DE2408572A1 - Hochdruckquecksilberdampfentladungslampe - Google Patents
HochdruckquecksilberdampfentladungslampeInfo
- Publication number
- DE2408572A1 DE2408572A1 DE19742408572 DE2408572A DE2408572A1 DE 2408572 A1 DE2408572 A1 DE 2408572A1 DE 19742408572 DE19742408572 DE 19742408572 DE 2408572 A DE2408572 A DE 2408572A DE 2408572 A1 DE2408572 A1 DE 2408572A1
- Authority
- DE
- Germany
- Prior art keywords
- tin
- lithium
- halide
- pressure mercury
- discharge vessel
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 title claims description 27
- -1 lithium halide Chemical class 0.000 claims description 51
- 230000005855 radiation Effects 0.000 claims description 29
- 229910052744 lithium Inorganic materials 0.000 claims description 26
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 claims description 20
- 229910052708 sodium Inorganic materials 0.000 claims description 18
- 239000011734 sodium Substances 0.000 claims description 18
- 229910052753 mercury Inorganic materials 0.000 claims description 16
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 11
- QPBYLOWPSRZOFX-UHFFFAOYSA-J tin(iv) iodide Chemical compound I[Sn](I)(I)I QPBYLOWPSRZOFX-UHFFFAOYSA-J 0.000 claims description 11
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 10
- 150000004820 halides Chemical class 0.000 claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 150000002367 halogens Chemical class 0.000 claims description 8
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 claims description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 5
- OAAKZKGKPMPJIF-UHFFFAOYSA-N [Cl].[I] Chemical compound [Cl].[I] OAAKZKGKPMPJIF-UHFFFAOYSA-N 0.000 claims description 5
- 229910052756 noble gas Inorganic materials 0.000 claims description 5
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 claims description 4
- KURZCZMGELAPSV-UHFFFAOYSA-N [Br].[I] Chemical compound [Br].[I] KURZCZMGELAPSV-UHFFFAOYSA-N 0.000 claims description 4
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 claims description 4
- 238000004040 coloring Methods 0.000 claims description 2
- 239000000344 soap Substances 0.000 claims 1
- 238000009877 rendering Methods 0.000 description 10
- 230000003595 spectral effect Effects 0.000 description 7
- 238000001228 spectrum Methods 0.000 description 6
- LTSUHJWLSNQKIP-UHFFFAOYSA-J tin(iv) bromide Chemical compound Br[Sn](Br)(Br)Br LTSUHJWLSNQKIP-UHFFFAOYSA-J 0.000 description 5
- 238000005259 measurement Methods 0.000 description 4
- 229910001507 metal halide Inorganic materials 0.000 description 3
- 150000005309 metal halides Chemical class 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical group [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 2
- 238000000295 emission spectrum Methods 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Chemical compound [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 150000002835 noble gases Chemical class 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- CMJCEVKJYRZMIA-UHFFFAOYSA-M thallium(i) iodide Chemical compound [Tl]I CMJCEVKJYRZMIA-UHFFFAOYSA-M 0.000 description 1
- YUOWTJMRMWQJDA-UHFFFAOYSA-J tin(iv) fluoride Chemical compound [F-].[F-].[F-].[F-].[Sn+4] YUOWTJMRMWQJDA-UHFFFAOYSA-J 0.000 description 1
- RMUKCGUDVKEQPL-UHFFFAOYSA-K triiodoindigane Chemical compound I[In](I)I RMUKCGUDVKEQPL-UHFFFAOYSA-K 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
- H01J61/18—Selection of substances for gas fillings; Specified operating pressure or temperature having a metallic vapour as the principal constituent
Landscapes
- Discharge Lamp (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL7303079A NL7303079A (enExample) | 1973-03-06 | 1973-03-06 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2408572A1 true DE2408572A1 (de) | 1974-09-12 |
Family
ID=19818379
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742408572 Pending DE2408572A1 (de) | 1973-03-06 | 1974-02-22 | Hochdruckquecksilberdampfentladungslampe |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3958145A (enExample) |
| JP (1) | JPS49119483A (enExample) |
| AR (1) | AR201849A1 (enExample) |
| AT (1) | AT333890B (enExample) |
| BE (1) | BE811850A (enExample) |
| BR (1) | BR7401558D0 (enExample) |
| CA (1) | CA993031A (enExample) |
| CH (1) | CH607325A5 (enExample) |
| DE (1) | DE2408572A1 (enExample) |
| ES (1) | ES423866A1 (enExample) |
| FR (1) | FR2220874B1 (enExample) |
| GB (1) | GB1427867A (enExample) |
| NL (1) | NL7303079A (enExample) |
| SE (1) | SE386009B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2605290A1 (de) * | 1975-02-13 | 1976-08-26 | Thorn Electrical Ind Ltd | Elektrische entladungslampe |
| DE2655167A1 (de) * | 1976-12-06 | 1978-06-08 | Patra Patent Treuhand | Hochdruckentladungslampe mit metallhalogeniden |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4135110A (en) * | 1975-02-13 | 1979-01-16 | Thorn Electrical Industries Limited | Electrical discharge lamp |
| NL7712058A (nl) * | 1977-11-02 | 1979-05-04 | Philips Nv | Lagedrukkwikdampontladingslamp. |
| US4298813A (en) * | 1978-10-23 | 1981-11-03 | General Electric Company | High intensity discharge lamps with uniform color |
| NL7901480A (nl) * | 1979-02-26 | 1980-08-28 | Philips Nv | Hogedrukkwikdampontladingslamp. |
| US4591759A (en) * | 1984-09-10 | 1986-05-27 | General Electric Company | Ingredients for solenoidal metal halide arc lamps |
| US4705987A (en) * | 1985-10-03 | 1987-11-10 | The United States Of America As Represented By The United States Department Of Energy | Very high efficacy electrodeless high intensity discharge lamps |
| JPH03152852A (ja) * | 1989-11-08 | 1991-06-28 | Matsushita Electric Works Ltd | 高輝度放電ランプ及び無電極放電灯装置 |
| JP2948200B1 (ja) * | 1998-04-08 | 1999-09-13 | ウシオ電機株式会社 | 高圧水銀ランプ |
| JP2001332215A (ja) * | 2000-05-19 | 2001-11-30 | Ushio Inc | 光線力学治療及び光線力学診断用ランプ |
| DE10242049A1 (de) * | 2002-09-11 | 2004-03-25 | Philips Intellectual Property & Standards Gmbh | Niederdruckgasentladungslampe mit zinnhaltiger Gasfüllung |
| US20060178075A1 (en) * | 2005-01-18 | 2006-08-10 | Musco Corporation | Altering chemicals and removing white oxide coating on high-intensity arc lamp for better performance |
| WO2006078831A2 (en) * | 2005-01-18 | 2006-07-27 | Musco Corporation | Altering chemicals and removing white oxide coating on high- intensity arc lamp for better performance |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3234421A (en) * | 1961-01-23 | 1966-02-08 | Gen Electric | Metallic halide electric discharge lamps |
| US3279877A (en) * | 1963-12-31 | 1966-10-18 | Westinghouse Electric Corp | Method for processing high-pressure vapor-discharge arc tube |
| US3431447A (en) * | 1966-02-16 | 1969-03-04 | Westinghouse Electric Corp | High-pressure metallic vapor discharge lamp including mercury and thallium iodide |
| US3566178A (en) * | 1968-12-11 | 1971-02-23 | Tokyo Shibaura Electric Co | High pressure discharge lamp containing an inert gas,mercury,a halogen and tin |
| US3586898A (en) * | 1969-05-19 | 1971-06-22 | Gen Electric | Aluminum chloride discharge lamp |
| NL6909891A (enExample) * | 1969-06-27 | 1970-12-29 | ||
| US3781586A (en) * | 1972-12-04 | 1973-12-25 | Gen Electric | Long lifetime mercury-metal halide discharge lamps |
-
1973
- 1973-03-06 NL NL7303079A patent/NL7303079A/xx unknown
-
1974
- 1974-02-14 US US05/442,654 patent/US3958145A/en not_active Expired - Lifetime
- 1974-02-20 AR AR252446A patent/AR201849A1/es active
- 1974-02-22 DE DE19742408572 patent/DE2408572A1/de active Pending
- 1974-02-25 GB GB837974A patent/GB1427867A/en not_active Expired
- 1974-02-28 CA CA193,744A patent/CA993031A/en not_active Expired
- 1974-03-01 CH CH294974A patent/CH607325A5/xx not_active IP Right Cessation
- 1974-03-02 JP JP49024724A patent/JPS49119483A/ja active Pending
- 1974-03-04 SE SE7402815A patent/SE386009B/xx unknown
- 1974-03-04 BE BE141627A patent/BE811850A/xx not_active IP Right Cessation
- 1974-03-04 ES ES423866A patent/ES423866A1/es not_active Expired
- 1974-03-04 FR FR7407216A patent/FR2220874B1/fr not_active Expired
- 1974-03-04 AT AT176074A patent/AT333890B/de not_active IP Right Cessation
- 1974-03-04 BR BR1558/74A patent/BR7401558D0/pt unknown
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2605290A1 (de) * | 1975-02-13 | 1976-08-26 | Thorn Electrical Ind Ltd | Elektrische entladungslampe |
| DE2655167A1 (de) * | 1976-12-06 | 1978-06-08 | Patra Patent Treuhand | Hochdruckentladungslampe mit metallhalogeniden |
Also Published As
| Publication number | Publication date |
|---|---|
| AU6624674A (en) | 1975-09-04 |
| CH607325A5 (enExample) | 1978-12-15 |
| BE811850A (fr) | 1974-09-04 |
| CA993031A (en) | 1976-07-13 |
| JPS49119483A (enExample) | 1974-11-14 |
| AT333890B (de) | 1976-12-10 |
| US3958145A (en) | 1976-05-18 |
| ES423866A1 (es) | 1976-05-01 |
| AR201849A1 (es) | 1975-04-24 |
| BR7401558D0 (pt) | 1974-11-05 |
| GB1427867A (en) | 1976-03-10 |
| ATA176074A (de) | 1976-04-15 |
| NL7303079A (enExample) | 1974-09-10 |
| SE386009B (sv) | 1976-07-26 |
| FR2220874A1 (enExample) | 1974-10-04 |
| FR2220874B1 (enExample) | 1976-12-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2455277C2 (de) | Hochdruck-Zinnhalogenidentladungslampe | |
| DE2655167C2 (de) | Hochdruckentladungslampe mit Metallhalogeniden | |
| DE1464181A1 (de) | Elektrische Gasentladungslampe | |
| DE2408572A1 (de) | Hochdruckquecksilberdampfentladungslampe | |
| EP0338637A2 (de) | Hochdruck-Quecksilberdampfentladungslampe | |
| DE1940539B2 (de) | Quecksilberdampf-Hochdruckentladungslampe mit Zusatz von Halogeniden der Seltenen Erden | |
| DE69703079T2 (de) | Hochdruck Quecksilber-Ultravioletlampe | |
| DE69015700T2 (de) | Metallhalogenidlampe. | |
| DE1764979A1 (de) | Quecksilber-Metallhalogenid-Dampflampe mit Regeneration | |
| DE2225308C3 (de) | Hochdruckgasentladungslampe | |
| DE1911985C3 (de) | Hochdruck-Bogenentladungslampe | |
| DE2031449C3 (de) | Hochdruck-Metalldampf lampe mit einer in ausgewählten Spektralbereichen konzentrierten Strahlung | |
| DE2422411A1 (de) | Hochdruckquecksilberdampfentladungslampe | |
| DE2028781A1 (de) | Hochdruck-Quecksilberdampf Jodid-Entladungslampe | |
| DE1489527B2 (de) | Quecksilberdampfhochdrucklampe | |
| DE69201339T2 (de) | Metalldampfentladungslampe. | |
| DE2456757C2 (de) | Metallhalogenid-Hochdruckgasentladungslampe | |
| DE2402760C3 (de) | Hochdruck-Entladungslampe | |
| DE7016628U (de) | Wandstabilisierte hochdruck-quecksilberdampf-entladungslampe mit jodid. | |
| DE69625143T2 (de) | Metallhalogenidlampe | |
| DE2114804B2 (de) | Quecksilberdampf-Hochdruckentladungslampe mit Zusatz von Halogeniden der Seltenen Erden | |
| DE3731134C2 (de) | Hochdruck-Metallhalogenidentladungslampe mit niedriger Farbtemperatur und guter Farbwiedergabe | |
| DE2605290C2 (de) | Hochdruck-Entladungslampe | |
| DE1938955B2 (de) | Elektrische Gluehlampe | |
| DE2430695B2 (de) | Halogenglühlampe mit differenter Leistungsgabe |