DE2409191C3 - Photoelektrisches Sichtgerät - Google Patents
Photoelektrisches SichtgerätInfo
- Publication number
- DE2409191C3 DE2409191C3 DE2409191A DE2409191A DE2409191C3 DE 2409191 C3 DE2409191 C3 DE 2409191C3 DE 2409191 A DE2409191 A DE 2409191A DE 2409191 A DE2409191 A DE 2409191A DE 2409191 C3 DE2409191 C3 DE 2409191C3
- Authority
- DE
- Germany
- Prior art keywords
- week
- days
- letters
- display
- displayed
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000000007 visual effect Effects 0.000 claims description 37
- 230000003287 optical effect Effects 0.000 claims 2
- 230000005540 biological transmission Effects 0.000 claims 1
- 239000004973 liquid crystal related substance Substances 0.000 description 7
- 210000000707 wrist Anatomy 0.000 description 4
- CXENHBSYCFFKJS-OXYODPPFSA-N (Z,E)-alpha-farnesene Chemical compound CC(C)=CCC\C(C)=C\C\C=C(\C)C=C CXENHBSYCFFKJS-OXYODPPFSA-N 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 210000001072 colon Anatomy 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- WABPQHHGFIMREM-UHFFFAOYSA-N lead(0) Chemical compound [Pb] WABPQHHGFIMREM-UHFFFAOYSA-N 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
Classifications
-
- G—PHYSICS
- G04—HOROLOGY
- G04G—ELECTRONIC TIME-PIECES
- G04G9/00—Visual time or date indication means
- G04G9/08—Visual time or date indication means by building-up characters using a combination of indicating elements, e.g. by using multiplexing techniques
- G04G9/085—Visual time or date indication means by building-up characters using a combination of indicating elements, e.g. by using multiplexing techniques provided with date indication
-
- G—PHYSICS
- G09—EDUCATION; CRYPTOGRAPHY; DISPLAY; ADVERTISING; SEALS
- G09F—DISPLAYING; ADVERTISING; SIGNS; LABELS OR NAME-PLATES; SEALS
- G09F9/00—Indicating arrangements for variable information in which the information is built-up on a support by selection or combination of individual elements
- G09F9/30—Indicating arrangements for variable information in which the information is built-up on a support by selection or combination of individual elements in which the desired character or characters are formed by combining individual elements
- G09F9/302—Indicating arrangements for variable information in which the information is built-up on a support by selection or combination of individual elements in which the desired character or characters are formed by combining individual elements characterised by the form or geometrical disposition of the individual elements
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Engineering & Computer Science (AREA)
- Theoretical Computer Science (AREA)
- Electric Clocks (AREA)
- Cathode-Ray Tubes And Fluorescent Screens For Display (AREA)
- Gas-Filled Discharge Tubes (AREA)
- Devices For Indicating Variable Information By Combining Individual Elements (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP6843873A JPS5616431B2 (enExample) | 1973-06-18 | 1973-06-18 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2409191A1 DE2409191A1 (de) | 1975-01-09 |
| DE2409191B2 DE2409191B2 (de) | 1980-03-06 |
| DE2409191C3 true DE2409191C3 (de) | 1980-10-16 |
Family
ID=13373698
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2409191A Expired DE2409191C3 (de) | 1973-06-18 | 1974-02-26 | Photoelektrisches Sichtgerät |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3971012A (enExample) |
| JP (1) | JPS5616431B2 (enExample) |
| CH (1) | CH302674A4 (enExample) |
| DE (1) | DE2409191C3 (enExample) |
| FR (1) | FR2233672B1 (enExample) |
| IT (1) | IT1005649B (enExample) |
Families Citing this family (55)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5120878A (enExample) * | 1974-08-10 | 1976-02-19 | Casio Computer Co Ltd | |
| JPS5128975U (enExample) * | 1974-08-23 | 1976-03-02 | ||
| CH1283674A4 (enExample) * | 1974-09-23 | 1977-02-28 | ||
| US4196582A (en) * | 1975-01-06 | 1980-04-08 | Ebauches S.A. | Control device for an electronic watch |
| GB1512342A (en) * | 1975-02-20 | 1978-06-01 | Omron Tateisi Electronics Co | Apparatus for displaying numerical value information |
| US4040048A (en) * | 1975-03-10 | 1977-08-02 | Lien Ming T | Display of mathematical equations |
| JPS5221861A (en) * | 1975-08-11 | 1977-02-18 | Seiko Instr & Electronics Ltd | Digital liquid-clystal electronic watch |
| JPS5238258A (en) * | 1975-09-22 | 1977-03-24 | Seiko Instr & Electronics Ltd | Digital electronic watch |
| USD246069S (en) | 1976-03-25 | 1977-10-11 | Westinghouse Electric Corporation | Font of characters |
| JPS5847036B2 (ja) * | 1976-07-07 | 1983-10-20 | シャープ株式会社 | 電子時計 |
| US4163230A (en) * | 1976-07-14 | 1979-07-31 | Citizen Watch Co. Ltd. | Display device for electronic timepieces |
| US4092638A (en) * | 1977-03-11 | 1978-05-30 | Textron Inc. | Display device employing special purpose monograms |
| DE2813478C2 (de) * | 1977-03-30 | 1982-03-11 | Casio Computer Co., Ltd., Tokyo | Elektronische Anzeigevorrichtung |
| DE2739817A1 (de) * | 1977-07-15 | 1979-01-25 | Bbc Brown Boveri & Cie | Anzeigevorrichtung |
| USD250675S (en) | 1977-07-25 | 1978-12-26 | Donovan James M | Video display unit |
| US4264966A (en) * | 1977-12-16 | 1981-04-28 | Terzian Berj A | Balanced digital time displays |
| US4270196A (en) * | 1977-12-16 | 1981-05-26 | Terzian Berj A | Balanced complementary digital time displays |
| US4194352A (en) * | 1977-12-16 | 1980-03-25 | Terzian Berj A | Compact, multi-functional digital time displays |
| USD255337S (en) | 1978-05-08 | 1980-06-10 | Timex Corporation | Electro-optic digital display for a timepiece |
| AU499808B1 (en) * | 1978-05-18 | 1979-05-03 | Ypsilantis, John | Alphanumeric display |
| USD262294S (en) | 1979-06-06 | 1981-12-15 | Xerox Corporation | Font of characters |
| US4483628A (en) * | 1979-06-29 | 1984-11-20 | Terzian Beri A | Balanced chronograph digital time display |
| US4394651A (en) * | 1980-06-09 | 1983-07-19 | Michael Frankston | Eastern Arabic number display |
| USD280419S (en) | 1982-07-09 | 1985-09-03 | Landis Harry M | Roman numeral electro-optical display |
| USD281788S (en) | 1983-08-15 | 1985-12-17 | General Motors Corporation | Alphabet font |
| DE3341439A1 (de) * | 1983-11-17 | 1985-05-30 | Diehl GmbH & Co, 8500 Nürnberg | Schaltungsanordnung fuer eine mehrstellige zahlen-anzeige |
| JPS60108881A (ja) * | 1983-11-17 | 1985-06-14 | シャープ株式会社 | 表示素子 |
| DE3345364A1 (de) * | 1983-12-15 | 1985-06-27 | Licentia Patent-Verwaltungs-Gmbh, 6000 Frankfurt | Anzeigetafel mit mehreren anzeigeeinheiten |
| USD289621S (en) | 1984-07-20 | 1987-05-05 | Canon Kabushiki Kaisha | Date and time display board |
| US4603495A (en) * | 1984-09-19 | 1986-08-05 | Stevens John K | Alphanumeric display modules |
| JPS6273128A (ja) * | 1985-09-27 | 1987-04-03 | Sharp Corp | 電子体温計 |
| USD297648S (en) | 1985-12-27 | 1988-09-13 | Telegenix, Inc. | Basic character for font of electroluminescent characters |
| US4877405A (en) * | 1986-09-24 | 1989-10-31 | Stewart Mark R | System of modules for composing alphanumerics |
| DE69001157T2 (de) * | 1989-02-07 | 1993-10-07 | Sonceboz Ebauches Fab | Datum-anzeigevorrichtung, insbesondere für elektronische uhren. |
| WO1992006464A1 (en) * | 1990-10-01 | 1992-04-16 | Motorola, Inc. | Liquid crystal display |
| JP2722824B2 (ja) * | 1991-01-30 | 1998-03-09 | 日本電気株式会社 | 曜日・時刻の表示方式 |
| ES2113319B1 (es) * | 1996-05-24 | 1999-02-01 | Rubio Jose Barber | Reloj electronico de cuarzo, alfabetico. |
| USD390799S (en) | 1997-02-10 | 1998-02-17 | Lux Products Corporation | Timer display |
| US6286991B1 (en) * | 2000-01-12 | 2001-09-11 | Equitime, Inc. | Crown control for enhanced quadribalanced digital time displays |
| US6563764B2 (en) * | 2001-01-05 | 2003-05-13 | Equitime, Inc. | Facilitated setting/resetting of digital date displays |
| US6724355B2 (en) * | 2002-02-26 | 2004-04-20 | Charles P. Resor | Electronically actuated display array for displaying arithmetic operation symbols |
| US7693009B2 (en) * | 2007-10-24 | 2010-04-06 | Buss Scott A | Method and apparatus for displaying time on a display panel |
| KR100934025B1 (ko) * | 2008-09-17 | 2009-12-28 | 주식회사 성음악기 | 디스플레이장치 |
| USD607008S1 (en) * | 2008-12-11 | 2009-12-29 | Microsoft Corporation | Icon for a portion of a display screen |
| USD628584S1 (en) * | 2009-02-11 | 2010-12-07 | Ricoh Company, Ltd. | Display screen with icon |
| USD649557S1 (en) * | 2009-07-21 | 2011-11-29 | Somfy Sas | Display screen with user interface icons |
| USD687047S1 (en) * | 2011-08-16 | 2013-07-30 | Nest Labs, Inc. | Display screen with an animated graphical user interface |
| USD687045S1 (en) * | 2011-08-16 | 2013-07-30 | Nest Labs, Inc. | Display screen with a graphical user interface |
| USD813949S1 (en) * | 2012-03-30 | 2018-03-27 | Andy K. F. Kaoh | Sign with segmented indicators |
| USD896891S1 (en) | 2012-03-30 | 2020-09-22 | Andy K. F. Kaoh | Lottery sign face |
| EP2887161B1 (fr) * | 2013-12-23 | 2021-08-04 | ETA SA Manufacture Horlogère Suisse | Affichage digital comprenant un agencement d'électrodes |
| USD904510S1 (en) * | 2019-01-14 | 2020-12-08 | Adp, Llc | Typeface |
| USD904509S1 (en) * | 2019-01-14 | 2020-12-08 | Adp, Llc | Typeface |
| USD904508S1 (en) * | 2019-01-14 | 2020-12-08 | Adp, Llc | Typeface |
| US11739965B2 (en) * | 2019-12-02 | 2023-08-29 | Johnson Controls Tyco IP Holdings LLP | Thermostat with segmented display |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2735038A (en) * | 1956-02-14 | Read-out tube | ||
| US1168084A (en) * | 1914-10-17 | 1916-01-11 | Hugh S Hill | Illuminated sign. |
| US1965874A (en) * | 1931-10-01 | 1934-07-10 | Edgar C Appold | Illuminating device |
| CH567299A (enExample) * | 1969-10-21 | 1975-09-30 | ||
| US3678678A (en) * | 1970-04-02 | 1972-07-25 | Alfonso O Macedo | Reminder clock |
| US3738099A (en) * | 1972-06-07 | 1973-06-12 | Seiko Instr & Electronics | Digital electronic watch having calendar display arrangement |
-
1973
- 1973-06-18 JP JP6843873A patent/JPS5616431B2/ja not_active Expired
-
1974
- 1974-02-25 US US05/445,625 patent/US3971012A/en not_active Expired - Lifetime
- 1974-02-26 DE DE2409191A patent/DE2409191C3/de not_active Expired
- 1974-03-04 CH CH302674D patent/CH302674A4/de unknown
- 1974-03-13 IT IT12549/74A patent/IT1005649B/it active
- 1974-03-22 FR FR7409865A patent/FR2233672B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IT1005649B (it) | 1976-09-30 |
| JPS5017996A (enExample) | 1975-02-25 |
| JPS5616431B2 (enExample) | 1981-04-16 |
| FR2233672A1 (enExample) | 1975-01-10 |
| FR2233672B1 (enExample) | 1977-03-04 |
| US3971012A (en) | 1976-07-20 |
| DE2409191A1 (de) | 1975-01-09 |
| DE2409191B2 (de) | 1980-03-06 |
| CH302674A4 (de) | 1976-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2409191C3 (de) | Photoelektrisches Sichtgerät | |
| DE2413516C2 (de) | Digital-Anzeigevorrichtung | |
| DE2050067B2 (de) | Digitalanzeigende elektronische Uhr | |
| WO2000072095A2 (de) | Uhr | |
| DE7522348U (de) | Elektro-optische anzeigevorrichtung | |
| DE2741612C3 (de) | Elektrooptische Anzeigeeinrichtung zur wahlweisen Digitalanzeige der Tageszeit in Stunden und Minuten oder des Wochentages und der Datumszahl | |
| DE2606946A1 (de) | Anzeigevorrichtung fuer numerische information | |
| EP0341443A1 (de) | Elektronische Digital-Zeituhr | |
| DE2312742C3 (de) | Elektronische Uhr | |
| DE2265339C3 (de) | Elektronische Digitaluhr | |
| DE3020415C2 (de) | Elektronische Uhr | |
| DE2820896A1 (de) | Mehrfarben-anzeigevorrichtung | |
| DE2153637B2 (de) | Anzeigeeinrichtung für eine elektronisch gesteuerte Uhr mit elektro-optischen Anzeigeelementen | |
| DE2339482C3 (de) | Anzeigevorrichtung | |
| DE2739817A1 (de) | Anzeigevorrichtung | |
| EP0110112B1 (de) | Digitalanzeigende elektronische Uhr | |
| DE2919563C3 (de) | Verfahren und Einrichtung zur quasianalogen Zeitanzeige | |
| DE3039450A1 (de) | Vorrichtung zum hinterleuchten grossflaechiger anzeigetafeln | |
| DE2854254B2 (de) | Verfahren und Anordnung zur digitalen Zeitanzeige | |
| DE2338287C3 (de) | Schaltung zur Helligkeitssteuerung der Anzeigeeinheiten einer Digitaluhr | |
| DE2140536A1 (de) | Zeiger und ziffernloses Zeitan zeigegerat | |
| DE3313353C1 (de) | Anzeigetafel | |
| DE1764969A1 (de) | Roehren zum Anzeigen alphanumerischer Zeichen und mit solchen Roehren ausgeruestete Leseschaltungen | |
| DE527484C (de) | Einrichtung zur Bildzerlegung bzw. Bildzusammensetzung fuer die Zwecke des Fernsehens | |
| DE2641779C2 (de) | Elektronische Uhr mit Analoganzeige |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: REINLAENDER, C., DIPL.-ING. DR.-ING., PAT.-ANW., 8000 MUENCHEN |
|
| 8339 | Ceased/non-payment of the annual fee |