellung | |
| DE2602032C2 (enrdf_load_stackoverflow) | ||
| DE69225855T2 (de) | Polyesterharz und seine Verwendung | |
| DE2418929C3 (de) | Verfahren zum Herstellen einer biaxial orientierten Folienbahn aus Polyester | |
| DE2163963C3 (de) | Verfahren zur Herstellung eines biaxial orientierten und wärmenachbehandelten, elektrisch isolierenden Filmes aus Polyäthylen-2,6-naphthalat | |
| DE1629593B2 (de) | Verfahren zur herstellung einer polyaethylenterephthalatfolie | |
| DE2029038C3 (de) | Verfahren beim Herstellen einer biaxial orientierten Polyäthylen-2,6-Naphthalatfolie |